public inbox for [email protected]help / color / mirror / Atom feed
[PATCH v2 12/12] Move away from argv string comparison 25+ messages / 4 participants [nested] [flat]
* [PATCH v2 12/12] Move away from argv string comparison @ 2020-03-17 18:43 Mike Palmiotto <[email protected]> 0 siblings, 0 replies; 25+ messages in thread From: Mike Palmiotto @ 2020-03-17 18:43 UTC (permalink / raw) --- src/backend/postmaster/postmaster.c | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) diff --git a/src/backend/postmaster/postmaster.c b/src/backend/postmaster/postmaster.c index 65305a18ee..b31fcc7d12 100644 --- a/src/backend/postmaster/postmaster.c +++ b/src/backend/postmaster/postmaster.c @@ -4883,7 +4883,7 @@ SubPostmasterMain(int argc, char *argv[]) ConnProcPort = &port; /* Close the postmaster's sockets (as soon as we know them) */ - ClosePostmasterPorts(strcmp(argv[1], "--forklog") == 0); + ClosePostmasterPorts(MySubprocessType == SysLoggerType); /* * Set reference point for stack-depth checking @@ -4928,9 +4928,9 @@ SubPostmasterMain(int argc, char *argv[]) PGSharedMemoryNoReAttach(); /* autovacuum needs this set before calling InitProcess */ - if (strcmp(argv[1], "--forkavlauncher") == 0) + if (MySubprocessType == AutoVacuumLauncherType) AutovacuumLauncherIAm(); - if (strcmp(argv[1], "--forkavworker") == 0) + if (MySubprocessType == AutoVacuumWorkerType) AutovacuumWorkerIAm(); /* -- 2.17.0 --FcSpk3Icpd/Pbul4-- ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-07-04 22:08 Tomas Vondra <[email protected]> 0 siblings, 2 replies; 25+ messages in thread From: Tomas Vondra @ 2023-07-04 22:08 UTC (permalink / raw) To: Matthias van de Meent <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On 7/4/23 23:53, Matthias van de Meent wrote: > On Thu, 8 Jun 2023 at 14:55, Tomas Vondra <[email protected]> wrote: >> >> Hi, >> >> Here's a WIP patch allowing parallel CREATE INDEX for BRIN indexes. The >> infrastructure (starting workers etc.) is "inspired" by the BTREE code >> (i.e. copied from that and massaged a bit to call brin stuff). > > Nice work. > >> In both cases _brin_end_parallel then reads the summaries from worker >> files, and adds them into the index. In 0001 this is fairly simple, >> although we could do one more improvement and sort the ranges by range >> start to make the index nicer (and possibly a bit more efficient). This >> should be simple, because the per-worker results are already sorted like >> that (so a merge sort in _brin_end_parallel would be enough). > > I see that you manually built the passing and sorting of tuples > between workers, but can't we use the parallel tuplesort > infrastructure for that? It already has similar features in place and > improves code commonality. > Maybe. I wasn't that familiar with what parallel tuplesort can and can't do, and the little I knew I managed to forget since I wrote this patch. Which similar features do you have in mind? The workers are producing the results in "start_block" order, so if they pass that to the leader, it probably can do the usual merge sort. >> For 0002 it's a bit more complicated, because with a single parallel >> scan brinbuildCallbackParallel can't decide if a range is assigned to a >> different worker or empty. And we want to generate summaries for empty >> ranges in the index. We could either skip such range during index build, >> and then add empty summaries in _brin_end_parallel (if needed), or add >> them and then merge them using "union". >> >> >> I just realized there's a third option to do this - we could just do >> regular parallel scan (with no particular regard to pagesPerRange), and >> then do "union" when merging results from workers. It doesn't require >> the sequence of TID scans, and the union would also handle the empty >> ranges. The per-worker results might be much larger, though, because >> each worker might produce up to the "full" BRIN index. > > Would it be too much effort to add a 'min_chunk_size' argument to > table_beginscan_parallel (or ParallelTableScanDesc) that defines the > minimum granularity of block ranges to be assigned to each process? I > think that would be the most elegant solution that would require > relatively little effort: table_block_parallelscan_nextpage already > does parallel management of multiple chunk sizes, and I think this > modification would fit quite well in that code. > I'm confused. Isn't that pretty much exactly what 0002 does? I mean, that passes pagesPerRange to table_parallelscan_initialize(), so that each pagesPerRange is assigned to a single worker. The trouble I described above is that the scan returns tuples, and the consumer has no idea what was the chunk size or how many other workers are there. Imagine you get a tuple from block 1, and then a tuple from block 1000. Does that mean that the blocks in between are empty or that they were processed by some other worker? regards -- Tomas Vondra EnterpriseDB: http://www.enterprisedb.com The Enterprise PostgreSQL Company ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-07-05 08:44 Matthias van de Meent <[email protected]> parent: Tomas Vondra <[email protected]> 1 sibling, 1 reply; 25+ messages in thread From: Matthias van de Meent @ 2023-07-05 08:44 UTC (permalink / raw) To: Tomas Vondra <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On Wed, 5 Jul 2023 at 00:08, Tomas Vondra <[email protected]> wrote: > > > > On 7/4/23 23:53, Matthias van de Meent wrote: > > On Thu, 8 Jun 2023 at 14:55, Tomas Vondra <[email protected]> wrote: > >> > >> Hi, > >> > >> Here's a WIP patch allowing parallel CREATE INDEX for BRIN indexes. The > >> infrastructure (starting workers etc.) is "inspired" by the BTREE code > >> (i.e. copied from that and massaged a bit to call brin stuff). > > > > Nice work. > > > >> In both cases _brin_end_parallel then reads the summaries from worker > >> files, and adds them into the index. In 0001 this is fairly simple, > >> although we could do one more improvement and sort the ranges by range > >> start to make the index nicer (and possibly a bit more efficient). This > >> should be simple, because the per-worker results are already sorted like > >> that (so a merge sort in _brin_end_parallel would be enough). > > > > I see that you manually built the passing and sorting of tuples > > between workers, but can't we use the parallel tuplesort > > infrastructure for that? It already has similar features in place and > > improves code commonality. > > > > Maybe. I wasn't that familiar with what parallel tuplesort can and can't > do, and the little I knew I managed to forget since I wrote this patch. > Which similar features do you have in mind? > > The workers are producing the results in "start_block" order, so if they > pass that to the leader, it probably can do the usual merge sort. > > >> For 0002 it's a bit more complicated, because with a single parallel > >> scan brinbuildCallbackParallel can't decide if a range is assigned to a > >> different worker or empty. And we want to generate summaries for empty > >> ranges in the index. We could either skip such range during index build, > >> and then add empty summaries in _brin_end_parallel (if needed), or add > >> them and then merge them using "union". > >> > >> > >> I just realized there's a third option to do this - we could just do > >> regular parallel scan (with no particular regard to pagesPerRange), and > >> then do "union" when merging results from workers. It doesn't require > >> the sequence of TID scans, and the union would also handle the empty > >> ranges. The per-worker results might be much larger, though, because > >> each worker might produce up to the "full" BRIN index. > > > > Would it be too much effort to add a 'min_chunk_size' argument to > > table_beginscan_parallel (or ParallelTableScanDesc) that defines the > > minimum granularity of block ranges to be assigned to each process? I > > think that would be the most elegant solution that would require > > relatively little effort: table_block_parallelscan_nextpage already > > does parallel management of multiple chunk sizes, and I think this > > modification would fit quite well in that code. > > > > I'm confused. Isn't that pretty much exactly what 0002 does? I mean, > that passes pagesPerRange to table_parallelscan_initialize(), so that > each pagesPerRange is assigned to a single worker. Huh, I overlooked that one... Sorry for that. > The trouble I described above is that the scan returns tuples, and the > consumer has no idea what was the chunk size or how many other workers > are there. Imagine you get a tuple from block 1, and then a tuple from > block 1000. Does that mean that the blocks in between are empty or that > they were processed by some other worker? If the unit of work for parallel table scans is the index's pages_per_range, then I think we can just fill in expected-but-missing ranges as 'empty' in the parallel leader during index loading, like the first of the two solutions you proposed. Kind regards, Matthias van de Meent Neon (https://neon.tech/) ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-07-05 11:11 Tomas Vondra <[email protected]> parent: Matthias van de Meent <[email protected]> 0 siblings, 0 replies; 25+ messages in thread From: Tomas Vondra @ 2023-07-05 11:11 UTC (permalink / raw) To: Matthias van de Meent <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On 7/5/23 10:44, Matthias van de Meent wrote: > On Wed, 5 Jul 2023 at 00:08, Tomas Vondra <[email protected]> wrote: >> >> >> >> On 7/4/23 23:53, Matthias van de Meent wrote: >>> On Thu, 8 Jun 2023 at 14:55, Tomas Vondra <[email protected]> wrote: >>>> >>>> Hi, >>>> >>>> Here's a WIP patch allowing parallel CREATE INDEX for BRIN indexes. The >>>> infrastructure (starting workers etc.) is "inspired" by the BTREE code >>>> (i.e. copied from that and massaged a bit to call brin stuff). >>> >>> Nice work. >>> >>>> In both cases _brin_end_parallel then reads the summaries from worker >>>> files, and adds them into the index. In 0001 this is fairly simple, >>>> although we could do one more improvement and sort the ranges by range >>>> start to make the index nicer (and possibly a bit more efficient). This >>>> should be simple, because the per-worker results are already sorted like >>>> that (so a merge sort in _brin_end_parallel would be enough). >>> >>> I see that you manually built the passing and sorting of tuples >>> between workers, but can't we use the parallel tuplesort >>> infrastructure for that? It already has similar features in place and >>> improves code commonality. >>> >> >> Maybe. I wasn't that familiar with what parallel tuplesort can and can't >> do, and the little I knew I managed to forget since I wrote this patch. >> Which similar features do you have in mind? >> >> The workers are producing the results in "start_block" order, so if they >> pass that to the leader, it probably can do the usual merge sort. >> >>>> For 0002 it's a bit more complicated, because with a single parallel >>>> scan brinbuildCallbackParallel can't decide if a range is assigned to a >>>> different worker or empty. And we want to generate summaries for empty >>>> ranges in the index. We could either skip such range during index build, >>>> and then add empty summaries in _brin_end_parallel (if needed), or add >>>> them and then merge them using "union". >>>> >>>> >>>> I just realized there's a third option to do this - we could just do >>>> regular parallel scan (with no particular regard to pagesPerRange), and >>>> then do "union" when merging results from workers. It doesn't require >>>> the sequence of TID scans, and the union would also handle the empty >>>> ranges. The per-worker results might be much larger, though, because >>>> each worker might produce up to the "full" BRIN index. >>> >>> Would it be too much effort to add a 'min_chunk_size' argument to >>> table_beginscan_parallel (or ParallelTableScanDesc) that defines the >>> minimum granularity of block ranges to be assigned to each process? I >>> think that would be the most elegant solution that would require >>> relatively little effort: table_block_parallelscan_nextpage already >>> does parallel management of multiple chunk sizes, and I think this >>> modification would fit quite well in that code. >>> >> >> I'm confused. Isn't that pretty much exactly what 0002 does? I mean, >> that passes pagesPerRange to table_parallelscan_initialize(), so that >> each pagesPerRange is assigned to a single worker. > > Huh, I overlooked that one... Sorry for that. > >> The trouble I described above is that the scan returns tuples, and the >> consumer has no idea what was the chunk size or how many other workers >> are there. Imagine you get a tuple from block 1, and then a tuple from >> block 1000. Does that mean that the blocks in between are empty or that >> they were processed by some other worker? > > If the unit of work for parallel table scans is the index's > pages_per_range, then I think we can just fill in expected-but-missing > ranges as 'empty' in the parallel leader during index loading, like > the first of the two solutions you proposed. > Right, I think that's the right solution. Or rather the only solution, because the other idea (generating the empty ranges in workers) relies on the workers knowing when to generate that. But I don't think the workers have the necessary information. regards -- Tomas Vondra EnterpriseDB: http://www.enterprisedb.com The Enterprise PostgreSQL Company ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-07-05 14:33 Matthias van de Meent <[email protected]> parent: Tomas Vondra <[email protected]> 1 sibling, 1 reply; 25+ messages in thread From: Matthias van de Meent @ 2023-07-05 14:33 UTC (permalink / raw) To: Tomas Vondra <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On Wed, 5 Jul 2023 at 00:08, Tomas Vondra <[email protected]> wrote: > > > > On 7/4/23 23:53, Matthias van de Meent wrote: > > On Thu, 8 Jun 2023 at 14:55, Tomas Vondra <[email protected]> wrote: > >> > >> Hi, > >> > >> Here's a WIP patch allowing parallel CREATE INDEX for BRIN indexes. The > >> infrastructure (starting workers etc.) is "inspired" by the BTREE code > >> (i.e. copied from that and massaged a bit to call brin stuff). > > > > Nice work. > > > >> In both cases _brin_end_parallel then reads the summaries from worker > >> files, and adds them into the index. In 0001 this is fairly simple, > >> although we could do one more improvement and sort the ranges by range > >> start to make the index nicer (and possibly a bit more efficient). This > >> should be simple, because the per-worker results are already sorted like > >> that (so a merge sort in _brin_end_parallel would be enough). > > > > I see that you manually built the passing and sorting of tuples > > between workers, but can't we use the parallel tuplesort > > infrastructure for that? It already has similar features in place and > > improves code commonality. > > > > Maybe. I wasn't that familiar with what parallel tuplesort can and can't > do, and the little I knew I managed to forget since I wrote this patch. > Which similar features do you have in mind? I was referring to the feature that is "emitting a single sorted run of tuples at the leader backend based on data gathered in parallel worker backends". It manages the sort state, on-disk runs etc. so that you don't have to manage that yourself. Adding a new storage format for what is effectively a logical tape (logtape.{c,h}) and manually merging it seems like a lot of changes if that functionality is readily available, standardized and optimized in sortsupport; and adds an additional place to manually go through for disk-related changes like TDE. Kind regards, Matthias van de Meent Neon (https://neon.tech/) ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-07-06 14:13 Tomas Vondra <[email protected]> parent: Matthias van de Meent <[email protected]> 0 siblings, 1 reply; 25+ messages in thread From: Tomas Vondra @ 2023-07-06 14:13 UTC (permalink / raw) To: Matthias van de Meent <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On 7/5/23 16:33, Matthias van de Meent wrote: > ... > >> Maybe. I wasn't that familiar with what parallel tuplesort can and can't >> do, and the little I knew I managed to forget since I wrote this patch. >> Which similar features do you have in mind? > > I was referring to the feature that is "emitting a single sorted run > of tuples at the leader backend based on data gathered in parallel > worker backends". It manages the sort state, on-disk runs etc. so that > you don't have to manage that yourself. > > Adding a new storage format for what is effectively a logical tape > (logtape.{c,h}) and manually merging it seems like a lot of changes if > that functionality is readily available, standardized and optimized in > sortsupport; and adds an additional place to manually go through for > disk-related changes like TDE. > Here's a new version of the patch, with three main changes: 1) Adoption of the parallel scan approach, instead of the homegrown solution with a sequence of TID scans. This is mostly what the 0002 patch did, except for fixing a bug - parallel scan has a "rampdown" close to the end, and this needs to consider the chunk size too. 2) Switches to the parallel tuplesort, as proposed. This turned out to be easier than I expected - most of the work was in adding methods to tuplesortvariants.c to allow reading/writing BrinTuple items. The main limitation is that we need to pass around the length of the tuple (AFAICS it's not in the BrinTuple itself). I'm not entirely sure about the memory management aspect of this, and maybe there's a more elegant solution. Overall it seems to work - the brin.c code is heavily based on how nbtsearch.c does parallel builds for btree, so hopefully it's fine. At some point I got a bit confused about which spool to create/use, but it seems to work. 3) Handling of empty ranges - I ended up ignoring empty ranges in workers (i.e. those are not written to the tuplesort), and instead the leader fills them in when reading data from the shared tuplesort. One thing I was wondering about is whether it might be better to allow the workers to process overlapping ranges, and then let the leader to merge the summaries. That would mean we might not need the tableam.c changes at all, but the leader would need to do more work (although the BRIN indexes tend to be fairly small). The main reason that got me thinking about this is that we have pretty much no tests for the union procedures, because triggering that is really difficult. But for parallel index builds that'd be much more common. regards -- Tomas Vondra EnterpriseDB: http://www.enterprisedb.com The Enterprise PostgreSQL Company Attachments: [text/x-patch] 0001-parallel-CREATE-INDEX-for-BRIN-20230706.patch (49.7K, ../../[email protected]/2-0001-parallel-CREATE-INDEX-for-BRIN-20230706.patch) download | inline diff: From 6485c26d0546ec35d81bad33f3893ec5ee421f87 Mon Sep 17 00:00:00 2001 From: Tomas Vondra <[email protected]> Date: Sun, 26 Mar 2023 00:44:01 +0100 Subject: [PATCH] parallel CREATE INDEX for BRIN --- src/backend/access/brin/brin.c | 781 ++++++++++++++++++++- src/backend/access/nbtree/nbtsort.c | 2 +- src/backend/access/table/tableam.c | 49 +- src/backend/access/transam/parallel.c | 4 + src/backend/catalog/index.c | 3 +- src/backend/executor/nodeSeqscan.c | 3 +- src/backend/utils/sort/tuplesort.c | 3 + src/backend/utils/sort/tuplesortvariants.c | 211 ++++++ src/include/access/brin.h | 3 + src/include/access/relscan.h | 1 + src/include/access/tableam.h | 9 +- src/include/utils/tuplesort.h | 11 + 12 files changed, 1065 insertions(+), 15 deletions(-) diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index 3c6a956eaa..9e72c54572 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -33,6 +33,7 @@ #include "postmaster/autovacuum.h" #include "storage/bufmgr.h" #include "storage/freespace.h" +#include "tcop/tcopprot.h" /* pgrminclude ignore */ #include "utils/acl.h" #include "utils/builtins.h" #include "utils/datum.h" @@ -40,7 +41,118 @@ #include "utils/index_selfuncs.h" #include "utils/memutils.h" #include "utils/rel.h" +#include "utils/tuplesort.h" +/* Magic numbers for parallel state sharing */ +#define PARALLEL_KEY_BRIN_SHARED UINT64CONST(0xA000000000000001) +#define PARALLEL_KEY_TUPLESORT UINT64CONST(0xA000000000000002) +#define PARALLEL_KEY_QUERY_TEXT UINT64CONST(0xA000000000000003) +#define PARALLEL_KEY_WAL_USAGE UINT64CONST(0xA000000000000004) +#define PARALLEL_KEY_BUFFER_USAGE UINT64CONST(0xA000000000000005) + +/* + * Status record for spooling/sorting phase. + */ +typedef struct BrinSpool +{ + Tuplesortstate *sortstate; /* state data for tuplesort.c */ + Relation heap; + Relation index; +} BrinSpool; + +/* + * Status for index builds performed in parallel. This is allocated in a + * dynamic shared memory segment. + */ +typedef struct BrinShared +{ + /* + * These fields are not modified during the build. They primarily exist for + * the benefit of worker processes that need to create state corresponding + * to that used by the leader. + */ + Oid heaprelid; + Oid indexrelid; + bool isconcurrent; + BlockNumber pagesPerRange; + int scantuplesortstates; + + /* + * workersdonecv is used to monitor the progress of workers. All parallel + * participants must indicate that they are done before leader can use + * results built by the workers (and before leader can write the data into + * the index). + */ + ConditionVariable workersdonecv; + + /* + * mutex protects all fields before heapdesc. + * + * These fields contain status information of interest to BRIN index + * builds that must work just the same when an index is built in parallel. + */ + slock_t mutex; + + /* + * Mutable state that is maintained by workers, and reported back to + * leader at end of the scans. + * + * nparticipantsdone is number of worker processes finished. + * + * reltuples is the total number of input heap tuples. + * + * indtuples is the total number of tuples that made it into the index. + */ + int nparticipantsdone; + double reltuples; + double indtuples; + + /* + * ParallelTableScanDescData data follows. Can't directly embed here, as + * implementations of the parallel table scan desc interface might need + * stronger alignment. + */ +} BrinShared; + +/* + * Return pointer to a BrinShared's parallel table scan. + * + * c.f. shm_toc_allocate as to why BUFFERALIGN is used, rather than just + * MAXALIGN. + */ +#define ParallelTableScanFromBrinShared(shared) \ + (ParallelTableScanDesc) ((char *) (shared) + BUFFERALIGN(sizeof(BrinShared))) + +/* + * Status for leader in parallel index build. + */ +typedef struct BrinLeader +{ + /* parallel context itself */ + ParallelContext *pcxt; + + /* + * nparticipanttuplesorts is the exact number of worker processes + * successfully launched, plus one leader process if it participates as a + * worker (only DISABLE_LEADER_PARTICIPATION builds avoid leader + * participating as a worker). + */ + int nparticipanttuplesorts; + + /* + * Leader process convenience pointers to shared state (leader avoids TOC + * lookups). + * + * brinshared is the shared state for entire build. sharedsort is the + * shared, tuplesort-managed state passed to each process tuplesort. + * snapshot is the snapshot used by the scan iff an MVCC snapshot is required. + */ + BrinShared *brinshared; + Sharedsort *sharedsort; + Snapshot snapshot; + WalUsage *walusage; + BufferUsage *bufferusage; +} BrinLeader; /* * We use a BrinBuildState during initial construction of a BRIN index. @@ -50,12 +162,23 @@ typedef struct BrinBuildState { Relation bs_irel; int bs_numtuples; + int bs_reltuples; Buffer bs_currentInsertBuf; BlockNumber bs_pagesPerRange; BlockNumber bs_currRangeStart; BrinRevmap *bs_rmAccess; BrinDesc *bs_bdesc; BrinMemTuple *bs_dtuple; + + /* + * bs_leader is only present when a parallel index build is performed, and + * only in the leader process. (Actually, only the leader has a + * BrinBuildState.) + */ + BrinLeader *bs_leader; + int bs_worker_id; + BrinSpool *bs_spool; + BrinSpool *bs_spool_out; } BrinBuildState; /* @@ -76,6 +199,7 @@ static void terminate_brin_buildstate(BrinBuildState *state); static void brinsummarize(Relation index, Relation heapRel, BlockNumber pageRange, bool include_partial, double *numSummarized, double *numExisting); static void form_and_insert_tuple(BrinBuildState *state); +static void form_and_spill_tuple(BrinBuildState *state); static void union_tuples(BrinDesc *bdesc, BrinMemTuple *a, BrinTuple *b); static void brin_vacuum_scan(Relation idxrel, BufferAccessStrategy strategy); @@ -83,6 +207,20 @@ static bool add_values_to_range(Relation idxRel, BrinDesc *bdesc, BrinMemTuple *dtup, Datum *values, bool *nulls); static bool check_null_keys(BrinValues *bval, ScanKey *nullkeys, int nnullkeys); +/* parallel index builds */ +static void _brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, + bool isconcurrent, int request); +static void _brin_end_parallel(BrinLeader *btleader, BrinBuildState *state); +static Size _brin_parallel_estimate_shared(Relation heap, Snapshot snapshot); +static void _brin_leader_participate_as_worker(BrinBuildState *buildstate, + Relation heap, Relation index); +static void _brin_parallel_scan_and_build(BrinBuildState *buildstate, + BrinSpool *brinspool, + BrinShared *brinshared, + Sharedsort *sharedsort, + Relation heap, Relation index, + int sortmem, bool progress); + /* * BRIN handler function: return IndexAmRoutine with access method parameters * and callbacks. @@ -822,6 +960,67 @@ brinbuildCallback(Relation index, values, isnull); } +/* + * A version of the callback, used by parallel index builds. The main difference + * is that instead of writing the BRIN tuples into the index, we write them into + * a shared tuplestore file, and leave the insertion up to the leader (which may + * reorder them a bit etc.). The callback also does not generate empty ranges, + * those may be added by the leader when merging results from workers. + */ +static void +brinbuildCallbackParallel(Relation index, + ItemPointer tid, + Datum *values, + bool *isnull, + bool tupleIsAlive, + void *brstate) +{ + BrinBuildState *state = (BrinBuildState *) brstate; + BlockNumber thisblock; + + thisblock = ItemPointerGetBlockNumber(tid); + + /* + * If we're in a block that belongs to a future range, summarize what + * we've got and start afresh. Note the scan might have skipped many + * pages, if they were devoid of live tuples; make sure to insert index + * tuples for those too. + */ + while (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) + { + + BRIN_elog((DEBUG2, + "brinbuildCallback: completed a range: %u--%u", + state->bs_currRangeStart, + state->bs_currRangeStart + state->bs_pagesPerRange)); + + /* create the index tuple and write it into the tuplesort */ + form_and_spill_tuple(state); + + /* + * set state to correspond to the next range + * + * XXX This has the issue that it skips ranges summarized by other + * workers, but it also skips empty ranges that should have been + * summarized. We'd need to either make the workers aware which + * chunk they are actually processing (which is currently known + * only in the ParallelBlockTableScan bit). Or we could ignore it + * here, and then decide it while "merging" results from workers + * (if there's no entry for the range, it had to be empty so we + * just add an empty one). + */ + while (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) + state->bs_currRangeStart += state->bs_pagesPerRange; + + /* re-initialize state for it */ + brin_memtuple_initialize(state->bs_dtuple, state->bs_bdesc); + } + + /* Accumulate the current tuple into the running state */ + (void) add_values_to_range(index, state->bs_bdesc, state->bs_dtuple, + values, isnull); +} + /* * brinbuild() -- build a new BRIN index. */ @@ -883,18 +1082,93 @@ brinbuild(Relation heap, Relation index, IndexInfo *indexInfo) revmap = brinRevmapInitialize(index, &pagesPerRange, NULL); state = initialize_brin_buildstate(index, revmap, pagesPerRange); + state->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + state->bs_spool->heap = heap; + state->bs_spool->index = index; + + /* + * Attempt to launch parallel worker scan when required + * + * XXX plan_create_index_workers makes the number of workers dependent on + * maintenance_work_mem, requiring 32MB for each worker. That makes sense + * for btree, but not for BRIN, which can do away with much less memory. + * So maybe make that somehow less strict, optionally? + */ + if (indexInfo->ii_ParallelWorkers > 0) + _brin_begin_parallel(state, heap, index, indexInfo->ii_Concurrent, + indexInfo->ii_ParallelWorkers); + /* * Now scan the relation. No syncscan allowed here because we want the * heap blocks in physical order. */ - reltuples = table_index_build_scan(heap, index, indexInfo, false, true, - brinbuildCallback, (void *) state, NULL); - /* process the final batch */ - form_and_insert_tuple(state); + /* + * If parallel build requested and at least one worker process was + * successfully launched, set up coordination state + */ + if (state->bs_leader) + { + SortCoordinate coordinate; + + coordinate = (SortCoordinate) palloc0(sizeof(SortCoordinateData)); + coordinate->isWorker = false; + coordinate->nParticipants = + state->bs_leader->nparticipanttuplesorts; + coordinate->sharedsort = state->bs_leader->sharedsort; + + + /* + * Begin serial/leader tuplesort. + * + * In cases where parallelism is involved, the leader receives the same + * share of maintenance_work_mem as a serial sort (it is generally treated + * in the same way as a serial sort once we return). Parallel worker + * Tuplesortstates will have received only a fraction of + * maintenance_work_mem, though. + * + * We rely on the lifetime of the Leader Tuplesortstate almost not + * overlapping with any worker Tuplesortstate's lifetime. There may be + * some small overlap, but that's okay because we rely on leader + * Tuplesortstate only allocating a small, fixed amount of memory here. + * When its tuplesort_performsort() is called (by our caller), and + * significant amounts of memory are likely to be used, all workers must + * have already freed almost all memory held by their Tuplesortstates + * (they are about to go away completely, too). The overall effect is + * that maintenance_work_mem always represents an absolute high watermark + * on the amount of memory used by a CREATE INDEX operation, regardless of + * the use of parallelism or any other factor. + */ + state->bs_spool_out = (BrinSpool *) palloc0(sizeof(BrinSpool)); + state->bs_spool_out->heap = heap; + state->bs_spool_out->index = index; + + state->bs_spool_out->sortstate = + tuplesort_begin_index_brin(heap, index, + maintenance_work_mem, coordinate, + TUPLESORT_NONE); + + /* + * In parallel mode, wait for workers to complete, and then read all + * tuples from the shared tuplesort and insert them into the index. + */ + _brin_end_parallel(state->bs_leader, state); + } + else /* no parallel index build, just do the usual thing */ + { + reltuples = table_index_build_scan(heap, index, indexInfo, false, true, + brinbuildCallback, (void *) state, NULL); + + /* process the final batch */ + form_and_insert_tuple(state); + + /* track the number of relation tuples */ + state->bs_reltuples = reltuples; + } /* release resources */ idxtuples = state->bs_numtuples; + reltuples = state->bs_reltuples; brinRevmapTerminate(state->bs_rmAccess); terminate_brin_buildstate(state); @@ -1299,12 +1573,16 @@ initialize_brin_buildstate(Relation idxRel, BrinRevmap *revmap, state->bs_irel = idxRel; state->bs_numtuples = 0; + state->bs_reltuples = 0; state->bs_currentInsertBuf = InvalidBuffer; state->bs_pagesPerRange = pagesPerRange; state->bs_currRangeStart = 0; state->bs_rmAccess = revmap; state->bs_bdesc = brin_build_desc(idxRel); state->bs_dtuple = brin_new_memtuple(state->bs_bdesc); + state->bs_leader = NULL; + state->bs_worker_id = 0; + state->bs_spool = NULL; return state; } @@ -1597,6 +1875,32 @@ form_and_insert_tuple(BrinBuildState *state) pfree(tup); } +/* + * Given a deformed tuple in the build state, convert it into the on-disk + * format and write it to a (shared) tuplestore (the leader will insert it + * into the index later). + */ +static void +form_and_spill_tuple(BrinBuildState *state) +{ + BrinTuple *tup; + Size size; + + /* don't insert empty tuples in parallel build */ + if (state->bs_dtuple->bt_empty_range) + return; + + tup = brin_form_tuple(state->bs_bdesc, state->bs_currRangeStart, + state->bs_dtuple, &size); + + /* write the BRIN tuple to the tuplesort */ + tuplesort_putbrintuple(state->bs_spool->sortstate, tup, size); + + state->bs_numtuples++; + + pfree(tup); +} + /* * Given two deformed tuples, adjust the first one so that it's consistent * with the summary values in both. @@ -1916,3 +2220,472 @@ check_null_keys(BrinValues *bval, ScanKey *nullkeys, int nnullkeys) return true; } + +static void +_brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, + bool isconcurrent, int request) +{ + ParallelContext *pcxt; + int scantuplesortstates; + Snapshot snapshot; + Size estbrinshared; + Size estsort; + BrinShared *brinshared; + Sharedsort *sharedsort; + BrinLeader *brinleader = (BrinLeader *) palloc0(sizeof(BrinLeader)); + WalUsage *walusage; + BufferUsage *bufferusage; + bool leaderparticipates = true; + int querylen; + +#ifdef DISABLE_LEADER_PARTICIPATION + leaderparticipates = false; +#endif + + /* + * Enter parallel mode, and create context for parallel build of brin + * index + */ + EnterParallelMode(); + Assert(request > 0); + pcxt = CreateParallelContext("postgres", "_brin_parallel_build_main", + request); + + scantuplesortstates = leaderparticipates ? request + 1 : request; + + /* + * Prepare for scan of the base relation. In a normal index build, we use + * SnapshotAny because we must retrieve all tuples and do our own time + * qual checks (because we have to index RECENTLY_DEAD tuples). In a + * concurrent build, we take a regular MVCC snapshot and index whatever's + * live according to that. + */ + if (!isconcurrent) + snapshot = SnapshotAny; + else + snapshot = RegisterSnapshot(GetTransactionSnapshot()); + + /* + * Estimate size for our own PARALLEL_KEY_BRIN_SHARED workspace. + */ + estbrinshared = _brin_parallel_estimate_shared(heap, snapshot); + shm_toc_estimate_chunk(&pcxt->estimator, estbrinshared); + estsort = tuplesort_estimate_shared(scantuplesortstates); + shm_toc_estimate_chunk(&pcxt->estimator, estsort); + + shm_toc_estimate_keys(&pcxt->estimator, 2); + + /* + * Estimate space for WalUsage and BufferUsage -- PARALLEL_KEY_WAL_USAGE + * and PARALLEL_KEY_BUFFER_USAGE. + * + * If there are no extensions loaded that care, we could skip this. We + * have no way of knowing whether anyone's looking at pgWalUsage or + * pgBufferUsage, so do it unconditionally. + */ + shm_toc_estimate_chunk(&pcxt->estimator, + mul_size(sizeof(WalUsage), pcxt->nworkers)); + shm_toc_estimate_keys(&pcxt->estimator, 1); + shm_toc_estimate_chunk(&pcxt->estimator, + mul_size(sizeof(BufferUsage), pcxt->nworkers)); + shm_toc_estimate_keys(&pcxt->estimator, 1); + + /* Finally, estimate PARALLEL_KEY_QUERY_TEXT space */ + if (debug_query_string) + { + querylen = strlen(debug_query_string); + shm_toc_estimate_chunk(&pcxt->estimator, querylen + 1); + shm_toc_estimate_keys(&pcxt->estimator, 1); + } + else + querylen = 0; /* keep compiler quiet */ + + /* Everyone's had a chance to ask for space, so now create the DSM */ + InitializeParallelDSM(pcxt); + + /* If no DSM segment was available, back out (do serial build) */ + if (pcxt->seg == NULL) + { + if (IsMVCCSnapshot(snapshot)) + UnregisterSnapshot(snapshot); + DestroyParallelContext(pcxt); + ExitParallelMode(); + return; + } + + /* Store shared build state, for which we reserved space */ + brinshared = (BrinShared *) shm_toc_allocate(pcxt->toc, estbrinshared); + /* Initialize immutable state */ + brinshared->heaprelid = RelationGetRelid(heap); + brinshared->indexrelid = RelationGetRelid(index); + brinshared->isconcurrent = isconcurrent; + brinshared->scantuplesortstates = scantuplesortstates; + brinshared->pagesPerRange = buildstate->bs_pagesPerRange; + ConditionVariableInit(&brinshared->workersdonecv); + SpinLockInit(&brinshared->mutex); + + /* Initialize mutable state */ + brinshared->nparticipantsdone = 0; + brinshared->reltuples = 0.0; + brinshared->indtuples = 0.0; + + table_parallelscan_initialize(heap, + ParallelTableScanFromBrinShared(brinshared), + snapshot, brinshared->pagesPerRange); + + /* + * Store shared tuplesort-private state, for which we reserved space. + * Then, initialize opaque state using tuplesort routine. + */ + sharedsort = (Sharedsort *) shm_toc_allocate(pcxt->toc, estsort); + tuplesort_initialize_shared(sharedsort, scantuplesortstates, + pcxt->seg); + + /* + * Store shared tuplesort-private state, for which we reserved space. + * Then, initialize opaque state using tuplesort routine. + */ + shm_toc_insert(pcxt->toc, PARALLEL_KEY_BRIN_SHARED, brinshared); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_TUPLESORT, sharedsort); + + /* Store query string for workers */ + if (debug_query_string) + { + char *sharedquery; + + sharedquery = (char *) shm_toc_allocate(pcxt->toc, querylen + 1); + memcpy(sharedquery, debug_query_string, querylen + 1); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_QUERY_TEXT, sharedquery); + } + + /* + * Allocate space for each worker's WalUsage and BufferUsage; no need to + * initialize. + */ + walusage = shm_toc_allocate(pcxt->toc, + mul_size(sizeof(WalUsage), pcxt->nworkers)); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_WAL_USAGE, walusage); + bufferusage = shm_toc_allocate(pcxt->toc, + mul_size(sizeof(BufferUsage), pcxt->nworkers)); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_BUFFER_USAGE, bufferusage); + + /* Launch workers, saving status for leader/caller */ + LaunchParallelWorkers(pcxt); + brinleader->pcxt = pcxt; + brinleader->nparticipanttuplesorts = pcxt->nworkers_launched; + if (leaderparticipates) + brinleader->nparticipanttuplesorts++; + brinleader->brinshared = brinshared; + brinleader->sharedsort = sharedsort; + brinleader->snapshot = snapshot; + brinleader->walusage = walusage; + brinleader->bufferusage = bufferusage; + + /* If no workers were successfully launched, back out (do serial build) */ + if (pcxt->nworkers_launched == 0) + { + _brin_end_parallel(brinleader, NULL); + return; + } + + /* Save leader state now that it's clear build will be parallel */ + buildstate->bs_leader = brinleader; + + /* Join heap scan ourselves */ + if (leaderparticipates) + _brin_leader_participate_as_worker(buildstate, heap, index); + + /* + * Caller needs to wait for all launched workers when we return. Make + * sure that the failure-to-start case will not hang forever. + */ + WaitForParallelWorkersToAttach(pcxt); +} + +/* + * Shut down workers, destroy parallel context, and end parallel mode. + */ +static void +_brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) +{ + int i; + BrinTuple *btup; + Size tuplen; + BrinShared *brinshared = brinleader->brinshared; + BlockNumber prevblkno = InvalidBlockNumber; + BrinTuple *emptyTuple = NULL; + Size emptySize; + + /* Shutdown worker processes */ + WaitForParallelWorkersToFinish(brinleader->pcxt); + + if (!state) + return; + + /* copy the data into leader state (we have to wait for the workers ) */ + state->bs_reltuples = brinshared->reltuples; + state->bs_numtuples = brinshared->indtuples; + + tuplesort_performsort(state->bs_spool_out->sortstate); + + /* + * Read the BRIN tuples from the shared tuplesort, sorted by block number. + * That probably gives us an index that is cheaper to scan, thanks to mostly + * getting data from the same index page as before. + * + * FIXME This probably needs some memory management fixes - we're reading + * tuples from the tuplesort, we're allocating an emty tuple, and so on. + * Probably better to release this memory. + * + * XXX We can't quite free the BrinTuple, though, because that's a field + * in BrinSortTuple. + */ + while ((btup = tuplesort_getbrintuple(state->bs_spool_out->sortstate, &tuplen, true)) != NULL) + { + /* + * We should not get two summaries for the same range. The workers + * are producing ranges for non-overlapping sections of the table. + */ + Assert(btup->bt_blkno != prevblkno); + + /* Ranges should be multiples of pages_per_range for the index. */ + Assert(btup->bt_blkno % brinshared->pagesPerRange == 0); + + /* Fill empty ranges for all ranges missing in the tuplesort. */ + prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; + while (prevblkno + state->bs_pagesPerRange < btup->bt_blkno) + { + /* the missing range */ + prevblkno += state->bs_pagesPerRange; + + /* Did we already build the empty range? If not, do it now. */ + if (emptyTuple == NULL) + { + BrinMemTuple *dtuple = brin_new_memtuple(state->bs_bdesc); + + emptyTuple = brin_form_tuple(state->bs_bdesc, prevblkno, dtuple, &emptySize); + } + else + { + /* we already have am "empty range" tuple, just set the block */ + emptyTuple->bt_blkno = prevblkno; + } + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, + emptyTuple->bt_blkno, emptyTuple, emptySize); + } + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, btup->bt_blkno, btup, tuplen); + + prevblkno = btup->bt_blkno; + } + + tuplesort_end(state->bs_spool_out->sortstate); + + /* + * Next, accumulate WAL usage. (This must wait for the workers to finish, + * or we might get incomplete data.) + */ + for (i = 0; i < brinleader->pcxt->nworkers_launched; i++) + InstrAccumParallelQuery(&brinleader->bufferusage[i], &brinleader->walusage[i]); + + /* Free last reference to MVCC snapshot, if one was used */ + if (IsMVCCSnapshot(brinleader->snapshot)) + UnregisterSnapshot(brinleader->snapshot); + DestroyParallelContext(brinleader->pcxt); + ExitParallelMode(); +} + +/* + * Returns size of shared memory required to store state for a parallel + * brin index build based on the snapshot its parallel scan will use. + */ +static Size +_brin_parallel_estimate_shared(Relation heap, Snapshot snapshot) +{ + /* c.f. shm_toc_allocate as to why BUFFERALIGN is used */ + return add_size(BUFFERALIGN(sizeof(BrinShared)), + table_parallelscan_estimate(heap, snapshot)); +} + +/* + * Within leader, participate as a parallel worker. + */ +static void +_brin_leader_participate_as_worker(BrinBuildState *buildstate, Relation heap, Relation index) +{ + BrinLeader *brinleader = buildstate->bs_leader; + int sortmem; + + /* Allocate memory and initialize private spool */ + buildstate->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + buildstate->bs_spool->heap = buildstate->bs_spool->heap; + buildstate->bs_spool->index = buildstate->bs_spool->index; + + /* + * Might as well use reliable figure when doling out maintenance_work_mem + * (when requested number of workers were not launched, this will be + * somewhat higher than it is for other workers). + */ + sortmem = maintenance_work_mem / brinleader->nparticipanttuplesorts; + + /* Perform work common to all participants */ + _brin_parallel_scan_and_build(buildstate, buildstate->bs_spool, brinleader->brinshared, + brinleader->sharedsort, heap, index, sortmem, true); +} + +/* + * Perform a worker's portion of a parallel sort. + * + * This generates a tuplesort for passed btspool, and a second tuplesort + * state if a second btspool is need (i.e. for unique index builds). All + * other spool fields should already be set when this is called. + * + * sortmem is the amount of working memory to use within each worker, + * expressed in KBs. + * + * When this returns, workers are done, and need only release resources. + */ +static void +_brin_parallel_scan_and_build(BrinBuildState *state, BrinSpool *brinspool, + BrinShared *brinshared, Sharedsort *sharedsort, + Relation heap, Relation index, int sortmem, + bool progress) +{ + SortCoordinate coordinate; + TableScanDesc scan; + double reltuples; + IndexInfo *indexInfo; + + /* Initialize local tuplesort coordination state */ + coordinate = palloc0(sizeof(SortCoordinateData)); + coordinate->isWorker = true; + coordinate->nParticipants = -1; + coordinate->sharedsort = sharedsort; + + /* Begin "partial" tuplesort */ + brinspool->sortstate = tuplesort_begin_index_brin(brinspool->heap, + brinspool->index, + sortmem, coordinate, + TUPLESORT_NONE); + + /* Join parallel scan */ + indexInfo = BuildIndexInfo(index); + indexInfo->ii_Concurrent = brinshared->isconcurrent; + + scan = table_beginscan_parallel(heap, + ParallelTableScanFromBrinShared(brinshared)); + + reltuples = table_index_build_scan(heap, index, indexInfo, true, true, + brinbuildCallbackParallel, state, scan); + + /* insert the last item */ + form_and_spill_tuple(state); + + /* sort the BRIN ranges built by this worker */ + tuplesort_performsort(brinspool->sortstate); + + state->bs_reltuples += reltuples; + + /* + * Done. Record ambuild statistics. + */ + SpinLockAcquire(&brinshared->mutex); + brinshared->nparticipantsdone++; + brinshared->reltuples += state->bs_reltuples; + brinshared->indtuples += state->bs_numtuples; + SpinLockRelease(&brinshared->mutex); + + /* Notify leader */ + ConditionVariableSignal(&brinshared->workersdonecv); + + tuplesort_end(brinspool->sortstate); +} + +/* + * Perform work within a launched parallel process. + */ +void +_brin_parallel_build_main(dsm_segment *seg, shm_toc *toc) +{ + char *sharedquery; + BrinShared *brinshared; + Sharedsort *sharedsort; + BrinBuildState *buildstate; + Relation heapRel; + Relation indexRel; + LOCKMODE heapLockmode; + LOCKMODE indexLockmode; + WalUsage *walusage; + BufferUsage *bufferusage; + int sortmem; + + /* + * The only possible status flag that can be set to the parallel worker is + * PROC_IN_SAFE_IC. + */ + Assert((MyProc->statusFlags == 0) || + (MyProc->statusFlags == PROC_IN_SAFE_IC)); + + /* Set debug_query_string for individual workers first */ + sharedquery = shm_toc_lookup(toc, PARALLEL_KEY_QUERY_TEXT, true); + debug_query_string = sharedquery; + + /* Report the query string from leader */ + pgstat_report_activity(STATE_RUNNING, debug_query_string); + + /* Look up brin shared state */ + brinshared = shm_toc_lookup(toc, PARALLEL_KEY_BRIN_SHARED, false); + + /* Open relations using lock modes known to be obtained by index.c */ + if (!brinshared->isconcurrent) + { + heapLockmode = ShareLock; + indexLockmode = AccessExclusiveLock; + } + else + { + heapLockmode = ShareUpdateExclusiveLock; + indexLockmode = RowExclusiveLock; + } + + /* Open relations within worker */ + heapRel = table_open(brinshared->heaprelid, heapLockmode); + indexRel = index_open(brinshared->indexrelid, indexLockmode); + + buildstate = initialize_brin_buildstate(indexRel, NULL, brinshared->pagesPerRange); + + /* Initialize worker's own spool */ + buildstate->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + buildstate->bs_spool->heap = heapRel; + buildstate->bs_spool->index = indexRel; + + /* Look up shared state private to tuplesort.c */ + sharedsort = shm_toc_lookup(toc, PARALLEL_KEY_TUPLESORT, false); + tuplesort_attach_shared(sharedsort, seg); + + /* Prepare to track buffer usage during parallel execution */ + InstrStartParallelQuery(); + + /* + * Might as well use reliable figure when doling out maintenance_work_mem + * (when requested number of workers were not launched, this will be + * somewhat higher than it is for other workers). + */ + sortmem = maintenance_work_mem / brinshared->scantuplesortstates; + + _brin_parallel_scan_and_build(buildstate, buildstate->bs_spool, + brinshared, sharedsort, + heapRel, indexRel, sortmem, false); + + /* Report WAL/buffer usage during parallel execution */ + bufferusage = shm_toc_lookup(toc, PARALLEL_KEY_BUFFER_USAGE, false); + walusage = shm_toc_lookup(toc, PARALLEL_KEY_WAL_USAGE, false); + InstrEndParallelQuery(&bufferusage[ParallelWorkerNumber], + &walusage[ParallelWorkerNumber]); + + index_close(indexRel, indexLockmode); + table_close(heapRel, heapLockmode); +} diff --git a/src/backend/access/nbtree/nbtsort.c b/src/backend/access/nbtree/nbtsort.c index c2665fce41..6241baeea8 100644 --- a/src/backend/access/nbtree/nbtsort.c +++ b/src/backend/access/nbtree/nbtsort.c @@ -1575,7 +1575,7 @@ _bt_begin_parallel(BTBuildState *buildstate, bool isconcurrent, int request) btshared->brokenhotchain = false; table_parallelscan_initialize(btspool->heap, ParallelTableScanFromBTShared(btshared), - snapshot); + snapshot, InvalidBlockNumber); /* * Store shared tuplesort-private state, for which we reserved space. diff --git a/src/backend/access/table/tableam.c b/src/backend/access/table/tableam.c index c6bdb7e1c6..4af0d433e9 100644 --- a/src/backend/access/table/tableam.c +++ b/src/backend/access/table/tableam.c @@ -153,9 +153,9 @@ table_parallelscan_estimate(Relation rel, Snapshot snapshot) void table_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan, - Snapshot snapshot) + Snapshot snapshot, BlockNumber chunk_factor) { - Size snapshot_off = rel->rd_tableam->parallelscan_initialize(rel, pscan); + Size snapshot_off = rel->rd_tableam->parallelscan_initialize(rel, pscan, chunk_factor); pscan->phs_snapshot_off = snapshot_off; @@ -395,16 +395,21 @@ table_block_parallelscan_estimate(Relation rel) } Size -table_block_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan) +table_block_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan, BlockNumber chunk_factor) { ParallelBlockTableScanDesc bpscan = (ParallelBlockTableScanDesc) pscan; bpscan->base.phs_relid = RelationGetRelid(rel); bpscan->phs_nblocks = RelationGetNumberOfBlocks(rel); - /* compare phs_syncscan initialization to similar logic in initscan */ + bpscan->phs_chunk_factor = chunk_factor; + /* compare phs_syncscan initialization to similar logic in initscan + * + * Disable sync scans if the chunk factor is set (valid block number). + */ bpscan->base.phs_syncscan = synchronize_seqscans && !RelationUsesLocalBuffers(rel) && - bpscan->phs_nblocks > NBuffers / 4; + (bpscan->phs_nblocks > NBuffers / 4) && + !BlockNumberIsValid(bpscan->phs_chunk_factor); SpinLockInit(&bpscan->phs_mutex); bpscan->phs_startblock = InvalidBlockNumber; pg_atomic_init_u64(&bpscan->phs_nallocated, 0); @@ -459,6 +464,25 @@ table_block_parallelscan_startblock_init(Relation rel, pbscanwork->phsw_chunk_size = Min(pbscanwork->phsw_chunk_size, PARALLEL_SEQSCAN_MAX_CHUNK_SIZE); + /* + * If the chunk size factor is set, we need to make sure the chunk size is + * a multiple of that value. We round the chunk size to the nearest chunk + * factor multiple, at least one chunk_factor. + * + * XXX Note this may override PARALLEL_SEQSCAN_MAX_CHUNK_SIZE, in case the + * chunk factor (e.g. BRIN pages_per_range) is larger. + */ + if (pbscan->phs_chunk_factor != InvalidBlockNumber) + { + /* nearest (smaller) multiple of chunk_factor */ + pbscanwork->phsw_chunk_size + = pbscan->phs_chunk_factor * (pbscanwork->phsw_chunk_size / pbscan->phs_chunk_factor); + + /* but at least one chunk_factor */ + pbscanwork->phsw_chunk_size = Max(pbscanwork->phsw_chunk_size, + pbscan->phs_chunk_factor); + } + retry: /* Grab the spinlock. */ SpinLockAcquire(&pbscan->phs_mutex); @@ -575,6 +599,21 @@ table_block_parallelscan_nextpage(Relation rel, (pbscanwork->phsw_chunk_size * PARALLEL_SEQSCAN_RAMPDOWN_CHUNKS)) pbscanwork->phsw_chunk_size >>= 1; + /* + * We need to make sure the new chunk_size is still a suitable multiple + * of chunk_factor. + */ + if (pbscan->phs_chunk_factor != InvalidBlockNumber) + { + /* nearest (smaller) multiple of chunk_factor */ + pbscanwork->phsw_chunk_size + = pbscan->phs_chunk_factor * (pbscanwork->phsw_chunk_size / pbscan->phs_chunk_factor); + + /* but at least one chunk_factor */ + pbscanwork->phsw_chunk_size = Max(pbscanwork->phsw_chunk_size, + pbscan->phs_chunk_factor); + } + nallocated = pbscanwork->phsw_nallocated = pg_atomic_fetch_add_u64(&pbscan->phs_nallocated, pbscanwork->phsw_chunk_size); diff --git a/src/backend/access/transam/parallel.c b/src/backend/access/transam/parallel.c index 2b8bc2f58d..72086212f4 100644 --- a/src/backend/access/transam/parallel.c +++ b/src/backend/access/transam/parallel.c @@ -14,6 +14,7 @@ #include "postgres.h" +#include "access/brin.h" #include "access/nbtree.h" #include "access/parallel.h" #include "access/session.h" @@ -144,6 +145,9 @@ static const struct { "_bt_parallel_build_main", _bt_parallel_build_main }, + { + "_brin_parallel_build_main", _brin_parallel_build_main + }, { "parallel_vacuum_main", parallel_vacuum_main } diff --git a/src/backend/catalog/index.c b/src/backend/catalog/index.c index 352e43d0e6..5bdd025bb2 100644 --- a/src/backend/catalog/index.c +++ b/src/backend/catalog/index.c @@ -2980,7 +2980,8 @@ index_build(Relation heapRelation, * Note that planner considers parallel safety for us. */ if (parallel && IsNormalProcessingMode() && - indexRelation->rd_rel->relam == BTREE_AM_OID) + (indexRelation->rd_rel->relam == BTREE_AM_OID || + indexRelation->rd_rel->relam == BRIN_AM_OID)) indexInfo->ii_ParallelWorkers = plan_create_index_workers(RelationGetRelid(heapRelation), RelationGetRelid(indexRelation)); diff --git a/src/backend/executor/nodeSeqscan.c b/src/backend/executor/nodeSeqscan.c index 4da0f28f7b..e017f05f78 100644 --- a/src/backend/executor/nodeSeqscan.c +++ b/src/backend/executor/nodeSeqscan.c @@ -274,7 +274,8 @@ ExecSeqScanInitializeDSM(SeqScanState *node, pscan = shm_toc_allocate(pcxt->toc, node->pscan_len); table_parallelscan_initialize(node->ss.ss_currentRelation, pscan, - estate->es_snapshot); + estate->es_snapshot, + InvalidBlockNumber); shm_toc_insert(pcxt->toc, node->ss.ps.plan->plan_node_id, pscan); node->ss.ss_currentScanDesc = table_beginscan_parallel(node->ss.ss_currentRelation, pscan); diff --git a/src/backend/utils/sort/tuplesort.c b/src/backend/utils/sort/tuplesort.c index e5a4e5b371..7b348195be 100644 --- a/src/backend/utils/sort/tuplesort.c +++ b/src/backend/utils/sort/tuplesort.c @@ -1331,6 +1331,7 @@ tuplesort_puttuple_common(Tuplesortstate *state, SortTuple *tuple, bool useAbbre break; default: + Assert(false); elog(ERROR, "invalid tuplesort state"); break; } @@ -1465,6 +1466,7 @@ tuplesort_performsort(Tuplesortstate *state) break; default: + Assert(false); elog(ERROR, "invalid tuplesort state"); break; } @@ -1721,6 +1723,7 @@ tuplesort_gettuple_common(Tuplesortstate *state, bool forward, return false; default: + Assert(false); elog(ERROR, "invalid tuplesort state"); return false; /* keep compiler quiet */ } diff --git a/src/backend/utils/sort/tuplesortvariants.c b/src/backend/utils/sort/tuplesortvariants.c index eb6cfcfd00..719ec57123 100644 --- a/src/backend/utils/sort/tuplesortvariants.c +++ b/src/backend/utils/sort/tuplesortvariants.c @@ -19,6 +19,7 @@ #include "postgres.h" +#include "access/brin_tuple.h" #include "access/hash.h" #include "access/htup_details.h" #include "access/nbtree.h" @@ -43,6 +44,8 @@ static void removeabbrev_cluster(Tuplesortstate *state, SortTuple *stups, int count); static void removeabbrev_index(Tuplesortstate *state, SortTuple *stups, int count); +static void removeabbrev_index_brin(Tuplesortstate *state, SortTuple *stups, + int count); static void removeabbrev_datum(Tuplesortstate *state, SortTuple *stups, int count); static int comparetup_heap(const SortTuple *a, const SortTuple *b, @@ -61,10 +64,16 @@ static int comparetup_index_btree(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); static int comparetup_index_hash(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); +static int comparetup_index_brin(const SortTuple *a, const SortTuple *b, + Tuplesortstate *state); static void writetup_index(Tuplesortstate *state, LogicalTape *tape, SortTuple *stup); static void readtup_index(Tuplesortstate *state, SortTuple *stup, LogicalTape *tape, unsigned int len); +static void writetup_index_brin(Tuplesortstate *state, LogicalTape *tape, + SortTuple *stup); +static void readtup_index_brin(Tuplesortstate *state, SortTuple *stup, + LogicalTape *tape, unsigned int len); static int comparetup_datum(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); static void writetup_datum(Tuplesortstate *state, LogicalTape *tape, @@ -118,6 +127,16 @@ typedef struct uint32 max_buckets; } TuplesortIndexHashArg; +/* + * Data struture pointed by "TuplesortPublic.arg" for the index_brin subcase. + */ +typedef struct +{ + TuplesortIndexArg index; + + /* XXX do we need something here? */ +} TuplesortIndexBrinArg; + /* * Data struture pointed by "TuplesortPublic.arg" for the Datum case. * Set by tuplesort_begin_datum and used only by the DatumTuple routines. @@ -130,6 +149,22 @@ typedef struct int datumTypeLen; } TuplesortDatumArg; +/* + * Computing BrinTuple size with only the tuple is difficult, so we want to track + * the length for r referenced by SortTuple. That's what BrinSortTuple is meant + * to do - it's essentially a BrinTuple prefixed by length. We only write the + * BrinTuple to the logtapes, though. + */ +typedef struct BrinSortTuple +{ + Size tuplen; + BrinTuple tuple; +} BrinSortTuple; + +/* Size of the BrinSortTuple, given length of the BrinTuple. */ +#define BRINSORTTUPLE_SIZE(len) (offsetof(BrinSortTuple, tuple) + (len)) + + Tuplesortstate * tuplesort_begin_heap(TupleDesc tupDesc, int nkeys, AttrNumber *attNums, @@ -512,6 +547,47 @@ tuplesort_begin_index_gist(Relation heapRel, return state; } +Tuplesortstate * +tuplesort_begin_index_brin(Relation heapRel, + Relation indexRel, + int workMem, + SortCoordinate coordinate, + int sortopt) +{ + Tuplesortstate *state = tuplesort_begin_common(workMem, coordinate, + sortopt); + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext; + TuplesortIndexBrinArg *arg; + + oldcontext = MemoryContextSwitchTo(base->maincontext); + arg = (TuplesortIndexBrinArg *) palloc(sizeof(TuplesortIndexBrinArg)); + +#ifdef TRACE_SORT + if (trace_sort) + elog(LOG, + "begin index sort: workMem = %d, randomAccess = %c", + workMem, + sortopt & TUPLESORT_RANDOMACCESS ? 't' : 'f'); +#endif + + base->nKeys = 1; /* Only one sort column, the block number */ + + base->removeabbrev = removeabbrev_index_brin; + base->comparetup = comparetup_index_brin; + base->writetup = writetup_index_brin; + base->readtup = readtup_index_brin; + base->haveDatum1 = true; + base->arg = arg; + + arg->index.heapRel = heapRel; + arg->index.indexRel = indexRel; + + MemoryContextSwitchTo(oldcontext); + + return state; +} + Tuplesortstate * tuplesort_begin_datum(Oid datumType, Oid sortOperator, Oid sortCollation, bool nullsFirstFlag, int workMem, @@ -691,6 +767,35 @@ tuplesort_putindextuplevalues(Tuplesortstate *state, Relation rel, !stup.isnull1); } +/* + * Collect one BRIN tuple while collecting input data for sort. + */ +void +tuplesort_putbrintuple(Tuplesortstate *state, BrinTuple *tuple, Size size) +{ + SortTuple stup; + BrinSortTuple *bstup; + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext = MemoryContextSwitchTo(base->tuplecontext); + + /* allocate space for the whole BRIN sort tuple */ + bstup = palloc(BRINSORTTUPLE_SIZE(size)); + stup.tuple = bstup; + + bstup->tuplen = size; + memcpy(&bstup->tuple, tuple, size); + + stup.datum1 = tuple->bt_blkno; + stup.isnull1 = false; + + tuplesort_puttuple_common(state, &stup, + base->sortKeys && + base->sortKeys->abbrev_converter && + !stup.isnull1); + + MemoryContextSwitchTo(oldcontext); +} + /* * Accept one Datum while collecting input data for sort. * @@ -834,6 +939,35 @@ tuplesort_getindextuple(Tuplesortstate *state, bool forward) return (IndexTuple) stup.tuple; } +/* + * Fetch the next BRIN tuple in either forward or back direction. + * Returns NULL if no more tuples. Returned tuple belongs to tuplesort memory + * context, and must not be freed by caller. Caller may not rely on tuple + * remaining valid after any further manipulation of tuplesort. + */ +BrinTuple * +tuplesort_getbrintuple(Tuplesortstate *state, Size *len, bool forward) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext = MemoryContextSwitchTo(base->sortcontext); + SortTuple stup; + BrinSortTuple *btup; + + if (!tuplesort_gettuple_common(state, forward, &stup)) + stup.tuple = NULL; + + MemoryContextSwitchTo(oldcontext); + + if (!stup.tuple) + return NULL; + + btup = (BrinSortTuple *) stup.tuple; + + *len = btup->tuplen; + + return &btup->tuple; +} + /* * Fetch the next Datum in either forward or back direction. * Returns false if no more datums. @@ -1501,6 +1635,83 @@ readtup_index(Tuplesortstate *state, SortTuple *stup, &stup->isnull1); } +/* + * Routines specialized for BrinTuple case + */ + +static void +removeabbrev_index_brin(Tuplesortstate *state, SortTuple *stups, int count) +{ + int i; + + for (i = 0; i < count; i++) + { + BrinSortTuple *tuple; + + tuple = stups[i].tuple; + stups[i].datum1 = tuple->tuple.bt_blkno; + } +} + +static int +comparetup_index_brin(const SortTuple *a, const SortTuple *b, + Tuplesortstate *state) +{ + BrinTuple *tuple1; + BrinTuple *tuple2; + + tuple1 = &((BrinSortTuple *) a)->tuple; + tuple2 = &((BrinSortTuple *) b)->tuple; + + if (tuple1->bt_blkno > tuple2->bt_blkno) + return 1; + else if (tuple1->bt_blkno < tuple2->bt_blkno) + return -1; + + /* silence compilers */ + return 0; +} + +static void +writetup_index_brin(Tuplesortstate *state, LogicalTape *tape, SortTuple *stup) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + BrinSortTuple *tuple = (BrinSortTuple *) stup->tuple; + unsigned int tuplen = tuple->tuplen; + + tuplen = tuplen + sizeof(tuplen); + LogicalTapeWrite(tape, &tuplen, sizeof(tuplen)); + LogicalTapeWrite(tape, &tuple->tuple, tuple->tuplen); + if (base->sortopt & TUPLESORT_RANDOMACCESS) /* need trailing length word? */ + LogicalTapeWrite(tape, &tuplen, sizeof(tuplen)); +} + +static void +readtup_index_brin(Tuplesortstate *state, SortTuple *stup, + LogicalTape *tape, unsigned int len) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + unsigned int tuplen = len - sizeof(unsigned int); + + /* + * Allocate space for the BRIN sort tuple, which is BrinTuple with an + * extra length field. + */ + BrinSortTuple *tuple + = (BrinSortTuple *) tuplesort_readtup_alloc(state, + BRINSORTTUPLE_SIZE(tuplen)); + + tuple->tuplen = tuplen; + + LogicalTapeReadExact(tape, &tuple->tuple, tuplen); + if (base->sortopt & TUPLESORT_RANDOMACCESS) /* need trailing length word? */ + LogicalTapeReadExact(tape, &tuplen, sizeof(tuplen)); + stup->tuple = (void *) tuple; + + /* set up first-column key value, which is block number */ + stup->datum1 = tuple->tuple.bt_blkno; +} + /* * Routines specialized for DatumTuple case */ diff --git a/src/include/access/brin.h b/src/include/access/brin.h index ed66f1b3d5..3451ecb211 100644 --- a/src/include/access/brin.h +++ b/src/include/access/brin.h @@ -11,6 +11,7 @@ #define BRIN_H #include "nodes/execnodes.h" +#include "storage/shm_toc.h" #include "utils/relcache.h" @@ -52,4 +53,6 @@ typedef struct BrinStatsData extern void brinGetStats(Relation index, BrinStatsData *stats); +extern void _brin_parallel_build_main(dsm_segment *seg, shm_toc *toc); + #endif /* BRIN_H */ diff --git a/src/include/access/relscan.h b/src/include/access/relscan.h index d03360eac0..72a20d882f 100644 --- a/src/include/access/relscan.h +++ b/src/include/access/relscan.h @@ -79,6 +79,7 @@ typedef struct ParallelBlockTableScanDescData BlockNumber phs_nblocks; /* # blocks in relation at start of scan */ slock_t phs_mutex; /* mutual exclusion for setting startblock */ BlockNumber phs_startblock; /* starting block number */ + BlockNumber phs_chunk_factor; /* chunks need to be a multiple of this */ pg_atomic_uint64 phs_nallocated; /* number of blocks allocated to * workers so far. */ } ParallelBlockTableScanDescData; diff --git a/src/include/access/tableam.h b/src/include/access/tableam.h index 230bc39cc0..82297546e2 100644 --- a/src/include/access/tableam.h +++ b/src/include/access/tableam.h @@ -390,7 +390,8 @@ typedef struct TableAmRoutine * relation. */ Size (*parallelscan_initialize) (Relation rel, - ParallelTableScanDesc pscan); + ParallelTableScanDesc pscan, + BlockNumber chunk_factor); /* * Reinitialize `pscan` for a new scan. `rel` will be the same relation as @@ -1148,7 +1149,8 @@ extern Size table_parallelscan_estimate(Relation rel, Snapshot snapshot); */ extern void table_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan, - Snapshot snapshot); + Snapshot snapshot, + BlockNumber chunk_factor); /* * Begin a parallel scan. `pscan` needs to have been initialized with @@ -2064,7 +2066,8 @@ extern void simple_table_tuple_update(Relation rel, ItemPointer otid, extern Size table_block_parallelscan_estimate(Relation rel); extern Size table_block_parallelscan_initialize(Relation rel, - ParallelTableScanDesc pscan); + ParallelTableScanDesc pscan, + BlockNumber chunk_factor); extern void table_block_parallelscan_reinitialize(Relation rel, ParallelTableScanDesc pscan); extern BlockNumber table_block_parallelscan_nextpage(Relation rel, diff --git a/src/include/utils/tuplesort.h b/src/include/utils/tuplesort.h index af057b6358..d6aa629233 100644 --- a/src/include/utils/tuplesort.h +++ b/src/include/utils/tuplesort.h @@ -21,6 +21,7 @@ #ifndef TUPLESORT_H #define TUPLESORT_H +#include "access/brin_tuple.h" #include "access/itup.h" #include "executor/tuptable.h" #include "storage/dsm.h" @@ -275,6 +276,9 @@ typedef struct * The "index_hash" API is similar to index_btree, but the tuples are * actually sorted by their hash codes not the raw data. * + * The "index_brin" API is similar to index_btree, but the tuples are + * BrinTuple and are sorted by their block number not the raw data. + * * Parallel sort callers are required to coordinate multiple tuplesort states * in a leader process and one or more worker processes. The leader process * must launch workers, and have each perform an independent "partial" @@ -419,6 +423,10 @@ extern Tuplesortstate *tuplesort_begin_index_gist(Relation heapRel, Relation indexRel, int workMem, SortCoordinate coordinate, int sortopt); +extern Tuplesortstate *tuplesort_begin_index_brin(Relation heapRel, + Relation indexRel, + int workMem, SortCoordinate coordinate, + int sortopt); extern Tuplesortstate *tuplesort_begin_datum(Oid datumType, Oid sortOperator, Oid sortCollation, bool nullsFirstFlag, @@ -431,6 +439,7 @@ extern void tuplesort_putheaptuple(Tuplesortstate *state, HeapTuple tup); extern void tuplesort_putindextuplevalues(Tuplesortstate *state, Relation rel, ItemPointer self, Datum *values, bool *isnull); +extern void tuplesort_putbrintuple(Tuplesortstate *state, BrinTuple *tup, Size len); extern void tuplesort_putdatum(Tuplesortstate *state, Datum val, bool isNull); @@ -438,6 +447,8 @@ extern bool tuplesort_gettupleslot(Tuplesortstate *state, bool forward, bool copy, TupleTableSlot *slot, Datum *abbrev); extern HeapTuple tuplesort_getheaptuple(Tuplesortstate *state, bool forward); extern IndexTuple tuplesort_getindextuple(Tuplesortstate *state, bool forward); +extern BrinTuple *tuplesort_getbrintuple(Tuplesortstate *state, Size *len, + bool forward); extern bool tuplesort_getdatum(Tuplesortstate *state, bool forward, bool copy, Datum *val, bool *isNull, Datum *abbrev); -- 2.41.0 ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-07-11 21:11 Matthias van de Meent <[email protected]> parent: Tomas Vondra <[email protected]> 0 siblings, 1 reply; 25+ messages in thread From: Matthias van de Meent @ 2023-07-11 21:11 UTC (permalink / raw) To: Tomas Vondra <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On Thu, 6 Jul 2023 at 16:13, Tomas Vondra <[email protected]> wrote: > > On 7/5/23 16:33, Matthias van de Meent wrote: > > ... > > > >> Maybe. I wasn't that familiar with what parallel tuplesort can and can't > >> do, and the little I knew I managed to forget since I wrote this patch. > >> Which similar features do you have in mind? > > > > I was referring to the feature that is "emitting a single sorted run > > of tuples at the leader backend based on data gathered in parallel > > worker backends". It manages the sort state, on-disk runs etc. so that > > you don't have to manage that yourself. > > > > Adding a new storage format for what is effectively a logical tape > > (logtape.{c,h}) and manually merging it seems like a lot of changes if > > that functionality is readily available, standardized and optimized in > > sortsupport; and adds an additional place to manually go through for > > disk-related changes like TDE. > > > > Here's a new version of the patch, with three main changes: Thanks! I've done a review on the patch, and most looks good. Some places need cleanup and polish, some others more documentations, and there are some other issues, but so far it's looking OK. > One thing I was wondering about is whether it might be better to allow > the workers to process overlapping ranges, and then let the leader to > merge the summaries. That would mean we might not need the tableam.c > changes at all, but the leader would need to do more work (although the > BRIN indexes tend to be fairly small). The main reason that got me > thinking about this is that we have pretty much no tests for the union > procedures, because triggering that is really difficult. But for > parallel index builds that'd be much more common. Hmm, that's a good point. I don't mind either way, but it would add overhead in the leader to do all of that merging - especially when you configure pages_per_range > PARALLEL_SEQSCAN_MAX_CHUNK_SIZE as we'd need to merge up to parallel_workers tuples. That could be a significant overhead. ... thinks a bit. Hmm, but with the current P_S_M_C_S of 8192 blocks that's quite unlikely to be a serious problem - the per-backend IO saved of such large ranges on a single backend has presumably much more impact than the merging of n_parallel_tasks max-sized brin tuples. So, seems fine with me. Review follows below. Kind regards, Matthias van de Meent Neon (https://neon.tech/) ----------- > diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c > + BrinShared *brinshared; Needs some indentation fixes. > + int bs_reltuples; > [...] > + state->bs_reltuples += reltuples; My IDE warns me that reltuples is a double. Looking deeper into the value, it contains the number of live tuples in the table, so this conversion may not result in a meaningful value for tables with >=2^31 live tuples. Tables > 56GB could begin to get affected by this. > + int bs_worker_id; This variable seems to be unused. > + BrinSpool *bs_spool; > + BrinSpool *bs_spool_out; Are both used? If so, could you add comments why we have two spools here, instead of only one? > +/* > + * A version of the callback, used by parallel index builds. The main difference > + * is that instead of writing the BRIN tuples into the index, we write them into > + * a shared tuplestore file, and leave the insertion up to the leader (which may + ... shared tuplesort, and ... > brinbuildCallbackParallel(...) > + while (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) shouldn't this be an 'if' now? > + while (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) > + state->bs_currRangeStart += state->bs_pagesPerRange; Is there a reason why you went with iterative addition instead of a single divide-and-multiply like the following?: + state->bs_currRangeStart += state->bs_pagesPerRange * ((state->bs_currRangeStart - thisblock) / state->bs_pagesPerRange); > diff --git a/src/backend/access/table/tableam.c b/src/backend/access/table/tableam.c > [...] > -table_block_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan) > +table_block_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan, BlockNumber chunk_factor) > [...] > - /* compare phs_syncscan initialization to similar logic in initscan */ > + bpscan->phs_chunk_factor = chunk_factor; > + /* compare phs_syncscan initialization to similar logic in initscan > + * > + * Disable sync scans if the chunk factor is set (valid block number). > + */ I think this needs some pgindent or other style work, both on comment style and line lengths > diff --git a/src/backend/utils/sort/tuplesort.c b/src/backend/utils/sort/tuplesort.c > [...] > + Assert(false); (x3) I think these can be cleaned up, right? > diff --git a/src/backend/utils/sort/tuplesortvariants.c b/src/backend/utils/sort/tuplesortvariants.c > [...] > + * Computing BrinTuple size with only the tuple is difficult, so we want to track > + * the length for r referenced by SortTuple. That's what BrinSortTuple is meant > + * to do - it's essentially a BrinTuple prefixed by length. We only write the > + * BrinTuple to the logtapes, though. Why don't we write the full BrinSortTuple to disk? Doesn't that make more sense? > + tuplesort_puttuple_common(state, &stup, > + base->sortKeys && > + base->sortKeys->abbrev_converter && > + !stup.isnull1); Can't this last argument just be inlined, based on knowledge that we don't use sortKeys in brin? > +comparetup_index_brin(const SortTuple *a, const SortTuple *b, > + Tuplesortstate *state) > +{ > + BrinTuple *tuple1; > [...] > + tuple1 = &((BrinSortTuple *) a)->tuple; > [...] I'm fairly sure that this cast (and it's neighbour) is incorrect and should be the following instead: + tuple1 = &((BrinSortTuple *) (a->tuple))->tuple; Additionally, I think the following would be a better approach here, as we wouldn't need to do pointer-chasing: + static int + comparetup_index_brin(const SortTuple *a, const SortTuple *b, + Tuplesortstate *state) + { + Assert(TuplesortstateGetPublic(state)->haveDatum1); + + if (DatumGetUInt32(a->datum1) > DatumGetUInt32(b->datum1)) + return 1; + if (DatumGetUInt32(a->datum1) < DatumGetUInt32(b->datum1)) + return -1; + /* silence compilers */ + return 0; + } --- Thanks for working on this! ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-07-14 13:57 Tomas Vondra <[email protected]> parent: Matthias van de Meent <[email protected]> 0 siblings, 1 reply; 25+ messages in thread From: Tomas Vondra @ 2023-07-14 13:57 UTC (permalink / raw) To: Matthias van de Meent <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On 7/11/23 23:11, Matthias van de Meent wrote: > On Thu, 6 Jul 2023 at 16:13, Tomas Vondra <[email protected]> wrote: >> >> On 7/5/23 16:33, Matthias van de Meent wrote: >>> ... >>> >>>> Maybe. I wasn't that familiar with what parallel tuplesort can and can't >>>> do, and the little I knew I managed to forget since I wrote this patch. >>>> Which similar features do you have in mind? >>> >>> I was referring to the feature that is "emitting a single sorted run >>> of tuples at the leader backend based on data gathered in parallel >>> worker backends". It manages the sort state, on-disk runs etc. so that >>> you don't have to manage that yourself. >>> >>> Adding a new storage format for what is effectively a logical tape >>> (logtape.{c,h}) and manually merging it seems like a lot of changes if >>> that functionality is readily available, standardized and optimized in >>> sortsupport; and adds an additional place to manually go through for >>> disk-related changes like TDE. >>> >> >> Here's a new version of the patch, with three main changes: > > Thanks! I've done a review on the patch, and most looks good. Some > places need cleanup and polish, some others more documentations, and > there are some other issues, but so far it's looking OK. > >> One thing I was wondering about is whether it might be better to allow >> the workers to process overlapping ranges, and then let the leader to >> merge the summaries. That would mean we might not need the tableam.c >> changes at all, but the leader would need to do more work (although the >> BRIN indexes tend to be fairly small). The main reason that got me >> thinking about this is that we have pretty much no tests for the union >> procedures, because triggering that is really difficult. But for >> parallel index builds that'd be much more common. > > Hmm, that's a good point. I don't mind either way, but it would add > overhead in the leader to do all of that merging - especially when you > configure pages_per_range > PARALLEL_SEQSCAN_MAX_CHUNK_SIZE as we'd > need to merge up to parallel_workers tuples. That could be a > significant overhead. > > ... thinks a bit. > > Hmm, but with the current P_S_M_C_S of 8192 blocks that's quite > unlikely to be a serious problem - the per-backend IO saved of such > large ranges on a single backend has presumably much more impact than > the merging of n_parallel_tasks max-sized brin tuples. So, seems fine > with me. > As for PARALLEL_SEQSCAN_MAX_CHUNK_SIZE, the last patch actually considers the chunk_factor (i.e. pages_per_range) *after* doing pbscanwork->phsw_chunk_size = Min(pbscanwork->phsw_chunk_size, PARALLEL_SEQSCAN_MAX_CHUNK_SIZE); so even with (pages_per_range > PARALLEL_SEQSCAN_MAX_CHUNK_SIZE) it would not need to merge anything. Now, that might have been a bad idea and PARALLEL_SEQSCAN_MAX_CHUNK_SIZE should be considered. In which case this *has* to do the union, even if only for the rare corner case. But I don't think that's a major issue - it's pretty sure summarizing the tuples is way more expensive than merging the summaries. Which is what matters for Amdahl's law ... > Review follows below. > > Kind regards, > > Matthias van de Meent > Neon (https://neon.tech/) > > ----------- > >> diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c > >> + BrinShared *brinshared; > > Needs some indentation fixes. > >> + int bs_reltuples; >> [...] >> + state->bs_reltuples += reltuples; > > My IDE warns me that reltuples is a double. Looking deeper into the > value, it contains the number of live tuples in the table, so this > conversion may not result in a meaningful value for tables with >=2^31 > live tuples. Tables > 56GB could begin to get affected by this. > >> + int bs_worker_id; > > This variable seems to be unused. > >> + BrinSpool *bs_spool; >> + BrinSpool *bs_spool_out; > > Are both used? If so, could you add comments why we have two spools > here, instead of only one? > OK, I admit I'm not sure both are actually necessary. I was struggling getting it working with just one spool, because when the leader participates as a worker, it needs to both summarize some of the chunks (and put the tuples somewhere). And then it also needs to consume the final output. Maybe it's just a case of cargo cult programming - I was mostly copying stuff from the btree index build, trying to make it work, and then with two spools it started working. >> +/* >> + * A version of the callback, used by parallel index builds. The main difference >> + * is that instead of writing the BRIN tuples into the index, we write them into >> + * a shared tuplestore file, and leave the insertion up to the leader (which may > > + ... shared tuplesort, and ... > >> brinbuildCallbackParallel(...) >> + while (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) > > shouldn't this be an 'if' now? > Hmmm, probably ... that way we'd skip the empty ranges. >> + while (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) >> + state->bs_currRangeStart += state->bs_pagesPerRange; > > Is there a reason why you went with iterative addition instead of a > single divide-and-multiply like the following?: > > + state->bs_currRangeStart += state->bs_pagesPerRange * > ((state->bs_currRangeStart - thisblock) / state->bs_pagesPerRange); > Probably laziness ... You're right the divide-multiply seems simpler. >> diff --git a/src/backend/access/table/tableam.c b/src/backend/access/table/tableam.c >> [...] >> -table_block_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan) >> +table_block_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan, BlockNumber chunk_factor) >> [...] >> - /* compare phs_syncscan initialization to similar logic in initscan */ >> + bpscan->phs_chunk_factor = chunk_factor; >> + /* compare phs_syncscan initialization to similar logic in initscan >> + * >> + * Disable sync scans if the chunk factor is set (valid block number). >> + */ > > I think this needs some pgindent or other style work, both on comment > style and line lengths > Right. >> diff --git a/src/backend/utils/sort/tuplesort.c b/src/backend/utils/sort/tuplesort.c >> [...] >> + Assert(false); (x3) > > I think these can be cleaned up, right? > Duh! Absolutely, this shouldn't have been in the patch at all. I only added those to quickly identify places that got the tuplesort into unexpected state (much easier with a coredump and a backtrace). >> diff --git a/src/backend/utils/sort/tuplesortvariants.c b/src/backend/utils/sort/tuplesortvariants.c >> [...] >> + * Computing BrinTuple size with only the tuple is difficult, so we want to track >> + * the length for r referenced by SortTuple. That's what BrinSortTuple is meant >> + * to do - it's essentially a BrinTuple prefixed by length. We only write the >> + * BrinTuple to the logtapes, though. > > Why don't we write the full BrinSortTuple to disk? Doesn't that make more sense? > Not sure I understand. We ultimately do, because we write (length + BrinTuple) and BrinSortTuple is exactly that. But if we write BrinSortTuple, we would end up writing length for that too, no? Or maybe I just don't understand how would that make things simpler. >> + tuplesort_puttuple_common(state, &stup, >> + base->sortKeys && >> + base->sortKeys->abbrev_converter && >> + !stup.isnull1); > > Can't this last argument just be inlined, based on knowledge that we > don't use sortKeys in brin? > What does "inlined" mean for an argument? But yeah, I guess it might be just set to false. And we should probably have an assert that there are no sortKeys. >> +comparetup_index_brin(const SortTuple *a, const SortTuple *b, >> + Tuplesortstate *state) >> +{ >> + BrinTuple *tuple1; >> [...] >> + tuple1 = &((BrinSortTuple *) a)->tuple; >> [...] > > I'm fairly sure that this cast (and it's neighbour) is incorrect and > should be the following instead: > > + tuple1 = &((BrinSortTuple *) (a->tuple))->tuple; > > Additionally, I think the following would be a better approach here, > as we wouldn't need to do pointer-chasing: > Uh, right. This only works because 'tuple' happens to be the first field in SortTuple. > + static int > + comparetup_index_brin(const SortTuple *a, const SortTuple *b, > + Tuplesortstate *state) > + { > + Assert(TuplesortstateGetPublic(state)->haveDatum1); > + > + if (DatumGetUInt32(a->datum1) > DatumGetUInt32(b->datum1)) > + return 1; > + if (DatumGetUInt32(a->datum1) < DatumGetUInt32(b->datum1)) > + return -1; > + /* silence compilers */ > + return 0; > + } > Good idea! I forgot we're guaranteed to have datum1. regards -- Tomas Vondra EnterpriseDB: http://www.enterprisedb.com The Enterprise PostgreSQL Company ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-07-14 15:01 Matthias van de Meent <[email protected]> parent: Tomas Vondra <[email protected]> 0 siblings, 1 reply; 25+ messages in thread From: Matthias van de Meent @ 2023-07-14 15:01 UTC (permalink / raw) To: Tomas Vondra <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On Fri, 14 Jul 2023 at 15:57, Tomas Vondra <[email protected]> wrote: > > On 7/11/23 23:11, Matthias van de Meent wrote: >> On Thu, 6 Jul 2023 at 16:13, Tomas Vondra <[email protected]> wrote: >>> >>> One thing I was wondering about is whether it might be better to allow >>> the workers to process overlapping ranges, and then let the leader to >>> merge the summaries. That would mean we might not need the tableam.c >>> changes at all, but the leader would need to do more work (although the >>> BRIN indexes tend to be fairly small). The main reason that got me >>> thinking about this is that we have pretty much no tests for the union >>> procedures, because triggering that is really difficult. But for >>> parallel index builds that'd be much more common. >> >> Hmm, that's a good point. I don't mind either way, but it would add >> overhead in the leader to do all of that merging - especially when you >> configure pages_per_range > PARALLEL_SEQSCAN_MAX_CHUNK_SIZE as we'd >> need to merge up to parallel_workers tuples. That could be a >> significant overhead. >> >> ... thinks a bit. >> >> Hmm, but with the current P_S_M_C_S of 8192 blocks that's quite >> unlikely to be a serious problem - the per-backend IO saved of such >> large ranges on a single backend has presumably much more impact than >> the merging of n_parallel_tasks max-sized brin tuples. So, seems fine >> with me. >> > > As for PARALLEL_SEQSCAN_MAX_CHUNK_SIZE, the last patch actually > considers the chunk_factor (i.e. pages_per_range) *after* doing > > pbscanwork->phsw_chunk_size = Min(pbscanwork->phsw_chunk_size, > PARALLEL_SEQSCAN_MAX_CHUNK_SIZE); > > so even with (pages_per_range > PARALLEL_SEQSCAN_MAX_CHUNK_SIZE) it > would not need to merge anything. > > Now, that might have been a bad idea and PARALLEL_SEQSCAN_MAX_CHUNK_SIZE > should be considered. In which case this *has* to do the union, even if > only for the rare corner case. > > But I don't think that's a major issue - it's pretty sure summarizing > the tuples is way more expensive than merging the summaries. Which is > what matters for Amdahl's law ... Agreed. >>> + BrinSpool *bs_spool; >>> + BrinSpool *bs_spool_out; >> >> Are both used? If so, could you add comments why we have two spools >> here, instead of only one? >> > > OK, I admit I'm not sure both are actually necessary. I was struggling > getting it working with just one spool, because when the leader > participates as a worker, it needs to both summarize some of the chunks > (and put the tuples somewhere). And then it also needs to consume the > final output. > > Maybe it's just a case of cargo cult programming - I was mostly copying > stuff from the btree index build, trying to make it work, and then with > two spools it started working. Two spools seem to be necessary in a participating leader, but both spools have non-overlapping lifetimes. In the btree code actually two pairs of spools are actually used (in unique indexes): you can see the pairs being allocated in both _bt_leader_participate_as_worker (called from _bt_begin_parallel, from _bt_spools_heapscan) and in _bt_spools_heapscan. > >> diff --git a/src/backend/utils/sort/tuplesortvariants.c b/src/backend/utils/sort/tuplesortvariants.c > >> [...] > >> + * Computing BrinTuple size with only the tuple is difficult, so we want to track > >> + * the length for r referenced by SortTuple. That's what BrinSortTuple is meant > >> + * to do - it's essentially a BrinTuple prefixed by length. We only write the > >> + * BrinTuple to the logtapes, though. > > > > Why don't we write the full BrinSortTuple to disk? Doesn't that make more sense? > > > > Not sure I understand. We ultimately do, because we write > > (length + BrinTuple) > > and BrinSortTuple is exactly that. But if we write BrinSortTuple, we > would end up writing length for that too, no? > > Or maybe I just don't understand how would that make things simpler. I don't quite understand the intricacies of the tape storage format quite yet (specifically, I'm continuously getting confused by the len -= sizeof(int)), so you might well be correct. My comment was written based on just the comment's contents, which claims "we can't easily recompute the length, so we store it with the tuple in memory. However, we don't store the length when we write it to the tape", which seems self-contradictory. > >> + tuplesort_puttuple_common(state, &stup, > >> + base->sortKeys && > >> + base->sortKeys->abbrev_converter && > >> + !stup.isnull1); > > > > Can't this last argument just be inlined, based on knowledge that we > > don't use sortKeys in brin? > > > > What does "inlined" mean for an argument? But yeah, I guess it might be > just set to false. And we should probably have an assert that there are > no sortKeys. "inlined", "precomputed", "const-ified"? I'm not super good at vocabulary. But, indeed, thanks. Kind regards, Matthias van de Meent Neon (https://neon.tech) ^ permalink raw reply [nested|flat] 25+ messages in thread
* [PATCH v1 2/3] Replace magic "one" in tsvector binary receiving=0A= @ 2023-09-19 08:40 Denis Erokhin <[email protected]> 0 siblings, 0 replies; 25+ messages in thread From: Denis Erokhin @ 2023-09-19 08:40 UTC (permalink / raw) ------=_NextPart_000_0099_01D9F2F3.17E4DDF0 Content-Type: application/octet-stream; name="v1-0003-Optimize-memory-allocation-during-tsvector-binary.patch" Content-Transfer-Encoding: quoted-printable Content-Disposition: attachment; filename="v1-0003-Optimize-memory-allocation-during-tsvector-binary.patch" ^ permalink raw reply [nested|flat] 25+ messages in thread
* [PATCH v1 2/3] Replace magic "one" in tsvector binary receiving=0A= @ 2023-09-19 08:40 Denis Erokhin <[email protected]> 0 siblings, 0 replies; 25+ messages in thread From: Denis Erokhin @ 2023-09-19 08:40 UTC (permalink / raw) ------=_NextPart_000_0099_01D9F2F3.17E4DDF0 Content-Type: application/octet-stream; name="v1-0003-Optimize-memory-allocation-during-tsvector-binary.patch" Content-Transfer-Encoding: quoted-printable Content-Disposition: attachment; filename="v1-0003-Optimize-memory-allocation-during-tsvector-binary.patch" ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-08 11:03 Tomas Vondra <[email protected]> parent: Matthias van de Meent <[email protected]> 0 siblings, 2 replies; 25+ messages in thread From: Tomas Vondra @ 2023-11-08 11:03 UTC (permalink / raw) To: Matthias van de Meent <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> Hi, here's an updated patch, addressing the review comments, and reworking how the work is divided between the workers & leader etc. 0001 is just v2, rebased to current master 0002 and 0003 address most of the issues, in particular it - removes the unnecessary spool - fixes bs_reltuples type to double - a couple comments are reworded to be clearer - changes loop/condition in brinbuildCallbackParallel - removes asserts added for debugging - fixes cast in comparetup_index_brin - 0003 then simplifies comparetup_index_brin - I haven't inlined the tuplesort_puttuple_common parameter (didn't seem worth it) 0004 Reworks how the work is divided between workers and combined by the leader. It undoes the tableam.c changes that attempted to divide the relation into chunks matching the BRIN ranges, and instead merges the results in the leader (using the BRIN "union" function). I haven't done any indentation fixes yet. I did fairly extensive testing, using pageinspect to compare indexes built with/without parallelism. More testing is needed, but it seems to work fine (with other opclasses and so on). In general I'm quite happy with the current state, and I believe it's fairly close to be committable. regards -- Tomas Vondra EnterpriseDB: http://www.enterprisedb.com The Enterprise PostgreSQL Company Attachments: [text/x-patch] v3-0001-parallel-CREATE-INDEX-for-BRIN-v2.patch (49.7K, ../../[email protected]/2-v3-0001-parallel-CREATE-INDEX-for-BRIN-v2.patch) download | inline diff: From 3e5fabc6e5a30bb16ec11fdc7fcf65880e172d0c Mon Sep 17 00:00:00 2001 From: Tomas Vondra <[email protected]> Date: Tue, 7 Nov 2023 17:04:28 +0100 Subject: [PATCH v3 1/4] parallel CREATE INDEX for BRIN v2 --- src/backend/access/brin/brin.c | 781 ++++++++++++++++++++- src/backend/access/nbtree/nbtsort.c | 2 +- src/backend/access/table/tableam.c | 49 +- src/backend/access/transam/parallel.c | 4 + src/backend/catalog/index.c | 3 +- src/backend/executor/nodeSeqscan.c | 3 +- src/backend/utils/sort/tuplesort.c | 3 + src/backend/utils/sort/tuplesortvariants.c | 211 ++++++ src/include/access/brin.h | 3 + src/include/access/relscan.h | 1 + src/include/access/tableam.h | 9 +- src/include/utils/tuplesort.h | 11 + 12 files changed, 1065 insertions(+), 15 deletions(-) diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index 25338a90e29..b7cd29c5968 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -33,6 +33,7 @@ #include "postmaster/autovacuum.h" #include "storage/bufmgr.h" #include "storage/freespace.h" +#include "tcop/tcopprot.h" /* pgrminclude ignore */ #include "utils/acl.h" #include "utils/builtins.h" #include "utils/datum.h" @@ -40,7 +41,118 @@ #include "utils/index_selfuncs.h" #include "utils/memutils.h" #include "utils/rel.h" +#include "utils/tuplesort.h" +/* Magic numbers for parallel state sharing */ +#define PARALLEL_KEY_BRIN_SHARED UINT64CONST(0xA000000000000001) +#define PARALLEL_KEY_TUPLESORT UINT64CONST(0xA000000000000002) +#define PARALLEL_KEY_QUERY_TEXT UINT64CONST(0xA000000000000003) +#define PARALLEL_KEY_WAL_USAGE UINT64CONST(0xA000000000000004) +#define PARALLEL_KEY_BUFFER_USAGE UINT64CONST(0xA000000000000005) + +/* + * Status record for spooling/sorting phase. + */ +typedef struct BrinSpool +{ + Tuplesortstate *sortstate; /* state data for tuplesort.c */ + Relation heap; + Relation index; +} BrinSpool; + +/* + * Status for index builds performed in parallel. This is allocated in a + * dynamic shared memory segment. + */ +typedef struct BrinShared +{ + /* + * These fields are not modified during the build. They primarily exist for + * the benefit of worker processes that need to create state corresponding + * to that used by the leader. + */ + Oid heaprelid; + Oid indexrelid; + bool isconcurrent; + BlockNumber pagesPerRange; + int scantuplesortstates; + + /* + * workersdonecv is used to monitor the progress of workers. All parallel + * participants must indicate that they are done before leader can use + * results built by the workers (and before leader can write the data into + * the index). + */ + ConditionVariable workersdonecv; + + /* + * mutex protects all fields before heapdesc. + * + * These fields contain status information of interest to BRIN index + * builds that must work just the same when an index is built in parallel. + */ + slock_t mutex; + + /* + * Mutable state that is maintained by workers, and reported back to + * leader at end of the scans. + * + * nparticipantsdone is number of worker processes finished. + * + * reltuples is the total number of input heap tuples. + * + * indtuples is the total number of tuples that made it into the index. + */ + int nparticipantsdone; + double reltuples; + double indtuples; + + /* + * ParallelTableScanDescData data follows. Can't directly embed here, as + * implementations of the parallel table scan desc interface might need + * stronger alignment. + */ +} BrinShared; + +/* + * Return pointer to a BrinShared's parallel table scan. + * + * c.f. shm_toc_allocate as to why BUFFERALIGN is used, rather than just + * MAXALIGN. + */ +#define ParallelTableScanFromBrinShared(shared) \ + (ParallelTableScanDesc) ((char *) (shared) + BUFFERALIGN(sizeof(BrinShared))) + +/* + * Status for leader in parallel index build. + */ +typedef struct BrinLeader +{ + /* parallel context itself */ + ParallelContext *pcxt; + + /* + * nparticipanttuplesorts is the exact number of worker processes + * successfully launched, plus one leader process if it participates as a + * worker (only DISABLE_LEADER_PARTICIPATION builds avoid leader + * participating as a worker). + */ + int nparticipanttuplesorts; + + /* + * Leader process convenience pointers to shared state (leader avoids TOC + * lookups). + * + * brinshared is the shared state for entire build. sharedsort is the + * shared, tuplesort-managed state passed to each process tuplesort. + * snapshot is the snapshot used by the scan iff an MVCC snapshot is required. + */ + BrinShared *brinshared; + Sharedsort *sharedsort; + Snapshot snapshot; + WalUsage *walusage; + BufferUsage *bufferusage; +} BrinLeader; /* * We use a BrinBuildState during initial construction of a BRIN index. @@ -50,12 +162,23 @@ typedef struct BrinBuildState { Relation bs_irel; int bs_numtuples; + int bs_reltuples; Buffer bs_currentInsertBuf; BlockNumber bs_pagesPerRange; BlockNumber bs_currRangeStart; BrinRevmap *bs_rmAccess; BrinDesc *bs_bdesc; BrinMemTuple *bs_dtuple; + + /* + * bs_leader is only present when a parallel index build is performed, and + * only in the leader process. (Actually, only the leader has a + * BrinBuildState.) + */ + BrinLeader *bs_leader; + int bs_worker_id; + BrinSpool *bs_spool; + BrinSpool *bs_spool_out; } BrinBuildState; /* @@ -76,6 +199,7 @@ static void terminate_brin_buildstate(BrinBuildState *state); static void brinsummarize(Relation index, Relation heapRel, BlockNumber pageRange, bool include_partial, double *numSummarized, double *numExisting); static void form_and_insert_tuple(BrinBuildState *state); +static void form_and_spill_tuple(BrinBuildState *state); static void union_tuples(BrinDesc *bdesc, BrinMemTuple *a, BrinTuple *b); static void brin_vacuum_scan(Relation idxrel, BufferAccessStrategy strategy); @@ -83,6 +207,20 @@ static bool add_values_to_range(Relation idxRel, BrinDesc *bdesc, BrinMemTuple *dtup, const Datum *values, const bool *nulls); static bool check_null_keys(BrinValues *bval, ScanKey *nullkeys, int nnullkeys); +/* parallel index builds */ +static void _brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, + bool isconcurrent, int request); +static void _brin_end_parallel(BrinLeader *btleader, BrinBuildState *state); +static Size _brin_parallel_estimate_shared(Relation heap, Snapshot snapshot); +static void _brin_leader_participate_as_worker(BrinBuildState *buildstate, + Relation heap, Relation index); +static void _brin_parallel_scan_and_build(BrinBuildState *buildstate, + BrinSpool *brinspool, + BrinShared *brinshared, + Sharedsort *sharedsort, + Relation heap, Relation index, + int sortmem, bool progress); + /* * BRIN handler function: return IndexAmRoutine with access method parameters * and callbacks. @@ -820,6 +958,67 @@ brinbuildCallback(Relation index, values, isnull); } +/* + * A version of the callback, used by parallel index builds. The main difference + * is that instead of writing the BRIN tuples into the index, we write them into + * a shared tuplestore file, and leave the insertion up to the leader (which may + * reorder them a bit etc.). The callback also does not generate empty ranges, + * those may be added by the leader when merging results from workers. + */ +static void +brinbuildCallbackParallel(Relation index, + ItemPointer tid, + Datum *values, + bool *isnull, + bool tupleIsAlive, + void *brstate) +{ + BrinBuildState *state = (BrinBuildState *) brstate; + BlockNumber thisblock; + + thisblock = ItemPointerGetBlockNumber(tid); + + /* + * If we're in a block that belongs to a future range, summarize what + * we've got and start afresh. Note the scan might have skipped many + * pages, if they were devoid of live tuples; make sure to insert index + * tuples for those too. + */ + while (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) + { + + BRIN_elog((DEBUG2, + "brinbuildCallback: completed a range: %u--%u", + state->bs_currRangeStart, + state->bs_currRangeStart + state->bs_pagesPerRange)); + + /* create the index tuple and write it into the tuplesort */ + form_and_spill_tuple(state); + + /* + * set state to correspond to the next range + * + * XXX This has the issue that it skips ranges summarized by other + * workers, but it also skips empty ranges that should have been + * summarized. We'd need to either make the workers aware which + * chunk they are actually processing (which is currently known + * only in the ParallelBlockTableScan bit). Or we could ignore it + * here, and then decide it while "merging" results from workers + * (if there's no entry for the range, it had to be empty so we + * just add an empty one). + */ + while (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) + state->bs_currRangeStart += state->bs_pagesPerRange; + + /* re-initialize state for it */ + brin_memtuple_initialize(state->bs_dtuple, state->bs_bdesc); + } + + /* Accumulate the current tuple into the running state */ + (void) add_values_to_range(index, state->bs_bdesc, state->bs_dtuple, + values, isnull); +} + /* * brinbuild() -- build a new BRIN index. */ @@ -881,18 +1080,93 @@ brinbuild(Relation heap, Relation index, IndexInfo *indexInfo) revmap = brinRevmapInitialize(index, &pagesPerRange); state = initialize_brin_buildstate(index, revmap, pagesPerRange); + state->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + state->bs_spool->heap = heap; + state->bs_spool->index = index; + + /* + * Attempt to launch parallel worker scan when required + * + * XXX plan_create_index_workers makes the number of workers dependent on + * maintenance_work_mem, requiring 32MB for each worker. That makes sense + * for btree, but not for BRIN, which can do away with much less memory. + * So maybe make that somehow less strict, optionally? + */ + if (indexInfo->ii_ParallelWorkers > 0) + _brin_begin_parallel(state, heap, index, indexInfo->ii_Concurrent, + indexInfo->ii_ParallelWorkers); + /* * Now scan the relation. No syncscan allowed here because we want the * heap blocks in physical order. */ - reltuples = table_index_build_scan(heap, index, indexInfo, false, true, - brinbuildCallback, (void *) state, NULL); - /* process the final batch */ - form_and_insert_tuple(state); + /* + * If parallel build requested and at least one worker process was + * successfully launched, set up coordination state + */ + if (state->bs_leader) + { + SortCoordinate coordinate; + + coordinate = (SortCoordinate) palloc0(sizeof(SortCoordinateData)); + coordinate->isWorker = false; + coordinate->nParticipants = + state->bs_leader->nparticipanttuplesorts; + coordinate->sharedsort = state->bs_leader->sharedsort; + + + /* + * Begin serial/leader tuplesort. + * + * In cases where parallelism is involved, the leader receives the same + * share of maintenance_work_mem as a serial sort (it is generally treated + * in the same way as a serial sort once we return). Parallel worker + * Tuplesortstates will have received only a fraction of + * maintenance_work_mem, though. + * + * We rely on the lifetime of the Leader Tuplesortstate almost not + * overlapping with any worker Tuplesortstate's lifetime. There may be + * some small overlap, but that's okay because we rely on leader + * Tuplesortstate only allocating a small, fixed amount of memory here. + * When its tuplesort_performsort() is called (by our caller), and + * significant amounts of memory are likely to be used, all workers must + * have already freed almost all memory held by their Tuplesortstates + * (they are about to go away completely, too). The overall effect is + * that maintenance_work_mem always represents an absolute high watermark + * on the amount of memory used by a CREATE INDEX operation, regardless of + * the use of parallelism or any other factor. + */ + state->bs_spool_out = (BrinSpool *) palloc0(sizeof(BrinSpool)); + state->bs_spool_out->heap = heap; + state->bs_spool_out->index = index; + + state->bs_spool_out->sortstate = + tuplesort_begin_index_brin(heap, index, + maintenance_work_mem, coordinate, + TUPLESORT_NONE); + + /* + * In parallel mode, wait for workers to complete, and then read all + * tuples from the shared tuplesort and insert them into the index. + */ + _brin_end_parallel(state->bs_leader, state); + } + else /* no parallel index build, just do the usual thing */ + { + reltuples = table_index_build_scan(heap, index, indexInfo, false, true, + brinbuildCallback, (void *) state, NULL); + + /* process the final batch */ + form_and_insert_tuple(state); + + /* track the number of relation tuples */ + state->bs_reltuples = reltuples; + } /* release resources */ idxtuples = state->bs_numtuples; + reltuples = state->bs_reltuples; brinRevmapTerminate(state->bs_rmAccess); terminate_brin_buildstate(state); @@ -1312,12 +1586,16 @@ initialize_brin_buildstate(Relation idxRel, BrinRevmap *revmap, state->bs_irel = idxRel; state->bs_numtuples = 0; + state->bs_reltuples = 0; state->bs_currentInsertBuf = InvalidBuffer; state->bs_pagesPerRange = pagesPerRange; state->bs_currRangeStart = 0; state->bs_rmAccess = revmap; state->bs_bdesc = brin_build_desc(idxRel); state->bs_dtuple = brin_new_memtuple(state->bs_bdesc); + state->bs_leader = NULL; + state->bs_worker_id = 0; + state->bs_spool = NULL; return state; } @@ -1609,6 +1887,32 @@ form_and_insert_tuple(BrinBuildState *state) pfree(tup); } +/* + * Given a deformed tuple in the build state, convert it into the on-disk + * format and write it to a (shared) tuplestore (the leader will insert it + * into the index later). + */ +static void +form_and_spill_tuple(BrinBuildState *state) +{ + BrinTuple *tup; + Size size; + + /* don't insert empty tuples in parallel build */ + if (state->bs_dtuple->bt_empty_range) + return; + + tup = brin_form_tuple(state->bs_bdesc, state->bs_currRangeStart, + state->bs_dtuple, &size); + + /* write the BRIN tuple to the tuplesort */ + tuplesort_putbrintuple(state->bs_spool->sortstate, tup, size); + + state->bs_numtuples++; + + pfree(tup); +} + /* * Given two deformed tuples, adjust the first one so that it's consistent * with the summary values in both. @@ -1928,3 +2232,472 @@ check_null_keys(BrinValues *bval, ScanKey *nullkeys, int nnullkeys) return true; } + +static void +_brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, + bool isconcurrent, int request) +{ + ParallelContext *pcxt; + int scantuplesortstates; + Snapshot snapshot; + Size estbrinshared; + Size estsort; + BrinShared *brinshared; + Sharedsort *sharedsort; + BrinLeader *brinleader = (BrinLeader *) palloc0(sizeof(BrinLeader)); + WalUsage *walusage; + BufferUsage *bufferusage; + bool leaderparticipates = true; + int querylen; + +#ifdef DISABLE_LEADER_PARTICIPATION + leaderparticipates = false; +#endif + + /* + * Enter parallel mode, and create context for parallel build of brin + * index + */ + EnterParallelMode(); + Assert(request > 0); + pcxt = CreateParallelContext("postgres", "_brin_parallel_build_main", + request); + + scantuplesortstates = leaderparticipates ? request + 1 : request; + + /* + * Prepare for scan of the base relation. In a normal index build, we use + * SnapshotAny because we must retrieve all tuples and do our own time + * qual checks (because we have to index RECENTLY_DEAD tuples). In a + * concurrent build, we take a regular MVCC snapshot and index whatever's + * live according to that. + */ + if (!isconcurrent) + snapshot = SnapshotAny; + else + snapshot = RegisterSnapshot(GetTransactionSnapshot()); + + /* + * Estimate size for our own PARALLEL_KEY_BRIN_SHARED workspace. + */ + estbrinshared = _brin_parallel_estimate_shared(heap, snapshot); + shm_toc_estimate_chunk(&pcxt->estimator, estbrinshared); + estsort = tuplesort_estimate_shared(scantuplesortstates); + shm_toc_estimate_chunk(&pcxt->estimator, estsort); + + shm_toc_estimate_keys(&pcxt->estimator, 2); + + /* + * Estimate space for WalUsage and BufferUsage -- PARALLEL_KEY_WAL_USAGE + * and PARALLEL_KEY_BUFFER_USAGE. + * + * If there are no extensions loaded that care, we could skip this. We + * have no way of knowing whether anyone's looking at pgWalUsage or + * pgBufferUsage, so do it unconditionally. + */ + shm_toc_estimate_chunk(&pcxt->estimator, + mul_size(sizeof(WalUsage), pcxt->nworkers)); + shm_toc_estimate_keys(&pcxt->estimator, 1); + shm_toc_estimate_chunk(&pcxt->estimator, + mul_size(sizeof(BufferUsage), pcxt->nworkers)); + shm_toc_estimate_keys(&pcxt->estimator, 1); + + /* Finally, estimate PARALLEL_KEY_QUERY_TEXT space */ + if (debug_query_string) + { + querylen = strlen(debug_query_string); + shm_toc_estimate_chunk(&pcxt->estimator, querylen + 1); + shm_toc_estimate_keys(&pcxt->estimator, 1); + } + else + querylen = 0; /* keep compiler quiet */ + + /* Everyone's had a chance to ask for space, so now create the DSM */ + InitializeParallelDSM(pcxt); + + /* If no DSM segment was available, back out (do serial build) */ + if (pcxt->seg == NULL) + { + if (IsMVCCSnapshot(snapshot)) + UnregisterSnapshot(snapshot); + DestroyParallelContext(pcxt); + ExitParallelMode(); + return; + } + + /* Store shared build state, for which we reserved space */ + brinshared = (BrinShared *) shm_toc_allocate(pcxt->toc, estbrinshared); + /* Initialize immutable state */ + brinshared->heaprelid = RelationGetRelid(heap); + brinshared->indexrelid = RelationGetRelid(index); + brinshared->isconcurrent = isconcurrent; + brinshared->scantuplesortstates = scantuplesortstates; + brinshared->pagesPerRange = buildstate->bs_pagesPerRange; + ConditionVariableInit(&brinshared->workersdonecv); + SpinLockInit(&brinshared->mutex); + + /* Initialize mutable state */ + brinshared->nparticipantsdone = 0; + brinshared->reltuples = 0.0; + brinshared->indtuples = 0.0; + + table_parallelscan_initialize(heap, + ParallelTableScanFromBrinShared(brinshared), + snapshot, brinshared->pagesPerRange); + + /* + * Store shared tuplesort-private state, for which we reserved space. + * Then, initialize opaque state using tuplesort routine. + */ + sharedsort = (Sharedsort *) shm_toc_allocate(pcxt->toc, estsort); + tuplesort_initialize_shared(sharedsort, scantuplesortstates, + pcxt->seg); + + /* + * Store shared tuplesort-private state, for which we reserved space. + * Then, initialize opaque state using tuplesort routine. + */ + shm_toc_insert(pcxt->toc, PARALLEL_KEY_BRIN_SHARED, brinshared); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_TUPLESORT, sharedsort); + + /* Store query string for workers */ + if (debug_query_string) + { + char *sharedquery; + + sharedquery = (char *) shm_toc_allocate(pcxt->toc, querylen + 1); + memcpy(sharedquery, debug_query_string, querylen + 1); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_QUERY_TEXT, sharedquery); + } + + /* + * Allocate space for each worker's WalUsage and BufferUsage; no need to + * initialize. + */ + walusage = shm_toc_allocate(pcxt->toc, + mul_size(sizeof(WalUsage), pcxt->nworkers)); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_WAL_USAGE, walusage); + bufferusage = shm_toc_allocate(pcxt->toc, + mul_size(sizeof(BufferUsage), pcxt->nworkers)); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_BUFFER_USAGE, bufferusage); + + /* Launch workers, saving status for leader/caller */ + LaunchParallelWorkers(pcxt); + brinleader->pcxt = pcxt; + brinleader->nparticipanttuplesorts = pcxt->nworkers_launched; + if (leaderparticipates) + brinleader->nparticipanttuplesorts++; + brinleader->brinshared = brinshared; + brinleader->sharedsort = sharedsort; + brinleader->snapshot = snapshot; + brinleader->walusage = walusage; + brinleader->bufferusage = bufferusage; + + /* If no workers were successfully launched, back out (do serial build) */ + if (pcxt->nworkers_launched == 0) + { + _brin_end_parallel(brinleader, NULL); + return; + } + + /* Save leader state now that it's clear build will be parallel */ + buildstate->bs_leader = brinleader; + + /* Join heap scan ourselves */ + if (leaderparticipates) + _brin_leader_participate_as_worker(buildstate, heap, index); + + /* + * Caller needs to wait for all launched workers when we return. Make + * sure that the failure-to-start case will not hang forever. + */ + WaitForParallelWorkersToAttach(pcxt); +} + +/* + * Shut down workers, destroy parallel context, and end parallel mode. + */ +static void +_brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) +{ + int i; + BrinTuple *btup; + Size tuplen; + BrinShared *brinshared = brinleader->brinshared; + BlockNumber prevblkno = InvalidBlockNumber; + BrinTuple *emptyTuple = NULL; + Size emptySize; + + /* Shutdown worker processes */ + WaitForParallelWorkersToFinish(brinleader->pcxt); + + if (!state) + return; + + /* copy the data into leader state (we have to wait for the workers ) */ + state->bs_reltuples = brinshared->reltuples; + state->bs_numtuples = brinshared->indtuples; + + tuplesort_performsort(state->bs_spool_out->sortstate); + + /* + * Read the BRIN tuples from the shared tuplesort, sorted by block number. + * That probably gives us an index that is cheaper to scan, thanks to mostly + * getting data from the same index page as before. + * + * FIXME This probably needs some memory management fixes - we're reading + * tuples from the tuplesort, we're allocating an emty tuple, and so on. + * Probably better to release this memory. + * + * XXX We can't quite free the BrinTuple, though, because that's a field + * in BrinSortTuple. + */ + while ((btup = tuplesort_getbrintuple(state->bs_spool_out->sortstate, &tuplen, true)) != NULL) + { + /* + * We should not get two summaries for the same range. The workers + * are producing ranges for non-overlapping sections of the table. + */ + Assert(btup->bt_blkno != prevblkno); + + /* Ranges should be multiples of pages_per_range for the index. */ + Assert(btup->bt_blkno % brinshared->pagesPerRange == 0); + + /* Fill empty ranges for all ranges missing in the tuplesort. */ + prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; + while (prevblkno + state->bs_pagesPerRange < btup->bt_blkno) + { + /* the missing range */ + prevblkno += state->bs_pagesPerRange; + + /* Did we already build the empty range? If not, do it now. */ + if (emptyTuple == NULL) + { + BrinMemTuple *dtuple = brin_new_memtuple(state->bs_bdesc); + + emptyTuple = brin_form_tuple(state->bs_bdesc, prevblkno, dtuple, &emptySize); + } + else + { + /* we already have am "empty range" tuple, just set the block */ + emptyTuple->bt_blkno = prevblkno; + } + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, + emptyTuple->bt_blkno, emptyTuple, emptySize); + } + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, btup->bt_blkno, btup, tuplen); + + prevblkno = btup->bt_blkno; + } + + tuplesort_end(state->bs_spool_out->sortstate); + + /* + * Next, accumulate WAL usage. (This must wait for the workers to finish, + * or we might get incomplete data.) + */ + for (i = 0; i < brinleader->pcxt->nworkers_launched; i++) + InstrAccumParallelQuery(&brinleader->bufferusage[i], &brinleader->walusage[i]); + + /* Free last reference to MVCC snapshot, if one was used */ + if (IsMVCCSnapshot(brinleader->snapshot)) + UnregisterSnapshot(brinleader->snapshot); + DestroyParallelContext(brinleader->pcxt); + ExitParallelMode(); +} + +/* + * Returns size of shared memory required to store state for a parallel + * brin index build based on the snapshot its parallel scan will use. + */ +static Size +_brin_parallel_estimate_shared(Relation heap, Snapshot snapshot) +{ + /* c.f. shm_toc_allocate as to why BUFFERALIGN is used */ + return add_size(BUFFERALIGN(sizeof(BrinShared)), + table_parallelscan_estimate(heap, snapshot)); +} + +/* + * Within leader, participate as a parallel worker. + */ +static void +_brin_leader_participate_as_worker(BrinBuildState *buildstate, Relation heap, Relation index) +{ + BrinLeader *brinleader = buildstate->bs_leader; + int sortmem; + + /* Allocate memory and initialize private spool */ + buildstate->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + buildstate->bs_spool->heap = buildstate->bs_spool->heap; + buildstate->bs_spool->index = buildstate->bs_spool->index; + + /* + * Might as well use reliable figure when doling out maintenance_work_mem + * (when requested number of workers were not launched, this will be + * somewhat higher than it is for other workers). + */ + sortmem = maintenance_work_mem / brinleader->nparticipanttuplesorts; + + /* Perform work common to all participants */ + _brin_parallel_scan_and_build(buildstate, buildstate->bs_spool, brinleader->brinshared, + brinleader->sharedsort, heap, index, sortmem, true); +} + +/* + * Perform a worker's portion of a parallel sort. + * + * This generates a tuplesort for passed btspool, and a second tuplesort + * state if a second btspool is need (i.e. for unique index builds). All + * other spool fields should already be set when this is called. + * + * sortmem is the amount of working memory to use within each worker, + * expressed in KBs. + * + * When this returns, workers are done, and need only release resources. + */ +static void +_brin_parallel_scan_and_build(BrinBuildState *state, BrinSpool *brinspool, + BrinShared *brinshared, Sharedsort *sharedsort, + Relation heap, Relation index, int sortmem, + bool progress) +{ + SortCoordinate coordinate; + TableScanDesc scan; + double reltuples; + IndexInfo *indexInfo; + + /* Initialize local tuplesort coordination state */ + coordinate = palloc0(sizeof(SortCoordinateData)); + coordinate->isWorker = true; + coordinate->nParticipants = -1; + coordinate->sharedsort = sharedsort; + + /* Begin "partial" tuplesort */ + brinspool->sortstate = tuplesort_begin_index_brin(brinspool->heap, + brinspool->index, + sortmem, coordinate, + TUPLESORT_NONE); + + /* Join parallel scan */ + indexInfo = BuildIndexInfo(index); + indexInfo->ii_Concurrent = brinshared->isconcurrent; + + scan = table_beginscan_parallel(heap, + ParallelTableScanFromBrinShared(brinshared)); + + reltuples = table_index_build_scan(heap, index, indexInfo, true, true, + brinbuildCallbackParallel, state, scan); + + /* insert the last item */ + form_and_spill_tuple(state); + + /* sort the BRIN ranges built by this worker */ + tuplesort_performsort(brinspool->sortstate); + + state->bs_reltuples += reltuples; + + /* + * Done. Record ambuild statistics. + */ + SpinLockAcquire(&brinshared->mutex); + brinshared->nparticipantsdone++; + brinshared->reltuples += state->bs_reltuples; + brinshared->indtuples += state->bs_numtuples; + SpinLockRelease(&brinshared->mutex); + + /* Notify leader */ + ConditionVariableSignal(&brinshared->workersdonecv); + + tuplesort_end(brinspool->sortstate); +} + +/* + * Perform work within a launched parallel process. + */ +void +_brin_parallel_build_main(dsm_segment *seg, shm_toc *toc) +{ + char *sharedquery; + BrinShared *brinshared; + Sharedsort *sharedsort; + BrinBuildState *buildstate; + Relation heapRel; + Relation indexRel; + LOCKMODE heapLockmode; + LOCKMODE indexLockmode; + WalUsage *walusage; + BufferUsage *bufferusage; + int sortmem; + + /* + * The only possible status flag that can be set to the parallel worker is + * PROC_IN_SAFE_IC. + */ + Assert((MyProc->statusFlags == 0) || + (MyProc->statusFlags == PROC_IN_SAFE_IC)); + + /* Set debug_query_string for individual workers first */ + sharedquery = shm_toc_lookup(toc, PARALLEL_KEY_QUERY_TEXT, true); + debug_query_string = sharedquery; + + /* Report the query string from leader */ + pgstat_report_activity(STATE_RUNNING, debug_query_string); + + /* Look up brin shared state */ + brinshared = shm_toc_lookup(toc, PARALLEL_KEY_BRIN_SHARED, false); + + /* Open relations using lock modes known to be obtained by index.c */ + if (!brinshared->isconcurrent) + { + heapLockmode = ShareLock; + indexLockmode = AccessExclusiveLock; + } + else + { + heapLockmode = ShareUpdateExclusiveLock; + indexLockmode = RowExclusiveLock; + } + + /* Open relations within worker */ + heapRel = table_open(brinshared->heaprelid, heapLockmode); + indexRel = index_open(brinshared->indexrelid, indexLockmode); + + buildstate = initialize_brin_buildstate(indexRel, NULL, brinshared->pagesPerRange); + + /* Initialize worker's own spool */ + buildstate->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + buildstate->bs_spool->heap = heapRel; + buildstate->bs_spool->index = indexRel; + + /* Look up shared state private to tuplesort.c */ + sharedsort = shm_toc_lookup(toc, PARALLEL_KEY_TUPLESORT, false); + tuplesort_attach_shared(sharedsort, seg); + + /* Prepare to track buffer usage during parallel execution */ + InstrStartParallelQuery(); + + /* + * Might as well use reliable figure when doling out maintenance_work_mem + * (when requested number of workers were not launched, this will be + * somewhat higher than it is for other workers). + */ + sortmem = maintenance_work_mem / brinshared->scantuplesortstates; + + _brin_parallel_scan_and_build(buildstate, buildstate->bs_spool, + brinshared, sharedsort, + heapRel, indexRel, sortmem, false); + + /* Report WAL/buffer usage during parallel execution */ + bufferusage = shm_toc_lookup(toc, PARALLEL_KEY_BUFFER_USAGE, false); + walusage = shm_toc_lookup(toc, PARALLEL_KEY_WAL_USAGE, false); + InstrEndParallelQuery(&bufferusage[ParallelWorkerNumber], + &walusage[ParallelWorkerNumber]); + + index_close(indexRel, indexLockmode); + table_close(heapRel, heapLockmode); +} diff --git a/src/backend/access/nbtree/nbtsort.c b/src/backend/access/nbtree/nbtsort.c index c2665fce411..6241baeea86 100644 --- a/src/backend/access/nbtree/nbtsort.c +++ b/src/backend/access/nbtree/nbtsort.c @@ -1575,7 +1575,7 @@ _bt_begin_parallel(BTBuildState *buildstate, bool isconcurrent, int request) btshared->brokenhotchain = false; table_parallelscan_initialize(btspool->heap, ParallelTableScanFromBTShared(btshared), - snapshot); + snapshot, InvalidBlockNumber); /* * Store shared tuplesort-private state, for which we reserved space. diff --git a/src/backend/access/table/tableam.c b/src/backend/access/table/tableam.c index c6bdb7e1c68..4af0d433e9d 100644 --- a/src/backend/access/table/tableam.c +++ b/src/backend/access/table/tableam.c @@ -153,9 +153,9 @@ table_parallelscan_estimate(Relation rel, Snapshot snapshot) void table_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan, - Snapshot snapshot) + Snapshot snapshot, BlockNumber chunk_factor) { - Size snapshot_off = rel->rd_tableam->parallelscan_initialize(rel, pscan); + Size snapshot_off = rel->rd_tableam->parallelscan_initialize(rel, pscan, chunk_factor); pscan->phs_snapshot_off = snapshot_off; @@ -395,16 +395,21 @@ table_block_parallelscan_estimate(Relation rel) } Size -table_block_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan) +table_block_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan, BlockNumber chunk_factor) { ParallelBlockTableScanDesc bpscan = (ParallelBlockTableScanDesc) pscan; bpscan->base.phs_relid = RelationGetRelid(rel); bpscan->phs_nblocks = RelationGetNumberOfBlocks(rel); - /* compare phs_syncscan initialization to similar logic in initscan */ + bpscan->phs_chunk_factor = chunk_factor; + /* compare phs_syncscan initialization to similar logic in initscan + * + * Disable sync scans if the chunk factor is set (valid block number). + */ bpscan->base.phs_syncscan = synchronize_seqscans && !RelationUsesLocalBuffers(rel) && - bpscan->phs_nblocks > NBuffers / 4; + (bpscan->phs_nblocks > NBuffers / 4) && + !BlockNumberIsValid(bpscan->phs_chunk_factor); SpinLockInit(&bpscan->phs_mutex); bpscan->phs_startblock = InvalidBlockNumber; pg_atomic_init_u64(&bpscan->phs_nallocated, 0); @@ -459,6 +464,25 @@ table_block_parallelscan_startblock_init(Relation rel, pbscanwork->phsw_chunk_size = Min(pbscanwork->phsw_chunk_size, PARALLEL_SEQSCAN_MAX_CHUNK_SIZE); + /* + * If the chunk size factor is set, we need to make sure the chunk size is + * a multiple of that value. We round the chunk size to the nearest chunk + * factor multiple, at least one chunk_factor. + * + * XXX Note this may override PARALLEL_SEQSCAN_MAX_CHUNK_SIZE, in case the + * chunk factor (e.g. BRIN pages_per_range) is larger. + */ + if (pbscan->phs_chunk_factor != InvalidBlockNumber) + { + /* nearest (smaller) multiple of chunk_factor */ + pbscanwork->phsw_chunk_size + = pbscan->phs_chunk_factor * (pbscanwork->phsw_chunk_size / pbscan->phs_chunk_factor); + + /* but at least one chunk_factor */ + pbscanwork->phsw_chunk_size = Max(pbscanwork->phsw_chunk_size, + pbscan->phs_chunk_factor); + } + retry: /* Grab the spinlock. */ SpinLockAcquire(&pbscan->phs_mutex); @@ -575,6 +599,21 @@ table_block_parallelscan_nextpage(Relation rel, (pbscanwork->phsw_chunk_size * PARALLEL_SEQSCAN_RAMPDOWN_CHUNKS)) pbscanwork->phsw_chunk_size >>= 1; + /* + * We need to make sure the new chunk_size is still a suitable multiple + * of chunk_factor. + */ + if (pbscan->phs_chunk_factor != InvalidBlockNumber) + { + /* nearest (smaller) multiple of chunk_factor */ + pbscanwork->phsw_chunk_size + = pbscan->phs_chunk_factor * (pbscanwork->phsw_chunk_size / pbscan->phs_chunk_factor); + + /* but at least one chunk_factor */ + pbscanwork->phsw_chunk_size = Max(pbscanwork->phsw_chunk_size, + pbscan->phs_chunk_factor); + } + nallocated = pbscanwork->phsw_nallocated = pg_atomic_fetch_add_u64(&pbscan->phs_nallocated, pbscanwork->phsw_chunk_size); diff --git a/src/backend/access/transam/parallel.c b/src/backend/access/transam/parallel.c index 194a1207be6..d78314062e0 100644 --- a/src/backend/access/transam/parallel.c +++ b/src/backend/access/transam/parallel.c @@ -14,6 +14,7 @@ #include "postgres.h" +#include "access/brin.h" #include "access/nbtree.h" #include "access/parallel.h" #include "access/session.h" @@ -145,6 +146,9 @@ static const struct { "_bt_parallel_build_main", _bt_parallel_build_main }, + { + "_brin_parallel_build_main", _brin_parallel_build_main + }, { "parallel_vacuum_main", parallel_vacuum_main } diff --git a/src/backend/catalog/index.c b/src/backend/catalog/index.c index 143fae01ebd..37e4305d50a 100644 --- a/src/backend/catalog/index.c +++ b/src/backend/catalog/index.c @@ -2982,7 +2982,8 @@ index_build(Relation heapRelation, * Note that planner considers parallel safety for us. */ if (parallel && IsNormalProcessingMode() && - indexRelation->rd_rel->relam == BTREE_AM_OID) + (indexRelation->rd_rel->relam == BTREE_AM_OID || + indexRelation->rd_rel->relam == BRIN_AM_OID)) indexInfo->ii_ParallelWorkers = plan_create_index_workers(RelationGetRelid(heapRelation), RelationGetRelid(indexRelation)); diff --git a/src/backend/executor/nodeSeqscan.c b/src/backend/executor/nodeSeqscan.c index 49a5933aff6..529a7ed3284 100644 --- a/src/backend/executor/nodeSeqscan.c +++ b/src/backend/executor/nodeSeqscan.c @@ -262,7 +262,8 @@ ExecSeqScanInitializeDSM(SeqScanState *node, pscan = shm_toc_allocate(pcxt->toc, node->pscan_len); table_parallelscan_initialize(node->ss.ss_currentRelation, pscan, - estate->es_snapshot); + estate->es_snapshot, + InvalidBlockNumber); shm_toc_insert(pcxt->toc, node->ss.ps.plan->plan_node_id, pscan); node->ss.ss_currentScanDesc = table_beginscan_parallel(node->ss.ss_currentRelation, pscan); diff --git a/src/backend/utils/sort/tuplesort.c b/src/backend/utils/sort/tuplesort.c index ab6353bdcd1..4c6b396a8a8 100644 --- a/src/backend/utils/sort/tuplesort.c +++ b/src/backend/utils/sort/tuplesort.c @@ -1328,6 +1328,7 @@ tuplesort_puttuple_common(Tuplesortstate *state, SortTuple *tuple, bool useAbbre break; default: + Assert(false); elog(ERROR, "invalid tuplesort state"); break; } @@ -1462,6 +1463,7 @@ tuplesort_performsort(Tuplesortstate *state) break; default: + Assert(false); elog(ERROR, "invalid tuplesort state"); break; } @@ -1718,6 +1720,7 @@ tuplesort_gettuple_common(Tuplesortstate *state, bool forward, return false; default: + Assert(false); elog(ERROR, "invalid tuplesort state"); return false; /* keep compiler quiet */ } diff --git a/src/backend/utils/sort/tuplesortvariants.c b/src/backend/utils/sort/tuplesortvariants.c index 2cd508e5130..343ed4bbc54 100644 --- a/src/backend/utils/sort/tuplesortvariants.c +++ b/src/backend/utils/sort/tuplesortvariants.c @@ -19,6 +19,7 @@ #include "postgres.h" +#include "access/brin_tuple.h" #include "access/hash.h" #include "access/htup_details.h" #include "access/nbtree.h" @@ -43,6 +44,8 @@ static void removeabbrev_cluster(Tuplesortstate *state, SortTuple *stups, int count); static void removeabbrev_index(Tuplesortstate *state, SortTuple *stups, int count); +static void removeabbrev_index_brin(Tuplesortstate *state, SortTuple *stups, + int count); static void removeabbrev_datum(Tuplesortstate *state, SortTuple *stups, int count); static int comparetup_heap(const SortTuple *a, const SortTuple *b, @@ -69,10 +72,16 @@ static int comparetup_index_hash(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); static int comparetup_index_hash_tiebreak(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); +static int comparetup_index_brin(const SortTuple *a, const SortTuple *b, + Tuplesortstate *state); static void writetup_index(Tuplesortstate *state, LogicalTape *tape, SortTuple *stup); static void readtup_index(Tuplesortstate *state, SortTuple *stup, LogicalTape *tape, unsigned int len); +static void writetup_index_brin(Tuplesortstate *state, LogicalTape *tape, + SortTuple *stup); +static void readtup_index_brin(Tuplesortstate *state, SortTuple *stup, + LogicalTape *tape, unsigned int len); static int comparetup_datum(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); static int comparetup_datum_tiebreak(const SortTuple *a, const SortTuple *b, @@ -128,6 +137,16 @@ typedef struct uint32 max_buckets; } TuplesortIndexHashArg; +/* + * Data struture pointed by "TuplesortPublic.arg" for the index_brin subcase. + */ +typedef struct +{ + TuplesortIndexArg index; + + /* XXX do we need something here? */ +} TuplesortIndexBrinArg; + /* * Data struture pointed by "TuplesortPublic.arg" for the Datum case. * Set by tuplesort_begin_datum and used only by the DatumTuple routines. @@ -140,6 +159,22 @@ typedef struct int datumTypeLen; } TuplesortDatumArg; +/* + * Computing BrinTuple size with only the tuple is difficult, so we want to track + * the length for r referenced by SortTuple. That's what BrinSortTuple is meant + * to do - it's essentially a BrinTuple prefixed by length. We only write the + * BrinTuple to the logtapes, though. + */ +typedef struct BrinSortTuple +{ + Size tuplen; + BrinTuple tuple; +} BrinSortTuple; + +/* Size of the BrinSortTuple, given length of the BrinTuple. */ +#define BRINSORTTUPLE_SIZE(len) (offsetof(BrinSortTuple, tuple) + (len)) + + Tuplesortstate * tuplesort_begin_heap(TupleDesc tupDesc, int nkeys, AttrNumber *attNums, @@ -527,6 +562,47 @@ tuplesort_begin_index_gist(Relation heapRel, return state; } +Tuplesortstate * +tuplesort_begin_index_brin(Relation heapRel, + Relation indexRel, + int workMem, + SortCoordinate coordinate, + int sortopt) +{ + Tuplesortstate *state = tuplesort_begin_common(workMem, coordinate, + sortopt); + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext; + TuplesortIndexBrinArg *arg; + + oldcontext = MemoryContextSwitchTo(base->maincontext); + arg = (TuplesortIndexBrinArg *) palloc(sizeof(TuplesortIndexBrinArg)); + +#ifdef TRACE_SORT + if (trace_sort) + elog(LOG, + "begin index sort: workMem = %d, randomAccess = %c", + workMem, + sortopt & TUPLESORT_RANDOMACCESS ? 't' : 'f'); +#endif + + base->nKeys = 1; /* Only one sort column, the block number */ + + base->removeabbrev = removeabbrev_index_brin; + base->comparetup = comparetup_index_brin; + base->writetup = writetup_index_brin; + base->readtup = readtup_index_brin; + base->haveDatum1 = true; + base->arg = arg; + + arg->index.heapRel = heapRel; + arg->index.indexRel = indexRel; + + MemoryContextSwitchTo(oldcontext); + + return state; +} + Tuplesortstate * tuplesort_begin_datum(Oid datumType, Oid sortOperator, Oid sortCollation, bool nullsFirstFlag, int workMem, @@ -707,6 +783,35 @@ tuplesort_putindextuplevalues(Tuplesortstate *state, Relation rel, !stup.isnull1); } +/* + * Collect one BRIN tuple while collecting input data for sort. + */ +void +tuplesort_putbrintuple(Tuplesortstate *state, BrinTuple *tuple, Size size) +{ + SortTuple stup; + BrinSortTuple *bstup; + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext = MemoryContextSwitchTo(base->tuplecontext); + + /* allocate space for the whole BRIN sort tuple */ + bstup = palloc(BRINSORTTUPLE_SIZE(size)); + stup.tuple = bstup; + + bstup->tuplen = size; + memcpy(&bstup->tuple, tuple, size); + + stup.datum1 = tuple->bt_blkno; + stup.isnull1 = false; + + tuplesort_puttuple_common(state, &stup, + base->sortKeys && + base->sortKeys->abbrev_converter && + !stup.isnull1); + + MemoryContextSwitchTo(oldcontext); +} + /* * Accept one Datum while collecting input data for sort. * @@ -850,6 +955,35 @@ tuplesort_getindextuple(Tuplesortstate *state, bool forward) return (IndexTuple) stup.tuple; } +/* + * Fetch the next BRIN tuple in either forward or back direction. + * Returns NULL if no more tuples. Returned tuple belongs to tuplesort memory + * context, and must not be freed by caller. Caller may not rely on tuple + * remaining valid after any further manipulation of tuplesort. + */ +BrinTuple * +tuplesort_getbrintuple(Tuplesortstate *state, Size *len, bool forward) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext = MemoryContextSwitchTo(base->sortcontext); + SortTuple stup; + BrinSortTuple *btup; + + if (!tuplesort_gettuple_common(state, forward, &stup)) + stup.tuple = NULL; + + MemoryContextSwitchTo(oldcontext); + + if (!stup.tuple) + return NULL; + + btup = (BrinSortTuple *) stup.tuple; + + *len = btup->tuplen; + + return &btup->tuple; +} + /* * Fetch the next Datum in either forward or back direction. * Returns false if no more datums. @@ -1564,6 +1698,83 @@ readtup_index(Tuplesortstate *state, SortTuple *stup, &stup->isnull1); } +/* + * Routines specialized for BrinTuple case + */ + +static void +removeabbrev_index_brin(Tuplesortstate *state, SortTuple *stups, int count) +{ + int i; + + for (i = 0; i < count; i++) + { + BrinSortTuple *tuple; + + tuple = stups[i].tuple; + stups[i].datum1 = tuple->tuple.bt_blkno; + } +} + +static int +comparetup_index_brin(const SortTuple *a, const SortTuple *b, + Tuplesortstate *state) +{ + BrinTuple *tuple1; + BrinTuple *tuple2; + + tuple1 = &((BrinSortTuple *) a)->tuple; + tuple2 = &((BrinSortTuple *) b)->tuple; + + if (tuple1->bt_blkno > tuple2->bt_blkno) + return 1; + else if (tuple1->bt_blkno < tuple2->bt_blkno) + return -1; + + /* silence compilers */ + return 0; +} + +static void +writetup_index_brin(Tuplesortstate *state, LogicalTape *tape, SortTuple *stup) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + BrinSortTuple *tuple = (BrinSortTuple *) stup->tuple; + unsigned int tuplen = tuple->tuplen; + + tuplen = tuplen + sizeof(tuplen); + LogicalTapeWrite(tape, &tuplen, sizeof(tuplen)); + LogicalTapeWrite(tape, &tuple->tuple, tuple->tuplen); + if (base->sortopt & TUPLESORT_RANDOMACCESS) /* need trailing length word? */ + LogicalTapeWrite(tape, &tuplen, sizeof(tuplen)); +} + +static void +readtup_index_brin(Tuplesortstate *state, SortTuple *stup, + LogicalTape *tape, unsigned int len) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + unsigned int tuplen = len - sizeof(unsigned int); + + /* + * Allocate space for the BRIN sort tuple, which is BrinTuple with an + * extra length field. + */ + BrinSortTuple *tuple + = (BrinSortTuple *) tuplesort_readtup_alloc(state, + BRINSORTTUPLE_SIZE(tuplen)); + + tuple->tuplen = tuplen; + + LogicalTapeReadExact(tape, &tuple->tuple, tuplen); + if (base->sortopt & TUPLESORT_RANDOMACCESS) /* need trailing length word? */ + LogicalTapeReadExact(tape, &tuplen, sizeof(tuplen)); + stup->tuple = (void *) tuple; + + /* set up first-column key value, which is block number */ + stup->datum1 = tuple->tuple.bt_blkno; +} + /* * Routines specialized for DatumTuple case */ diff --git a/src/include/access/brin.h b/src/include/access/brin.h index ed66f1b3d51..3451ecb211f 100644 --- a/src/include/access/brin.h +++ b/src/include/access/brin.h @@ -11,6 +11,7 @@ #define BRIN_H #include "nodes/execnodes.h" +#include "storage/shm_toc.h" #include "utils/relcache.h" @@ -52,4 +53,6 @@ typedef struct BrinStatsData extern void brinGetStats(Relation index, BrinStatsData *stats); +extern void _brin_parallel_build_main(dsm_segment *seg, shm_toc *toc); + #endif /* BRIN_H */ diff --git a/src/include/access/relscan.h b/src/include/access/relscan.h index d03360eac04..72a20d882f5 100644 --- a/src/include/access/relscan.h +++ b/src/include/access/relscan.h @@ -79,6 +79,7 @@ typedef struct ParallelBlockTableScanDescData BlockNumber phs_nblocks; /* # blocks in relation at start of scan */ slock_t phs_mutex; /* mutual exclusion for setting startblock */ BlockNumber phs_startblock; /* starting block number */ + BlockNumber phs_chunk_factor; /* chunks need to be a multiple of this */ pg_atomic_uint64 phs_nallocated; /* number of blocks allocated to * workers so far. */ } ParallelBlockTableScanDescData; diff --git a/src/include/access/tableam.h b/src/include/access/tableam.h index dbb709b56ce..d94e4d32aa1 100644 --- a/src/include/access/tableam.h +++ b/src/include/access/tableam.h @@ -390,7 +390,8 @@ typedef struct TableAmRoutine * relation. */ Size (*parallelscan_initialize) (Relation rel, - ParallelTableScanDesc pscan); + ParallelTableScanDesc pscan, + BlockNumber chunk_factor); /* * Reinitialize `pscan` for a new scan. `rel` will be the same relation as @@ -1148,7 +1149,8 @@ extern Size table_parallelscan_estimate(Relation rel, Snapshot snapshot); */ extern void table_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan, - Snapshot snapshot); + Snapshot snapshot, + BlockNumber chunk_factor); /* * Begin a parallel scan. `pscan` needs to have been initialized with @@ -2064,7 +2066,8 @@ extern void simple_table_tuple_update(Relation rel, ItemPointer otid, extern Size table_block_parallelscan_estimate(Relation rel); extern Size table_block_parallelscan_initialize(Relation rel, - ParallelTableScanDesc pscan); + ParallelTableScanDesc pscan, + BlockNumber chunk_factor); extern void table_block_parallelscan_reinitialize(Relation rel, ParallelTableScanDesc pscan); extern BlockNumber table_block_parallelscan_nextpage(Relation rel, diff --git a/src/include/utils/tuplesort.h b/src/include/utils/tuplesort.h index 9ed2de76cd6..357eb35311d 100644 --- a/src/include/utils/tuplesort.h +++ b/src/include/utils/tuplesort.h @@ -21,6 +21,7 @@ #ifndef TUPLESORT_H #define TUPLESORT_H +#include "access/brin_tuple.h" #include "access/itup.h" #include "executor/tuptable.h" #include "storage/dsm.h" @@ -282,6 +283,9 @@ typedef struct * The "index_hash" API is similar to index_btree, but the tuples are * actually sorted by their hash codes not the raw data. * + * The "index_brin" API is similar to index_btree, but the tuples are + * BrinTuple and are sorted by their block number not the raw data. + * * Parallel sort callers are required to coordinate multiple tuplesort states * in a leader process and one or more worker processes. The leader process * must launch workers, and have each perform an independent "partial" @@ -426,6 +430,10 @@ extern Tuplesortstate *tuplesort_begin_index_gist(Relation heapRel, Relation indexRel, int workMem, SortCoordinate coordinate, int sortopt); +extern Tuplesortstate *tuplesort_begin_index_brin(Relation heapRel, + Relation indexRel, + int workMem, SortCoordinate coordinate, + int sortopt); extern Tuplesortstate *tuplesort_begin_datum(Oid datumType, Oid sortOperator, Oid sortCollation, bool nullsFirstFlag, @@ -438,6 +446,7 @@ extern void tuplesort_putheaptuple(Tuplesortstate *state, HeapTuple tup); extern void tuplesort_putindextuplevalues(Tuplesortstate *state, Relation rel, ItemPointer self, const Datum *values, const bool *isnull); +extern void tuplesort_putbrintuple(Tuplesortstate *state, BrinTuple *tup, Size len); extern void tuplesort_putdatum(Tuplesortstate *state, Datum val, bool isNull); @@ -445,6 +454,8 @@ extern bool tuplesort_gettupleslot(Tuplesortstate *state, bool forward, bool copy, TupleTableSlot *slot, Datum *abbrev); extern HeapTuple tuplesort_getheaptuple(Tuplesortstate *state, bool forward); extern IndexTuple tuplesort_getindextuple(Tuplesortstate *state, bool forward); +extern BrinTuple *tuplesort_getbrintuple(Tuplesortstate *state, Size *len, + bool forward); extern bool tuplesort_getdatum(Tuplesortstate *state, bool forward, bool copy, Datum *val, bool *isNull, Datum *abbrev); -- 2.41.0 [text/x-patch] v3-0002-fix-review-comments.patch (7.9K, ../../[email protected]/3-v3-0002-fix-review-comments.patch) download | inline diff: From dcb0058540f46fa5f9cbb21e1cff640874418401 Mon Sep 17 00:00:00 2001 From: Tomas Vondra <[email protected]> Date: Tue, 7 Nov 2023 18:15:20 +0100 Subject: [PATCH v3 2/4] fix review comments --- src/backend/access/brin/brin.c | 44 +++++++++------------- src/backend/utils/sort/tuplesort.c | 3 -- src/backend/utils/sort/tuplesortvariants.c | 11 +++--- 3 files changed, 23 insertions(+), 35 deletions(-) diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index b7cd29c5968..d54d39a535e 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -162,7 +162,7 @@ typedef struct BrinBuildState { Relation bs_irel; int bs_numtuples; - int bs_reltuples; + double bs_reltuples; Buffer bs_currentInsertBuf; BlockNumber bs_pagesPerRange; BlockNumber bs_currRangeStart; @@ -172,13 +172,12 @@ typedef struct BrinBuildState /* * bs_leader is only present when a parallel index build is performed, and - * only in the leader process. (Actually, only the leader has a + * only in the leader process. (Actually, only the leader process has a * BrinBuildState.) */ BrinLeader *bs_leader; int bs_worker_id; BrinSpool *bs_spool; - BrinSpool *bs_spool_out; } BrinBuildState; /* @@ -961,7 +960,7 @@ brinbuildCallback(Relation index, /* * A version of the callback, used by parallel index builds. The main difference * is that instead of writing the BRIN tuples into the index, we write them into - * a shared tuplestore file, and leave the insertion up to the leader (which may + * a shared tuplestore, and leave the insertion up to the leader (which may * reorder them a bit etc.). The callback also does not generate empty ranges, * those may be added by the leader when merging results from workers. */ @@ -981,10 +980,10 @@ brinbuildCallbackParallel(Relation index, /* * If we're in a block that belongs to a future range, summarize what * we've got and start afresh. Note the scan might have skipped many - * pages, if they were devoid of live tuples; make sure to insert index - * tuples for those too. + * pages, if they were devoid of live tuples; we do not create emptry + * BRIN ranges here - the leader is responsible for filling them in. */ - while (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) + if (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) { BRIN_elog((DEBUG2, @@ -996,19 +995,15 @@ brinbuildCallbackParallel(Relation index, form_and_spill_tuple(state); /* - * set state to correspond to the next range + * Set state to correspond to the next range (for this block). * - * XXX This has the issue that it skips ranges summarized by other - * workers, but it also skips empty ranges that should have been - * summarized. We'd need to either make the workers aware which - * chunk they are actually processing (which is currently known - * only in the ParallelBlockTableScan bit). Or we could ignore it - * here, and then decide it while "merging" results from workers - * (if there's no entry for the range, it had to be empty so we - * just add an empty one). + * This skips ranges that are either empty (and so we don't get any + * tuples to summarize), or processes by other workers. We can't + * differentiate those cases here easily, so we leave it up to the + * leader to fill empty ranges where needed. */ - while (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) - state->bs_currRangeStart += state->bs_pagesPerRange; + state->bs_currRangeStart + = state->bs_pagesPerRange * (thisblock / state->bs_pagesPerRange); /* re-initialize state for it */ brin_memtuple_initialize(state->bs_dtuple, state->bs_bdesc); @@ -1137,11 +1132,7 @@ brinbuild(Relation heap, Relation index, IndexInfo *indexInfo) * on the amount of memory used by a CREATE INDEX operation, regardless of * the use of parallelism or any other factor. */ - state->bs_spool_out = (BrinSpool *) palloc0(sizeof(BrinSpool)); - state->bs_spool_out->heap = heap; - state->bs_spool_out->index = index; - - state->bs_spool_out->sortstate = + state->bs_spool->sortstate = tuplesort_begin_index_brin(heap, index, maintenance_work_mem, coordinate, TUPLESORT_NONE); @@ -2427,6 +2418,7 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) BlockNumber prevblkno = InvalidBlockNumber; BrinTuple *emptyTuple = NULL; Size emptySize; + BrinSpool *spool = state->bs_spool; /* Shutdown worker processes */ WaitForParallelWorkersToFinish(brinleader->pcxt); @@ -2438,7 +2430,7 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) state->bs_reltuples = brinshared->reltuples; state->bs_numtuples = brinshared->indtuples; - tuplesort_performsort(state->bs_spool_out->sortstate); + tuplesort_performsort(spool->sortstate); /* * Read the BRIN tuples from the shared tuplesort, sorted by block number. @@ -2452,7 +2444,7 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) * XXX We can't quite free the BrinTuple, though, because that's a field * in BrinSortTuple. */ - while ((btup = tuplesort_getbrintuple(state->bs_spool_out->sortstate, &tuplen, true)) != NULL) + while ((btup = tuplesort_getbrintuple(spool->sortstate, &tuplen, true)) != NULL) { /* * We should not get two summaries for the same range. The workers @@ -2494,7 +2486,7 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) prevblkno = btup->bt_blkno; } - tuplesort_end(state->bs_spool_out->sortstate); + tuplesort_end(spool->sortstate); /* * Next, accumulate WAL usage. (This must wait for the workers to finish, diff --git a/src/backend/utils/sort/tuplesort.c b/src/backend/utils/sort/tuplesort.c index 4c6b396a8a8..ab6353bdcd1 100644 --- a/src/backend/utils/sort/tuplesort.c +++ b/src/backend/utils/sort/tuplesort.c @@ -1328,7 +1328,6 @@ tuplesort_puttuple_common(Tuplesortstate *state, SortTuple *tuple, bool useAbbre break; default: - Assert(false); elog(ERROR, "invalid tuplesort state"); break; } @@ -1463,7 +1462,6 @@ tuplesort_performsort(Tuplesortstate *state) break; default: - Assert(false); elog(ERROR, "invalid tuplesort state"); break; } @@ -1720,7 +1718,6 @@ tuplesort_gettuple_common(Tuplesortstate *state, bool forward, return false; default: - Assert(false); elog(ERROR, "invalid tuplesort state"); return false; /* keep compiler quiet */ } diff --git a/src/backend/utils/sort/tuplesortvariants.c b/src/backend/utils/sort/tuplesortvariants.c index 343ed4bbc54..525cc01b474 100644 --- a/src/backend/utils/sort/tuplesortvariants.c +++ b/src/backend/utils/sort/tuplesortvariants.c @@ -161,9 +161,8 @@ typedef struct /* * Computing BrinTuple size with only the tuple is difficult, so we want to track - * the length for r referenced by SortTuple. That's what BrinSortTuple is meant - * to do - it's essentially a BrinTuple prefixed by length. We only write the - * BrinTuple to the logtapes, though. + * the length referenced by the SortTuple. That's what BrinSortTuple is meant + * to do - it's essentially a BrinTuple prefixed by its length. */ typedef struct BrinSortTuple { @@ -796,11 +795,11 @@ tuplesort_putbrintuple(Tuplesortstate *state, BrinTuple *tuple, Size size) /* allocate space for the whole BRIN sort tuple */ bstup = palloc(BRINSORTTUPLE_SIZE(size)); - stup.tuple = bstup; bstup->tuplen = size; memcpy(&bstup->tuple, tuple, size); + stup.tuple = bstup; stup.datum1 = tuple->bt_blkno; stup.isnull1 = false; @@ -1723,8 +1722,8 @@ comparetup_index_brin(const SortTuple *a, const SortTuple *b, BrinTuple *tuple1; BrinTuple *tuple2; - tuple1 = &((BrinSortTuple *) a)->tuple; - tuple2 = &((BrinSortTuple *) b)->tuple; + tuple1 = &((BrinSortTuple *) (a->tuple))->tuple; + tuple2 = &((BrinSortTuple *) (b->tuple))->tuple; if (tuple1->bt_blkno > tuple2->bt_blkno) return 1; -- 2.41.0 [text/x-patch] v3-0003-simplify-comparetup_index_brin.patch (1.2K, ../../[email protected]/4-v3-0003-simplify-comparetup_index_brin.patch) download | inline diff: From f5a5bf18e3049e21f2b2cc62f7cab7fb892bf3a6 Mon Sep 17 00:00:00 2001 From: Tomas Vondra <[email protected]> Date: Tue, 7 Nov 2023 19:07:48 +0100 Subject: [PATCH v3 3/4] simplify comparetup_index_brin --- src/backend/utils/sort/tuplesortvariants.c | 11 ++++------- 1 file changed, 4 insertions(+), 7 deletions(-) diff --git a/src/backend/utils/sort/tuplesortvariants.c b/src/backend/utils/sort/tuplesortvariants.c index 525cc01b474..9b3a70e6ccf 100644 --- a/src/backend/utils/sort/tuplesortvariants.c +++ b/src/backend/utils/sort/tuplesortvariants.c @@ -1719,15 +1719,12 @@ static int comparetup_index_brin(const SortTuple *a, const SortTuple *b, Tuplesortstate *state) { - BrinTuple *tuple1; - BrinTuple *tuple2; + Assert(TuplesortstateGetPublic(state)->haveDatum1); - tuple1 = &((BrinSortTuple *) (a->tuple))->tuple; - tuple2 = &((BrinSortTuple *) (b->tuple))->tuple; - - if (tuple1->bt_blkno > tuple2->bt_blkno) + if (DatumGetUInt32(a->datum1) > DatumGetUInt32(b->datum1)) return 1; - else if (tuple1->bt_blkno < tuple2->bt_blkno) + + if (DatumGetUInt32(a->datum1) < DatumGetUInt32(b->datum1)) return -1; /* silence compilers */ -- 2.41.0 [text/x-patch] v3-0004-remove-tableam-changes.patch (13.2K, ../../[email protected]/5-v3-0004-remove-tableam-changes.patch) download | inline diff: From 7c9be5a2a71a0eead626c8f9ac248008bc6db3e9 Mon Sep 17 00:00:00 2001 From: Tomas Vondra <[email protected]> Date: Tue, 7 Nov 2023 20:02:03 +0100 Subject: [PATCH v3 4/4] remove tableam changes --- src/backend/access/brin/brin.c | 115 +++++++++++++++++++++++++--- src/backend/access/nbtree/nbtsort.c | 2 +- src/backend/access/table/tableam.c | 49 ++---------- src/backend/executor/nodeSeqscan.c | 3 +- src/include/access/relscan.h | 1 - src/include/access/tableam.h | 9 +-- 6 files changed, 115 insertions(+), 64 deletions(-) diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index d54d39a535e..daadd051e30 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -2334,7 +2334,7 @@ _brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, table_parallelscan_initialize(heap, ParallelTableScanFromBrinShared(brinshared), - snapshot, brinshared->pagesPerRange); + snapshot); /* * Store shared tuplesort-private state, for which we reserved space. @@ -2413,6 +2413,7 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) { int i; BrinTuple *btup; + BrinMemTuple *memtuple = NULL; Size tuplen; BrinShared *brinshared = brinleader->brinshared; BlockNumber prevblkno = InvalidBlockNumber; @@ -2432,13 +2433,19 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) tuplesort_performsort(spool->sortstate); + /* + * Initialize BrinMemTuple we'll use to union summaries from workers + * (in case they happened to produce parts of the same paga range). + */ + memtuple = brin_new_memtuple(state->bs_bdesc); + /* * Read the BRIN tuples from the shared tuplesort, sorted by block number. * That probably gives us an index that is cheaper to scan, thanks to mostly * getting data from the same index page as before. * * FIXME This probably needs some memory management fixes - we're reading - * tuples from the tuplesort, we're allocating an emty tuple, and so on. + * tuples from the tuplesort, we're allocating an empty tuple, and so on. * Probably better to release this memory. * * XXX We can't quite free the BrinTuple, though, because that's a field @@ -2446,14 +2453,65 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) */ while ((btup = tuplesort_getbrintuple(spool->sortstate, &tuplen, true)) != NULL) { + /* Ranges should be multiples of pages_per_range for the index. */ + Assert(btup->bt_blkno % brinshared->pagesPerRange == 0); + /* - * We should not get two summaries for the same range. The workers - * are producing ranges for non-overlapping sections of the table. + * Do we need to union summaries for the same page range? + * + * If this is the first brin tuple we read, then just deform it into + * the memtuple, and continue with the next one from tuplesort. We + * however may need to insert empty summaries into the index. + * + * If it's the same block as the last we saw, we simply union the + * brin tuple into it, and we're done - we don't even need to insert + * empty ranges, because that was done earlier when we saw the first + * brin tuple (for this range). + * + * Finally, if it's not the first brin tuple, and it's not the same + * page range, we need to do the insert and then deform the tuple + * into the memtuple. Then we'll insert empty ranges before the + * new brin tuple, if needed. */ - Assert(btup->bt_blkno != prevblkno); + if (prevblkno == InvalidBlockNumber) + { + /* First brin tuples, just deform into memtuple. */ + memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); - /* Ranges should be multiples of pages_per_range for the index. */ - Assert(btup->bt_blkno % brinshared->pagesPerRange == 0); + /* continue to insert empty pages before thisblock */ + } + else if (memtuple->bt_blkno == btup->bt_blkno) + { + /* + * Not the first brin tuple, but same page range as the previous + * one, so we can merge it into the memtuple. + */ + union_tuples(state->bs_bdesc, memtuple, btup); + continue; + } + else + { + BrinTuple *tmp; + Size len; + + /* + * We got brin tuple for a different page range, so form a brin + * tuple from the memtuple, insert it, and re-init the memtuple + * from the new brin tuple. + */ + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); + + /* free the formed on-disk tuple */ + pfree(tmp); + + memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); + + /* continue to insert empty pages before thisblock */ + } /* Fill empty ranges for all ranges missing in the tuplesort. */ prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; @@ -2480,14 +2538,51 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) emptyTuple->bt_blkno, emptyTuple, emptySize); } - brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, - &state->bs_currentInsertBuf, btup->bt_blkno, btup, tuplen); - prevblkno = btup->bt_blkno; } tuplesort_end(spool->sortstate); + /* Fill empty ranges for all ranges missing in the tuplesort. */ + prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; + while (prevblkno + state->bs_pagesPerRange < memtuple->bt_blkno) + { + /* the missing range */ + prevblkno += state->bs_pagesPerRange; + + /* Did we already build the empty range? If not, do it now. */ + if (emptyTuple == NULL) + { + BrinMemTuple *dtuple = brin_new_memtuple(state->bs_bdesc); + + emptyTuple = brin_form_tuple(state->bs_bdesc, prevblkno, dtuple, &emptySize); + } + else + { + /* we already have am "empty range" tuple, just set the block */ + emptyTuple->bt_blkno = prevblkno; + } + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, + emptyTuple->bt_blkno, emptyTuple, emptySize); + } + + /**/ + if (prevblkno != InvalidBlockNumber) + { + BrinTuple *tmp; + Size len; + + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); + + pfree(tmp); + } + /* * Next, accumulate WAL usage. (This must wait for the workers to finish, * or we might get incomplete data.) diff --git a/src/backend/access/nbtree/nbtsort.c b/src/backend/access/nbtree/nbtsort.c index 6241baeea86..c2665fce411 100644 --- a/src/backend/access/nbtree/nbtsort.c +++ b/src/backend/access/nbtree/nbtsort.c @@ -1575,7 +1575,7 @@ _bt_begin_parallel(BTBuildState *buildstate, bool isconcurrent, int request) btshared->brokenhotchain = false; table_parallelscan_initialize(btspool->heap, ParallelTableScanFromBTShared(btshared), - snapshot, InvalidBlockNumber); + snapshot); /* * Store shared tuplesort-private state, for which we reserved space. diff --git a/src/backend/access/table/tableam.c b/src/backend/access/table/tableam.c index 4af0d433e9d..c6bdb7e1c68 100644 --- a/src/backend/access/table/tableam.c +++ b/src/backend/access/table/tableam.c @@ -153,9 +153,9 @@ table_parallelscan_estimate(Relation rel, Snapshot snapshot) void table_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan, - Snapshot snapshot, BlockNumber chunk_factor) + Snapshot snapshot) { - Size snapshot_off = rel->rd_tableam->parallelscan_initialize(rel, pscan, chunk_factor); + Size snapshot_off = rel->rd_tableam->parallelscan_initialize(rel, pscan); pscan->phs_snapshot_off = snapshot_off; @@ -395,21 +395,16 @@ table_block_parallelscan_estimate(Relation rel) } Size -table_block_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan, BlockNumber chunk_factor) +table_block_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan) { ParallelBlockTableScanDesc bpscan = (ParallelBlockTableScanDesc) pscan; bpscan->base.phs_relid = RelationGetRelid(rel); bpscan->phs_nblocks = RelationGetNumberOfBlocks(rel); - bpscan->phs_chunk_factor = chunk_factor; - /* compare phs_syncscan initialization to similar logic in initscan - * - * Disable sync scans if the chunk factor is set (valid block number). - */ + /* compare phs_syncscan initialization to similar logic in initscan */ bpscan->base.phs_syncscan = synchronize_seqscans && !RelationUsesLocalBuffers(rel) && - (bpscan->phs_nblocks > NBuffers / 4) && - !BlockNumberIsValid(bpscan->phs_chunk_factor); + bpscan->phs_nblocks > NBuffers / 4; SpinLockInit(&bpscan->phs_mutex); bpscan->phs_startblock = InvalidBlockNumber; pg_atomic_init_u64(&bpscan->phs_nallocated, 0); @@ -464,25 +459,6 @@ table_block_parallelscan_startblock_init(Relation rel, pbscanwork->phsw_chunk_size = Min(pbscanwork->phsw_chunk_size, PARALLEL_SEQSCAN_MAX_CHUNK_SIZE); - /* - * If the chunk size factor is set, we need to make sure the chunk size is - * a multiple of that value. We round the chunk size to the nearest chunk - * factor multiple, at least one chunk_factor. - * - * XXX Note this may override PARALLEL_SEQSCAN_MAX_CHUNK_SIZE, in case the - * chunk factor (e.g. BRIN pages_per_range) is larger. - */ - if (pbscan->phs_chunk_factor != InvalidBlockNumber) - { - /* nearest (smaller) multiple of chunk_factor */ - pbscanwork->phsw_chunk_size - = pbscan->phs_chunk_factor * (pbscanwork->phsw_chunk_size / pbscan->phs_chunk_factor); - - /* but at least one chunk_factor */ - pbscanwork->phsw_chunk_size = Max(pbscanwork->phsw_chunk_size, - pbscan->phs_chunk_factor); - } - retry: /* Grab the spinlock. */ SpinLockAcquire(&pbscan->phs_mutex); @@ -599,21 +575,6 @@ table_block_parallelscan_nextpage(Relation rel, (pbscanwork->phsw_chunk_size * PARALLEL_SEQSCAN_RAMPDOWN_CHUNKS)) pbscanwork->phsw_chunk_size >>= 1; - /* - * We need to make sure the new chunk_size is still a suitable multiple - * of chunk_factor. - */ - if (pbscan->phs_chunk_factor != InvalidBlockNumber) - { - /* nearest (smaller) multiple of chunk_factor */ - pbscanwork->phsw_chunk_size - = pbscan->phs_chunk_factor * (pbscanwork->phsw_chunk_size / pbscan->phs_chunk_factor); - - /* but at least one chunk_factor */ - pbscanwork->phsw_chunk_size = Max(pbscanwork->phsw_chunk_size, - pbscan->phs_chunk_factor); - } - nallocated = pbscanwork->phsw_nallocated = pg_atomic_fetch_add_u64(&pbscan->phs_nallocated, pbscanwork->phsw_chunk_size); diff --git a/src/backend/executor/nodeSeqscan.c b/src/backend/executor/nodeSeqscan.c index 529a7ed3284..49a5933aff6 100644 --- a/src/backend/executor/nodeSeqscan.c +++ b/src/backend/executor/nodeSeqscan.c @@ -262,8 +262,7 @@ ExecSeqScanInitializeDSM(SeqScanState *node, pscan = shm_toc_allocate(pcxt->toc, node->pscan_len); table_parallelscan_initialize(node->ss.ss_currentRelation, pscan, - estate->es_snapshot, - InvalidBlockNumber); + estate->es_snapshot); shm_toc_insert(pcxt->toc, node->ss.ps.plan->plan_node_id, pscan); node->ss.ss_currentScanDesc = table_beginscan_parallel(node->ss.ss_currentRelation, pscan); diff --git a/src/include/access/relscan.h b/src/include/access/relscan.h index 72a20d882f5..d03360eac04 100644 --- a/src/include/access/relscan.h +++ b/src/include/access/relscan.h @@ -79,7 +79,6 @@ typedef struct ParallelBlockTableScanDescData BlockNumber phs_nblocks; /* # blocks in relation at start of scan */ slock_t phs_mutex; /* mutual exclusion for setting startblock */ BlockNumber phs_startblock; /* starting block number */ - BlockNumber phs_chunk_factor; /* chunks need to be a multiple of this */ pg_atomic_uint64 phs_nallocated; /* number of blocks allocated to * workers so far. */ } ParallelBlockTableScanDescData; diff --git a/src/include/access/tableam.h b/src/include/access/tableam.h index d94e4d32aa1..dbb709b56ce 100644 --- a/src/include/access/tableam.h +++ b/src/include/access/tableam.h @@ -390,8 +390,7 @@ typedef struct TableAmRoutine * relation. */ Size (*parallelscan_initialize) (Relation rel, - ParallelTableScanDesc pscan, - BlockNumber chunk_factor); + ParallelTableScanDesc pscan); /* * Reinitialize `pscan` for a new scan. `rel` will be the same relation as @@ -1149,8 +1148,7 @@ extern Size table_parallelscan_estimate(Relation rel, Snapshot snapshot); */ extern void table_parallelscan_initialize(Relation rel, ParallelTableScanDesc pscan, - Snapshot snapshot, - BlockNumber chunk_factor); + Snapshot snapshot); /* * Begin a parallel scan. `pscan` needs to have been initialized with @@ -2066,8 +2064,7 @@ extern void simple_table_tuple_update(Relation rel, ItemPointer otid, extern Size table_block_parallelscan_estimate(Relation rel); extern Size table_block_parallelscan_initialize(Relation rel, - ParallelTableScanDesc pscan, - BlockNumber chunk_factor); + ParallelTableScanDesc pscan); extern void table_block_parallelscan_reinitialize(Relation rel, ParallelTableScanDesc pscan); extern BlockNumber table_block_parallelscan_nextpage(Relation rel, -- 2.41.0 ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-12 09:38 Matthias van de Meent <[email protected]> parent: Tomas Vondra <[email protected]> 1 sibling, 1 reply; 25+ messages in thread From: Matthias van de Meent @ 2023-11-12 09:38 UTC (permalink / raw) To: Tomas Vondra <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On Wed, 8 Nov 2023 at 12:03, Tomas Vondra <[email protected]> wrote: > > Hi, > > here's an updated patch, addressing the review comments, and reworking > how the work is divided between the workers & leader etc. Thanks! > In general I'm quite happy with the current state, and I believe it's > fairly close to be committable. Are you planning on committing the patches separately, or squashed? I won't have much time this week for reviewing the patch, and it seems like these patches are incremental, so some guidance on what you want to be reviewed would be appreciated. Kind regards, Matthias van de Meent Neon (https://neon.tech) ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-12 10:01 Tomas Vondra <[email protected]> parent: Matthias van de Meent <[email protected]> 0 siblings, 0 replies; 25+ messages in thread From: Tomas Vondra @ 2023-11-12 10:01 UTC (permalink / raw) To: Matthias van de Meent <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On 11/12/23 10:38, Matthias van de Meent wrote: > On Wed, 8 Nov 2023 at 12:03, Tomas Vondra <[email protected]> wrote: >> >> Hi, >> >> here's an updated patch, addressing the review comments, and reworking >> how the work is divided between the workers & leader etc. > > Thanks! > >> In general I'm quite happy with the current state, and I believe it's >> fairly close to be committable. > > Are you planning on committing the patches separately, or squashed? I > won't have much time this week for reviewing the patch, and it seems > like these patches are incremental, so some guidance on what you want > to be reviewed would be appreciated. > Definitely squashed. I only kept them separate to make it more obvious what the changes are. If you need more time for a review, I can certainly wait. No rush. regards -- Tomas Vondra EnterpriseDB: http://www.enterprisedb.com The Enterprise PostgreSQL Company ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-20 19:48 Matthias van de Meent <[email protected]> parent: Tomas Vondra <[email protected]> 1 sibling, 1 reply; 25+ messages in thread From: Matthias van de Meent @ 2023-11-20 19:48 UTC (permalink / raw) To: Tomas Vondra <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On Wed, 8 Nov 2023 at 12:03, Tomas Vondra <[email protected]> wrote: > > Hi, > > here's an updated patch, addressing the review comments, and reworking > how the work is divided between the workers & leader etc. > > 0001 is just v2, rebased to current master > > 0002 and 0003 address most of the issues, in particular it > > - removes the unnecessary spool > - fixes bs_reltuples type to double > - a couple comments are reworded to be clearer > - changes loop/condition in brinbuildCallbackParallel > - removes asserts added for debugging > - fixes cast in comparetup_index_brin > - 0003 then simplifies comparetup_index_brin > - I haven't inlined the tuplesort_puttuple_common parameter > (didn't seem worth it) OK, thanks > 0004 Reworks how the work is divided between workers and combined by the > leader. It undoes the tableam.c changes that attempted to divide the > relation into chunks matching the BRIN ranges, and instead merges the > results in the leader (using the BRIN "union" function). That's OK. > I haven't done any indentation fixes yet. > > I did fairly extensive testing, using pageinspect to compare indexes > built with/without parallelism. More testing is needed, but it seems to > work fine (with other opclasses and so on). After code-only review, here are some comments: > +++ b/src/backend/access/brin/brin.c > [...] > +/* Magic numbers for parallel state sharing */ > +#define PARALLEL_KEY_BRIN_SHARED UINT64CONST(0xA000000000000001) > +#define PARALLEL_KEY_TUPLESORT UINT64CONST(0xA000000000000002) These shm keys use the same constants also in use in access/nbtree/nbtsort.c. While this shouldn't be an issue in normal operations, I'd prefer if we didn't actively introduce conflicting identifiers when we still have significant amounts of unused values remaining. > +#define PARALLEL_KEY_QUERY_TEXT UINT64CONST(0xA000000000000003) This is the fourth definition of a PARALLEL%_KEY_QUERY_TEXT, the others being in access/nbtree/nbtsort.c (value 0xA000000000000004, one more than brin's), backend/executor/execParallel.c (0xE000000000000008), and PARALLEL_VACUUM_KEY_QUERY_TEXT (0x3) (though I've not checked that their uses are exactly the same, I'd expect at least btree to match mostly, if not fully, 1:1). I think we could probably benefit from a less ad-hoc sharing of query texts. I don't think that needs to happen specifically in this patch, but I think it's something to keep in mind in future efforts. > +_brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) > [...] > + BrinSpool *spool = state->bs_spool; > [...] > + if (!state) > + return; I think the assignment to spool should be moved to below this condition, as _brin_begin_parallel calls this with state=NULL when it can't launch parallel workers, which will cause issues here. > + state->bs_numtuples = brinshared->indtuples; My IDE complains about bs_numtuples being an integer. This is a pre-existing issue, but still valid: we can hit an overflow on tables with pages_per_range=1 and relsize >= 2^31 pages. Extremely unlikely, but problematic nonetheless. > + * FIXME This probably needs some memory management fixes - we're reading > + * tuples from the tuplesort, we're allocating an emty tuple, and so on. > + * Probably better to release this memory. This should probably be resolved. I also noticed that this is likely to execute `union_tuples` many times when pages_per_range is coprime with the parallel table scan's block stride (or when we for other reasons have many tuples returned for each range); and this `union_tuples` internally allocates and deletes its own memory context for its deserialization of the 'b' tuple. I think we should just pass a scratch context instead, so that we don't have the overhead of continously creating then deleting the same memory context. > +++ b/src/backend/catalog/index.c > [...] > - indexRelation->rd_rel->relam == BTREE_AM_OID) > + (indexRelation->rd_rel->relam == BTREE_AM_OID || > + indexRelation->rd_rel->relam == BRIN_AM_OID)) I think this needs some more effort. I imagine a new IndexAmRoutine->amcanbuildparallel is more appropriate than this hard-coded list - external indexes may want to utilize the parallel index creation planner facility, too. Some notes: As a project PostgreSQL seems to be trying to move away from hardcoding heap into everything in favour of the more AM-agnostic 'table'. I suggest replacing all mentions of "heap" in the arguments with "table", to reduce the work future maintainers need to do to fix this. Even when this AM is mostly targetted towards the heap AM, other AMs (such as those I've heard of that were developed internally at EDB) use the same block-addressing that heap does, and should thus be compatible with BRIN. Thus, "heap" is not a useful name here. There are 2 new mentions of "tuplestore" in the patch, while the structure used is tuplesort: one on form_and_spill_tuple, and one on brinbuildCallbackParallel. Please update those comments. That's it for code review. I'll do some performance comparisons and testing soon, too. Kind regards, Matthias van de Meent Neon (https://neon.tech) ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-22 19:16 Tomas Vondra <[email protected]> parent: Matthias van de Meent <[email protected]> 0 siblings, 1 reply; 25+ messages in thread From: Tomas Vondra @ 2023-11-22 19:16 UTC (permalink / raw) To: Matthias van de Meent <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On 11/20/23 20:48, Matthias van de Meent wrote: > On Wed, 8 Nov 2023 at 12:03, Tomas Vondra <[email protected]> wrote: >> >> Hi, >> >> here's an updated patch, addressing the review comments, and reworking >> how the work is divided between the workers & leader etc. >> >> 0001 is just v2, rebased to current master >> >> 0002 and 0003 address most of the issues, in particular it >> >> - removes the unnecessary spool >> - fixes bs_reltuples type to double >> - a couple comments are reworded to be clearer >> - changes loop/condition in brinbuildCallbackParallel >> - removes asserts added for debugging >> - fixes cast in comparetup_index_brin >> - 0003 then simplifies comparetup_index_brin >> - I haven't inlined the tuplesort_puttuple_common parameter >> (didn't seem worth it) > > OK, thanks > >> 0004 Reworks how the work is divided between workers and combined by the >> leader. It undoes the tableam.c changes that attempted to divide the >> relation into chunks matching the BRIN ranges, and instead merges the >> results in the leader (using the BRIN "union" function). > > That's OK. > >> I haven't done any indentation fixes yet. >> >> I did fairly extensive testing, using pageinspect to compare indexes >> built with/without parallelism. More testing is needed, but it seems to >> work fine (with other opclasses and so on). > > After code-only review, here are some comments: > >> +++ b/src/backend/access/brin/brin.c >> [...] >> +/* Magic numbers for parallel state sharing */ >> +#define PARALLEL_KEY_BRIN_SHARED UINT64CONST(0xA000000000000001) >> +#define PARALLEL_KEY_TUPLESORT UINT64CONST(0xA000000000000002) > > These shm keys use the same constants also in use in > access/nbtree/nbtsort.c. While this shouldn't be an issue in normal > operations, I'd prefer if we didn't actively introduce conflicting > identifiers when we still have significant amounts of unused values > remaining. > Hmmm. Is there some rule of thumb how to pick these key values? I see nbtsort.c uses 0xA prefix, execParallel.c uses 0xE, while parallel.c ended up using 0xFFFFFFFFFFFF as prefix. I've user 0xB, simply because BRIN also starts with B. >> +#define PARALLEL_KEY_QUERY_TEXT UINT64CONST(0xA000000000000003) > > This is the fourth definition of a PARALLEL%_KEY_QUERY_TEXT, the > others being in access/nbtree/nbtsort.c (value 0xA000000000000004, one > more than brin's), backend/executor/execParallel.c > (0xE000000000000008), and PARALLEL_VACUUM_KEY_QUERY_TEXT (0x3) (though > I've not checked that their uses are exactly the same, I'd expect at > least btree to match mostly, if not fully, 1:1). > I think we could probably benefit from a less ad-hoc sharing of query > texts. I don't think that needs to happen specifically in this patch, > but I think it's something to keep in mind in future efforts. > I'm afraid I don't quite get what you mean by "ad hoc sharing of query texts". Are you saying we shouldn't propagate the query text to the parallel workers? Why? Or what's the proper solution? >> +_brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) >> [...] >> + BrinSpool *spool = state->bs_spool; >> [...] >> + if (!state) >> + return; > > I think the assignment to spool should be moved to below this > condition, as _brin_begin_parallel calls this with state=NULL when it > can't launch parallel workers, which will cause issues here. > Good catch! I wonder if we have tests that might trigger this, say by setting max_parallel_maintenance_workers > 0 while no workers allowed. >> + state->bs_numtuples = brinshared->indtuples; > > My IDE complains about bs_numtuples being an integer. This is a > pre-existing issue, but still valid: we can hit an overflow on tables > with pages_per_range=1 and relsize >= 2^31 pages. Extremely unlikely, > but problematic nonetheless. > True. I think I've been hesitant to make this a double because it seems a bit weird to do +1 with a double, and at some point (d == d+1). But this seems safe, we're guaranteed to be far away from that threshold. >> + * FIXME This probably needs some memory management fixes - we're reading >> + * tuples from the tuplesort, we're allocating an emty tuple, and so on. >> + * Probably better to release this memory. > > This should probably be resolved. > AFAICS that comment is actually inaccurate/stale, sorry about that. The code actually allocates (and resets) a single memtuple, and also emptyTuple. So I think that's OK, I've removed the comment. > I also noticed that this is likely to execute `union_tuples` many > times when pages_per_range is coprime with the parallel table scan's > block stride (or when we for other reasons have many tuples returned > for each range); and this `union_tuples` internally allocates and > deletes its own memory context for its deserialization of the 'b' > tuple. I think we should just pass a scratch context instead, so that > we don't have the overhead of continously creating then deleting the > same memory context Perhaps. Looking at the code, isn't it a bit strange how union_tuples uses the context? It creates the context, calls brin_deform_tuple in that context, but then the rest of the function (including datumCopy and similar stuff) happens in the caller's context ... However, I don't think the number of union_tuples calls is likely to be very high, especially for large tables. Because we split the table into 2048 chunks, and then cap the chunk size by 8192. For large tables (where this matters) we're likely close to 8192. > >> +++ b/src/backend/catalog/index.c >> [...] >> - indexRelation->rd_rel->relam == BTREE_AM_OID) >> + (indexRelation->rd_rel->relam == BTREE_AM_OID || >> + indexRelation->rd_rel->relam == BRIN_AM_OID)) > > I think this needs some more effort. I imagine a new > IndexAmRoutine->amcanbuildparallel is more appropriate than this > hard-coded list - external indexes may want to utilize the parallel > index creation planner facility, too. > Good idea. I added the IndexAmRoutine flag and used it here. > > Some notes: > As a project PostgreSQL seems to be trying to move away from > hardcoding heap into everything in favour of the more AM-agnostic > 'table'. I suggest replacing all mentions of "heap" in the arguments > with "table", to reduce the work future maintainers need to do to fix > this. Even when this AM is mostly targetted towards the heap AM, other > AMs (such as those I've heard of that were developed internally at > EDB) use the same block-addressing that heap does, and should thus be > compatible with BRIN. Thus, "heap" is not a useful name here. > I'm not against doing that, but I'd prefer to do that in a separate patch. There's a bunch of preexisting heap references, so and I don't want to introduce inconsistency (patch using table, old code heap) nor do I want to tweak unrelated code. > There are 2 new mentions of "tuplestore" in the patch, while the > structure used is tuplesort: one on form_and_spill_tuple, and one on > brinbuildCallbackParallel. Please update those comments. > > That's it for code review. I'll do some performance comparisons and > testing soon, too. > Thanks! Attached is a patch squashing the previous version into a single v3 commit, with fixes for your review in a separate commit. regards -- Tomas Vondra EnterpriseDB: http://www.enterprisedb.com The Enterprise PostgreSQL Company Attachments: [text/x-patch] v4-0001-parallel-CREATE-INDEX-for-BRIN-v3.patch (44.3K, ../../[email protected]/2-v4-0001-parallel-CREATE-INDEX-for-BRIN-v3.patch) download | inline diff: From dc59165200834ce9a9756055e7dd7f492977e223 Mon Sep 17 00:00:00 2001 From: Tomas Vondra <[email protected]> Date: Tue, 7 Nov 2023 17:04:28 +0100 Subject: [PATCH v4 1/2] parallel CREATE INDEX for BRIN v3 --- src/backend/access/brin/brin.c | 868 ++++++++++++++++++++- src/backend/access/transam/parallel.c | 4 + src/backend/catalog/index.c | 3 +- src/backend/utils/sort/tuplesortvariants.c | 207 +++++ src/include/access/brin.h | 3 + src/include/utils/tuplesort.h | 11 + 6 files changed, 1091 insertions(+), 5 deletions(-) diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index f0eac078e0b..0d3d728c9bf 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -33,6 +33,7 @@ #include "postmaster/autovacuum.h" #include "storage/bufmgr.h" #include "storage/freespace.h" +#include "tcop/tcopprot.h" /* pgrminclude ignore */ #include "utils/acl.h" #include "utils/builtins.h" #include "utils/datum.h" @@ -40,7 +41,118 @@ #include "utils/index_selfuncs.h" #include "utils/memutils.h" #include "utils/rel.h" +#include "utils/tuplesort.h" +/* Magic numbers for parallel state sharing */ +#define PARALLEL_KEY_BRIN_SHARED UINT64CONST(0xA000000000000001) +#define PARALLEL_KEY_TUPLESORT UINT64CONST(0xA000000000000002) +#define PARALLEL_KEY_QUERY_TEXT UINT64CONST(0xA000000000000003) +#define PARALLEL_KEY_WAL_USAGE UINT64CONST(0xA000000000000004) +#define PARALLEL_KEY_BUFFER_USAGE UINT64CONST(0xA000000000000005) + +/* + * Status record for spooling/sorting phase. + */ +typedef struct BrinSpool +{ + Tuplesortstate *sortstate; /* state data for tuplesort.c */ + Relation heap; + Relation index; +} BrinSpool; + +/* + * Status for index builds performed in parallel. This is allocated in a + * dynamic shared memory segment. + */ +typedef struct BrinShared +{ + /* + * These fields are not modified during the build. They primarily exist for + * the benefit of worker processes that need to create state corresponding + * to that used by the leader. + */ + Oid heaprelid; + Oid indexrelid; + bool isconcurrent; + BlockNumber pagesPerRange; + int scantuplesortstates; + + /* + * workersdonecv is used to monitor the progress of workers. All parallel + * participants must indicate that they are done before leader can use + * results built by the workers (and before leader can write the data into + * the index). + */ + ConditionVariable workersdonecv; + + /* + * mutex protects all fields before heapdesc. + * + * These fields contain status information of interest to BRIN index + * builds that must work just the same when an index is built in parallel. + */ + slock_t mutex; + + /* + * Mutable state that is maintained by workers, and reported back to + * leader at end of the scans. + * + * nparticipantsdone is number of worker processes finished. + * + * reltuples is the total number of input heap tuples. + * + * indtuples is the total number of tuples that made it into the index. + */ + int nparticipantsdone; + double reltuples; + double indtuples; + + /* + * ParallelTableScanDescData data follows. Can't directly embed here, as + * implementations of the parallel table scan desc interface might need + * stronger alignment. + */ +} BrinShared; + +/* + * Return pointer to a BrinShared's parallel table scan. + * + * c.f. shm_toc_allocate as to why BUFFERALIGN is used, rather than just + * MAXALIGN. + */ +#define ParallelTableScanFromBrinShared(shared) \ + (ParallelTableScanDesc) ((char *) (shared) + BUFFERALIGN(sizeof(BrinShared))) + +/* + * Status for leader in parallel index build. + */ +typedef struct BrinLeader +{ + /* parallel context itself */ + ParallelContext *pcxt; + + /* + * nparticipanttuplesorts is the exact number of worker processes + * successfully launched, plus one leader process if it participates as a + * worker (only DISABLE_LEADER_PARTICIPATION builds avoid leader + * participating as a worker). + */ + int nparticipanttuplesorts; + + /* + * Leader process convenience pointers to shared state (leader avoids TOC + * lookups). + * + * brinshared is the shared state for entire build. sharedsort is the + * shared, tuplesort-managed state passed to each process tuplesort. + * snapshot is the snapshot used by the scan iff an MVCC snapshot is required. + */ + BrinShared *brinshared; + Sharedsort *sharedsort; + Snapshot snapshot; + WalUsage *walusage; + BufferUsage *bufferusage; +} BrinLeader; /* * We use a BrinBuildState during initial construction of a BRIN index. @@ -50,12 +162,22 @@ typedef struct BrinBuildState { Relation bs_irel; int bs_numtuples; + double bs_reltuples; Buffer bs_currentInsertBuf; BlockNumber bs_pagesPerRange; BlockNumber bs_currRangeStart; BrinRevmap *bs_rmAccess; BrinDesc *bs_bdesc; BrinMemTuple *bs_dtuple; + + /* + * bs_leader is only present when a parallel index build is performed, and + * only in the leader process. (Actually, only the leader process has a + * BrinBuildState.) + */ + BrinLeader *bs_leader; + int bs_worker_id; + BrinSpool *bs_spool; } BrinBuildState; /* @@ -76,6 +198,7 @@ static void terminate_brin_buildstate(BrinBuildState *state); static void brinsummarize(Relation index, Relation heapRel, BlockNumber pageRange, bool include_partial, double *numSummarized, double *numExisting); static void form_and_insert_tuple(BrinBuildState *state); +static void form_and_spill_tuple(BrinBuildState *state); static void union_tuples(BrinDesc *bdesc, BrinMemTuple *a, BrinTuple *b); static void brin_vacuum_scan(Relation idxrel, BufferAccessStrategy strategy); @@ -83,6 +206,20 @@ static bool add_values_to_range(Relation idxRel, BrinDesc *bdesc, BrinMemTuple *dtup, const Datum *values, const bool *nulls); static bool check_null_keys(BrinValues *bval, ScanKey *nullkeys, int nnullkeys); +/* parallel index builds */ +static void _brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, + bool isconcurrent, int request); +static void _brin_end_parallel(BrinLeader *btleader, BrinBuildState *state); +static Size _brin_parallel_estimate_shared(Relation heap, Snapshot snapshot); +static void _brin_leader_participate_as_worker(BrinBuildState *buildstate, + Relation heap, Relation index); +static void _brin_parallel_scan_and_build(BrinBuildState *buildstate, + BrinSpool *brinspool, + BrinShared *brinshared, + Sharedsort *sharedsort, + Relation heap, Relation index, + int sortmem, bool progress); + /* * BRIN handler function: return IndexAmRoutine with access method parameters * and callbacks. @@ -820,6 +957,63 @@ brinbuildCallback(Relation index, values, isnull); } +/* + * A version of the callback, used by parallel index builds. The main difference + * is that instead of writing the BRIN tuples into the index, we write them into + * a shared tuplestore, and leave the insertion up to the leader (which may + * reorder them a bit etc.). The callback also does not generate empty ranges, + * those may be added by the leader when merging results from workers. + */ +static void +brinbuildCallbackParallel(Relation index, + ItemPointer tid, + Datum *values, + bool *isnull, + bool tupleIsAlive, + void *brstate) +{ + BrinBuildState *state = (BrinBuildState *) brstate; + BlockNumber thisblock; + + thisblock = ItemPointerGetBlockNumber(tid); + + /* + * If we're in a block that belongs to a future range, summarize what + * we've got and start afresh. Note the scan might have skipped many + * pages, if they were devoid of live tuples; we do not create emptry + * BRIN ranges here - the leader is responsible for filling them in. + */ + if (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) + { + + BRIN_elog((DEBUG2, + "brinbuildCallback: completed a range: %u--%u", + state->bs_currRangeStart, + state->bs_currRangeStart + state->bs_pagesPerRange)); + + /* create the index tuple and write it into the tuplesort */ + form_and_spill_tuple(state); + + /* + * Set state to correspond to the next range (for this block). + * + * This skips ranges that are either empty (and so we don't get any + * tuples to summarize), or processes by other workers. We can't + * differentiate those cases here easily, so we leave it up to the + * leader to fill empty ranges where needed. + */ + state->bs_currRangeStart + = state->bs_pagesPerRange * (thisblock / state->bs_pagesPerRange); + + /* re-initialize state for it */ + brin_memtuple_initialize(state->bs_dtuple, state->bs_bdesc); + } + + /* Accumulate the current tuple into the running state */ + (void) add_values_to_range(index, state->bs_bdesc, state->bs_dtuple, + values, isnull); +} + /* * brinbuild() -- build a new BRIN index. */ @@ -881,18 +1075,89 @@ brinbuild(Relation heap, Relation index, IndexInfo *indexInfo) revmap = brinRevmapInitialize(index, &pagesPerRange); state = initialize_brin_buildstate(index, revmap, pagesPerRange); + state->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + state->bs_spool->heap = heap; + state->bs_spool->index = index; + + /* + * Attempt to launch parallel worker scan when required + * + * XXX plan_create_index_workers makes the number of workers dependent on + * maintenance_work_mem, requiring 32MB for each worker. That makes sense + * for btree, but not for BRIN, which can do away with much less memory. + * So maybe make that somehow less strict, optionally? + */ + if (indexInfo->ii_ParallelWorkers > 0) + _brin_begin_parallel(state, heap, index, indexInfo->ii_Concurrent, + indexInfo->ii_ParallelWorkers); + /* * Now scan the relation. No syncscan allowed here because we want the * heap blocks in physical order. */ - reltuples = table_index_build_scan(heap, index, indexInfo, false, true, - brinbuildCallback, (void *) state, NULL); - /* process the final batch */ - form_and_insert_tuple(state); + /* + * If parallel build requested and at least one worker process was + * successfully launched, set up coordination state + */ + if (state->bs_leader) + { + SortCoordinate coordinate; + + coordinate = (SortCoordinate) palloc0(sizeof(SortCoordinateData)); + coordinate->isWorker = false; + coordinate->nParticipants = + state->bs_leader->nparticipanttuplesorts; + coordinate->sharedsort = state->bs_leader->sharedsort; + + + /* + * Begin serial/leader tuplesort. + * + * In cases where parallelism is involved, the leader receives the same + * share of maintenance_work_mem as a serial sort (it is generally treated + * in the same way as a serial sort once we return). Parallel worker + * Tuplesortstates will have received only a fraction of + * maintenance_work_mem, though. + * + * We rely on the lifetime of the Leader Tuplesortstate almost not + * overlapping with any worker Tuplesortstate's lifetime. There may be + * some small overlap, but that's okay because we rely on leader + * Tuplesortstate only allocating a small, fixed amount of memory here. + * When its tuplesort_performsort() is called (by our caller), and + * significant amounts of memory are likely to be used, all workers must + * have already freed almost all memory held by their Tuplesortstates + * (they are about to go away completely, too). The overall effect is + * that maintenance_work_mem always represents an absolute high watermark + * on the amount of memory used by a CREATE INDEX operation, regardless of + * the use of parallelism or any other factor. + */ + state->bs_spool->sortstate = + tuplesort_begin_index_brin(heap, index, + maintenance_work_mem, coordinate, + TUPLESORT_NONE); + + /* + * In parallel mode, wait for workers to complete, and then read all + * tuples from the shared tuplesort and insert them into the index. + */ + _brin_end_parallel(state->bs_leader, state); + } + else /* no parallel index build, just do the usual thing */ + { + reltuples = table_index_build_scan(heap, index, indexInfo, false, true, + brinbuildCallback, (void *) state, NULL); + + /* process the final batch */ + form_and_insert_tuple(state); + + /* track the number of relation tuples */ + state->bs_reltuples = reltuples; + } /* release resources */ idxtuples = state->bs_numtuples; + reltuples = state->bs_reltuples; brinRevmapTerminate(state->bs_rmAccess); terminate_brin_buildstate(state); @@ -1312,12 +1577,16 @@ initialize_brin_buildstate(Relation idxRel, BrinRevmap *revmap, state->bs_irel = idxRel; state->bs_numtuples = 0; + state->bs_reltuples = 0; state->bs_currentInsertBuf = InvalidBuffer; state->bs_pagesPerRange = pagesPerRange; state->bs_currRangeStart = 0; state->bs_rmAccess = revmap; state->bs_bdesc = brin_build_desc(idxRel); state->bs_dtuple = brin_new_memtuple(state->bs_bdesc); + state->bs_leader = NULL; + state->bs_worker_id = 0; + state->bs_spool = NULL; return state; } @@ -1609,6 +1878,32 @@ form_and_insert_tuple(BrinBuildState *state) pfree(tup); } +/* + * Given a deformed tuple in the build state, convert it into the on-disk + * format and write it to a (shared) tuplestore (the leader will insert it + * into the index later). + */ +static void +form_and_spill_tuple(BrinBuildState *state) +{ + BrinTuple *tup; + Size size; + + /* don't insert empty tuples in parallel build */ + if (state->bs_dtuple->bt_empty_range) + return; + + tup = brin_form_tuple(state->bs_bdesc, state->bs_currRangeStart, + state->bs_dtuple, &size); + + /* write the BRIN tuple to the tuplesort */ + tuplesort_putbrintuple(state->bs_spool->sortstate, tup, size); + + state->bs_numtuples++; + + pfree(tup); +} + /* * Given two deformed tuples, adjust the first one so that it's consistent * with the summary values in both. @@ -1928,3 +2223,568 @@ check_null_keys(BrinValues *bval, ScanKey *nullkeys, int nnullkeys) return true; } + +static void +_brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, + bool isconcurrent, int request) +{ + ParallelContext *pcxt; + int scantuplesortstates; + Snapshot snapshot; + Size estbrinshared; + Size estsort; + BrinShared *brinshared; + Sharedsort *sharedsort; + BrinLeader *brinleader = (BrinLeader *) palloc0(sizeof(BrinLeader)); + WalUsage *walusage; + BufferUsage *bufferusage; + bool leaderparticipates = true; + int querylen; + +#ifdef DISABLE_LEADER_PARTICIPATION + leaderparticipates = false; +#endif + + /* + * Enter parallel mode, and create context for parallel build of brin + * index + */ + EnterParallelMode(); + Assert(request > 0); + pcxt = CreateParallelContext("postgres", "_brin_parallel_build_main", + request); + + scantuplesortstates = leaderparticipates ? request + 1 : request; + + /* + * Prepare for scan of the base relation. In a normal index build, we use + * SnapshotAny because we must retrieve all tuples and do our own time + * qual checks (because we have to index RECENTLY_DEAD tuples). In a + * concurrent build, we take a regular MVCC snapshot and index whatever's + * live according to that. + */ + if (!isconcurrent) + snapshot = SnapshotAny; + else + snapshot = RegisterSnapshot(GetTransactionSnapshot()); + + /* + * Estimate size for our own PARALLEL_KEY_BRIN_SHARED workspace. + */ + estbrinshared = _brin_parallel_estimate_shared(heap, snapshot); + shm_toc_estimate_chunk(&pcxt->estimator, estbrinshared); + estsort = tuplesort_estimate_shared(scantuplesortstates); + shm_toc_estimate_chunk(&pcxt->estimator, estsort); + + shm_toc_estimate_keys(&pcxt->estimator, 2); + + /* + * Estimate space for WalUsage and BufferUsage -- PARALLEL_KEY_WAL_USAGE + * and PARALLEL_KEY_BUFFER_USAGE. + * + * If there are no extensions loaded that care, we could skip this. We + * have no way of knowing whether anyone's looking at pgWalUsage or + * pgBufferUsage, so do it unconditionally. + */ + shm_toc_estimate_chunk(&pcxt->estimator, + mul_size(sizeof(WalUsage), pcxt->nworkers)); + shm_toc_estimate_keys(&pcxt->estimator, 1); + shm_toc_estimate_chunk(&pcxt->estimator, + mul_size(sizeof(BufferUsage), pcxt->nworkers)); + shm_toc_estimate_keys(&pcxt->estimator, 1); + + /* Finally, estimate PARALLEL_KEY_QUERY_TEXT space */ + if (debug_query_string) + { + querylen = strlen(debug_query_string); + shm_toc_estimate_chunk(&pcxt->estimator, querylen + 1); + shm_toc_estimate_keys(&pcxt->estimator, 1); + } + else + querylen = 0; /* keep compiler quiet */ + + /* Everyone's had a chance to ask for space, so now create the DSM */ + InitializeParallelDSM(pcxt); + + /* If no DSM segment was available, back out (do serial build) */ + if (pcxt->seg == NULL) + { + if (IsMVCCSnapshot(snapshot)) + UnregisterSnapshot(snapshot); + DestroyParallelContext(pcxt); + ExitParallelMode(); + return; + } + + /* Store shared build state, for which we reserved space */ + brinshared = (BrinShared *) shm_toc_allocate(pcxt->toc, estbrinshared); + /* Initialize immutable state */ + brinshared->heaprelid = RelationGetRelid(heap); + brinshared->indexrelid = RelationGetRelid(index); + brinshared->isconcurrent = isconcurrent; + brinshared->scantuplesortstates = scantuplesortstates; + brinshared->pagesPerRange = buildstate->bs_pagesPerRange; + ConditionVariableInit(&brinshared->workersdonecv); + SpinLockInit(&brinshared->mutex); + + /* Initialize mutable state */ + brinshared->nparticipantsdone = 0; + brinshared->reltuples = 0.0; + brinshared->indtuples = 0.0; + + table_parallelscan_initialize(heap, + ParallelTableScanFromBrinShared(brinshared), + snapshot); + + /* + * Store shared tuplesort-private state, for which we reserved space. + * Then, initialize opaque state using tuplesort routine. + */ + sharedsort = (Sharedsort *) shm_toc_allocate(pcxt->toc, estsort); + tuplesort_initialize_shared(sharedsort, scantuplesortstates, + pcxt->seg); + + /* + * Store shared tuplesort-private state, for which we reserved space. + * Then, initialize opaque state using tuplesort routine. + */ + shm_toc_insert(pcxt->toc, PARALLEL_KEY_BRIN_SHARED, brinshared); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_TUPLESORT, sharedsort); + + /* Store query string for workers */ + if (debug_query_string) + { + char *sharedquery; + + sharedquery = (char *) shm_toc_allocate(pcxt->toc, querylen + 1); + memcpy(sharedquery, debug_query_string, querylen + 1); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_QUERY_TEXT, sharedquery); + } + + /* + * Allocate space for each worker's WalUsage and BufferUsage; no need to + * initialize. + */ + walusage = shm_toc_allocate(pcxt->toc, + mul_size(sizeof(WalUsage), pcxt->nworkers)); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_WAL_USAGE, walusage); + bufferusage = shm_toc_allocate(pcxt->toc, + mul_size(sizeof(BufferUsage), pcxt->nworkers)); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_BUFFER_USAGE, bufferusage); + + /* Launch workers, saving status for leader/caller */ + LaunchParallelWorkers(pcxt); + brinleader->pcxt = pcxt; + brinleader->nparticipanttuplesorts = pcxt->nworkers_launched; + if (leaderparticipates) + brinleader->nparticipanttuplesorts++; + brinleader->brinshared = brinshared; + brinleader->sharedsort = sharedsort; + brinleader->snapshot = snapshot; + brinleader->walusage = walusage; + brinleader->bufferusage = bufferusage; + + /* If no workers were successfully launched, back out (do serial build) */ + if (pcxt->nworkers_launched == 0) + { + _brin_end_parallel(brinleader, NULL); + return; + } + + /* Save leader state now that it's clear build will be parallel */ + buildstate->bs_leader = brinleader; + + /* Join heap scan ourselves */ + if (leaderparticipates) + _brin_leader_participate_as_worker(buildstate, heap, index); + + /* + * Caller needs to wait for all launched workers when we return. Make + * sure that the failure-to-start case will not hang forever. + */ + WaitForParallelWorkersToAttach(pcxt); +} + +/* + * Shut down workers, destroy parallel context, and end parallel mode. + */ +static void +_brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) +{ + int i; + BrinTuple *btup; + BrinMemTuple *memtuple = NULL; + Size tuplen; + BrinShared *brinshared = brinleader->brinshared; + BlockNumber prevblkno = InvalidBlockNumber; + BrinTuple *emptyTuple = NULL; + Size emptySize; + BrinSpool *spool = state->bs_spool; + + /* Shutdown worker processes */ + WaitForParallelWorkersToFinish(brinleader->pcxt); + + if (!state) + return; + + /* copy the data into leader state (we have to wait for the workers ) */ + state->bs_reltuples = brinshared->reltuples; + state->bs_numtuples = brinshared->indtuples; + + tuplesort_performsort(spool->sortstate); + + /* + * Initialize BrinMemTuple we'll use to union summaries from workers + * (in case they happened to produce parts of the same paga range). + */ + memtuple = brin_new_memtuple(state->bs_bdesc); + + /* + * Read the BRIN tuples from the shared tuplesort, sorted by block number. + * That probably gives us an index that is cheaper to scan, thanks to mostly + * getting data from the same index page as before. + * + * FIXME This probably needs some memory management fixes - we're reading + * tuples from the tuplesort, we're allocating an empty tuple, and so on. + * Probably better to release this memory. + * + * XXX We can't quite free the BrinTuple, though, because that's a field + * in BrinSortTuple. + */ + while ((btup = tuplesort_getbrintuple(spool->sortstate, &tuplen, true)) != NULL) + { + /* Ranges should be multiples of pages_per_range for the index. */ + Assert(btup->bt_blkno % brinshared->pagesPerRange == 0); + + /* + * Do we need to union summaries for the same page range? + * + * If this is the first brin tuple we read, then just deform it into + * the memtuple, and continue with the next one from tuplesort. We + * however may need to insert empty summaries into the index. + * + * If it's the same block as the last we saw, we simply union the + * brin tuple into it, and we're done - we don't even need to insert + * empty ranges, because that was done earlier when we saw the first + * brin tuple (for this range). + * + * Finally, if it's not the first brin tuple, and it's not the same + * page range, we need to do the insert and then deform the tuple + * into the memtuple. Then we'll insert empty ranges before the + * new brin tuple, if needed. + */ + if (prevblkno == InvalidBlockNumber) + { + /* First brin tuples, just deform into memtuple. */ + memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); + + /* continue to insert empty pages before thisblock */ + } + else if (memtuple->bt_blkno == btup->bt_blkno) + { + /* + * Not the first brin tuple, but same page range as the previous + * one, so we can merge it into the memtuple. + */ + union_tuples(state->bs_bdesc, memtuple, btup); + continue; + } + else + { + BrinTuple *tmp; + Size len; + + /* + * We got brin tuple for a different page range, so form a brin + * tuple from the memtuple, insert it, and re-init the memtuple + * from the new brin tuple. + */ + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); + + /* free the formed on-disk tuple */ + pfree(tmp); + + memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); + + /* continue to insert empty pages before thisblock */ + } + + /* Fill empty ranges for all ranges missing in the tuplesort. */ + prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; + while (prevblkno + state->bs_pagesPerRange < btup->bt_blkno) + { + /* the missing range */ + prevblkno += state->bs_pagesPerRange; + + /* Did we already build the empty range? If not, do it now. */ + if (emptyTuple == NULL) + { + BrinMemTuple *dtuple = brin_new_memtuple(state->bs_bdesc); + + emptyTuple = brin_form_tuple(state->bs_bdesc, prevblkno, dtuple, &emptySize); + } + else + { + /* we already have am "empty range" tuple, just set the block */ + emptyTuple->bt_blkno = prevblkno; + } + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, + emptyTuple->bt_blkno, emptyTuple, emptySize); + } + + prevblkno = btup->bt_blkno; + } + + tuplesort_end(spool->sortstate); + + /* Fill empty ranges for all ranges missing in the tuplesort. */ + prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; + while (prevblkno + state->bs_pagesPerRange < memtuple->bt_blkno) + { + /* the missing range */ + prevblkno += state->bs_pagesPerRange; + + /* Did we already build the empty range? If not, do it now. */ + if (emptyTuple == NULL) + { + BrinMemTuple *dtuple = brin_new_memtuple(state->bs_bdesc); + + emptyTuple = brin_form_tuple(state->bs_bdesc, prevblkno, dtuple, &emptySize); + } + else + { + /* we already have am "empty range" tuple, just set the block */ + emptyTuple->bt_blkno = prevblkno; + } + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, + emptyTuple->bt_blkno, emptyTuple, emptySize); + } + + /**/ + if (prevblkno != InvalidBlockNumber) + { + BrinTuple *tmp; + Size len; + + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); + + pfree(tmp); + } + + /* + * Next, accumulate WAL usage. (This must wait for the workers to finish, + * or we might get incomplete data.) + */ + for (i = 0; i < brinleader->pcxt->nworkers_launched; i++) + InstrAccumParallelQuery(&brinleader->bufferusage[i], &brinleader->walusage[i]); + + /* Free last reference to MVCC snapshot, if one was used */ + if (IsMVCCSnapshot(brinleader->snapshot)) + UnregisterSnapshot(brinleader->snapshot); + DestroyParallelContext(brinleader->pcxt); + ExitParallelMode(); +} + +/* + * Returns size of shared memory required to store state for a parallel + * brin index build based on the snapshot its parallel scan will use. + */ +static Size +_brin_parallel_estimate_shared(Relation heap, Snapshot snapshot) +{ + /* c.f. shm_toc_allocate as to why BUFFERALIGN is used */ + return add_size(BUFFERALIGN(sizeof(BrinShared)), + table_parallelscan_estimate(heap, snapshot)); +} + +/* + * Within leader, participate as a parallel worker. + */ +static void +_brin_leader_participate_as_worker(BrinBuildState *buildstate, Relation heap, Relation index) +{ + BrinLeader *brinleader = buildstate->bs_leader; + int sortmem; + + /* Allocate memory and initialize private spool */ + buildstate->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + buildstate->bs_spool->heap = buildstate->bs_spool->heap; + buildstate->bs_spool->index = buildstate->bs_spool->index; + + /* + * Might as well use reliable figure when doling out maintenance_work_mem + * (when requested number of workers were not launched, this will be + * somewhat higher than it is for other workers). + */ + sortmem = maintenance_work_mem / brinleader->nparticipanttuplesorts; + + /* Perform work common to all participants */ + _brin_parallel_scan_and_build(buildstate, buildstate->bs_spool, brinleader->brinshared, + brinleader->sharedsort, heap, index, sortmem, true); +} + +/* + * Perform a worker's portion of a parallel sort. + * + * This generates a tuplesort for passed btspool, and a second tuplesort + * state if a second btspool is need (i.e. for unique index builds). All + * other spool fields should already be set when this is called. + * + * sortmem is the amount of working memory to use within each worker, + * expressed in KBs. + * + * When this returns, workers are done, and need only release resources. + */ +static void +_brin_parallel_scan_and_build(BrinBuildState *state, BrinSpool *brinspool, + BrinShared *brinshared, Sharedsort *sharedsort, + Relation heap, Relation index, int sortmem, + bool progress) +{ + SortCoordinate coordinate; + TableScanDesc scan; + double reltuples; + IndexInfo *indexInfo; + + /* Initialize local tuplesort coordination state */ + coordinate = palloc0(sizeof(SortCoordinateData)); + coordinate->isWorker = true; + coordinate->nParticipants = -1; + coordinate->sharedsort = sharedsort; + + /* Begin "partial" tuplesort */ + brinspool->sortstate = tuplesort_begin_index_brin(brinspool->heap, + brinspool->index, + sortmem, coordinate, + TUPLESORT_NONE); + + /* Join parallel scan */ + indexInfo = BuildIndexInfo(index); + indexInfo->ii_Concurrent = brinshared->isconcurrent; + + scan = table_beginscan_parallel(heap, + ParallelTableScanFromBrinShared(brinshared)); + + reltuples = table_index_build_scan(heap, index, indexInfo, true, true, + brinbuildCallbackParallel, state, scan); + + /* insert the last item */ + form_and_spill_tuple(state); + + /* sort the BRIN ranges built by this worker */ + tuplesort_performsort(brinspool->sortstate); + + state->bs_reltuples += reltuples; + + /* + * Done. Record ambuild statistics. + */ + SpinLockAcquire(&brinshared->mutex); + brinshared->nparticipantsdone++; + brinshared->reltuples += state->bs_reltuples; + brinshared->indtuples += state->bs_numtuples; + SpinLockRelease(&brinshared->mutex); + + /* Notify leader */ + ConditionVariableSignal(&brinshared->workersdonecv); + + tuplesort_end(brinspool->sortstate); +} + +/* + * Perform work within a launched parallel process. + */ +void +_brin_parallel_build_main(dsm_segment *seg, shm_toc *toc) +{ + char *sharedquery; + BrinShared *brinshared; + Sharedsort *sharedsort; + BrinBuildState *buildstate; + Relation heapRel; + Relation indexRel; + LOCKMODE heapLockmode; + LOCKMODE indexLockmode; + WalUsage *walusage; + BufferUsage *bufferusage; + int sortmem; + + /* + * The only possible status flag that can be set to the parallel worker is + * PROC_IN_SAFE_IC. + */ + Assert((MyProc->statusFlags == 0) || + (MyProc->statusFlags == PROC_IN_SAFE_IC)); + + /* Set debug_query_string for individual workers first */ + sharedquery = shm_toc_lookup(toc, PARALLEL_KEY_QUERY_TEXT, true); + debug_query_string = sharedquery; + + /* Report the query string from leader */ + pgstat_report_activity(STATE_RUNNING, debug_query_string); + + /* Look up brin shared state */ + brinshared = shm_toc_lookup(toc, PARALLEL_KEY_BRIN_SHARED, false); + + /* Open relations using lock modes known to be obtained by index.c */ + if (!brinshared->isconcurrent) + { + heapLockmode = ShareLock; + indexLockmode = AccessExclusiveLock; + } + else + { + heapLockmode = ShareUpdateExclusiveLock; + indexLockmode = RowExclusiveLock; + } + + /* Open relations within worker */ + heapRel = table_open(brinshared->heaprelid, heapLockmode); + indexRel = index_open(brinshared->indexrelid, indexLockmode); + + buildstate = initialize_brin_buildstate(indexRel, NULL, brinshared->pagesPerRange); + + /* Initialize worker's own spool */ + buildstate->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + buildstate->bs_spool->heap = heapRel; + buildstate->bs_spool->index = indexRel; + + /* Look up shared state private to tuplesort.c */ + sharedsort = shm_toc_lookup(toc, PARALLEL_KEY_TUPLESORT, false); + tuplesort_attach_shared(sharedsort, seg); + + /* Prepare to track buffer usage during parallel execution */ + InstrStartParallelQuery(); + + /* + * Might as well use reliable figure when doling out maintenance_work_mem + * (when requested number of workers were not launched, this will be + * somewhat higher than it is for other workers). + */ + sortmem = maintenance_work_mem / brinshared->scantuplesortstates; + + _brin_parallel_scan_and_build(buildstate, buildstate->bs_spool, + brinshared, sharedsort, + heapRel, indexRel, sortmem, false); + + /* Report WAL/buffer usage during parallel execution */ + bufferusage = shm_toc_lookup(toc, PARALLEL_KEY_BUFFER_USAGE, false); + walusage = shm_toc_lookup(toc, PARALLEL_KEY_WAL_USAGE, false); + InstrEndParallelQuery(&bufferusage[ParallelWorkerNumber], + &walusage[ParallelWorkerNumber]); + + index_close(indexRel, indexLockmode); + table_close(heapRel, heapLockmode); +} diff --git a/src/backend/access/transam/parallel.c b/src/backend/access/transam/parallel.c index 194a1207be6..d78314062e0 100644 --- a/src/backend/access/transam/parallel.c +++ b/src/backend/access/transam/parallel.c @@ -14,6 +14,7 @@ #include "postgres.h" +#include "access/brin.h" #include "access/nbtree.h" #include "access/parallel.h" #include "access/session.h" @@ -145,6 +146,9 @@ static const struct { "_bt_parallel_build_main", _bt_parallel_build_main }, + { + "_brin_parallel_build_main", _brin_parallel_build_main + }, { "parallel_vacuum_main", parallel_vacuum_main } diff --git a/src/backend/catalog/index.c b/src/backend/catalog/index.c index 143fae01ebd..37e4305d50a 100644 --- a/src/backend/catalog/index.c +++ b/src/backend/catalog/index.c @@ -2982,7 +2982,8 @@ index_build(Relation heapRelation, * Note that planner considers parallel safety for us. */ if (parallel && IsNormalProcessingMode() && - indexRelation->rd_rel->relam == BTREE_AM_OID) + (indexRelation->rd_rel->relam == BTREE_AM_OID || + indexRelation->rd_rel->relam == BRIN_AM_OID)) indexInfo->ii_ParallelWorkers = plan_create_index_workers(RelationGetRelid(heapRelation), RelationGetRelid(indexRelation)); diff --git a/src/backend/utils/sort/tuplesortvariants.c b/src/backend/utils/sort/tuplesortvariants.c index 2cd508e5130..9b3a70e6ccf 100644 --- a/src/backend/utils/sort/tuplesortvariants.c +++ b/src/backend/utils/sort/tuplesortvariants.c @@ -19,6 +19,7 @@ #include "postgres.h" +#include "access/brin_tuple.h" #include "access/hash.h" #include "access/htup_details.h" #include "access/nbtree.h" @@ -43,6 +44,8 @@ static void removeabbrev_cluster(Tuplesortstate *state, SortTuple *stups, int count); static void removeabbrev_index(Tuplesortstate *state, SortTuple *stups, int count); +static void removeabbrev_index_brin(Tuplesortstate *state, SortTuple *stups, + int count); static void removeabbrev_datum(Tuplesortstate *state, SortTuple *stups, int count); static int comparetup_heap(const SortTuple *a, const SortTuple *b, @@ -69,10 +72,16 @@ static int comparetup_index_hash(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); static int comparetup_index_hash_tiebreak(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); +static int comparetup_index_brin(const SortTuple *a, const SortTuple *b, + Tuplesortstate *state); static void writetup_index(Tuplesortstate *state, LogicalTape *tape, SortTuple *stup); static void readtup_index(Tuplesortstate *state, SortTuple *stup, LogicalTape *tape, unsigned int len); +static void writetup_index_brin(Tuplesortstate *state, LogicalTape *tape, + SortTuple *stup); +static void readtup_index_brin(Tuplesortstate *state, SortTuple *stup, + LogicalTape *tape, unsigned int len); static int comparetup_datum(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); static int comparetup_datum_tiebreak(const SortTuple *a, const SortTuple *b, @@ -128,6 +137,16 @@ typedef struct uint32 max_buckets; } TuplesortIndexHashArg; +/* + * Data struture pointed by "TuplesortPublic.arg" for the index_brin subcase. + */ +typedef struct +{ + TuplesortIndexArg index; + + /* XXX do we need something here? */ +} TuplesortIndexBrinArg; + /* * Data struture pointed by "TuplesortPublic.arg" for the Datum case. * Set by tuplesort_begin_datum and used only by the DatumTuple routines. @@ -140,6 +159,21 @@ typedef struct int datumTypeLen; } TuplesortDatumArg; +/* + * Computing BrinTuple size with only the tuple is difficult, so we want to track + * the length referenced by the SortTuple. That's what BrinSortTuple is meant + * to do - it's essentially a BrinTuple prefixed by its length. + */ +typedef struct BrinSortTuple +{ + Size tuplen; + BrinTuple tuple; +} BrinSortTuple; + +/* Size of the BrinSortTuple, given length of the BrinTuple. */ +#define BRINSORTTUPLE_SIZE(len) (offsetof(BrinSortTuple, tuple) + (len)) + + Tuplesortstate * tuplesort_begin_heap(TupleDesc tupDesc, int nkeys, AttrNumber *attNums, @@ -527,6 +561,47 @@ tuplesort_begin_index_gist(Relation heapRel, return state; } +Tuplesortstate * +tuplesort_begin_index_brin(Relation heapRel, + Relation indexRel, + int workMem, + SortCoordinate coordinate, + int sortopt) +{ + Tuplesortstate *state = tuplesort_begin_common(workMem, coordinate, + sortopt); + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext; + TuplesortIndexBrinArg *arg; + + oldcontext = MemoryContextSwitchTo(base->maincontext); + arg = (TuplesortIndexBrinArg *) palloc(sizeof(TuplesortIndexBrinArg)); + +#ifdef TRACE_SORT + if (trace_sort) + elog(LOG, + "begin index sort: workMem = %d, randomAccess = %c", + workMem, + sortopt & TUPLESORT_RANDOMACCESS ? 't' : 'f'); +#endif + + base->nKeys = 1; /* Only one sort column, the block number */ + + base->removeabbrev = removeabbrev_index_brin; + base->comparetup = comparetup_index_brin; + base->writetup = writetup_index_brin; + base->readtup = readtup_index_brin; + base->haveDatum1 = true; + base->arg = arg; + + arg->index.heapRel = heapRel; + arg->index.indexRel = indexRel; + + MemoryContextSwitchTo(oldcontext); + + return state; +} + Tuplesortstate * tuplesort_begin_datum(Oid datumType, Oid sortOperator, Oid sortCollation, bool nullsFirstFlag, int workMem, @@ -707,6 +782,35 @@ tuplesort_putindextuplevalues(Tuplesortstate *state, Relation rel, !stup.isnull1); } +/* + * Collect one BRIN tuple while collecting input data for sort. + */ +void +tuplesort_putbrintuple(Tuplesortstate *state, BrinTuple *tuple, Size size) +{ + SortTuple stup; + BrinSortTuple *bstup; + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext = MemoryContextSwitchTo(base->tuplecontext); + + /* allocate space for the whole BRIN sort tuple */ + bstup = palloc(BRINSORTTUPLE_SIZE(size)); + + bstup->tuplen = size; + memcpy(&bstup->tuple, tuple, size); + + stup.tuple = bstup; + stup.datum1 = tuple->bt_blkno; + stup.isnull1 = false; + + tuplesort_puttuple_common(state, &stup, + base->sortKeys && + base->sortKeys->abbrev_converter && + !stup.isnull1); + + MemoryContextSwitchTo(oldcontext); +} + /* * Accept one Datum while collecting input data for sort. * @@ -850,6 +954,35 @@ tuplesort_getindextuple(Tuplesortstate *state, bool forward) return (IndexTuple) stup.tuple; } +/* + * Fetch the next BRIN tuple in either forward or back direction. + * Returns NULL if no more tuples. Returned tuple belongs to tuplesort memory + * context, and must not be freed by caller. Caller may not rely on tuple + * remaining valid after any further manipulation of tuplesort. + */ +BrinTuple * +tuplesort_getbrintuple(Tuplesortstate *state, Size *len, bool forward) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext = MemoryContextSwitchTo(base->sortcontext); + SortTuple stup; + BrinSortTuple *btup; + + if (!tuplesort_gettuple_common(state, forward, &stup)) + stup.tuple = NULL; + + MemoryContextSwitchTo(oldcontext); + + if (!stup.tuple) + return NULL; + + btup = (BrinSortTuple *) stup.tuple; + + *len = btup->tuplen; + + return &btup->tuple; +} + /* * Fetch the next Datum in either forward or back direction. * Returns false if no more datums. @@ -1564,6 +1697,80 @@ readtup_index(Tuplesortstate *state, SortTuple *stup, &stup->isnull1); } +/* + * Routines specialized for BrinTuple case + */ + +static void +removeabbrev_index_brin(Tuplesortstate *state, SortTuple *stups, int count) +{ + int i; + + for (i = 0; i < count; i++) + { + BrinSortTuple *tuple; + + tuple = stups[i].tuple; + stups[i].datum1 = tuple->tuple.bt_blkno; + } +} + +static int +comparetup_index_brin(const SortTuple *a, const SortTuple *b, + Tuplesortstate *state) +{ + Assert(TuplesortstateGetPublic(state)->haveDatum1); + + if (DatumGetUInt32(a->datum1) > DatumGetUInt32(b->datum1)) + return 1; + + if (DatumGetUInt32(a->datum1) < DatumGetUInt32(b->datum1)) + return -1; + + /* silence compilers */ + return 0; +} + +static void +writetup_index_brin(Tuplesortstate *state, LogicalTape *tape, SortTuple *stup) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + BrinSortTuple *tuple = (BrinSortTuple *) stup->tuple; + unsigned int tuplen = tuple->tuplen; + + tuplen = tuplen + sizeof(tuplen); + LogicalTapeWrite(tape, &tuplen, sizeof(tuplen)); + LogicalTapeWrite(tape, &tuple->tuple, tuple->tuplen); + if (base->sortopt & TUPLESORT_RANDOMACCESS) /* need trailing length word? */ + LogicalTapeWrite(tape, &tuplen, sizeof(tuplen)); +} + +static void +readtup_index_brin(Tuplesortstate *state, SortTuple *stup, + LogicalTape *tape, unsigned int len) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + unsigned int tuplen = len - sizeof(unsigned int); + + /* + * Allocate space for the BRIN sort tuple, which is BrinTuple with an + * extra length field. + */ + BrinSortTuple *tuple + = (BrinSortTuple *) tuplesort_readtup_alloc(state, + BRINSORTTUPLE_SIZE(tuplen)); + + tuple->tuplen = tuplen; + + LogicalTapeReadExact(tape, &tuple->tuple, tuplen); + if (base->sortopt & TUPLESORT_RANDOMACCESS) /* need trailing length word? */ + LogicalTapeReadExact(tape, &tuplen, sizeof(tuplen)); + stup->tuple = (void *) tuple; + + /* set up first-column key value, which is block number */ + stup->datum1 = tuple->tuple.bt_blkno; +} + /* * Routines specialized for DatumTuple case */ diff --git a/src/include/access/brin.h b/src/include/access/brin.h index ed66f1b3d51..3451ecb211f 100644 --- a/src/include/access/brin.h +++ b/src/include/access/brin.h @@ -11,6 +11,7 @@ #define BRIN_H #include "nodes/execnodes.h" +#include "storage/shm_toc.h" #include "utils/relcache.h" @@ -52,4 +53,6 @@ typedef struct BrinStatsData extern void brinGetStats(Relation index, BrinStatsData *stats); +extern void _brin_parallel_build_main(dsm_segment *seg, shm_toc *toc); + #endif /* BRIN_H */ diff --git a/src/include/utils/tuplesort.h b/src/include/utils/tuplesort.h index 9ed2de76cd6..357eb35311d 100644 --- a/src/include/utils/tuplesort.h +++ b/src/include/utils/tuplesort.h @@ -21,6 +21,7 @@ #ifndef TUPLESORT_H #define TUPLESORT_H +#include "access/brin_tuple.h" #include "access/itup.h" #include "executor/tuptable.h" #include "storage/dsm.h" @@ -282,6 +283,9 @@ typedef struct * The "index_hash" API is similar to index_btree, but the tuples are * actually sorted by their hash codes not the raw data. * + * The "index_brin" API is similar to index_btree, but the tuples are + * BrinTuple and are sorted by their block number not the raw data. + * * Parallel sort callers are required to coordinate multiple tuplesort states * in a leader process and one or more worker processes. The leader process * must launch workers, and have each perform an independent "partial" @@ -426,6 +430,10 @@ extern Tuplesortstate *tuplesort_begin_index_gist(Relation heapRel, Relation indexRel, int workMem, SortCoordinate coordinate, int sortopt); +extern Tuplesortstate *tuplesort_begin_index_brin(Relation heapRel, + Relation indexRel, + int workMem, SortCoordinate coordinate, + int sortopt); extern Tuplesortstate *tuplesort_begin_datum(Oid datumType, Oid sortOperator, Oid sortCollation, bool nullsFirstFlag, @@ -438,6 +446,7 @@ extern void tuplesort_putheaptuple(Tuplesortstate *state, HeapTuple tup); extern void tuplesort_putindextuplevalues(Tuplesortstate *state, Relation rel, ItemPointer self, const Datum *values, const bool *isnull); +extern void tuplesort_putbrintuple(Tuplesortstate *state, BrinTuple *tup, Size len); extern void tuplesort_putdatum(Tuplesortstate *state, Datum val, bool isNull); @@ -445,6 +454,8 @@ extern bool tuplesort_gettupleslot(Tuplesortstate *state, bool forward, bool copy, TupleTableSlot *slot, Datum *abbrev); extern HeapTuple tuplesort_getheaptuple(Tuplesortstate *state, bool forward); extern IndexTuple tuplesort_getindextuple(Tuplesortstate *state, bool forward); +extern BrinTuple *tuplesort_getbrintuple(Tuplesortstate *state, Size *len, + bool forward); extern bool tuplesort_getdatum(Tuplesortstate *state, bool forward, bool copy, Datum *val, bool *isNull, Datum *abbrev); -- 2.41.0 [text/x-patch] v4-0002-review-fixes.patch (9.1K, ../../[email protected]/3-v4-0002-review-fixes.patch) download | inline diff: From 625880de662181fd433eb583a00af0f16d57c420 Mon Sep 17 00:00:00 2001 From: Tomas Vondra <[email protected]> Date: Wed, 22 Nov 2023 19:58:10 +0100 Subject: [PATCH v4 2/2] review fixes --- contrib/bloom/blutils.c | 1 + src/backend/access/brin/brin.c | 28 ++++++++----------- src/backend/access/gin/ginutil.c | 1 + src/backend/access/gist/gist.c | 1 + src/backend/access/hash/hash.c | 1 + src/backend/access/nbtree/nbtree.c | 1 + src/backend/access/spgist/spgutils.c | 1 + src/backend/catalog/index.c | 3 +- src/include/access/amapi.h | 2 ++ .../modules/dummy_index_am/dummy_index_am.c | 1 + 10 files changed, 22 insertions(+), 18 deletions(-) diff --git a/contrib/bloom/blutils.c b/contrib/bloom/blutils.c index f23fbb1d9e0..7451fb1b3bb 100644 --- a/contrib/bloom/blutils.c +++ b/contrib/bloom/blutils.c @@ -122,6 +122,7 @@ blhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amparallelvacuumoptions = diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index 0d3d728c9bf..e836cbaad0b 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -44,11 +44,11 @@ #include "utils/tuplesort.h" /* Magic numbers for parallel state sharing */ -#define PARALLEL_KEY_BRIN_SHARED UINT64CONST(0xA000000000000001) -#define PARALLEL_KEY_TUPLESORT UINT64CONST(0xA000000000000002) -#define PARALLEL_KEY_QUERY_TEXT UINT64CONST(0xA000000000000003) -#define PARALLEL_KEY_WAL_USAGE UINT64CONST(0xA000000000000004) -#define PARALLEL_KEY_BUFFER_USAGE UINT64CONST(0xA000000000000005) +#define PARALLEL_KEY_BRIN_SHARED UINT64CONST(0xB000000000000001) +#define PARALLEL_KEY_TUPLESORT UINT64CONST(0xB000000000000002) +#define PARALLEL_KEY_QUERY_TEXT UINT64CONST(0xB000000000000003) +#define PARALLEL_KEY_WAL_USAGE UINT64CONST(0xB000000000000004) +#define PARALLEL_KEY_BUFFER_USAGE UINT64CONST(0xB000000000000005) /* * Status record for spooling/sorting phase. @@ -161,7 +161,7 @@ typedef struct BrinLeader typedef struct BrinBuildState { Relation bs_irel; - int bs_numtuples; + double bs_numtuples; double bs_reltuples; Buffer bs_currentInsertBuf; BlockNumber bs_pagesPerRange; @@ -244,6 +244,7 @@ brinhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = true; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = true; @@ -960,7 +961,7 @@ brinbuildCallback(Relation index, /* * A version of the callback, used by parallel index builds. The main difference * is that instead of writing the BRIN tuples into the index, we write them into - * a shared tuplestore, and leave the insertion up to the leader (which may + * a shared tuplesort, and leave the insertion up to the leader (which may * reorder them a bit etc.). The callback also does not generate empty ranges, * those may be added by the leader when merging results from workers. */ @@ -1880,7 +1881,7 @@ form_and_insert_tuple(BrinBuildState *state) /* * Given a deformed tuple in the build state, convert it into the on-disk - * format and write it to a (shared) tuplestore (the leader will insert it + * format and write it to a (shared) tuplesort (the leader will insert it * into the index later). */ static void @@ -2419,7 +2420,7 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) BlockNumber prevblkno = InvalidBlockNumber; BrinTuple *emptyTuple = NULL; Size emptySize; - BrinSpool *spool = state->bs_spool; + BrinSpool *spool; /* Shutdown worker processes */ WaitForParallelWorkersToFinish(brinleader->pcxt); @@ -2431,6 +2432,8 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) state->bs_reltuples = brinshared->reltuples; state->bs_numtuples = brinshared->indtuples; + /* do the actual sort in the leader */ + spool = state->bs_spool; tuplesort_performsort(spool->sortstate); /* @@ -2443,13 +2446,6 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) * Read the BRIN tuples from the shared tuplesort, sorted by block number. * That probably gives us an index that is cheaper to scan, thanks to mostly * getting data from the same index page as before. - * - * FIXME This probably needs some memory management fixes - we're reading - * tuples from the tuplesort, we're allocating an empty tuple, and so on. - * Probably better to release this memory. - * - * XXX We can't quite free the BrinTuple, though, because that's a field - * in BrinSortTuple. */ while ((btup = tuplesort_getbrintuple(spool->sortstate, &tuplen, true)) != NULL) { diff --git a/src/backend/access/gin/ginutil.c b/src/backend/access/gin/ginutil.c index 7a4cd93f301..d4c9d678223 100644 --- a/src/backend/access/gin/ginutil.c +++ b/src/backend/access/gin/ginutil.c @@ -54,6 +54,7 @@ ginhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = true; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = true; amroutine->amsummarizing = false; diff --git a/src/backend/access/gist/gist.c b/src/backend/access/gist/gist.c index 8ef5fa03290..acec490912d 100644 --- a/src/backend/access/gist/gist.c +++ b/src/backend/access/gist/gist.c @@ -76,6 +76,7 @@ gisthandler(PG_FUNCTION_ARGS) amroutine->amclusterable = true; amroutine->ampredlocks = true; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = true; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/hash/hash.c b/src/backend/access/hash/hash.c index 7a025f33cfe..74592c7d428 100644 --- a/src/backend/access/hash/hash.c +++ b/src/backend/access/hash/hash.c @@ -73,6 +73,7 @@ hashhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = true; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/nbtree/nbtree.c b/src/backend/access/nbtree/nbtree.c index a88b36a589a..2aba6f5b91e 100644 --- a/src/backend/access/nbtree/nbtree.c +++ b/src/backend/access/nbtree/nbtree.c @@ -112,6 +112,7 @@ bthandler(PG_FUNCTION_ARGS) amroutine->amclusterable = true; amroutine->ampredlocks = true; amroutine->amcanparallel = true; + amroutine->amcanbuildparallel = true; amroutine->amcaninclude = true; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/spgist/spgutils.c b/src/backend/access/spgist/spgutils.c index c112e1e5dd4..77b6af694fb 100644 --- a/src/backend/access/spgist/spgutils.c +++ b/src/backend/access/spgist/spgutils.c @@ -60,6 +60,7 @@ spghandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = true; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/catalog/index.c b/src/backend/catalog/index.c index 37e4305d50a..40abbaf476b 100644 --- a/src/backend/catalog/index.c +++ b/src/backend/catalog/index.c @@ -2982,8 +2982,7 @@ index_build(Relation heapRelation, * Note that planner considers parallel safety for us. */ if (parallel && IsNormalProcessingMode() && - (indexRelation->rd_rel->relam == BTREE_AM_OID || - indexRelation->rd_rel->relam == BRIN_AM_OID)) + indexRelation->rd_indam->amcanbuildparallel) indexInfo->ii_ParallelWorkers = plan_create_index_workers(RelationGetRelid(heapRelation), RelationGetRelid(indexRelation)); diff --git a/src/include/access/amapi.h b/src/include/access/amapi.h index 995725502a6..408bb7595bb 100644 --- a/src/include/access/amapi.h +++ b/src/include/access/amapi.h @@ -240,6 +240,8 @@ typedef struct IndexAmRoutine bool ampredlocks; /* does AM support parallel scan? */ bool amcanparallel; + /* does AM support parallel build? */ + bool amcanbuildparallel; /* does AM support columns included with clause INCLUDE? */ bool amcaninclude; /* does AM use maintenance_work_mem? */ diff --git a/src/test/modules/dummy_index_am/dummy_index_am.c b/src/test/modules/dummy_index_am/dummy_index_am.c index cbdae7ab7a5..eaa0c483b7e 100644 --- a/src/test/modules/dummy_index_am/dummy_index_am.c +++ b/src/test/modules/dummy_index_am/dummy_index_am.c @@ -294,6 +294,7 @@ dihandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; -- 2.41.0 ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-23 12:33 Matthias van de Meent <[email protected]> parent: Tomas Vondra <[email protected]> 0 siblings, 1 reply; 25+ messages in thread From: Matthias van de Meent @ 2023-11-23 12:33 UTC (permalink / raw) To: Tomas Vondra <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> Hi, On Wed, 22 Nov 2023 at 20:16, Tomas Vondra <[email protected]> wrote: > > On 11/20/23 20:48, Matthias van de Meent wrote: >> On Wed, 8 Nov 2023 at 12:03, Tomas Vondra <[email protected]> wrote: >>> >>> Hi, >>> >>> here's an updated patch, addressing the review comments, and reworking >>> how the work is divided between the workers & leader etc. >>> >> >> After code-only review, here are some comments: >> >>> +++ b/src/backend/access/brin/brin.c >>> [...] >>> +/* Magic numbers for parallel state sharing */ >>> +#define PARALLEL_KEY_BRIN_SHARED UINT64CONST(0xA000000000000001) >>> +#define PARALLEL_KEY_TUPLESORT UINT64CONST(0xA000000000000002) >> >> These shm keys use the same constants also in use in >> access/nbtree/nbtsort.c. While this shouldn't be an issue in normal >> operations, I'd prefer if we didn't actively introduce conflicting >> identifiers when we still have significant amounts of unused values >> remaining. >> > > Hmmm. Is there some rule of thumb how to pick these key values? None that I know of. There is a warning in various places that define these constants that they take care to not conflict with plan node's node_id: parallel plan execution uses plain plan node IDs as keys, and as node_id is int-sized, any other key value that's created manually of value < 2^32 should be sure that it can't be executed in a parallel backend. But apart from that one case, I can't find a convention, no. >>> +#define PARALLEL_KEY_QUERY_TEXT UINT64CONST(0xA000000000000003) >> >> This is the fourth definition of a PARALLEL%_KEY_QUERY_TEXT, the >> others being in access/nbtree/nbtsort.c (value 0xA000000000000004, one >> more than brin's), backend/executor/execParallel.c >> (0xE000000000000008), and PARALLEL_VACUUM_KEY_QUERY_TEXT (0x3) (though >> I've not checked that their uses are exactly the same, I'd expect at >> least btree to match mostly, if not fully, 1:1). >> I think we could probably benefit from a less ad-hoc sharing of query >> texts. I don't think that needs to happen specifically in this patch, >> but I think it's something to keep in mind in future efforts. >> > > I'm afraid I don't quite get what you mean by "ad hoc sharing of query > texts". Are you saying we shouldn't propagate the query text to the > parallel workers? Why? Or what's the proper solution? What I mean is that we have several different keys that all look like they contain the debug query string, and always for the same debugging purposes. For debugging, I think it'd be useful to use one well-known key, rather than N well-known keys in each of the N parallel subsystems. But as mentioned, it doesn't need to happen in this patch, as that'd increase scope beyond brin/index ams. >>> + state->bs_numtuples = brinshared->indtuples; >> >> My IDE complains about bs_numtuples being an integer. This is a >> pre-existing issue, but still valid: we can hit an overflow on tables >> with pages_per_range=1 and relsize >= 2^31 pages. Extremely unlikely, >> but problematic nonetheless. >> > > True. I think I've been hesitant to make this a double because it seems > a bit weird to do +1 with a double, and at some point (d == d+1). But > this seems safe, we're guaranteed to be far away from that threshold. Yes, ignoring practical constraints like page space, we "only" have bitspace for 2^48 tuples in each (non-partitioned) relation, so double's 56 significant bits should be more than enough to count tuples. >> I also noticed that this is likely to execute `union_tuples` many >> times when pages_per_range is coprime with the parallel table scan's >> block stride (or when we for other reasons have many tuples returned >> for each range); and this `union_tuples` internally allocates and >> deletes its own memory context for its deserialization of the 'b' >> tuple. I think we should just pass a scratch context instead, so that >> we don't have the overhead of continously creating then deleting the >> same memory context > > Perhaps. Looking at the code, isn't it a bit strange how union_tuples > uses the context? It creates the context, calls brin_deform_tuple in > that context, but then the rest of the function (including datumCopy and > similar stuff) happens in the caller's context ... The union operator may leak (lots of) memory, so I think it makes sense to keep a context around that can be reset after we've extracted the merge result. > However, I don't think the number of union_tuples calls is likely to be > very high, especially for large tables. Because we split the table into > 2048 chunks, and then cap the chunk size by 8192. For large tables > (where this matters) we're likely close to 8192. I agree that the merging part of the index creation is the last part, and usually has no high impact on the total performance of the reindex operation, but in memory-constrained environments releasing and then requesting the same chunk of memory over and over again just isn't great. Also note that parallel scan chunk sizes decrease when we're about to hit the end of the table, and that a different AM may have different ideas about scanning a table in parallel; it could very well decide to use striped assignments exclusively, as opposed to on-demand chunk allocations; both increasing the chance that brin's page ranges are processed by more than one backend. >> As a project PostgreSQL seems to be trying to move away from >> hardcoding heap into everything in favour of the more AM-agnostic >> 'table'. I suggest replacing all mentions of "heap" in the arguments >> with "table", to reduce the work future maintainers need to do to fix >> this. > > I'm not against doing that, but I'd prefer to do that in a separate > patch. There's a bunch of preexisting heap references, so and I don't > want to introduce inconsistency (patch using table, old code heap) nor > do I want to tweak unrelated code. Sure. Kind regards, Matthias van de Meent Neon (https://neon.tech) ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-23 13:35 Tomas Vondra <[email protected]> parent: Matthias van de Meent <[email protected]> 0 siblings, 1 reply; 25+ messages in thread From: Tomas Vondra @ 2023-11-23 13:35 UTC (permalink / raw) To: Matthias van de Meent <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On 11/23/23 13:33, Matthias van de Meent wrote: > Hi, > > On Wed, 22 Nov 2023 at 20:16, Tomas Vondra > <[email protected]> wrote: >> >> On 11/20/23 20:48, Matthias van de Meent wrote: >>> On Wed, 8 Nov 2023 at 12:03, Tomas Vondra <[email protected]> wrote: >>>> >>>> Hi, >>>> >>>> here's an updated patch, addressing the review comments, and reworking >>>> how the work is divided between the workers & leader etc. >>>> >>> >>> After code-only review, here are some comments: >>> >>>> +++ b/src/backend/access/brin/brin.c >>>> [...] >>>> +/* Magic numbers for parallel state sharing */ >>>> +#define PARALLEL_KEY_BRIN_SHARED UINT64CONST(0xA000000000000001) >>>> +#define PARALLEL_KEY_TUPLESORT UINT64CONST(0xA000000000000002) >>> >>> These shm keys use the same constants also in use in >>> access/nbtree/nbtsort.c. While this shouldn't be an issue in normal >>> operations, I'd prefer if we didn't actively introduce conflicting >>> identifiers when we still have significant amounts of unused values >>> remaining. >>> >> >> Hmmm. Is there some rule of thumb how to pick these key values? > > None that I know of. > There is a warning in various places that define these constants that > they take care to not conflict with plan node's node_id: parallel plan > execution uses plain plan node IDs as keys, and as node_id is > int-sized, any other key value that's created manually of value < 2^32 > should be sure that it can't be executed in a parallel backend. > But apart from that one case, I can't find a convention, no. > OK, in that case 0xB is fine. >>>> +#define PARALLEL_KEY_QUERY_TEXT UINT64CONST(0xA000000000000003) >>> >>> This is the fourth definition of a PARALLEL%_KEY_QUERY_TEXT, the >>> others being in access/nbtree/nbtsort.c (value 0xA000000000000004, one >>> more than brin's), backend/executor/execParallel.c >>> (0xE000000000000008), and PARALLEL_VACUUM_KEY_QUERY_TEXT (0x3) (though >>> I've not checked that their uses are exactly the same, I'd expect at >>> least btree to match mostly, if not fully, 1:1). >>> I think we could probably benefit from a less ad-hoc sharing of query >>> texts. I don't think that needs to happen specifically in this patch, >>> but I think it's something to keep in mind in future efforts. >>> >> >> I'm afraid I don't quite get what you mean by "ad hoc sharing of query >> texts". Are you saying we shouldn't propagate the query text to the >> parallel workers? Why? Or what's the proper solution? > > What I mean is that we have several different keys that all look like > they contain the debug query string, and always for the same debugging > purposes. For debugging, I think it'd be useful to use one well-known > key, rather than N well-known keys in each of the N parallel > subsystems. > > But as mentioned, it doesn't need to happen in this patch, as that'd > increase scope beyond brin/index ams. > Agreed. >>> I also noticed that this is likely to execute `union_tuples` many >>> times when pages_per_range is coprime with the parallel table scan's >>> block stride (or when we for other reasons have many tuples returned >>> for each range); and this `union_tuples` internally allocates and >>> deletes its own memory context for its deserialization of the 'b' >>> tuple. I think we should just pass a scratch context instead, so that >>> we don't have the overhead of continously creating then deleting the >>> same memory context >> >> Perhaps. Looking at the code, isn't it a bit strange how union_tuples >> uses the context? It creates the context, calls brin_deform_tuple in >> that context, but then the rest of the function (including datumCopy and >> similar stuff) happens in the caller's context ... > > The union operator may leak (lots of) memory, so I think it makes > sense to keep a context around that can be reset after we've extracted > the merge result. > But does the current code actually achieve that? It does create a "brin union" context, but then it only does this: /* Use our own memory context to avoid retail pfree */ cxt = AllocSetContextCreate(CurrentMemoryContext, "brin union", ALLOCSET_DEFAULT_SIZES); oldcxt = MemoryContextSwitchTo(cxt); db = brin_deform_tuple(bdesc, b, NULL); MemoryContextSwitchTo(oldcxt); Surely that does not limit the amount of memory used by the actual union functions in any way? >> However, I don't think the number of union_tuples calls is likely to be >> very high, especially for large tables. Because we split the table into >> 2048 chunks, and then cap the chunk size by 8192. For large tables >> (where this matters) we're likely close to 8192. > > I agree that the merging part of the index creation is the last part, > and usually has no high impact on the total performance of the reindex > operation, but in memory-constrained environments releasing and then > requesting the same chunk of memory over and over again just isn't > great. OK, I'll take a look at the scratch context you suggested. My point however was we won't actually do that very often, because on large tables the BRIN ranges are likely smaller than the parallel scan chunk size, so few overlaps. OTOH if the table is small, or if the BRIN ranges are large, there'll be few of them. > Also note that parallel scan chunk sizes decrease when we're about to > hit the end of the table, and that a different AM may have different > ideas about scanning a table in parallel; it could very well decide to > use striped assignments exclusively, as opposed to on-demand chunk > allocations; both increasing the chance that brin's page ranges are > processed by more than one backend. > Yeah, but the ramp-up and ramp-down should have negligible impact, IMO. regards -- Tomas Vondra EnterpriseDB: http://www.enterprisedb.com The Enterprise PostgreSQL Company ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-28 15:39 Matthias van de Meent <[email protected]> parent: Tomas Vondra <[email protected]> 0 siblings, 1 reply; 25+ messages in thread From: Matthias van de Meent @ 2023-11-28 15:39 UTC (permalink / raw) To: Tomas Vondra <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On Thu, 23 Nov 2023 at 14:35, Tomas Vondra <[email protected]> wrote: > On 11/23/23 13:33, Matthias van de Meent wrote: >> The union operator may leak (lots of) memory, so I think it makes >> sense to keep a context around that can be reset after we've extracted >> the merge result. >> > > But does the current code actually achieve that? It does create a "brin > union" context, but then it only does this: > > /* Use our own memory context to avoid retail pfree */ > cxt = AllocSetContextCreate(CurrentMemoryContext, > "brin union", > ALLOCSET_DEFAULT_SIZES); > oldcxt = MemoryContextSwitchTo(cxt); > db = brin_deform_tuple(bdesc, b, NULL); > MemoryContextSwitchTo(oldcxt); > > Surely that does not limit the amount of memory used by the actual union > functions in any way? Oh, yes, of course. For some reason I thought that covered the calls to the union operator function too, but it indeed only covers deserialization. I do think it is still worthwhile to not do the create/delete cycle, but won't hold the patch back for that. >>> However, I don't think the number of union_tuples calls is likely to be >>> very high, especially for large tables. Because we split the table into >>> 2048 chunks, and then cap the chunk size by 8192. For large tables >>> (where this matters) we're likely close to 8192. >> >> I agree that the merging part of the index creation is the last part, >> and usually has no high impact on the total performance of the reindex >> operation, but in memory-constrained environments releasing and then >> requesting the same chunk of memory over and over again just isn't >> great. > > OK, I'll take a look at the scratch context you suggested. > > My point however was we won't actually do that very often, because on > large tables the BRIN ranges are likely smaller than the parallel scan > chunk size, so few overlaps. OTOH if the table is small, or if the BRIN > ranges are large, there'll be few of them. That's true, so maybe I'm concerned about something that amounts to only marginal gains. I noticed that the v4 patch doesn't yet update the documentation in indexam.sgml with am->amcanbuildparallel. Once that is included and reviewed I think this will be ready, unless you want to address any of my comments upthread (that I marked with 'not in this patch') in this patch. Kind regards, Matthias van de Meent Neon (https://neon.tech) ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-28 17:59 Tomas Vondra <[email protected]> parent: Matthias van de Meent <[email protected]> 0 siblings, 1 reply; 25+ messages in thread From: Tomas Vondra @ 2023-11-28 17:59 UTC (permalink / raw) To: Matthias van de Meent <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On 11/28/23 16:39, Matthias van de Meent wrote: > On Thu, 23 Nov 2023 at 14:35, Tomas Vondra > <[email protected]> wrote: >> On 11/23/23 13:33, Matthias van de Meent wrote: >>> The union operator may leak (lots of) memory, so I think it makes >>> sense to keep a context around that can be reset after we've extracted >>> the merge result. >>> >> >> But does the current code actually achieve that? It does create a "brin >> union" context, but then it only does this: >> >> /* Use our own memory context to avoid retail pfree */ >> cxt = AllocSetContextCreate(CurrentMemoryContext, >> "brin union", >> ALLOCSET_DEFAULT_SIZES); >> oldcxt = MemoryContextSwitchTo(cxt); >> db = brin_deform_tuple(bdesc, b, NULL); >> MemoryContextSwitchTo(oldcxt); >> >> Surely that does not limit the amount of memory used by the actual union >> functions in any way? > > Oh, yes, of course. For some reason I thought that covered the calls > to the union operator function too, but it indeed only covers > deserialization. I do think it is still worthwhile to not do the > create/delete cycle, but won't hold the patch back for that. > I think the union_tuples() changes are better left for a separate patch. >>>> However, I don't think the number of union_tuples calls is likely to be >>>> very high, especially for large tables. Because we split the table into >>>> 2048 chunks, and then cap the chunk size by 8192. For large tables >>>> (where this matters) we're likely close to 8192. >>> >>> I agree that the merging part of the index creation is the last part, >>> and usually has no high impact on the total performance of the reindex >>> operation, but in memory-constrained environments releasing and then >>> requesting the same chunk of memory over and over again just isn't >>> great. >> >> OK, I'll take a look at the scratch context you suggested. >> >> My point however was we won't actually do that very often, because on >> large tables the BRIN ranges are likely smaller than the parallel scan >> chunk size, so few overlaps. OTOH if the table is small, or if the BRIN >> ranges are large, there'll be few of them. > > That's true, so maybe I'm concerned about something that amounts to > only marginal gains. > However, after thinking about this a bit more, I think we actually do need to do something about the memory management when merging tuples. AFAIK the general assumption was that union_tuple() only runs for a single range, and then the whole context gets freed. But the way the merging was implemented, it all runs in a single context. And while a single union_tuple() may not need a lot memory, in total it may be annoying. I just added a palloc(1MB) into union_tuples and ended up with ~160MB allocated in the PortalContext on just 2GB table. In practice the memory will grow more slowly, but not great :-/ The attached 0003 patch adds a memory context that's reset after producing a merged BRIN tuple for each page range. > I noticed that the v4 patch doesn't yet update the documentation in > indexam.sgml with am->amcanbuildparallel. Should be fixed by 0002. I decided to add a simple note to ambuild(), not sure if something more is needed. > Once that is included and reviewed I think this will be ready, unless > you want to address any of my comments upthread (that I marked with > 'not in this patch') in this patch. > Thanks. I believe the attached version addresses it. There's also 0004 with some indentation tweaks per pgindent. regards -- Tomas Vondra EnterpriseDB: http://www.enterprisedb.com The Enterprise PostgreSQL Company Attachments: [text/x-patch] v20231128-0001-parallel-CREATE-INDEX-for-BRIN-v3.patch (48.8K, ../../[email protected]/2-v20231128-0001-parallel-CREATE-INDEX-for-BRIN-v3.patch) download | inline diff: From 219a451250cbbbc1235c60f4776c2ee6bc84432d Mon Sep 17 00:00:00 2001 From: Tomas Vondra <[email protected]> Date: Tue, 7 Nov 2023 17:04:28 +0100 Subject: [PATCH v20231128 1/4] parallel CREATE INDEX for BRIN v3 --- contrib/bloom/blutils.c | 1 + src/backend/access/brin/brin.c | 866 +++++++++++++++++- src/backend/access/gin/ginutil.c | 1 + src/backend/access/gist/gist.c | 1 + src/backend/access/hash/hash.c | 1 + src/backend/access/nbtree/nbtree.c | 1 + src/backend/access/spgist/spgutils.c | 1 + src/backend/access/transam/parallel.c | 4 + src/backend/catalog/index.c | 2 +- src/backend/utils/sort/tuplesortvariants.c | 207 +++++ src/include/access/amapi.h | 2 + src/include/access/brin.h | 3 + src/include/utils/tuplesort.h | 11 + .../modules/dummy_index_am/dummy_index_am.c | 1 + 14 files changed, 1096 insertions(+), 6 deletions(-) diff --git a/contrib/bloom/blutils.c b/contrib/bloom/blutils.c index 4830cb3fee6..a781c5d98d6 100644 --- a/contrib/bloom/blutils.c +++ b/contrib/bloom/blutils.c @@ -122,6 +122,7 @@ blhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amparallelvacuumoptions = diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index 4f2dfdd17b9..0c6ca1ac18c 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -33,6 +33,7 @@ #include "postmaster/autovacuum.h" #include "storage/bufmgr.h" #include "storage/freespace.h" +#include "tcop/tcopprot.h" /* pgrminclude ignore */ #include "utils/acl.h" #include "utils/builtins.h" #include "utils/datum.h" @@ -40,7 +41,118 @@ #include "utils/index_selfuncs.h" #include "utils/memutils.h" #include "utils/rel.h" +#include "utils/tuplesort.h" +/* Magic numbers for parallel state sharing */ +#define PARALLEL_KEY_BRIN_SHARED UINT64CONST(0xB000000000000001) +#define PARALLEL_KEY_TUPLESORT UINT64CONST(0xB000000000000002) +#define PARALLEL_KEY_QUERY_TEXT UINT64CONST(0xB000000000000003) +#define PARALLEL_KEY_WAL_USAGE UINT64CONST(0xB000000000000004) +#define PARALLEL_KEY_BUFFER_USAGE UINT64CONST(0xB000000000000005) + +/* + * Status record for spooling/sorting phase. + */ +typedef struct BrinSpool +{ + Tuplesortstate *sortstate; /* state data for tuplesort.c */ + Relation heap; + Relation index; +} BrinSpool; + +/* + * Status for index builds performed in parallel. This is allocated in a + * dynamic shared memory segment. + */ +typedef struct BrinShared +{ + /* + * These fields are not modified during the build. They primarily exist for + * the benefit of worker processes that need to create state corresponding + * to that used by the leader. + */ + Oid heaprelid; + Oid indexrelid; + bool isconcurrent; + BlockNumber pagesPerRange; + int scantuplesortstates; + + /* + * workersdonecv is used to monitor the progress of workers. All parallel + * participants must indicate that they are done before leader can use + * results built by the workers (and before leader can write the data into + * the index). + */ + ConditionVariable workersdonecv; + + /* + * mutex protects all fields before heapdesc. + * + * These fields contain status information of interest to BRIN index + * builds that must work just the same when an index is built in parallel. + */ + slock_t mutex; + + /* + * Mutable state that is maintained by workers, and reported back to + * leader at end of the scans. + * + * nparticipantsdone is number of worker processes finished. + * + * reltuples is the total number of input heap tuples. + * + * indtuples is the total number of tuples that made it into the index. + */ + int nparticipantsdone; + double reltuples; + double indtuples; + + /* + * ParallelTableScanDescData data follows. Can't directly embed here, as + * implementations of the parallel table scan desc interface might need + * stronger alignment. + */ +} BrinShared; + +/* + * Return pointer to a BrinShared's parallel table scan. + * + * c.f. shm_toc_allocate as to why BUFFERALIGN is used, rather than just + * MAXALIGN. + */ +#define ParallelTableScanFromBrinShared(shared) \ + (ParallelTableScanDesc) ((char *) (shared) + BUFFERALIGN(sizeof(BrinShared))) + +/* + * Status for leader in parallel index build. + */ +typedef struct BrinLeader +{ + /* parallel context itself */ + ParallelContext *pcxt; + + /* + * nparticipanttuplesorts is the exact number of worker processes + * successfully launched, plus one leader process if it participates as a + * worker (only DISABLE_LEADER_PARTICIPATION builds avoid leader + * participating as a worker). + */ + int nparticipanttuplesorts; + + /* + * Leader process convenience pointers to shared state (leader avoids TOC + * lookups). + * + * brinshared is the shared state for entire build. sharedsort is the + * shared, tuplesort-managed state passed to each process tuplesort. + * snapshot is the snapshot used by the scan iff an MVCC snapshot is required. + */ + BrinShared *brinshared; + Sharedsort *sharedsort; + Snapshot snapshot; + WalUsage *walusage; + BufferUsage *bufferusage; +} BrinLeader; /* * We use a BrinBuildState during initial construction of a BRIN index. @@ -49,13 +161,23 @@ typedef struct BrinBuildState { Relation bs_irel; - int bs_numtuples; + double bs_numtuples; + double bs_reltuples; Buffer bs_currentInsertBuf; BlockNumber bs_pagesPerRange; BlockNumber bs_currRangeStart; BrinRevmap *bs_rmAccess; BrinDesc *bs_bdesc; BrinMemTuple *bs_dtuple; + + /* + * bs_leader is only present when a parallel index build is performed, and + * only in the leader process. (Actually, only the leader process has a + * BrinBuildState.) + */ + BrinLeader *bs_leader; + int bs_worker_id; + BrinSpool *bs_spool; } BrinBuildState; /* @@ -88,6 +210,7 @@ static void terminate_brin_buildstate(BrinBuildState *state); static void brinsummarize(Relation index, Relation heapRel, BlockNumber pageRange, bool include_partial, double *numSummarized, double *numExisting); static void form_and_insert_tuple(BrinBuildState *state); +static void form_and_spill_tuple(BrinBuildState *state); static void union_tuples(BrinDesc *bdesc, BrinMemTuple *a, BrinTuple *b); static void brin_vacuum_scan(Relation idxrel, BufferAccessStrategy strategy); @@ -95,6 +218,20 @@ static bool add_values_to_range(Relation idxRel, BrinDesc *bdesc, BrinMemTuple *dtup, const Datum *values, const bool *nulls); static bool check_null_keys(BrinValues *bval, ScanKey *nullkeys, int nnullkeys); +/* parallel index builds */ +static void _brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, + bool isconcurrent, int request); +static void _brin_end_parallel(BrinLeader *btleader, BrinBuildState *state); +static Size _brin_parallel_estimate_shared(Relation heap, Snapshot snapshot); +static void _brin_leader_participate_as_worker(BrinBuildState *buildstate, + Relation heap, Relation index); +static void _brin_parallel_scan_and_build(BrinBuildState *buildstate, + BrinSpool *brinspool, + BrinShared *brinshared, + Sharedsort *sharedsort, + Relation heap, Relation index, + int sortmem, bool progress); + /* * BRIN handler function: return IndexAmRoutine with access method parameters * and callbacks. @@ -119,6 +256,7 @@ brinhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = true; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = true; @@ -874,6 +1012,63 @@ brinbuildCallback(Relation index, values, isnull); } +/* + * A version of the callback, used by parallel index builds. The main difference + * is that instead of writing the BRIN tuples into the index, we write them into + * a shared tuplesort, and leave the insertion up to the leader (which may + * reorder them a bit etc.). The callback also does not generate empty ranges, + * those may be added by the leader when merging results from workers. + */ +static void +brinbuildCallbackParallel(Relation index, + ItemPointer tid, + Datum *values, + bool *isnull, + bool tupleIsAlive, + void *brstate) +{ + BrinBuildState *state = (BrinBuildState *) brstate; + BlockNumber thisblock; + + thisblock = ItemPointerGetBlockNumber(tid); + + /* + * If we're in a block that belongs to a future range, summarize what + * we've got and start afresh. Note the scan might have skipped many + * pages, if they were devoid of live tuples; we do not create emptry + * BRIN ranges here - the leader is responsible for filling them in. + */ + if (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) + { + + BRIN_elog((DEBUG2, + "brinbuildCallback: completed a range: %u--%u", + state->bs_currRangeStart, + state->bs_currRangeStart + state->bs_pagesPerRange)); + + /* create the index tuple and write it into the tuplesort */ + form_and_spill_tuple(state); + + /* + * Set state to correspond to the next range (for this block). + * + * This skips ranges that are either empty (and so we don't get any + * tuples to summarize), or processes by other workers. We can't + * differentiate those cases here easily, so we leave it up to the + * leader to fill empty ranges where needed. + */ + state->bs_currRangeStart + = state->bs_pagesPerRange * (thisblock / state->bs_pagesPerRange); + + /* re-initialize state for it */ + brin_memtuple_initialize(state->bs_dtuple, state->bs_bdesc); + } + + /* Accumulate the current tuple into the running state */ + (void) add_values_to_range(index, state->bs_bdesc, state->bs_dtuple, + values, isnull); +} + /* * brinbuild() -- build a new BRIN index. */ @@ -935,18 +1130,89 @@ brinbuild(Relation heap, Relation index, IndexInfo *indexInfo) revmap = brinRevmapInitialize(index, &pagesPerRange); state = initialize_brin_buildstate(index, revmap, pagesPerRange); + state->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + state->bs_spool->heap = heap; + state->bs_spool->index = index; + + /* + * Attempt to launch parallel worker scan when required + * + * XXX plan_create_index_workers makes the number of workers dependent on + * maintenance_work_mem, requiring 32MB for each worker. That makes sense + * for btree, but not for BRIN, which can do away with much less memory. + * So maybe make that somehow less strict, optionally? + */ + if (indexInfo->ii_ParallelWorkers > 0) + _brin_begin_parallel(state, heap, index, indexInfo->ii_Concurrent, + indexInfo->ii_ParallelWorkers); + /* * Now scan the relation. No syncscan allowed here because we want the * heap blocks in physical order. */ - reltuples = table_index_build_scan(heap, index, indexInfo, false, true, - brinbuildCallback, (void *) state, NULL); - /* process the final batch */ - form_and_insert_tuple(state); + /* + * If parallel build requested and at least one worker process was + * successfully launched, set up coordination state + */ + if (state->bs_leader) + { + SortCoordinate coordinate; + + coordinate = (SortCoordinate) palloc0(sizeof(SortCoordinateData)); + coordinate->isWorker = false; + coordinate->nParticipants = + state->bs_leader->nparticipanttuplesorts; + coordinate->sharedsort = state->bs_leader->sharedsort; + + + /* + * Begin serial/leader tuplesort. + * + * In cases where parallelism is involved, the leader receives the same + * share of maintenance_work_mem as a serial sort (it is generally treated + * in the same way as a serial sort once we return). Parallel worker + * Tuplesortstates will have received only a fraction of + * maintenance_work_mem, though. + * + * We rely on the lifetime of the Leader Tuplesortstate almost not + * overlapping with any worker Tuplesortstate's lifetime. There may be + * some small overlap, but that's okay because we rely on leader + * Tuplesortstate only allocating a small, fixed amount of memory here. + * When its tuplesort_performsort() is called (by our caller), and + * significant amounts of memory are likely to be used, all workers must + * have already freed almost all memory held by their Tuplesortstates + * (they are about to go away completely, too). The overall effect is + * that maintenance_work_mem always represents an absolute high watermark + * on the amount of memory used by a CREATE INDEX operation, regardless of + * the use of parallelism or any other factor. + */ + state->bs_spool->sortstate = + tuplesort_begin_index_brin(heap, index, + maintenance_work_mem, coordinate, + TUPLESORT_NONE); + + /* + * In parallel mode, wait for workers to complete, and then read all + * tuples from the shared tuplesort and insert them into the index. + */ + _brin_end_parallel(state->bs_leader, state); + } + else /* no parallel index build, just do the usual thing */ + { + reltuples = table_index_build_scan(heap, index, indexInfo, false, true, + brinbuildCallback, (void *) state, NULL); + + /* process the final batch */ + form_and_insert_tuple(state); + + /* track the number of relation tuples */ + state->bs_reltuples = reltuples; + } /* release resources */ idxtuples = state->bs_numtuples; + reltuples = state->bs_reltuples; brinRevmapTerminate(state->bs_rmAccess); terminate_brin_buildstate(state); @@ -1366,12 +1632,16 @@ initialize_brin_buildstate(Relation idxRel, BrinRevmap *revmap, state->bs_irel = idxRel; state->bs_numtuples = 0; + state->bs_reltuples = 0; state->bs_currentInsertBuf = InvalidBuffer; state->bs_pagesPerRange = pagesPerRange; state->bs_currRangeStart = 0; state->bs_rmAccess = revmap; state->bs_bdesc = brin_build_desc(idxRel); state->bs_dtuple = brin_new_memtuple(state->bs_bdesc); + state->bs_leader = NULL; + state->bs_worker_id = 0; + state->bs_spool = NULL; return state; } @@ -1663,6 +1933,32 @@ form_and_insert_tuple(BrinBuildState *state) pfree(tup); } +/* + * Given a deformed tuple in the build state, convert it into the on-disk + * format and write it to a (shared) tuplesort (the leader will insert it + * into the index later). + */ +static void +form_and_spill_tuple(BrinBuildState *state) +{ + BrinTuple *tup; + Size size; + + /* don't insert empty tuples in parallel build */ + if (state->bs_dtuple->bt_empty_range) + return; + + tup = brin_form_tuple(state->bs_bdesc, state->bs_currRangeStart, + state->bs_dtuple, &size); + + /* write the BRIN tuple to the tuplesort */ + tuplesort_putbrintuple(state->bs_spool->sortstate, tup, size); + + state->bs_numtuples++; + + pfree(tup); +} + /* * Given two deformed tuples, adjust the first one so that it's consistent * with the summary values in both. @@ -1982,3 +2278,563 @@ check_null_keys(BrinValues *bval, ScanKey *nullkeys, int nnullkeys) return true; } + +static void +_brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, + bool isconcurrent, int request) +{ + ParallelContext *pcxt; + int scantuplesortstates; + Snapshot snapshot; + Size estbrinshared; + Size estsort; + BrinShared *brinshared; + Sharedsort *sharedsort; + BrinLeader *brinleader = (BrinLeader *) palloc0(sizeof(BrinLeader)); + WalUsage *walusage; + BufferUsage *bufferusage; + bool leaderparticipates = true; + int querylen; + +#ifdef DISABLE_LEADER_PARTICIPATION + leaderparticipates = false; +#endif + + /* + * Enter parallel mode, and create context for parallel build of brin + * index + */ + EnterParallelMode(); + Assert(request > 0); + pcxt = CreateParallelContext("postgres", "_brin_parallel_build_main", + request); + + scantuplesortstates = leaderparticipates ? request + 1 : request; + + /* + * Prepare for scan of the base relation. In a normal index build, we use + * SnapshotAny because we must retrieve all tuples and do our own time + * qual checks (because we have to index RECENTLY_DEAD tuples). In a + * concurrent build, we take a regular MVCC snapshot and index whatever's + * live according to that. + */ + if (!isconcurrent) + snapshot = SnapshotAny; + else + snapshot = RegisterSnapshot(GetTransactionSnapshot()); + + /* + * Estimate size for our own PARALLEL_KEY_BRIN_SHARED workspace. + */ + estbrinshared = _brin_parallel_estimate_shared(heap, snapshot); + shm_toc_estimate_chunk(&pcxt->estimator, estbrinshared); + estsort = tuplesort_estimate_shared(scantuplesortstates); + shm_toc_estimate_chunk(&pcxt->estimator, estsort); + + shm_toc_estimate_keys(&pcxt->estimator, 2); + + /* + * Estimate space for WalUsage and BufferUsage -- PARALLEL_KEY_WAL_USAGE + * and PARALLEL_KEY_BUFFER_USAGE. + * + * If there are no extensions loaded that care, we could skip this. We + * have no way of knowing whether anyone's looking at pgWalUsage or + * pgBufferUsage, so do it unconditionally. + */ + shm_toc_estimate_chunk(&pcxt->estimator, + mul_size(sizeof(WalUsage), pcxt->nworkers)); + shm_toc_estimate_keys(&pcxt->estimator, 1); + shm_toc_estimate_chunk(&pcxt->estimator, + mul_size(sizeof(BufferUsage), pcxt->nworkers)); + shm_toc_estimate_keys(&pcxt->estimator, 1); + + /* Finally, estimate PARALLEL_KEY_QUERY_TEXT space */ + if (debug_query_string) + { + querylen = strlen(debug_query_string); + shm_toc_estimate_chunk(&pcxt->estimator, querylen + 1); + shm_toc_estimate_keys(&pcxt->estimator, 1); + } + else + querylen = 0; /* keep compiler quiet */ + + /* Everyone's had a chance to ask for space, so now create the DSM */ + InitializeParallelDSM(pcxt); + + /* If no DSM segment was available, back out (do serial build) */ + if (pcxt->seg == NULL) + { + if (IsMVCCSnapshot(snapshot)) + UnregisterSnapshot(snapshot); + DestroyParallelContext(pcxt); + ExitParallelMode(); + return; + } + + /* Store shared build state, for which we reserved space */ + brinshared = (BrinShared *) shm_toc_allocate(pcxt->toc, estbrinshared); + /* Initialize immutable state */ + brinshared->heaprelid = RelationGetRelid(heap); + brinshared->indexrelid = RelationGetRelid(index); + brinshared->isconcurrent = isconcurrent; + brinshared->scantuplesortstates = scantuplesortstates; + brinshared->pagesPerRange = buildstate->bs_pagesPerRange; + ConditionVariableInit(&brinshared->workersdonecv); + SpinLockInit(&brinshared->mutex); + + /* Initialize mutable state */ + brinshared->nparticipantsdone = 0; + brinshared->reltuples = 0.0; + brinshared->indtuples = 0.0; + + table_parallelscan_initialize(heap, + ParallelTableScanFromBrinShared(brinshared), + snapshot); + + /* + * Store shared tuplesort-private state, for which we reserved space. + * Then, initialize opaque state using tuplesort routine. + */ + sharedsort = (Sharedsort *) shm_toc_allocate(pcxt->toc, estsort); + tuplesort_initialize_shared(sharedsort, scantuplesortstates, + pcxt->seg); + + /* + * Store shared tuplesort-private state, for which we reserved space. + * Then, initialize opaque state using tuplesort routine. + */ + shm_toc_insert(pcxt->toc, PARALLEL_KEY_BRIN_SHARED, brinshared); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_TUPLESORT, sharedsort); + + /* Store query string for workers */ + if (debug_query_string) + { + char *sharedquery; + + sharedquery = (char *) shm_toc_allocate(pcxt->toc, querylen + 1); + memcpy(sharedquery, debug_query_string, querylen + 1); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_QUERY_TEXT, sharedquery); + } + + /* + * Allocate space for each worker's WalUsage and BufferUsage; no need to + * initialize. + */ + walusage = shm_toc_allocate(pcxt->toc, + mul_size(sizeof(WalUsage), pcxt->nworkers)); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_WAL_USAGE, walusage); + bufferusage = shm_toc_allocate(pcxt->toc, + mul_size(sizeof(BufferUsage), pcxt->nworkers)); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_BUFFER_USAGE, bufferusage); + + /* Launch workers, saving status for leader/caller */ + LaunchParallelWorkers(pcxt); + brinleader->pcxt = pcxt; + brinleader->nparticipanttuplesorts = pcxt->nworkers_launched; + if (leaderparticipates) + brinleader->nparticipanttuplesorts++; + brinleader->brinshared = brinshared; + brinleader->sharedsort = sharedsort; + brinleader->snapshot = snapshot; + brinleader->walusage = walusage; + brinleader->bufferusage = bufferusage; + + /* If no workers were successfully launched, back out (do serial build) */ + if (pcxt->nworkers_launched == 0) + { + _brin_end_parallel(brinleader, NULL); + return; + } + + /* Save leader state now that it's clear build will be parallel */ + buildstate->bs_leader = brinleader; + + /* Join heap scan ourselves */ + if (leaderparticipates) + _brin_leader_participate_as_worker(buildstate, heap, index); + + /* + * Caller needs to wait for all launched workers when we return. Make + * sure that the failure-to-start case will not hang forever. + */ + WaitForParallelWorkersToAttach(pcxt); +} + +/* + * Shut down workers, destroy parallel context, and end parallel mode. + */ +static void +_brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) +{ + int i; + BrinTuple *btup; + BrinMemTuple *memtuple = NULL; + Size tuplen; + BrinShared *brinshared = brinleader->brinshared; + BlockNumber prevblkno = InvalidBlockNumber; + BrinTuple *emptyTuple = NULL; + Size emptySize; + BrinSpool *spool; + + /* Shutdown worker processes */ + WaitForParallelWorkersToFinish(brinleader->pcxt); + + if (!state) + return; + + /* copy the data into leader state (we have to wait for the workers ) */ + state->bs_reltuples = brinshared->reltuples; + state->bs_numtuples = brinshared->indtuples; + + /* do the actual sort in the leader */ + spool = state->bs_spool; + tuplesort_performsort(spool->sortstate); + + /* + * Initialize BrinMemTuple we'll use to union summaries from workers + * (in case they happened to produce parts of the same paga range). + */ + memtuple = brin_new_memtuple(state->bs_bdesc); + + /* + * Read the BRIN tuples from the shared tuplesort, sorted by block number. + * That probably gives us an index that is cheaper to scan, thanks to mostly + * getting data from the same index page as before. + */ + while ((btup = tuplesort_getbrintuple(spool->sortstate, &tuplen, true)) != NULL) + { + /* Ranges should be multiples of pages_per_range for the index. */ + Assert(btup->bt_blkno % brinshared->pagesPerRange == 0); + + /* + * Do we need to union summaries for the same page range? + * + * If this is the first brin tuple we read, then just deform it into + * the memtuple, and continue with the next one from tuplesort. We + * however may need to insert empty summaries into the index. + * + * If it's the same block as the last we saw, we simply union the + * brin tuple into it, and we're done - we don't even need to insert + * empty ranges, because that was done earlier when we saw the first + * brin tuple (for this range). + * + * Finally, if it's not the first brin tuple, and it's not the same + * page range, we need to do the insert and then deform the tuple + * into the memtuple. Then we'll insert empty ranges before the + * new brin tuple, if needed. + */ + if (prevblkno == InvalidBlockNumber) + { + /* First brin tuples, just deform into memtuple. */ + memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); + + /* continue to insert empty pages before thisblock */ + } + else if (memtuple->bt_blkno == btup->bt_blkno) + { + /* + * Not the first brin tuple, but same page range as the previous + * one, so we can merge it into the memtuple. + */ + union_tuples(state->bs_bdesc, memtuple, btup); + continue; + } + else + { + BrinTuple *tmp; + Size len; + + /* + * We got brin tuple for a different page range, so form a brin + * tuple from the memtuple, insert it, and re-init the memtuple + * from the new brin tuple. + */ + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); + + /* free the formed on-disk tuple */ + pfree(tmp); + + memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); + + /* continue to insert empty pages before thisblock */ + } + + /* Fill empty ranges for all ranges missing in the tuplesort. */ + prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; + while (prevblkno + state->bs_pagesPerRange < btup->bt_blkno) + { + /* the missing range */ + prevblkno += state->bs_pagesPerRange; + + /* Did we already build the empty range? If not, do it now. */ + if (emptyTuple == NULL) + { + BrinMemTuple *dtuple = brin_new_memtuple(state->bs_bdesc); + + emptyTuple = brin_form_tuple(state->bs_bdesc, prevblkno, dtuple, &emptySize); + } + else + { + /* we already have am "empty range" tuple, just set the block */ + emptyTuple->bt_blkno = prevblkno; + } + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, + emptyTuple->bt_blkno, emptyTuple, emptySize); + } + + prevblkno = btup->bt_blkno; + } + + tuplesort_end(spool->sortstate); + + /* Fill empty ranges for all ranges missing in the tuplesort. */ + prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; + while (prevblkno + state->bs_pagesPerRange < memtuple->bt_blkno) + { + /* the missing range */ + prevblkno += state->bs_pagesPerRange; + + /* Did we already build the empty range? If not, do it now. */ + if (emptyTuple == NULL) + { + BrinMemTuple *dtuple = brin_new_memtuple(state->bs_bdesc); + + emptyTuple = brin_form_tuple(state->bs_bdesc, prevblkno, dtuple, &emptySize); + } + else + { + /* we already have am "empty range" tuple, just set the block */ + emptyTuple->bt_blkno = prevblkno; + } + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, + emptyTuple->bt_blkno, emptyTuple, emptySize); + } + + /**/ + if (prevblkno != InvalidBlockNumber) + { + BrinTuple *tmp; + Size len; + + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); + + pfree(tmp); + } + + /* + * Next, accumulate WAL usage. (This must wait for the workers to finish, + * or we might get incomplete data.) + */ + for (i = 0; i < brinleader->pcxt->nworkers_launched; i++) + InstrAccumParallelQuery(&brinleader->bufferusage[i], &brinleader->walusage[i]); + + /* Free last reference to MVCC snapshot, if one was used */ + if (IsMVCCSnapshot(brinleader->snapshot)) + UnregisterSnapshot(brinleader->snapshot); + DestroyParallelContext(brinleader->pcxt); + ExitParallelMode(); +} + +/* + * Returns size of shared memory required to store state for a parallel + * brin index build based on the snapshot its parallel scan will use. + */ +static Size +_brin_parallel_estimate_shared(Relation heap, Snapshot snapshot) +{ + /* c.f. shm_toc_allocate as to why BUFFERALIGN is used */ + return add_size(BUFFERALIGN(sizeof(BrinShared)), + table_parallelscan_estimate(heap, snapshot)); +} + +/* + * Within leader, participate as a parallel worker. + */ +static void +_brin_leader_participate_as_worker(BrinBuildState *buildstate, Relation heap, Relation index) +{ + BrinLeader *brinleader = buildstate->bs_leader; + int sortmem; + + /* Allocate memory and initialize private spool */ + buildstate->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + buildstate->bs_spool->heap = buildstate->bs_spool->heap; + buildstate->bs_spool->index = buildstate->bs_spool->index; + + /* + * Might as well use reliable figure when doling out maintenance_work_mem + * (when requested number of workers were not launched, this will be + * somewhat higher than it is for other workers). + */ + sortmem = maintenance_work_mem / brinleader->nparticipanttuplesorts; + + /* Perform work common to all participants */ + _brin_parallel_scan_and_build(buildstate, buildstate->bs_spool, brinleader->brinshared, + brinleader->sharedsort, heap, index, sortmem, true); +} + +/* + * Perform a worker's portion of a parallel sort. + * + * This generates a tuplesort for passed btspool, and a second tuplesort + * state if a second btspool is need (i.e. for unique index builds). All + * other spool fields should already be set when this is called. + * + * sortmem is the amount of working memory to use within each worker, + * expressed in KBs. + * + * When this returns, workers are done, and need only release resources. + */ +static void +_brin_parallel_scan_and_build(BrinBuildState *state, BrinSpool *brinspool, + BrinShared *brinshared, Sharedsort *sharedsort, + Relation heap, Relation index, int sortmem, + bool progress) +{ + SortCoordinate coordinate; + TableScanDesc scan; + double reltuples; + IndexInfo *indexInfo; + + /* Initialize local tuplesort coordination state */ + coordinate = palloc0(sizeof(SortCoordinateData)); + coordinate->isWorker = true; + coordinate->nParticipants = -1; + coordinate->sharedsort = sharedsort; + + /* Begin "partial" tuplesort */ + brinspool->sortstate = tuplesort_begin_index_brin(brinspool->heap, + brinspool->index, + sortmem, coordinate, + TUPLESORT_NONE); + + /* Join parallel scan */ + indexInfo = BuildIndexInfo(index); + indexInfo->ii_Concurrent = brinshared->isconcurrent; + + scan = table_beginscan_parallel(heap, + ParallelTableScanFromBrinShared(brinshared)); + + reltuples = table_index_build_scan(heap, index, indexInfo, true, true, + brinbuildCallbackParallel, state, scan); + + /* insert the last item */ + form_and_spill_tuple(state); + + /* sort the BRIN ranges built by this worker */ + tuplesort_performsort(brinspool->sortstate); + + state->bs_reltuples += reltuples; + + /* + * Done. Record ambuild statistics. + */ + SpinLockAcquire(&brinshared->mutex); + brinshared->nparticipantsdone++; + brinshared->reltuples += state->bs_reltuples; + brinshared->indtuples += state->bs_numtuples; + SpinLockRelease(&brinshared->mutex); + + /* Notify leader */ + ConditionVariableSignal(&brinshared->workersdonecv); + + tuplesort_end(brinspool->sortstate); +} + +/* + * Perform work within a launched parallel process. + */ +void +_brin_parallel_build_main(dsm_segment *seg, shm_toc *toc) +{ + char *sharedquery; + BrinShared *brinshared; + Sharedsort *sharedsort; + BrinBuildState *buildstate; + Relation heapRel; + Relation indexRel; + LOCKMODE heapLockmode; + LOCKMODE indexLockmode; + WalUsage *walusage; + BufferUsage *bufferusage; + int sortmem; + + /* + * The only possible status flag that can be set to the parallel worker is + * PROC_IN_SAFE_IC. + */ + Assert((MyProc->statusFlags == 0) || + (MyProc->statusFlags == PROC_IN_SAFE_IC)); + + /* Set debug_query_string for individual workers first */ + sharedquery = shm_toc_lookup(toc, PARALLEL_KEY_QUERY_TEXT, true); + debug_query_string = sharedquery; + + /* Report the query string from leader */ + pgstat_report_activity(STATE_RUNNING, debug_query_string); + + /* Look up brin shared state */ + brinshared = shm_toc_lookup(toc, PARALLEL_KEY_BRIN_SHARED, false); + + /* Open relations using lock modes known to be obtained by index.c */ + if (!brinshared->isconcurrent) + { + heapLockmode = ShareLock; + indexLockmode = AccessExclusiveLock; + } + else + { + heapLockmode = ShareUpdateExclusiveLock; + indexLockmode = RowExclusiveLock; + } + + /* Open relations within worker */ + heapRel = table_open(brinshared->heaprelid, heapLockmode); + indexRel = index_open(brinshared->indexrelid, indexLockmode); + + buildstate = initialize_brin_buildstate(indexRel, NULL, brinshared->pagesPerRange); + + /* Initialize worker's own spool */ + buildstate->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + buildstate->bs_spool->heap = heapRel; + buildstate->bs_spool->index = indexRel; + + /* Look up shared state private to tuplesort.c */ + sharedsort = shm_toc_lookup(toc, PARALLEL_KEY_TUPLESORT, false); + tuplesort_attach_shared(sharedsort, seg); + + /* Prepare to track buffer usage during parallel execution */ + InstrStartParallelQuery(); + + /* + * Might as well use reliable figure when doling out maintenance_work_mem + * (when requested number of workers were not launched, this will be + * somewhat higher than it is for other workers). + */ + sortmem = maintenance_work_mem / brinshared->scantuplesortstates; + + _brin_parallel_scan_and_build(buildstate, buildstate->bs_spool, + brinshared, sharedsort, + heapRel, indexRel, sortmem, false); + + /* Report WAL/buffer usage during parallel execution */ + bufferusage = shm_toc_lookup(toc, PARALLEL_KEY_BUFFER_USAGE, false); + walusage = shm_toc_lookup(toc, PARALLEL_KEY_WAL_USAGE, false); + InstrEndParallelQuery(&bufferusage[ParallelWorkerNumber], + &walusage[ParallelWorkerNumber]); + + index_close(indexRel, indexLockmode); + table_close(heapRel, heapLockmode); +} diff --git a/src/backend/access/gin/ginutil.c b/src/backend/access/gin/ginutil.c index a875c5d3d7a..9b1a0ac345d 100644 --- a/src/backend/access/gin/ginutil.c +++ b/src/backend/access/gin/ginutil.c @@ -54,6 +54,7 @@ ginhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = true; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = true; amroutine->amsummarizing = false; diff --git a/src/backend/access/gist/gist.c b/src/backend/access/gist/gist.c index 9a1bf8f66cb..e052ba8bda2 100644 --- a/src/backend/access/gist/gist.c +++ b/src/backend/access/gist/gist.c @@ -76,6 +76,7 @@ gisthandler(PG_FUNCTION_ARGS) amroutine->amclusterable = true; amroutine->ampredlocks = true; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = true; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/hash/hash.c b/src/backend/access/hash/hash.c index 6443ff21bda..905519692c6 100644 --- a/src/backend/access/hash/hash.c +++ b/src/backend/access/hash/hash.c @@ -73,6 +73,7 @@ hashhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = true; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/nbtree/nbtree.c b/src/backend/access/nbtree/nbtree.c index 0930f9b37e3..6c8cd93fa0a 100644 --- a/src/backend/access/nbtree/nbtree.c +++ b/src/backend/access/nbtree/nbtree.c @@ -112,6 +112,7 @@ bthandler(PG_FUNCTION_ARGS) amroutine->amclusterable = true; amroutine->ampredlocks = true; amroutine->amcanparallel = true; + amroutine->amcanbuildparallel = true; amroutine->amcaninclude = true; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/spgist/spgutils.c b/src/backend/access/spgist/spgutils.c index 30c00876a56..fd4b6157101 100644 --- a/src/backend/access/spgist/spgutils.c +++ b/src/backend/access/spgist/spgutils.c @@ -60,6 +60,7 @@ spghandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = true; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/transam/parallel.c b/src/backend/access/transam/parallel.c index 194a1207be6..d78314062e0 100644 --- a/src/backend/access/transam/parallel.c +++ b/src/backend/access/transam/parallel.c @@ -14,6 +14,7 @@ #include "postgres.h" +#include "access/brin.h" #include "access/nbtree.h" #include "access/parallel.h" #include "access/session.h" @@ -145,6 +146,9 @@ static const struct { "_bt_parallel_build_main", _bt_parallel_build_main }, + { + "_brin_parallel_build_main", _brin_parallel_build_main + }, { "parallel_vacuum_main", parallel_vacuum_main } diff --git a/src/backend/catalog/index.c b/src/backend/catalog/index.c index 143fae01ebd..40abbaf476b 100644 --- a/src/backend/catalog/index.c +++ b/src/backend/catalog/index.c @@ -2982,7 +2982,7 @@ index_build(Relation heapRelation, * Note that planner considers parallel safety for us. */ if (parallel && IsNormalProcessingMode() && - indexRelation->rd_rel->relam == BTREE_AM_OID) + indexRelation->rd_indam->amcanbuildparallel) indexInfo->ii_ParallelWorkers = plan_create_index_workers(RelationGetRelid(heapRelation), RelationGetRelid(indexRelation)); diff --git a/src/backend/utils/sort/tuplesortvariants.c b/src/backend/utils/sort/tuplesortvariants.c index 2cd508e5130..9b3a70e6ccf 100644 --- a/src/backend/utils/sort/tuplesortvariants.c +++ b/src/backend/utils/sort/tuplesortvariants.c @@ -19,6 +19,7 @@ #include "postgres.h" +#include "access/brin_tuple.h" #include "access/hash.h" #include "access/htup_details.h" #include "access/nbtree.h" @@ -43,6 +44,8 @@ static void removeabbrev_cluster(Tuplesortstate *state, SortTuple *stups, int count); static void removeabbrev_index(Tuplesortstate *state, SortTuple *stups, int count); +static void removeabbrev_index_brin(Tuplesortstate *state, SortTuple *stups, + int count); static void removeabbrev_datum(Tuplesortstate *state, SortTuple *stups, int count); static int comparetup_heap(const SortTuple *a, const SortTuple *b, @@ -69,10 +72,16 @@ static int comparetup_index_hash(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); static int comparetup_index_hash_tiebreak(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); +static int comparetup_index_brin(const SortTuple *a, const SortTuple *b, + Tuplesortstate *state); static void writetup_index(Tuplesortstate *state, LogicalTape *tape, SortTuple *stup); static void readtup_index(Tuplesortstate *state, SortTuple *stup, LogicalTape *tape, unsigned int len); +static void writetup_index_brin(Tuplesortstate *state, LogicalTape *tape, + SortTuple *stup); +static void readtup_index_brin(Tuplesortstate *state, SortTuple *stup, + LogicalTape *tape, unsigned int len); static int comparetup_datum(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); static int comparetup_datum_tiebreak(const SortTuple *a, const SortTuple *b, @@ -128,6 +137,16 @@ typedef struct uint32 max_buckets; } TuplesortIndexHashArg; +/* + * Data struture pointed by "TuplesortPublic.arg" for the index_brin subcase. + */ +typedef struct +{ + TuplesortIndexArg index; + + /* XXX do we need something here? */ +} TuplesortIndexBrinArg; + /* * Data struture pointed by "TuplesortPublic.arg" for the Datum case. * Set by tuplesort_begin_datum and used only by the DatumTuple routines. @@ -140,6 +159,21 @@ typedef struct int datumTypeLen; } TuplesortDatumArg; +/* + * Computing BrinTuple size with only the tuple is difficult, so we want to track + * the length referenced by the SortTuple. That's what BrinSortTuple is meant + * to do - it's essentially a BrinTuple prefixed by its length. + */ +typedef struct BrinSortTuple +{ + Size tuplen; + BrinTuple tuple; +} BrinSortTuple; + +/* Size of the BrinSortTuple, given length of the BrinTuple. */ +#define BRINSORTTUPLE_SIZE(len) (offsetof(BrinSortTuple, tuple) + (len)) + + Tuplesortstate * tuplesort_begin_heap(TupleDesc tupDesc, int nkeys, AttrNumber *attNums, @@ -527,6 +561,47 @@ tuplesort_begin_index_gist(Relation heapRel, return state; } +Tuplesortstate * +tuplesort_begin_index_brin(Relation heapRel, + Relation indexRel, + int workMem, + SortCoordinate coordinate, + int sortopt) +{ + Tuplesortstate *state = tuplesort_begin_common(workMem, coordinate, + sortopt); + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext; + TuplesortIndexBrinArg *arg; + + oldcontext = MemoryContextSwitchTo(base->maincontext); + arg = (TuplesortIndexBrinArg *) palloc(sizeof(TuplesortIndexBrinArg)); + +#ifdef TRACE_SORT + if (trace_sort) + elog(LOG, + "begin index sort: workMem = %d, randomAccess = %c", + workMem, + sortopt & TUPLESORT_RANDOMACCESS ? 't' : 'f'); +#endif + + base->nKeys = 1; /* Only one sort column, the block number */ + + base->removeabbrev = removeabbrev_index_brin; + base->comparetup = comparetup_index_brin; + base->writetup = writetup_index_brin; + base->readtup = readtup_index_brin; + base->haveDatum1 = true; + base->arg = arg; + + arg->index.heapRel = heapRel; + arg->index.indexRel = indexRel; + + MemoryContextSwitchTo(oldcontext); + + return state; +} + Tuplesortstate * tuplesort_begin_datum(Oid datumType, Oid sortOperator, Oid sortCollation, bool nullsFirstFlag, int workMem, @@ -707,6 +782,35 @@ tuplesort_putindextuplevalues(Tuplesortstate *state, Relation rel, !stup.isnull1); } +/* + * Collect one BRIN tuple while collecting input data for sort. + */ +void +tuplesort_putbrintuple(Tuplesortstate *state, BrinTuple *tuple, Size size) +{ + SortTuple stup; + BrinSortTuple *bstup; + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext = MemoryContextSwitchTo(base->tuplecontext); + + /* allocate space for the whole BRIN sort tuple */ + bstup = palloc(BRINSORTTUPLE_SIZE(size)); + + bstup->tuplen = size; + memcpy(&bstup->tuple, tuple, size); + + stup.tuple = bstup; + stup.datum1 = tuple->bt_blkno; + stup.isnull1 = false; + + tuplesort_puttuple_common(state, &stup, + base->sortKeys && + base->sortKeys->abbrev_converter && + !stup.isnull1); + + MemoryContextSwitchTo(oldcontext); +} + /* * Accept one Datum while collecting input data for sort. * @@ -850,6 +954,35 @@ tuplesort_getindextuple(Tuplesortstate *state, bool forward) return (IndexTuple) stup.tuple; } +/* + * Fetch the next BRIN tuple in either forward or back direction. + * Returns NULL if no more tuples. Returned tuple belongs to tuplesort memory + * context, and must not be freed by caller. Caller may not rely on tuple + * remaining valid after any further manipulation of tuplesort. + */ +BrinTuple * +tuplesort_getbrintuple(Tuplesortstate *state, Size *len, bool forward) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext = MemoryContextSwitchTo(base->sortcontext); + SortTuple stup; + BrinSortTuple *btup; + + if (!tuplesort_gettuple_common(state, forward, &stup)) + stup.tuple = NULL; + + MemoryContextSwitchTo(oldcontext); + + if (!stup.tuple) + return NULL; + + btup = (BrinSortTuple *) stup.tuple; + + *len = btup->tuplen; + + return &btup->tuple; +} + /* * Fetch the next Datum in either forward or back direction. * Returns false if no more datums. @@ -1564,6 +1697,80 @@ readtup_index(Tuplesortstate *state, SortTuple *stup, &stup->isnull1); } +/* + * Routines specialized for BrinTuple case + */ + +static void +removeabbrev_index_brin(Tuplesortstate *state, SortTuple *stups, int count) +{ + int i; + + for (i = 0; i < count; i++) + { + BrinSortTuple *tuple; + + tuple = stups[i].tuple; + stups[i].datum1 = tuple->tuple.bt_blkno; + } +} + +static int +comparetup_index_brin(const SortTuple *a, const SortTuple *b, + Tuplesortstate *state) +{ + Assert(TuplesortstateGetPublic(state)->haveDatum1); + + if (DatumGetUInt32(a->datum1) > DatumGetUInt32(b->datum1)) + return 1; + + if (DatumGetUInt32(a->datum1) < DatumGetUInt32(b->datum1)) + return -1; + + /* silence compilers */ + return 0; +} + +static void +writetup_index_brin(Tuplesortstate *state, LogicalTape *tape, SortTuple *stup) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + BrinSortTuple *tuple = (BrinSortTuple *) stup->tuple; + unsigned int tuplen = tuple->tuplen; + + tuplen = tuplen + sizeof(tuplen); + LogicalTapeWrite(tape, &tuplen, sizeof(tuplen)); + LogicalTapeWrite(tape, &tuple->tuple, tuple->tuplen); + if (base->sortopt & TUPLESORT_RANDOMACCESS) /* need trailing length word? */ + LogicalTapeWrite(tape, &tuplen, sizeof(tuplen)); +} + +static void +readtup_index_brin(Tuplesortstate *state, SortTuple *stup, + LogicalTape *tape, unsigned int len) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + unsigned int tuplen = len - sizeof(unsigned int); + + /* + * Allocate space for the BRIN sort tuple, which is BrinTuple with an + * extra length field. + */ + BrinSortTuple *tuple + = (BrinSortTuple *) tuplesort_readtup_alloc(state, + BRINSORTTUPLE_SIZE(tuplen)); + + tuple->tuplen = tuplen; + + LogicalTapeReadExact(tape, &tuple->tuple, tuplen); + if (base->sortopt & TUPLESORT_RANDOMACCESS) /* need trailing length word? */ + LogicalTapeReadExact(tape, &tuplen, sizeof(tuplen)); + stup->tuple = (void *) tuple; + + /* set up first-column key value, which is block number */ + stup->datum1 = tuple->tuple.bt_blkno; +} + /* * Routines specialized for DatumTuple case */ diff --git a/src/include/access/amapi.h b/src/include/access/amapi.h index 244459587fc..df85ae3aace 100644 --- a/src/include/access/amapi.h +++ b/src/include/access/amapi.h @@ -243,6 +243,8 @@ typedef struct IndexAmRoutine bool ampredlocks; /* does AM support parallel scan? */ bool amcanparallel; + /* does AM support parallel build? */ + bool amcanbuildparallel; /* does AM support columns included with clause INCLUDE? */ bool amcaninclude; /* does AM use maintenance_work_mem? */ diff --git a/src/include/access/brin.h b/src/include/access/brin.h index ed66f1b3d51..3451ecb211f 100644 --- a/src/include/access/brin.h +++ b/src/include/access/brin.h @@ -11,6 +11,7 @@ #define BRIN_H #include "nodes/execnodes.h" +#include "storage/shm_toc.h" #include "utils/relcache.h" @@ -52,4 +53,6 @@ typedef struct BrinStatsData extern void brinGetStats(Relation index, BrinStatsData *stats); +extern void _brin_parallel_build_main(dsm_segment *seg, shm_toc *toc); + #endif /* BRIN_H */ diff --git a/src/include/utils/tuplesort.h b/src/include/utils/tuplesort.h index 9ed2de76cd6..357eb35311d 100644 --- a/src/include/utils/tuplesort.h +++ b/src/include/utils/tuplesort.h @@ -21,6 +21,7 @@ #ifndef TUPLESORT_H #define TUPLESORT_H +#include "access/brin_tuple.h" #include "access/itup.h" #include "executor/tuptable.h" #include "storage/dsm.h" @@ -282,6 +283,9 @@ typedef struct * The "index_hash" API is similar to index_btree, but the tuples are * actually sorted by their hash codes not the raw data. * + * The "index_brin" API is similar to index_btree, but the tuples are + * BrinTuple and are sorted by their block number not the raw data. + * * Parallel sort callers are required to coordinate multiple tuplesort states * in a leader process and one or more worker processes. The leader process * must launch workers, and have each perform an independent "partial" @@ -426,6 +430,10 @@ extern Tuplesortstate *tuplesort_begin_index_gist(Relation heapRel, Relation indexRel, int workMem, SortCoordinate coordinate, int sortopt); +extern Tuplesortstate *tuplesort_begin_index_brin(Relation heapRel, + Relation indexRel, + int workMem, SortCoordinate coordinate, + int sortopt); extern Tuplesortstate *tuplesort_begin_datum(Oid datumType, Oid sortOperator, Oid sortCollation, bool nullsFirstFlag, @@ -438,6 +446,7 @@ extern void tuplesort_putheaptuple(Tuplesortstate *state, HeapTuple tup); extern void tuplesort_putindextuplevalues(Tuplesortstate *state, Relation rel, ItemPointer self, const Datum *values, const bool *isnull); +extern void tuplesort_putbrintuple(Tuplesortstate *state, BrinTuple *tup, Size len); extern void tuplesort_putdatum(Tuplesortstate *state, Datum val, bool isNull); @@ -445,6 +454,8 @@ extern bool tuplesort_gettupleslot(Tuplesortstate *state, bool forward, bool copy, TupleTableSlot *slot, Datum *abbrev); extern HeapTuple tuplesort_getheaptuple(Tuplesortstate *state, bool forward); extern IndexTuple tuplesort_getindextuple(Tuplesortstate *state, bool forward); +extern BrinTuple *tuplesort_getbrintuple(Tuplesortstate *state, Size *len, + bool forward); extern bool tuplesort_getdatum(Tuplesortstate *state, bool forward, bool copy, Datum *val, bool *isNull, Datum *abbrev); diff --git a/src/test/modules/dummy_index_am/dummy_index_am.c b/src/test/modules/dummy_index_am/dummy_index_am.c index cbdae7ab7a5..eaa0c483b7e 100644 --- a/src/test/modules/dummy_index_am/dummy_index_am.c +++ b/src/test/modules/dummy_index_am/dummy_index_am.c @@ -294,6 +294,7 @@ dihandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; -- 2.42.0 [text/x-patch] v20231128-0002-add-docs-for-amcanbuildparallel.patch (1.4K, ../../[email protected]/3-v20231128-0002-add-docs-for-amcanbuildparallel.patch) download | inline diff: From e3f42c711c0426b85edf3a88a538e58bc0588b6e Mon Sep 17 00:00:00 2001 From: Tomas Vondra <[email protected]> Date: Tue, 28 Nov 2023 18:37:42 +0100 Subject: [PATCH v20231128 2/4] add docs for amcanbuildparallel --- doc/src/sgml/indexam.sgml | 7 +++++++ 1 file changed, 7 insertions(+) diff --git a/doc/src/sgml/indexam.sgml b/doc/src/sgml/indexam.sgml index f107c43d6a6..cc4135e3940 100644 --- a/doc/src/sgml/indexam.sgml +++ b/doc/src/sgml/indexam.sgml @@ -123,6 +123,8 @@ typedef struct IndexAmRoutine bool ampredlocks; /* does AM support parallel scan? */ bool amcanparallel; + /* does AM support parallel build? */ + bool amcanbuildparallel; /* does AM support columns included with clause INCLUDE? */ bool amcaninclude; /* does AM use maintenance_work_mem? */ @@ -286,6 +288,11 @@ ambuild (Relation heapRelation, and compute the keys that need to be inserted into the index. The function must return a palloc'd struct containing statistics about the new index. + The <structfield>amcanbuildparallel</structfield> flag indicates whether + the access method supports parallel index builds. When set to <literal>true</literal>, + the system will attempt to allocate parallel workers for the build. + Access methods supporting only non-parallel index builds should leave + this flag set to <literal>false</literal>. </para> <para> -- 2.42.0 [text/x-patch] v20231128-0003-use-per-range-memory-context-for-merging-i.patch (3.4K, ../../[email protected]/4-v20231128-0003-use-per-range-memory-context-for-merging-i.patch) download | inline diff: From 0b431ec837f00f852e28b7b5e8e59dbdf61af27f Mon Sep 17 00:00:00 2001 From: Tomas Vondra <[email protected]> Date: Tue, 28 Nov 2023 18:38:32 +0100 Subject: [PATCH v20231128 3/4] use per-range memory context for merging in leader --- src/backend/access/brin/brin.c | 34 ++++++++++++++++++++++++++++++---- 1 file changed, 30 insertions(+), 4 deletions(-) diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index 0c6ca1ac18c..8d96d2ac9be 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -2475,6 +2475,8 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) BrinTuple *emptyTuple = NULL; Size emptySize; BrinSpool *spool; + MemoryContext rangeCxt, + oldCxt; /* Shutdown worker processes */ WaitForParallelWorkersToFinish(brinleader->pcxt); @@ -2496,6 +2498,19 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) */ memtuple = brin_new_memtuple(state->bs_bdesc); + /* + * Create a memory context we'll reset to combine results for a single + * page range (received from the workers). We don't expect huge number + * of overlaps under regular circumstances, because for large tables + * the chunk size is likely larger than the BRIN page range), but it + * can happen, and the union functions may do all kinds of stuff. So + * we better reset the context once in a while. + */ + rangeCxt = AllocSetContextCreate(CurrentMemoryContext, + "brin union", + ALLOCSET_DEFAULT_SIZES); + oldCxt = MemoryContextSwitchTo(rangeCxt); + /* * Read the BRIN tuples from the shared tuplesort, sorted by block number. * That probably gives us an index that is cheaper to scan, thanks to mostly @@ -2555,8 +2570,12 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); - /* free the formed on-disk tuple */ - pfree(tmp); + /* + * Reset the per-output-range context. This frees all the memory + * possibly allocated by the union functions, and also the BRIN + * tuple we just formed and inserted. + */ + MemoryContextReset(rangeCxt); memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); @@ -2593,7 +2612,7 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) tuplesort_end(spool->sortstate); - /* Fill empty ranges for all ranges missing in the tuplesort. */ + /* Fill empty ranges at the end, for all ranges missing in the tuplesort. */ prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; while (prevblkno + state->bs_pagesPerRange < memtuple->bt_blkno) { @@ -2618,7 +2637,7 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) emptyTuple->bt_blkno, emptyTuple, emptySize); } - /**/ + /* Fill the BRIN tuple for the last page range. */ if (prevblkno != InvalidBlockNumber) { BrinTuple *tmp; @@ -2633,6 +2652,13 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) pfree(tmp); } + /* + * Switch back to the originam memory context, and destroy the one we + * created to isolate the union_tuple calls. + */ + MemoryContextSwitchTo(oldCxt); + MemoryContextDelete(rangeCxt); + /* * Next, accumulate WAL usage. (This must wait for the workers to finish, * or we might get incomplete data.) -- 2.42.0 [text/x-patch] v20231128-0004-pgindent.patch (11.8K, ../../[email protected]/5-v20231128-0004-pgindent.patch) download | inline diff: From d6c08a8426907292a352d85b8fecc12d3adc8cbc Mon Sep 17 00:00:00 2001 From: Tomas Vondra <[email protected]> Date: Tue, 28 Nov 2023 18:48:21 +0100 Subject: [PATCH v20231128 4/4] pgindent --- src/backend/access/brin/brin.c | 96 +++++++++++----------- src/backend/utils/sort/tuplesortvariants.c | 16 ++-- src/tools/pgindent/typedefs.list | 5 ++ 3 files changed, 62 insertions(+), 55 deletions(-) diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index 8d96d2ac9be..001cf04aac5 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -67,14 +67,14 @@ typedef struct BrinSpool typedef struct BrinShared { /* - * These fields are not modified during the build. They primarily exist for - * the benefit of worker processes that need to create state corresponding - * to that used by the leader. + * These fields are not modified during the build. They primarily exist + * for the benefit of worker processes that need to create state + * corresponding to that used by the leader. */ Oid heaprelid; Oid indexrelid; bool isconcurrent; - BlockNumber pagesPerRange; + BlockNumber pagesPerRange; int scantuplesortstates; /* @@ -145,9 +145,10 @@ typedef struct BrinLeader * * brinshared is the shared state for entire build. sharedsort is the * shared, tuplesort-managed state passed to each process tuplesort. - * snapshot is the snapshot used by the scan iff an MVCC snapshot is required. + * snapshot is the snapshot used by the scan iff an MVCC snapshot is + * required. */ - BrinShared *brinshared; + BrinShared *brinshared; Sharedsort *sharedsort; Snapshot snapshot; WalUsage *walusage; @@ -1035,8 +1036,8 @@ brinbuildCallbackParallel(Relation index, /* * If we're in a block that belongs to a future range, summarize what * we've got and start afresh. Note the scan might have skipped many - * pages, if they were devoid of live tuples; we do not create emptry - * BRIN ranges here - the leader is responsible for filling them in. + * pages, if they were devoid of live tuples; we do not create emptry BRIN + * ranges here - the leader is responsible for filling them in. */ if (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) { @@ -1169,23 +1170,24 @@ brinbuild(Relation heap, Relation index, IndexInfo *indexInfo) /* * Begin serial/leader tuplesort. * - * In cases where parallelism is involved, the leader receives the same - * share of maintenance_work_mem as a serial sort (it is generally treated - * in the same way as a serial sort once we return). Parallel worker - * Tuplesortstates will have received only a fraction of - * maintenance_work_mem, though. + * In cases where parallelism is involved, the leader receives the + * same share of maintenance_work_mem as a serial sort (it is + * generally treated in the same way as a serial sort once we return). + * Parallel worker Tuplesortstates will have received only a fraction + * of maintenance_work_mem, though. * * We rely on the lifetime of the Leader Tuplesortstate almost not - * overlapping with any worker Tuplesortstate's lifetime. There may be - * some small overlap, but that's okay because we rely on leader - * Tuplesortstate only allocating a small, fixed amount of memory here. - * When its tuplesort_performsort() is called (by our caller), and - * significant amounts of memory are likely to be used, all workers must - * have already freed almost all memory held by their Tuplesortstates - * (they are about to go away completely, too). The overall effect is - * that maintenance_work_mem always represents an absolute high watermark - * on the amount of memory used by a CREATE INDEX operation, regardless of - * the use of parallelism or any other factor. + * overlapping with any worker Tuplesortstate's lifetime. There may + * be some small overlap, but that's okay because we rely on leader + * Tuplesortstate only allocating a small, fixed amount of memory + * here. When its tuplesort_performsort() is called (by our caller), + * and significant amounts of memory are likely to be used, all + * workers must have already freed almost all memory held by their + * Tuplesortstates (they are about to go away completely, too). The + * overall effect is that maintenance_work_mem always represents an + * absolute high watermark on the amount of memory used by a CREATE + * INDEX operation, regardless of the use of parallelism or any other + * factor. */ state->bs_spool->sortstate = tuplesort_begin_index_brin(heap, index, @@ -1198,7 +1200,7 @@ brinbuild(Relation heap, Relation index, IndexInfo *indexInfo) */ _brin_end_parallel(state->bs_leader, state); } - else /* no parallel index build, just do the usual thing */ + else /* no parallel index build */ { reltuples = table_index_build_scan(heap, index, indexInfo, false, true, brinbuildCallback, (void *) state, NULL); @@ -2288,9 +2290,9 @@ _brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, Snapshot snapshot; Size estbrinshared; Size estsort; - BrinShared *brinshared; - Sharedsort *sharedsort; - BrinLeader *brinleader = (BrinLeader *) palloc0(sizeof(BrinLeader)); + BrinShared *brinshared; + Sharedsort *sharedsort; + BrinLeader *brinleader = (BrinLeader *) palloc0(sizeof(BrinLeader)); WalUsage *walusage; BufferUsage *bufferusage; bool leaderparticipates = true; @@ -2471,12 +2473,12 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) BrinMemTuple *memtuple = NULL; Size tuplen; BrinShared *brinshared = brinleader->brinshared; - BlockNumber prevblkno = InvalidBlockNumber; + BlockNumber prevblkno = InvalidBlockNumber; BrinTuple *emptyTuple = NULL; Size emptySize; BrinSpool *spool; - MemoryContext rangeCxt, - oldCxt; + MemoryContext rangeCxt, + oldCxt; /* Shutdown worker processes */ WaitForParallelWorkersToFinish(brinleader->pcxt); @@ -2493,18 +2495,18 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) tuplesort_performsort(spool->sortstate); /* - * Initialize BrinMemTuple we'll use to union summaries from workers - * (in case they happened to produce parts of the same paga range). + * Initialize BrinMemTuple we'll use to union summaries from workers (in + * case they happened to produce parts of the same paga range). */ memtuple = brin_new_memtuple(state->bs_bdesc); /* * Create a memory context we'll reset to combine results for a single - * page range (received from the workers). We don't expect huge number - * of overlaps under regular circumstances, because for large tables - * the chunk size is likely larger than the BRIN page range), but it - * can happen, and the union functions may do all kinds of stuff. So - * we better reset the context once in a while. + * page range (received from the workers). We don't expect huge number of + * overlaps under regular circumstances, because for large tables the + * chunk size is likely larger than the BRIN page range), but it can + * happen, and the union functions may do all kinds of stuff. So we better + * reset the context once in a while. */ rangeCxt = AllocSetContextCreate(CurrentMemoryContext, "brin union", @@ -2513,8 +2515,8 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) /* * Read the BRIN tuples from the shared tuplesort, sorted by block number. - * That probably gives us an index that is cheaper to scan, thanks to mostly - * getting data from the same index page as before. + * That probably gives us an index that is cheaper to scan, thanks to + * mostly getting data from the same index page as before. */ while ((btup = tuplesort_getbrintuple(spool->sortstate, &tuplen, true)) != NULL) { @@ -2528,15 +2530,15 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) * the memtuple, and continue with the next one from tuplesort. We * however may need to insert empty summaries into the index. * - * If it's the same block as the last we saw, we simply union the - * brin tuple into it, and we're done - we don't even need to insert - * empty ranges, because that was done earlier when we saw the first - * brin tuple (for this range). + * If it's the same block as the last we saw, we simply union the brin + * tuple into it, and we're done - we don't even need to insert empty + * ranges, because that was done earlier when we saw the first brin + * tuple (for this range). * * Finally, if it's not the first brin tuple, and it's not the same - * page range, we need to do the insert and then deform the tuple - * into the memtuple. Then we'll insert empty ranges before the - * new brin tuple, if needed. + * page range, we need to do the insert and then deform the tuple into + * the memtuple. Then we'll insert empty ranges before the new brin + * tuple, if needed. */ if (prevblkno == InvalidBlockNumber) { @@ -2730,7 +2732,7 @@ _brin_parallel_scan_and_build(BrinBuildState *state, BrinSpool *brinspool, bool progress) { SortCoordinate coordinate; - TableScanDesc scan; + TableScanDesc scan; double reltuples; IndexInfo *indexInfo; diff --git a/src/backend/utils/sort/tuplesortvariants.c b/src/backend/utils/sort/tuplesortvariants.c index 9b3a70e6ccf..90fc605f1ca 100644 --- a/src/backend/utils/sort/tuplesortvariants.c +++ b/src/backend/utils/sort/tuplesortvariants.c @@ -965,8 +965,8 @@ tuplesort_getbrintuple(Tuplesortstate *state, Size *len, bool forward) { TuplesortPublic *base = TuplesortstateGetPublic(state); MemoryContext oldcontext = MemoryContextSwitchTo(base->sortcontext); - SortTuple stup; - BrinSortTuple *btup; + SortTuple stup; + BrinSortTuple *btup; if (!tuplesort_gettuple_common(state, forward, &stup)) stup.tuple = NULL; @@ -1708,7 +1708,7 @@ removeabbrev_index_brin(Tuplesortstate *state, SortTuple *stups, int count) for (i = 0; i < count; i++) { - BrinSortTuple *tuple; + BrinSortTuple *tuple; tuple = stups[i].tuple; stups[i].datum1 = tuple->tuple.bt_blkno; @@ -1735,8 +1735,8 @@ static void writetup_index_brin(Tuplesortstate *state, LogicalTape *tape, SortTuple *stup) { TuplesortPublic *base = TuplesortstateGetPublic(state); - BrinSortTuple *tuple = (BrinSortTuple *) stup->tuple; - unsigned int tuplen = tuple->tuplen; + BrinSortTuple *tuple = (BrinSortTuple *) stup->tuple; + unsigned int tuplen = tuple->tuplen; tuplen = tuplen + sizeof(tuplen); LogicalTapeWrite(tape, &tuplen, sizeof(tuplen)); @@ -1749,6 +1749,7 @@ static void readtup_index_brin(Tuplesortstate *state, SortTuple *stup, LogicalTape *tape, unsigned int len) { + BrinSortTuple *tuple; TuplesortPublic *base = TuplesortstateGetPublic(state); unsigned int tuplen = len - sizeof(unsigned int); @@ -1756,9 +1757,8 @@ readtup_index_brin(Tuplesortstate *state, SortTuple *stup, * Allocate space for the BRIN sort tuple, which is BrinTuple with an * extra length field. */ - BrinSortTuple *tuple - = (BrinSortTuple *) tuplesort_readtup_alloc(state, - BRINSORTTUPLE_SIZE(tuplen)); + tuple = (BrinSortTuple *) tuplesort_readtup_alloc(state, + BRINSORTTUPLE_SIZE(tuplen)); tuple->tuplen = tuplen; diff --git a/src/tools/pgindent/typedefs.list b/src/tools/pgindent/typedefs.list index 86a9886d4f7..001fef58652 100644 --- a/src/tools/pgindent/typedefs.list +++ b/src/tools/pgindent/typedefs.list @@ -297,13 +297,17 @@ BpChar BrinBuildState BrinDesc BrinInsertState +BrinLeader BrinMemTuple BrinMetaPageData BrinOpaque BrinOpcInfo BrinOptions BrinRevmap +BrinShared +BrinSortTuple BrinSpecialSpace +BrinSpool BrinStatsData BrinTuple BrinValues @@ -2879,6 +2883,7 @@ TupleTableSlotOps TuplesortClusterArg TuplesortDatumArg TuplesortIndexArg +TuplesortIndexBrinArg TuplesortIndexBTreeArg TuplesortIndexHashArg TuplesortInstrumentation -- 2.42.0 ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-29 14:42 Matthias van de Meent <[email protected]> parent: Tomas Vondra <[email protected]> 0 siblings, 1 reply; 25+ messages in thread From: Matthias van de Meent @ 2023-11-29 14:42 UTC (permalink / raw) To: Tomas Vondra <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On Tue, 28 Nov 2023 at 18:59, Tomas Vondra <[email protected]> wrote: > > On 11/28/23 16:39, Matthias van de Meent wrote: > > On Thu, 23 Nov 2023 at 14:35, Tomas Vondra > > <[email protected]> wrote: > >> On 11/23/23 13:33, Matthias van de Meent wrote: > >>> The union operator may leak (lots of) memory, so I think it makes > >>> sense to keep a context around that can be reset after we've extracted > >>> the merge result. > >>> > >> > >> But does the current code actually achieve that? It does create a "brin > >> union" context, but then it only does this: > >> > >> /* Use our own memory context to avoid retail pfree */ > >> cxt = AllocSetContextCreate(CurrentMemoryContext, > >> "brin union", > >> ALLOCSET_DEFAULT_SIZES); > >> oldcxt = MemoryContextSwitchTo(cxt); > >> db = brin_deform_tuple(bdesc, b, NULL); > >> MemoryContextSwitchTo(oldcxt); > >> > >> Surely that does not limit the amount of memory used by the actual union > >> functions in any way? > > > > Oh, yes, of course. For some reason I thought that covered the calls > > to the union operator function too, but it indeed only covers > > deserialization. I do think it is still worthwhile to not do the > > create/delete cycle, but won't hold the patch back for that. > > > > I think the union_tuples() changes are better left for a separate patch. > > >>>> However, I don't think the number of union_tuples calls is likely to be > >>>> very high, especially for large tables. Because we split the table into > >>>> 2048 chunks, and then cap the chunk size by 8192. For large tables > >>>> (where this matters) we're likely close to 8192. > >>> > >>> I agree that the merging part of the index creation is the last part, > >>> and usually has no high impact on the total performance of the reindex > >>> operation, but in memory-constrained environments releasing and then > >>> requesting the same chunk of memory over and over again just isn't > >>> great. > >> > >> OK, I'll take a look at the scratch context you suggested. > >> > >> My point however was we won't actually do that very often, because on > >> large tables the BRIN ranges are likely smaller than the parallel scan > >> chunk size, so few overlaps. OTOH if the table is small, or if the BRIN > >> ranges are large, there'll be few of them. > > > > That's true, so maybe I'm concerned about something that amounts to > > only marginal gains. > > > > However, after thinking about this a bit more, I think we actually do > need to do something about the memory management when merging tuples. > AFAIK the general assumption was that union_tuple() only runs for a > single range, and then the whole context gets freed. Correct, but it is also is (or should be) assumed that union_tuple will be called several times in the same context to fix repeat concurrent updates. Presumably, that only happens rarely, but it's something that should be kept in mind regardless. > But the way the > merging was implemented, it all runs in a single context. And while a > single union_tuple() may not need a lot memory, in total it may be > annoying. I just added a palloc(1MB) into union_tuples and ended up with > ~160MB allocated in the PortalContext on just 2GB table. In practice the > memory will grow more slowly, but not great :-/ > > The attached 0003 patch adds a memory context that's reset after > producing a merged BRIN tuple for each page range. Looks good. This also made me think a bit more about how we're working with the tuples. With your latest patch, we always deserialize and re-serialize the sorted brin tuples, just in case the next tuple will also be a BRIN tuple of the same page range. Could we save some of that deserialization time by optimistically expecting that we're not going to need to merge the tuple and only store a local copy of it locally? See attached 0002; this saves some cycles in common cases. The v20231128 version of the patchset (as squashed, attached v5-0001) looks good to me. Kind regards, Matthias van de Meent Neon (http://neon.tech) Attachments: [application/octet-stream] v5-0002-Reduce-de-forming-of-BRIN-tuples-in-parallel-BRIN.patch (4.9K, ../../CAEze2Wj5LneVaDgm1+43eHLGPxh_e7f23viA12cXm=k+igz5Kw@mail.gmail.com/2-v5-0002-Reduce-de-forming-of-BRIN-tuples-in-parallel-BRIN.patch) download | inline diff: From 40536a80563b5b12e9123989af3d94c264a824ee Mon Sep 17 00:00:00 2001 From: Matthias van de Meent <[email protected]> Date: Wed, 29 Nov 2023 15:09:17 +0100 Subject: [PATCH v5 2/2] Reduce de-/forming of BRIN tuples in parallel BRIN build De-/forming of the BRIN tuple is actually quite expensive, so in this commit we introduce a mechanism where we don't do that if only one BRIN tuple is stored in the shared sort by moving the serialized tuple into the local context, and only deserialize it once we need to use the memtuple. --- src/backend/access/brin/brin.c | 58 ++++++++++++++++++++++++++-------- 1 file changed, 44 insertions(+), 14 deletions(-) diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index 001cf04aac..909074d430 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -2471,6 +2471,7 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) int i; BrinTuple *btup; BrinMemTuple *memtuple = NULL; + BrinMemTuple *memtup_holder = NULL; Size tuplen; BrinShared *brinshared = brinleader->brinshared; BlockNumber prevblkno = InvalidBlockNumber; @@ -2479,6 +2480,8 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) BrinSpool *spool; MemoryContext rangeCxt, oldCxt; + BrinTuple *prevbtup; + Size prevtuplen; /* Shutdown worker processes */ WaitForParallelWorkersToFinish(brinleader->pcxt); @@ -2498,7 +2501,7 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) * Initialize BrinMemTuple we'll use to union summaries from workers (in * case they happened to produce parts of the same paga range). */ - memtuple = brin_new_memtuple(state->bs_bdesc); + memtup_holder = brin_new_memtuple(state->bs_bdesc); /* * Create a memory context we'll reset to combine results for a single @@ -2542,17 +2545,25 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) */ if (prevblkno == InvalidBlockNumber) { - /* First brin tuples, just deform into memtuple. */ - memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); + /* First brin tuple, store it in the local context. */ + prevbtup = palloc0(tuplen); + memcpy(prevbtup, btup, tuplen); + prevtuplen = tuplen; /* continue to insert empty pages before thisblock */ } - else if (memtuple->bt_blkno == btup->bt_blkno) + else if (prevbtup->bt_blkno == btup->bt_blkno) { /* * Not the first brin tuple, but same page range as the previous - * one, so we can merge it into the memtuple. + * one, so we can merge it into the memtuple. If this is the first + * merge for this block number, we still have to deform the + * original tuple before we can merge them. */ + if (memtuple == NULL) + memtuple = brin_deform_tuple(state->bs_bdesc, btup, + memtup_holder); + union_tuples(state->bs_bdesc, memtuple, btup); continue; } @@ -2563,23 +2574,36 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) /* * We got brin tuple for a different page range, so form a brin - * tuple from the memtuple, insert it, and re-init the memtuple - * from the new brin tuple. + * tuple from the memtuple (if required), insert it, and store a + * copy of the new tuple for future use. */ - tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, - memtuple, &len); + if (memtuple != NULL) + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); + else + { + tmp = prevbtup; + len = prevtuplen; + } brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); /* * Reset the per-output-range context. This frees all the memory - * possibly allocated by the union functions, and also the BRIN - * tuple we just formed and inserted. + * possibly allocated by the union functions, the previous cached + * btuple, and the btup we just may have formed from the memtuple. */ MemoryContextReset(rangeCxt); - memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); + /* + * Prepare for the next iteration by storing the new range's tuple + * in the current context, and resetting memtuple. + */ + prevbtup = palloc0(tuplen); + memcpy(prevbtup, btup, tuplen); + prevtuplen = tuplen; + memtuple = NULL; /* continue to insert empty pages before thisblock */ } @@ -2645,8 +2669,14 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) BrinTuple *tmp; Size len; - tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, - memtuple, &len); + if (memtuple != NULL) + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); + else + { + tmp = prevbtup; + len = prevtuplen; + } brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); -- 2.40.1 [application/octet-stream] v5-0001-Allow-BRIN-to-build-its-index-in-parallel.patch (51.6K, ../../CAEze2Wj5LneVaDgm1+43eHLGPxh_e7f23viA12cXm=k+igz5Kw@mail.gmail.com/3-v5-0001-Allow-BRIN-to-build-its-index-in-parallel.patch) download | inline diff: From 48ea20bc3d991ea57475ead179c510a420d5e406 Mon Sep 17 00:00:00 2001 From: Tomas Vondra <[email protected]> Date: Wed, 29 Nov 2023 14:35:10 +0100 Subject: [PATCH v5 1/2] Allow BRIN to build its index in parallel --- contrib/bloom/blutils.c | 1 + doc/src/sgml/indexam.sgml | 7 + src/backend/access/brin/brin.c | 894 +++++++++++++++++- src/backend/access/gin/ginutil.c | 1 + src/backend/access/gist/gist.c | 1 + src/backend/access/hash/hash.c | 1 + src/backend/access/nbtree/nbtree.c | 1 + src/backend/access/spgist/spgutils.c | 1 + src/backend/access/transam/parallel.c | 4 + src/backend/catalog/index.c | 2 +- src/backend/utils/sort/tuplesortvariants.c | 207 ++++ src/include/access/amapi.h | 2 + src/include/access/brin.h | 3 + src/include/utils/tuplesort.h | 11 + .../modules/dummy_index_am/dummy_index_am.c | 1 + src/tools/pgindent/typedefs.list | 5 + 16 files changed, 1136 insertions(+), 6 deletions(-) diff --git a/contrib/bloom/blutils.c b/contrib/bloom/blutils.c index 4830cb3fee..a781c5d98d 100644 --- a/contrib/bloom/blutils.c +++ b/contrib/bloom/blutils.c @@ -122,6 +122,7 @@ blhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amparallelvacuumoptions = diff --git a/doc/src/sgml/indexam.sgml b/doc/src/sgml/indexam.sgml index f107c43d6a..cc4135e394 100644 --- a/doc/src/sgml/indexam.sgml +++ b/doc/src/sgml/indexam.sgml @@ -123,6 +123,8 @@ typedef struct IndexAmRoutine bool ampredlocks; /* does AM support parallel scan? */ bool amcanparallel; + /* does AM support parallel build? */ + bool amcanbuildparallel; /* does AM support columns included with clause INCLUDE? */ bool amcaninclude; /* does AM use maintenance_work_mem? */ @@ -286,6 +288,11 @@ ambuild (Relation heapRelation, and compute the keys that need to be inserted into the index. The function must return a palloc'd struct containing statistics about the new index. + The <structfield>amcanbuildparallel</structfield> flag indicates whether + the access method supports parallel index builds. When set to <literal>true</literal>, + the system will attempt to allocate parallel workers for the build. + Access methods supporting only non-parallel index builds should leave + this flag set to <literal>false</literal>. </para> <para> diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index 4f2dfdd17b..001cf04aac 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -33,6 +33,7 @@ #include "postmaster/autovacuum.h" #include "storage/bufmgr.h" #include "storage/freespace.h" +#include "tcop/tcopprot.h" /* pgrminclude ignore */ #include "utils/acl.h" #include "utils/builtins.h" #include "utils/datum.h" @@ -40,7 +41,119 @@ #include "utils/index_selfuncs.h" #include "utils/memutils.h" #include "utils/rel.h" +#include "utils/tuplesort.h" +/* Magic numbers for parallel state sharing */ +#define PARALLEL_KEY_BRIN_SHARED UINT64CONST(0xB000000000000001) +#define PARALLEL_KEY_TUPLESORT UINT64CONST(0xB000000000000002) +#define PARALLEL_KEY_QUERY_TEXT UINT64CONST(0xB000000000000003) +#define PARALLEL_KEY_WAL_USAGE UINT64CONST(0xB000000000000004) +#define PARALLEL_KEY_BUFFER_USAGE UINT64CONST(0xB000000000000005) + +/* + * Status record for spooling/sorting phase. + */ +typedef struct BrinSpool +{ + Tuplesortstate *sortstate; /* state data for tuplesort.c */ + Relation heap; + Relation index; +} BrinSpool; + +/* + * Status for index builds performed in parallel. This is allocated in a + * dynamic shared memory segment. + */ +typedef struct BrinShared +{ + /* + * These fields are not modified during the build. They primarily exist + * for the benefit of worker processes that need to create state + * corresponding to that used by the leader. + */ + Oid heaprelid; + Oid indexrelid; + bool isconcurrent; + BlockNumber pagesPerRange; + int scantuplesortstates; + + /* + * workersdonecv is used to monitor the progress of workers. All parallel + * participants must indicate that they are done before leader can use + * results built by the workers (and before leader can write the data into + * the index). + */ + ConditionVariable workersdonecv; + + /* + * mutex protects all fields before heapdesc. + * + * These fields contain status information of interest to BRIN index + * builds that must work just the same when an index is built in parallel. + */ + slock_t mutex; + + /* + * Mutable state that is maintained by workers, and reported back to + * leader at end of the scans. + * + * nparticipantsdone is number of worker processes finished. + * + * reltuples is the total number of input heap tuples. + * + * indtuples is the total number of tuples that made it into the index. + */ + int nparticipantsdone; + double reltuples; + double indtuples; + + /* + * ParallelTableScanDescData data follows. Can't directly embed here, as + * implementations of the parallel table scan desc interface might need + * stronger alignment. + */ +} BrinShared; + +/* + * Return pointer to a BrinShared's parallel table scan. + * + * c.f. shm_toc_allocate as to why BUFFERALIGN is used, rather than just + * MAXALIGN. + */ +#define ParallelTableScanFromBrinShared(shared) \ + (ParallelTableScanDesc) ((char *) (shared) + BUFFERALIGN(sizeof(BrinShared))) + +/* + * Status for leader in parallel index build. + */ +typedef struct BrinLeader +{ + /* parallel context itself */ + ParallelContext *pcxt; + + /* + * nparticipanttuplesorts is the exact number of worker processes + * successfully launched, plus one leader process if it participates as a + * worker (only DISABLE_LEADER_PARTICIPATION builds avoid leader + * participating as a worker). + */ + int nparticipanttuplesorts; + + /* + * Leader process convenience pointers to shared state (leader avoids TOC + * lookups). + * + * brinshared is the shared state for entire build. sharedsort is the + * shared, tuplesort-managed state passed to each process tuplesort. + * snapshot is the snapshot used by the scan iff an MVCC snapshot is + * required. + */ + BrinShared *brinshared; + Sharedsort *sharedsort; + Snapshot snapshot; + WalUsage *walusage; + BufferUsage *bufferusage; +} BrinLeader; /* * We use a BrinBuildState during initial construction of a BRIN index. @@ -49,13 +162,23 @@ typedef struct BrinBuildState { Relation bs_irel; - int bs_numtuples; + double bs_numtuples; + double bs_reltuples; Buffer bs_currentInsertBuf; BlockNumber bs_pagesPerRange; BlockNumber bs_currRangeStart; BrinRevmap *bs_rmAccess; BrinDesc *bs_bdesc; BrinMemTuple *bs_dtuple; + + /* + * bs_leader is only present when a parallel index build is performed, and + * only in the leader process. (Actually, only the leader process has a + * BrinBuildState.) + */ + BrinLeader *bs_leader; + int bs_worker_id; + BrinSpool *bs_spool; } BrinBuildState; /* @@ -88,6 +211,7 @@ static void terminate_brin_buildstate(BrinBuildState *state); static void brinsummarize(Relation index, Relation heapRel, BlockNumber pageRange, bool include_partial, double *numSummarized, double *numExisting); static void form_and_insert_tuple(BrinBuildState *state); +static void form_and_spill_tuple(BrinBuildState *state); static void union_tuples(BrinDesc *bdesc, BrinMemTuple *a, BrinTuple *b); static void brin_vacuum_scan(Relation idxrel, BufferAccessStrategy strategy); @@ -95,6 +219,20 @@ static bool add_values_to_range(Relation idxRel, BrinDesc *bdesc, BrinMemTuple *dtup, const Datum *values, const bool *nulls); static bool check_null_keys(BrinValues *bval, ScanKey *nullkeys, int nnullkeys); +/* parallel index builds */ +static void _brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, + bool isconcurrent, int request); +static void _brin_end_parallel(BrinLeader *btleader, BrinBuildState *state); +static Size _brin_parallel_estimate_shared(Relation heap, Snapshot snapshot); +static void _brin_leader_participate_as_worker(BrinBuildState *buildstate, + Relation heap, Relation index); +static void _brin_parallel_scan_and_build(BrinBuildState *buildstate, + BrinSpool *brinspool, + BrinShared *brinshared, + Sharedsort *sharedsort, + Relation heap, Relation index, + int sortmem, bool progress); + /* * BRIN handler function: return IndexAmRoutine with access method parameters * and callbacks. @@ -119,6 +257,7 @@ brinhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = true; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = true; @@ -874,6 +1013,63 @@ brinbuildCallback(Relation index, values, isnull); } +/* + * A version of the callback, used by parallel index builds. The main difference + * is that instead of writing the BRIN tuples into the index, we write them into + * a shared tuplesort, and leave the insertion up to the leader (which may + * reorder them a bit etc.). The callback also does not generate empty ranges, + * those may be added by the leader when merging results from workers. + */ +static void +brinbuildCallbackParallel(Relation index, + ItemPointer tid, + Datum *values, + bool *isnull, + bool tupleIsAlive, + void *brstate) +{ + BrinBuildState *state = (BrinBuildState *) brstate; + BlockNumber thisblock; + + thisblock = ItemPointerGetBlockNumber(tid); + + /* + * If we're in a block that belongs to a future range, summarize what + * we've got and start afresh. Note the scan might have skipped many + * pages, if they were devoid of live tuples; we do not create emptry BRIN + * ranges here - the leader is responsible for filling them in. + */ + if (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) + { + + BRIN_elog((DEBUG2, + "brinbuildCallback: completed a range: %u--%u", + state->bs_currRangeStart, + state->bs_currRangeStart + state->bs_pagesPerRange)); + + /* create the index tuple and write it into the tuplesort */ + form_and_spill_tuple(state); + + /* + * Set state to correspond to the next range (for this block). + * + * This skips ranges that are either empty (and so we don't get any + * tuples to summarize), or processes by other workers. We can't + * differentiate those cases here easily, so we leave it up to the + * leader to fill empty ranges where needed. + */ + state->bs_currRangeStart + = state->bs_pagesPerRange * (thisblock / state->bs_pagesPerRange); + + /* re-initialize state for it */ + brin_memtuple_initialize(state->bs_dtuple, state->bs_bdesc); + } + + /* Accumulate the current tuple into the running state */ + (void) add_values_to_range(index, state->bs_bdesc, state->bs_dtuple, + values, isnull); +} + /* * brinbuild() -- build a new BRIN index. */ @@ -935,18 +1131,90 @@ brinbuild(Relation heap, Relation index, IndexInfo *indexInfo) revmap = brinRevmapInitialize(index, &pagesPerRange); state = initialize_brin_buildstate(index, revmap, pagesPerRange); + state->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + state->bs_spool->heap = heap; + state->bs_spool->index = index; + + /* + * Attempt to launch parallel worker scan when required + * + * XXX plan_create_index_workers makes the number of workers dependent on + * maintenance_work_mem, requiring 32MB for each worker. That makes sense + * for btree, but not for BRIN, which can do away with much less memory. + * So maybe make that somehow less strict, optionally? + */ + if (indexInfo->ii_ParallelWorkers > 0) + _brin_begin_parallel(state, heap, index, indexInfo->ii_Concurrent, + indexInfo->ii_ParallelWorkers); + /* * Now scan the relation. No syncscan allowed here because we want the * heap blocks in physical order. */ - reltuples = table_index_build_scan(heap, index, indexInfo, false, true, - brinbuildCallback, (void *) state, NULL); - /* process the final batch */ - form_and_insert_tuple(state); + /* + * If parallel build requested and at least one worker process was + * successfully launched, set up coordination state + */ + if (state->bs_leader) + { + SortCoordinate coordinate; + + coordinate = (SortCoordinate) palloc0(sizeof(SortCoordinateData)); + coordinate->isWorker = false; + coordinate->nParticipants = + state->bs_leader->nparticipanttuplesorts; + coordinate->sharedsort = state->bs_leader->sharedsort; + + + /* + * Begin serial/leader tuplesort. + * + * In cases where parallelism is involved, the leader receives the + * same share of maintenance_work_mem as a serial sort (it is + * generally treated in the same way as a serial sort once we return). + * Parallel worker Tuplesortstates will have received only a fraction + * of maintenance_work_mem, though. + * + * We rely on the lifetime of the Leader Tuplesortstate almost not + * overlapping with any worker Tuplesortstate's lifetime. There may + * be some small overlap, but that's okay because we rely on leader + * Tuplesortstate only allocating a small, fixed amount of memory + * here. When its tuplesort_performsort() is called (by our caller), + * and significant amounts of memory are likely to be used, all + * workers must have already freed almost all memory held by their + * Tuplesortstates (they are about to go away completely, too). The + * overall effect is that maintenance_work_mem always represents an + * absolute high watermark on the amount of memory used by a CREATE + * INDEX operation, regardless of the use of parallelism or any other + * factor. + */ + state->bs_spool->sortstate = + tuplesort_begin_index_brin(heap, index, + maintenance_work_mem, coordinate, + TUPLESORT_NONE); + + /* + * In parallel mode, wait for workers to complete, and then read all + * tuples from the shared tuplesort and insert them into the index. + */ + _brin_end_parallel(state->bs_leader, state); + } + else /* no parallel index build */ + { + reltuples = table_index_build_scan(heap, index, indexInfo, false, true, + brinbuildCallback, (void *) state, NULL); + + /* process the final batch */ + form_and_insert_tuple(state); + + /* track the number of relation tuples */ + state->bs_reltuples = reltuples; + } /* release resources */ idxtuples = state->bs_numtuples; + reltuples = state->bs_reltuples; brinRevmapTerminate(state->bs_rmAccess); terminate_brin_buildstate(state); @@ -1366,12 +1634,16 @@ initialize_brin_buildstate(Relation idxRel, BrinRevmap *revmap, state->bs_irel = idxRel; state->bs_numtuples = 0; + state->bs_reltuples = 0; state->bs_currentInsertBuf = InvalidBuffer; state->bs_pagesPerRange = pagesPerRange; state->bs_currRangeStart = 0; state->bs_rmAccess = revmap; state->bs_bdesc = brin_build_desc(idxRel); state->bs_dtuple = brin_new_memtuple(state->bs_bdesc); + state->bs_leader = NULL; + state->bs_worker_id = 0; + state->bs_spool = NULL; return state; } @@ -1663,6 +1935,32 @@ form_and_insert_tuple(BrinBuildState *state) pfree(tup); } +/* + * Given a deformed tuple in the build state, convert it into the on-disk + * format and write it to a (shared) tuplesort (the leader will insert it + * into the index later). + */ +static void +form_and_spill_tuple(BrinBuildState *state) +{ + BrinTuple *tup; + Size size; + + /* don't insert empty tuples in parallel build */ + if (state->bs_dtuple->bt_empty_range) + return; + + tup = brin_form_tuple(state->bs_bdesc, state->bs_currRangeStart, + state->bs_dtuple, &size); + + /* write the BRIN tuple to the tuplesort */ + tuplesort_putbrintuple(state->bs_spool->sortstate, tup, size); + + state->bs_numtuples++; + + pfree(tup); +} + /* * Given two deformed tuples, adjust the first one so that it's consistent * with the summary values in both. @@ -1982,3 +2280,589 @@ check_null_keys(BrinValues *bval, ScanKey *nullkeys, int nnullkeys) return true; } + +static void +_brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, + bool isconcurrent, int request) +{ + ParallelContext *pcxt; + int scantuplesortstates; + Snapshot snapshot; + Size estbrinshared; + Size estsort; + BrinShared *brinshared; + Sharedsort *sharedsort; + BrinLeader *brinleader = (BrinLeader *) palloc0(sizeof(BrinLeader)); + WalUsage *walusage; + BufferUsage *bufferusage; + bool leaderparticipates = true; + int querylen; + +#ifdef DISABLE_LEADER_PARTICIPATION + leaderparticipates = false; +#endif + + /* + * Enter parallel mode, and create context for parallel build of brin + * index + */ + EnterParallelMode(); + Assert(request > 0); + pcxt = CreateParallelContext("postgres", "_brin_parallel_build_main", + request); + + scantuplesortstates = leaderparticipates ? request + 1 : request; + + /* + * Prepare for scan of the base relation. In a normal index build, we use + * SnapshotAny because we must retrieve all tuples and do our own time + * qual checks (because we have to index RECENTLY_DEAD tuples). In a + * concurrent build, we take a regular MVCC snapshot and index whatever's + * live according to that. + */ + if (!isconcurrent) + snapshot = SnapshotAny; + else + snapshot = RegisterSnapshot(GetTransactionSnapshot()); + + /* + * Estimate size for our own PARALLEL_KEY_BRIN_SHARED workspace. + */ + estbrinshared = _brin_parallel_estimate_shared(heap, snapshot); + shm_toc_estimate_chunk(&pcxt->estimator, estbrinshared); + estsort = tuplesort_estimate_shared(scantuplesortstates); + shm_toc_estimate_chunk(&pcxt->estimator, estsort); + + shm_toc_estimate_keys(&pcxt->estimator, 2); + + /* + * Estimate space for WalUsage and BufferUsage -- PARALLEL_KEY_WAL_USAGE + * and PARALLEL_KEY_BUFFER_USAGE. + * + * If there are no extensions loaded that care, we could skip this. We + * have no way of knowing whether anyone's looking at pgWalUsage or + * pgBufferUsage, so do it unconditionally. + */ + shm_toc_estimate_chunk(&pcxt->estimator, + mul_size(sizeof(WalUsage), pcxt->nworkers)); + shm_toc_estimate_keys(&pcxt->estimator, 1); + shm_toc_estimate_chunk(&pcxt->estimator, + mul_size(sizeof(BufferUsage), pcxt->nworkers)); + shm_toc_estimate_keys(&pcxt->estimator, 1); + + /* Finally, estimate PARALLEL_KEY_QUERY_TEXT space */ + if (debug_query_string) + { + querylen = strlen(debug_query_string); + shm_toc_estimate_chunk(&pcxt->estimator, querylen + 1); + shm_toc_estimate_keys(&pcxt->estimator, 1); + } + else + querylen = 0; /* keep compiler quiet */ + + /* Everyone's had a chance to ask for space, so now create the DSM */ + InitializeParallelDSM(pcxt); + + /* If no DSM segment was available, back out (do serial build) */ + if (pcxt->seg == NULL) + { + if (IsMVCCSnapshot(snapshot)) + UnregisterSnapshot(snapshot); + DestroyParallelContext(pcxt); + ExitParallelMode(); + return; + } + + /* Store shared build state, for which we reserved space */ + brinshared = (BrinShared *) shm_toc_allocate(pcxt->toc, estbrinshared); + /* Initialize immutable state */ + brinshared->heaprelid = RelationGetRelid(heap); + brinshared->indexrelid = RelationGetRelid(index); + brinshared->isconcurrent = isconcurrent; + brinshared->scantuplesortstates = scantuplesortstates; + brinshared->pagesPerRange = buildstate->bs_pagesPerRange; + ConditionVariableInit(&brinshared->workersdonecv); + SpinLockInit(&brinshared->mutex); + + /* Initialize mutable state */ + brinshared->nparticipantsdone = 0; + brinshared->reltuples = 0.0; + brinshared->indtuples = 0.0; + + table_parallelscan_initialize(heap, + ParallelTableScanFromBrinShared(brinshared), + snapshot); + + /* + * Store shared tuplesort-private state, for which we reserved space. + * Then, initialize opaque state using tuplesort routine. + */ + sharedsort = (Sharedsort *) shm_toc_allocate(pcxt->toc, estsort); + tuplesort_initialize_shared(sharedsort, scantuplesortstates, + pcxt->seg); + + /* + * Store shared tuplesort-private state, for which we reserved space. + * Then, initialize opaque state using tuplesort routine. + */ + shm_toc_insert(pcxt->toc, PARALLEL_KEY_BRIN_SHARED, brinshared); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_TUPLESORT, sharedsort); + + /* Store query string for workers */ + if (debug_query_string) + { + char *sharedquery; + + sharedquery = (char *) shm_toc_allocate(pcxt->toc, querylen + 1); + memcpy(sharedquery, debug_query_string, querylen + 1); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_QUERY_TEXT, sharedquery); + } + + /* + * Allocate space for each worker's WalUsage and BufferUsage; no need to + * initialize. + */ + walusage = shm_toc_allocate(pcxt->toc, + mul_size(sizeof(WalUsage), pcxt->nworkers)); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_WAL_USAGE, walusage); + bufferusage = shm_toc_allocate(pcxt->toc, + mul_size(sizeof(BufferUsage), pcxt->nworkers)); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_BUFFER_USAGE, bufferusage); + + /* Launch workers, saving status for leader/caller */ + LaunchParallelWorkers(pcxt); + brinleader->pcxt = pcxt; + brinleader->nparticipanttuplesorts = pcxt->nworkers_launched; + if (leaderparticipates) + brinleader->nparticipanttuplesorts++; + brinleader->brinshared = brinshared; + brinleader->sharedsort = sharedsort; + brinleader->snapshot = snapshot; + brinleader->walusage = walusage; + brinleader->bufferusage = bufferusage; + + /* If no workers were successfully launched, back out (do serial build) */ + if (pcxt->nworkers_launched == 0) + { + _brin_end_parallel(brinleader, NULL); + return; + } + + /* Save leader state now that it's clear build will be parallel */ + buildstate->bs_leader = brinleader; + + /* Join heap scan ourselves */ + if (leaderparticipates) + _brin_leader_participate_as_worker(buildstate, heap, index); + + /* + * Caller needs to wait for all launched workers when we return. Make + * sure that the failure-to-start case will not hang forever. + */ + WaitForParallelWorkersToAttach(pcxt); +} + +/* + * Shut down workers, destroy parallel context, and end parallel mode. + */ +static void +_brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) +{ + int i; + BrinTuple *btup; + BrinMemTuple *memtuple = NULL; + Size tuplen; + BrinShared *brinshared = brinleader->brinshared; + BlockNumber prevblkno = InvalidBlockNumber; + BrinTuple *emptyTuple = NULL; + Size emptySize; + BrinSpool *spool; + MemoryContext rangeCxt, + oldCxt; + + /* Shutdown worker processes */ + WaitForParallelWorkersToFinish(brinleader->pcxt); + + if (!state) + return; + + /* copy the data into leader state (we have to wait for the workers ) */ + state->bs_reltuples = brinshared->reltuples; + state->bs_numtuples = brinshared->indtuples; + + /* do the actual sort in the leader */ + spool = state->bs_spool; + tuplesort_performsort(spool->sortstate); + + /* + * Initialize BrinMemTuple we'll use to union summaries from workers (in + * case they happened to produce parts of the same paga range). + */ + memtuple = brin_new_memtuple(state->bs_bdesc); + + /* + * Create a memory context we'll reset to combine results for a single + * page range (received from the workers). We don't expect huge number of + * overlaps under regular circumstances, because for large tables the + * chunk size is likely larger than the BRIN page range), but it can + * happen, and the union functions may do all kinds of stuff. So we better + * reset the context once in a while. + */ + rangeCxt = AllocSetContextCreate(CurrentMemoryContext, + "brin union", + ALLOCSET_DEFAULT_SIZES); + oldCxt = MemoryContextSwitchTo(rangeCxt); + + /* + * Read the BRIN tuples from the shared tuplesort, sorted by block number. + * That probably gives us an index that is cheaper to scan, thanks to + * mostly getting data from the same index page as before. + */ + while ((btup = tuplesort_getbrintuple(spool->sortstate, &tuplen, true)) != NULL) + { + /* Ranges should be multiples of pages_per_range for the index. */ + Assert(btup->bt_blkno % brinshared->pagesPerRange == 0); + + /* + * Do we need to union summaries for the same page range? + * + * If this is the first brin tuple we read, then just deform it into + * the memtuple, and continue with the next one from tuplesort. We + * however may need to insert empty summaries into the index. + * + * If it's the same block as the last we saw, we simply union the brin + * tuple into it, and we're done - we don't even need to insert empty + * ranges, because that was done earlier when we saw the first brin + * tuple (for this range). + * + * Finally, if it's not the first brin tuple, and it's not the same + * page range, we need to do the insert and then deform the tuple into + * the memtuple. Then we'll insert empty ranges before the new brin + * tuple, if needed. + */ + if (prevblkno == InvalidBlockNumber) + { + /* First brin tuples, just deform into memtuple. */ + memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); + + /* continue to insert empty pages before thisblock */ + } + else if (memtuple->bt_blkno == btup->bt_blkno) + { + /* + * Not the first brin tuple, but same page range as the previous + * one, so we can merge it into the memtuple. + */ + union_tuples(state->bs_bdesc, memtuple, btup); + continue; + } + else + { + BrinTuple *tmp; + Size len; + + /* + * We got brin tuple for a different page range, so form a brin + * tuple from the memtuple, insert it, and re-init the memtuple + * from the new brin tuple. + */ + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); + + /* + * Reset the per-output-range context. This frees all the memory + * possibly allocated by the union functions, and also the BRIN + * tuple we just formed and inserted. + */ + MemoryContextReset(rangeCxt); + + memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); + + /* continue to insert empty pages before thisblock */ + } + + /* Fill empty ranges for all ranges missing in the tuplesort. */ + prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; + while (prevblkno + state->bs_pagesPerRange < btup->bt_blkno) + { + /* the missing range */ + prevblkno += state->bs_pagesPerRange; + + /* Did we already build the empty range? If not, do it now. */ + if (emptyTuple == NULL) + { + BrinMemTuple *dtuple = brin_new_memtuple(state->bs_bdesc); + + emptyTuple = brin_form_tuple(state->bs_bdesc, prevblkno, dtuple, &emptySize); + } + else + { + /* we already have am "empty range" tuple, just set the block */ + emptyTuple->bt_blkno = prevblkno; + } + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, + emptyTuple->bt_blkno, emptyTuple, emptySize); + } + + prevblkno = btup->bt_blkno; + } + + tuplesort_end(spool->sortstate); + + /* Fill empty ranges at the end, for all ranges missing in the tuplesort. */ + prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; + while (prevblkno + state->bs_pagesPerRange < memtuple->bt_blkno) + { + /* the missing range */ + prevblkno += state->bs_pagesPerRange; + + /* Did we already build the empty range? If not, do it now. */ + if (emptyTuple == NULL) + { + BrinMemTuple *dtuple = brin_new_memtuple(state->bs_bdesc); + + emptyTuple = brin_form_tuple(state->bs_bdesc, prevblkno, dtuple, &emptySize); + } + else + { + /* we already have am "empty range" tuple, just set the block */ + emptyTuple->bt_blkno = prevblkno; + } + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, + emptyTuple->bt_blkno, emptyTuple, emptySize); + } + + /* Fill the BRIN tuple for the last page range. */ + if (prevblkno != InvalidBlockNumber) + { + BrinTuple *tmp; + Size len; + + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); + + pfree(tmp); + } + + /* + * Switch back to the originam memory context, and destroy the one we + * created to isolate the union_tuple calls. + */ + MemoryContextSwitchTo(oldCxt); + MemoryContextDelete(rangeCxt); + + /* + * Next, accumulate WAL usage. (This must wait for the workers to finish, + * or we might get incomplete data.) + */ + for (i = 0; i < brinleader->pcxt->nworkers_launched; i++) + InstrAccumParallelQuery(&brinleader->bufferusage[i], &brinleader->walusage[i]); + + /* Free last reference to MVCC snapshot, if one was used */ + if (IsMVCCSnapshot(brinleader->snapshot)) + UnregisterSnapshot(brinleader->snapshot); + DestroyParallelContext(brinleader->pcxt); + ExitParallelMode(); +} + +/* + * Returns size of shared memory required to store state for a parallel + * brin index build based on the snapshot its parallel scan will use. + */ +static Size +_brin_parallel_estimate_shared(Relation heap, Snapshot snapshot) +{ + /* c.f. shm_toc_allocate as to why BUFFERALIGN is used */ + return add_size(BUFFERALIGN(sizeof(BrinShared)), + table_parallelscan_estimate(heap, snapshot)); +} + +/* + * Within leader, participate as a parallel worker. + */ +static void +_brin_leader_participate_as_worker(BrinBuildState *buildstate, Relation heap, Relation index) +{ + BrinLeader *brinleader = buildstate->bs_leader; + int sortmem; + + /* Allocate memory and initialize private spool */ + buildstate->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + buildstate->bs_spool->heap = buildstate->bs_spool->heap; + buildstate->bs_spool->index = buildstate->bs_spool->index; + + /* + * Might as well use reliable figure when doling out maintenance_work_mem + * (when requested number of workers were not launched, this will be + * somewhat higher than it is for other workers). + */ + sortmem = maintenance_work_mem / brinleader->nparticipanttuplesorts; + + /* Perform work common to all participants */ + _brin_parallel_scan_and_build(buildstate, buildstate->bs_spool, brinleader->brinshared, + brinleader->sharedsort, heap, index, sortmem, true); +} + +/* + * Perform a worker's portion of a parallel sort. + * + * This generates a tuplesort for passed btspool, and a second tuplesort + * state if a second btspool is need (i.e. for unique index builds). All + * other spool fields should already be set when this is called. + * + * sortmem is the amount of working memory to use within each worker, + * expressed in KBs. + * + * When this returns, workers are done, and need only release resources. + */ +static void +_brin_parallel_scan_and_build(BrinBuildState *state, BrinSpool *brinspool, + BrinShared *brinshared, Sharedsort *sharedsort, + Relation heap, Relation index, int sortmem, + bool progress) +{ + SortCoordinate coordinate; + TableScanDesc scan; + double reltuples; + IndexInfo *indexInfo; + + /* Initialize local tuplesort coordination state */ + coordinate = palloc0(sizeof(SortCoordinateData)); + coordinate->isWorker = true; + coordinate->nParticipants = -1; + coordinate->sharedsort = sharedsort; + + /* Begin "partial" tuplesort */ + brinspool->sortstate = tuplesort_begin_index_brin(brinspool->heap, + brinspool->index, + sortmem, coordinate, + TUPLESORT_NONE); + + /* Join parallel scan */ + indexInfo = BuildIndexInfo(index); + indexInfo->ii_Concurrent = brinshared->isconcurrent; + + scan = table_beginscan_parallel(heap, + ParallelTableScanFromBrinShared(brinshared)); + + reltuples = table_index_build_scan(heap, index, indexInfo, true, true, + brinbuildCallbackParallel, state, scan); + + /* insert the last item */ + form_and_spill_tuple(state); + + /* sort the BRIN ranges built by this worker */ + tuplesort_performsort(brinspool->sortstate); + + state->bs_reltuples += reltuples; + + /* + * Done. Record ambuild statistics. + */ + SpinLockAcquire(&brinshared->mutex); + brinshared->nparticipantsdone++; + brinshared->reltuples += state->bs_reltuples; + brinshared->indtuples += state->bs_numtuples; + SpinLockRelease(&brinshared->mutex); + + /* Notify leader */ + ConditionVariableSignal(&brinshared->workersdonecv); + + tuplesort_end(brinspool->sortstate); +} + +/* + * Perform work within a launched parallel process. + */ +void +_brin_parallel_build_main(dsm_segment *seg, shm_toc *toc) +{ + char *sharedquery; + BrinShared *brinshared; + Sharedsort *sharedsort; + BrinBuildState *buildstate; + Relation heapRel; + Relation indexRel; + LOCKMODE heapLockmode; + LOCKMODE indexLockmode; + WalUsage *walusage; + BufferUsage *bufferusage; + int sortmem; + + /* + * The only possible status flag that can be set to the parallel worker is + * PROC_IN_SAFE_IC. + */ + Assert((MyProc->statusFlags == 0) || + (MyProc->statusFlags == PROC_IN_SAFE_IC)); + + /* Set debug_query_string for individual workers first */ + sharedquery = shm_toc_lookup(toc, PARALLEL_KEY_QUERY_TEXT, true); + debug_query_string = sharedquery; + + /* Report the query string from leader */ + pgstat_report_activity(STATE_RUNNING, debug_query_string); + + /* Look up brin shared state */ + brinshared = shm_toc_lookup(toc, PARALLEL_KEY_BRIN_SHARED, false); + + /* Open relations using lock modes known to be obtained by index.c */ + if (!brinshared->isconcurrent) + { + heapLockmode = ShareLock; + indexLockmode = AccessExclusiveLock; + } + else + { + heapLockmode = ShareUpdateExclusiveLock; + indexLockmode = RowExclusiveLock; + } + + /* Open relations within worker */ + heapRel = table_open(brinshared->heaprelid, heapLockmode); + indexRel = index_open(brinshared->indexrelid, indexLockmode); + + buildstate = initialize_brin_buildstate(indexRel, NULL, brinshared->pagesPerRange); + + /* Initialize worker's own spool */ + buildstate->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + buildstate->bs_spool->heap = heapRel; + buildstate->bs_spool->index = indexRel; + + /* Look up shared state private to tuplesort.c */ + sharedsort = shm_toc_lookup(toc, PARALLEL_KEY_TUPLESORT, false); + tuplesort_attach_shared(sharedsort, seg); + + /* Prepare to track buffer usage during parallel execution */ + InstrStartParallelQuery(); + + /* + * Might as well use reliable figure when doling out maintenance_work_mem + * (when requested number of workers were not launched, this will be + * somewhat higher than it is for other workers). + */ + sortmem = maintenance_work_mem / brinshared->scantuplesortstates; + + _brin_parallel_scan_and_build(buildstate, buildstate->bs_spool, + brinshared, sharedsort, + heapRel, indexRel, sortmem, false); + + /* Report WAL/buffer usage during parallel execution */ + bufferusage = shm_toc_lookup(toc, PARALLEL_KEY_BUFFER_USAGE, false); + walusage = shm_toc_lookup(toc, PARALLEL_KEY_WAL_USAGE, false); + InstrEndParallelQuery(&bufferusage[ParallelWorkerNumber], + &walusage[ParallelWorkerNumber]); + + index_close(indexRel, indexLockmode); + table_close(heapRel, heapLockmode); +} diff --git a/src/backend/access/gin/ginutil.c b/src/backend/access/gin/ginutil.c index a875c5d3d7..9b1a0ac345 100644 --- a/src/backend/access/gin/ginutil.c +++ b/src/backend/access/gin/ginutil.c @@ -54,6 +54,7 @@ ginhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = true; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = true; amroutine->amsummarizing = false; diff --git a/src/backend/access/gist/gist.c b/src/backend/access/gist/gist.c index 9a1bf8f66c..e052ba8bda 100644 --- a/src/backend/access/gist/gist.c +++ b/src/backend/access/gist/gist.c @@ -76,6 +76,7 @@ gisthandler(PG_FUNCTION_ARGS) amroutine->amclusterable = true; amroutine->ampredlocks = true; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = true; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/hash/hash.c b/src/backend/access/hash/hash.c index 6443ff21bd..905519692c 100644 --- a/src/backend/access/hash/hash.c +++ b/src/backend/access/hash/hash.c @@ -73,6 +73,7 @@ hashhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = true; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/nbtree/nbtree.c b/src/backend/access/nbtree/nbtree.c index 0930f9b37e..6c8cd93fa0 100644 --- a/src/backend/access/nbtree/nbtree.c +++ b/src/backend/access/nbtree/nbtree.c @@ -112,6 +112,7 @@ bthandler(PG_FUNCTION_ARGS) amroutine->amclusterable = true; amroutine->ampredlocks = true; amroutine->amcanparallel = true; + amroutine->amcanbuildparallel = true; amroutine->amcaninclude = true; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/spgist/spgutils.c b/src/backend/access/spgist/spgutils.c index 30c00876a5..fd4b615710 100644 --- a/src/backend/access/spgist/spgutils.c +++ b/src/backend/access/spgist/spgutils.c @@ -60,6 +60,7 @@ spghandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = true; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/transam/parallel.c b/src/backend/access/transam/parallel.c index 194a1207be..d78314062e 100644 --- a/src/backend/access/transam/parallel.c +++ b/src/backend/access/transam/parallel.c @@ -14,6 +14,7 @@ #include "postgres.h" +#include "access/brin.h" #include "access/nbtree.h" #include "access/parallel.h" #include "access/session.h" @@ -145,6 +146,9 @@ static const struct { "_bt_parallel_build_main", _bt_parallel_build_main }, + { + "_brin_parallel_build_main", _brin_parallel_build_main + }, { "parallel_vacuum_main", parallel_vacuum_main } diff --git a/src/backend/catalog/index.c b/src/backend/catalog/index.c index 143fae01eb..40abbaf476 100644 --- a/src/backend/catalog/index.c +++ b/src/backend/catalog/index.c @@ -2982,7 +2982,7 @@ index_build(Relation heapRelation, * Note that planner considers parallel safety for us. */ if (parallel && IsNormalProcessingMode() && - indexRelation->rd_rel->relam == BTREE_AM_OID) + indexRelation->rd_indam->amcanbuildparallel) indexInfo->ii_ParallelWorkers = plan_create_index_workers(RelationGetRelid(heapRelation), RelationGetRelid(indexRelation)); diff --git a/src/backend/utils/sort/tuplesortvariants.c b/src/backend/utils/sort/tuplesortvariants.c index 2cd508e513..90fc605f1c 100644 --- a/src/backend/utils/sort/tuplesortvariants.c +++ b/src/backend/utils/sort/tuplesortvariants.c @@ -19,6 +19,7 @@ #include "postgres.h" +#include "access/brin_tuple.h" #include "access/hash.h" #include "access/htup_details.h" #include "access/nbtree.h" @@ -43,6 +44,8 @@ static void removeabbrev_cluster(Tuplesortstate *state, SortTuple *stups, int count); static void removeabbrev_index(Tuplesortstate *state, SortTuple *stups, int count); +static void removeabbrev_index_brin(Tuplesortstate *state, SortTuple *stups, + int count); static void removeabbrev_datum(Tuplesortstate *state, SortTuple *stups, int count); static int comparetup_heap(const SortTuple *a, const SortTuple *b, @@ -69,10 +72,16 @@ static int comparetup_index_hash(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); static int comparetup_index_hash_tiebreak(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); +static int comparetup_index_brin(const SortTuple *a, const SortTuple *b, + Tuplesortstate *state); static void writetup_index(Tuplesortstate *state, LogicalTape *tape, SortTuple *stup); static void readtup_index(Tuplesortstate *state, SortTuple *stup, LogicalTape *tape, unsigned int len); +static void writetup_index_brin(Tuplesortstate *state, LogicalTape *tape, + SortTuple *stup); +static void readtup_index_brin(Tuplesortstate *state, SortTuple *stup, + LogicalTape *tape, unsigned int len); static int comparetup_datum(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); static int comparetup_datum_tiebreak(const SortTuple *a, const SortTuple *b, @@ -128,6 +137,16 @@ typedef struct uint32 max_buckets; } TuplesortIndexHashArg; +/* + * Data struture pointed by "TuplesortPublic.arg" for the index_brin subcase. + */ +typedef struct +{ + TuplesortIndexArg index; + + /* XXX do we need something here? */ +} TuplesortIndexBrinArg; + /* * Data struture pointed by "TuplesortPublic.arg" for the Datum case. * Set by tuplesort_begin_datum and used only by the DatumTuple routines. @@ -140,6 +159,21 @@ typedef struct int datumTypeLen; } TuplesortDatumArg; +/* + * Computing BrinTuple size with only the tuple is difficult, so we want to track + * the length referenced by the SortTuple. That's what BrinSortTuple is meant + * to do - it's essentially a BrinTuple prefixed by its length. + */ +typedef struct BrinSortTuple +{ + Size tuplen; + BrinTuple tuple; +} BrinSortTuple; + +/* Size of the BrinSortTuple, given length of the BrinTuple. */ +#define BRINSORTTUPLE_SIZE(len) (offsetof(BrinSortTuple, tuple) + (len)) + + Tuplesortstate * tuplesort_begin_heap(TupleDesc tupDesc, int nkeys, AttrNumber *attNums, @@ -527,6 +561,47 @@ tuplesort_begin_index_gist(Relation heapRel, return state; } +Tuplesortstate * +tuplesort_begin_index_brin(Relation heapRel, + Relation indexRel, + int workMem, + SortCoordinate coordinate, + int sortopt) +{ + Tuplesortstate *state = tuplesort_begin_common(workMem, coordinate, + sortopt); + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext; + TuplesortIndexBrinArg *arg; + + oldcontext = MemoryContextSwitchTo(base->maincontext); + arg = (TuplesortIndexBrinArg *) palloc(sizeof(TuplesortIndexBrinArg)); + +#ifdef TRACE_SORT + if (trace_sort) + elog(LOG, + "begin index sort: workMem = %d, randomAccess = %c", + workMem, + sortopt & TUPLESORT_RANDOMACCESS ? 't' : 'f'); +#endif + + base->nKeys = 1; /* Only one sort column, the block number */ + + base->removeabbrev = removeabbrev_index_brin; + base->comparetup = comparetup_index_brin; + base->writetup = writetup_index_brin; + base->readtup = readtup_index_brin; + base->haveDatum1 = true; + base->arg = arg; + + arg->index.heapRel = heapRel; + arg->index.indexRel = indexRel; + + MemoryContextSwitchTo(oldcontext); + + return state; +} + Tuplesortstate * tuplesort_begin_datum(Oid datumType, Oid sortOperator, Oid sortCollation, bool nullsFirstFlag, int workMem, @@ -707,6 +782,35 @@ tuplesort_putindextuplevalues(Tuplesortstate *state, Relation rel, !stup.isnull1); } +/* + * Collect one BRIN tuple while collecting input data for sort. + */ +void +tuplesort_putbrintuple(Tuplesortstate *state, BrinTuple *tuple, Size size) +{ + SortTuple stup; + BrinSortTuple *bstup; + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext = MemoryContextSwitchTo(base->tuplecontext); + + /* allocate space for the whole BRIN sort tuple */ + bstup = palloc(BRINSORTTUPLE_SIZE(size)); + + bstup->tuplen = size; + memcpy(&bstup->tuple, tuple, size); + + stup.tuple = bstup; + stup.datum1 = tuple->bt_blkno; + stup.isnull1 = false; + + tuplesort_puttuple_common(state, &stup, + base->sortKeys && + base->sortKeys->abbrev_converter && + !stup.isnull1); + + MemoryContextSwitchTo(oldcontext); +} + /* * Accept one Datum while collecting input data for sort. * @@ -850,6 +954,35 @@ tuplesort_getindextuple(Tuplesortstate *state, bool forward) return (IndexTuple) stup.tuple; } +/* + * Fetch the next BRIN tuple in either forward or back direction. + * Returns NULL if no more tuples. Returned tuple belongs to tuplesort memory + * context, and must not be freed by caller. Caller may not rely on tuple + * remaining valid after any further manipulation of tuplesort. + */ +BrinTuple * +tuplesort_getbrintuple(Tuplesortstate *state, Size *len, bool forward) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext = MemoryContextSwitchTo(base->sortcontext); + SortTuple stup; + BrinSortTuple *btup; + + if (!tuplesort_gettuple_common(state, forward, &stup)) + stup.tuple = NULL; + + MemoryContextSwitchTo(oldcontext); + + if (!stup.tuple) + return NULL; + + btup = (BrinSortTuple *) stup.tuple; + + *len = btup->tuplen; + + return &btup->tuple; +} + /* * Fetch the next Datum in either forward or back direction. * Returns false if no more datums. @@ -1564,6 +1697,80 @@ readtup_index(Tuplesortstate *state, SortTuple *stup, &stup->isnull1); } +/* + * Routines specialized for BrinTuple case + */ + +static void +removeabbrev_index_brin(Tuplesortstate *state, SortTuple *stups, int count) +{ + int i; + + for (i = 0; i < count; i++) + { + BrinSortTuple *tuple; + + tuple = stups[i].tuple; + stups[i].datum1 = tuple->tuple.bt_blkno; + } +} + +static int +comparetup_index_brin(const SortTuple *a, const SortTuple *b, + Tuplesortstate *state) +{ + Assert(TuplesortstateGetPublic(state)->haveDatum1); + + if (DatumGetUInt32(a->datum1) > DatumGetUInt32(b->datum1)) + return 1; + + if (DatumGetUInt32(a->datum1) < DatumGetUInt32(b->datum1)) + return -1; + + /* silence compilers */ + return 0; +} + +static void +writetup_index_brin(Tuplesortstate *state, LogicalTape *tape, SortTuple *stup) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + BrinSortTuple *tuple = (BrinSortTuple *) stup->tuple; + unsigned int tuplen = tuple->tuplen; + + tuplen = tuplen + sizeof(tuplen); + LogicalTapeWrite(tape, &tuplen, sizeof(tuplen)); + LogicalTapeWrite(tape, &tuple->tuple, tuple->tuplen); + if (base->sortopt & TUPLESORT_RANDOMACCESS) /* need trailing length word? */ + LogicalTapeWrite(tape, &tuplen, sizeof(tuplen)); +} + +static void +readtup_index_brin(Tuplesortstate *state, SortTuple *stup, + LogicalTape *tape, unsigned int len) +{ + BrinSortTuple *tuple; + TuplesortPublic *base = TuplesortstateGetPublic(state); + unsigned int tuplen = len - sizeof(unsigned int); + + /* + * Allocate space for the BRIN sort tuple, which is BrinTuple with an + * extra length field. + */ + tuple = (BrinSortTuple *) tuplesort_readtup_alloc(state, + BRINSORTTUPLE_SIZE(tuplen)); + + tuple->tuplen = tuplen; + + LogicalTapeReadExact(tape, &tuple->tuple, tuplen); + if (base->sortopt & TUPLESORT_RANDOMACCESS) /* need trailing length word? */ + LogicalTapeReadExact(tape, &tuplen, sizeof(tuplen)); + stup->tuple = (void *) tuple; + + /* set up first-column key value, which is block number */ + stup->datum1 = tuple->tuple.bt_blkno; +} + /* * Routines specialized for DatumTuple case */ diff --git a/src/include/access/amapi.h b/src/include/access/amapi.h index 244459587f..df85ae3aac 100644 --- a/src/include/access/amapi.h +++ b/src/include/access/amapi.h @@ -243,6 +243,8 @@ typedef struct IndexAmRoutine bool ampredlocks; /* does AM support parallel scan? */ bool amcanparallel; + /* does AM support parallel build? */ + bool amcanbuildparallel; /* does AM support columns included with clause INCLUDE? */ bool amcaninclude; /* does AM use maintenance_work_mem? */ diff --git a/src/include/access/brin.h b/src/include/access/brin.h index ed66f1b3d5..3451ecb211 100644 --- a/src/include/access/brin.h +++ b/src/include/access/brin.h @@ -11,6 +11,7 @@ #define BRIN_H #include "nodes/execnodes.h" +#include "storage/shm_toc.h" #include "utils/relcache.h" @@ -52,4 +53,6 @@ typedef struct BrinStatsData extern void brinGetStats(Relation index, BrinStatsData *stats); +extern void _brin_parallel_build_main(dsm_segment *seg, shm_toc *toc); + #endif /* BRIN_H */ diff --git a/src/include/utils/tuplesort.h b/src/include/utils/tuplesort.h index 9ed2de76cd..357eb35311 100644 --- a/src/include/utils/tuplesort.h +++ b/src/include/utils/tuplesort.h @@ -21,6 +21,7 @@ #ifndef TUPLESORT_H #define TUPLESORT_H +#include "access/brin_tuple.h" #include "access/itup.h" #include "executor/tuptable.h" #include "storage/dsm.h" @@ -282,6 +283,9 @@ typedef struct * The "index_hash" API is similar to index_btree, but the tuples are * actually sorted by their hash codes not the raw data. * + * The "index_brin" API is similar to index_btree, but the tuples are + * BrinTuple and are sorted by their block number not the raw data. + * * Parallel sort callers are required to coordinate multiple tuplesort states * in a leader process and one or more worker processes. The leader process * must launch workers, and have each perform an independent "partial" @@ -426,6 +430,10 @@ extern Tuplesortstate *tuplesort_begin_index_gist(Relation heapRel, Relation indexRel, int workMem, SortCoordinate coordinate, int sortopt); +extern Tuplesortstate *tuplesort_begin_index_brin(Relation heapRel, + Relation indexRel, + int workMem, SortCoordinate coordinate, + int sortopt); extern Tuplesortstate *tuplesort_begin_datum(Oid datumType, Oid sortOperator, Oid sortCollation, bool nullsFirstFlag, @@ -438,6 +446,7 @@ extern void tuplesort_putheaptuple(Tuplesortstate *state, HeapTuple tup); extern void tuplesort_putindextuplevalues(Tuplesortstate *state, Relation rel, ItemPointer self, const Datum *values, const bool *isnull); +extern void tuplesort_putbrintuple(Tuplesortstate *state, BrinTuple *tup, Size len); extern void tuplesort_putdatum(Tuplesortstate *state, Datum val, bool isNull); @@ -445,6 +454,8 @@ extern bool tuplesort_gettupleslot(Tuplesortstate *state, bool forward, bool copy, TupleTableSlot *slot, Datum *abbrev); extern HeapTuple tuplesort_getheaptuple(Tuplesortstate *state, bool forward); extern IndexTuple tuplesort_getindextuple(Tuplesortstate *state, bool forward); +extern BrinTuple *tuplesort_getbrintuple(Tuplesortstate *state, Size *len, + bool forward); extern bool tuplesort_getdatum(Tuplesortstate *state, bool forward, bool copy, Datum *val, bool *isNull, Datum *abbrev); diff --git a/src/test/modules/dummy_index_am/dummy_index_am.c b/src/test/modules/dummy_index_am/dummy_index_am.c index cbdae7ab7a..eaa0c483b7 100644 --- a/src/test/modules/dummy_index_am/dummy_index_am.c +++ b/src/test/modules/dummy_index_am/dummy_index_am.c @@ -294,6 +294,7 @@ dihandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/tools/pgindent/typedefs.list b/src/tools/pgindent/typedefs.list index 86a9886d4f..001fef5865 100644 --- a/src/tools/pgindent/typedefs.list +++ b/src/tools/pgindent/typedefs.list @@ -297,13 +297,17 @@ BpChar BrinBuildState BrinDesc BrinInsertState +BrinLeader BrinMemTuple BrinMetaPageData BrinOpaque BrinOpcInfo BrinOptions BrinRevmap +BrinShared +BrinSortTuple BrinSpecialSpace +BrinSpool BrinStatsData BrinTuple BrinValues @@ -2879,6 +2883,7 @@ TupleTableSlotOps TuplesortClusterArg TuplesortDatumArg TuplesortIndexArg +TuplesortIndexBrinArg TuplesortIndexBTreeArg TuplesortIndexHashArg TuplesortInstrumentation -- 2.40.1 ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-29 14:52 Tomas Vondra <[email protected]> parent: Matthias van de Meent <[email protected]> 0 siblings, 1 reply; 25+ messages in thread From: Tomas Vondra @ 2023-11-29 14:52 UTC (permalink / raw) To: Matthias van de Meent <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On 11/29/23 15:42, Matthias van de Meent wrote: > On Tue, 28 Nov 2023 at 18:59, Tomas Vondra > <[email protected]> wrote: >> >> On 11/28/23 16:39, Matthias van de Meent wrote: >>> On Thu, 23 Nov 2023 at 14:35, Tomas Vondra >>> <[email protected]> wrote: >>>> On 11/23/23 13:33, Matthias van de Meent wrote: >>>>> The union operator may leak (lots of) memory, so I think it makes >>>>> sense to keep a context around that can be reset after we've extracted >>>>> the merge result. >>>>> >>>> >>>> But does the current code actually achieve that? It does create a "brin >>>> union" context, but then it only does this: >>>> >>>> /* Use our own memory context to avoid retail pfree */ >>>> cxt = AllocSetContextCreate(CurrentMemoryContext, >>>> "brin union", >>>> ALLOCSET_DEFAULT_SIZES); >>>> oldcxt = MemoryContextSwitchTo(cxt); >>>> db = brin_deform_tuple(bdesc, b, NULL); >>>> MemoryContextSwitchTo(oldcxt); >>>> >>>> Surely that does not limit the amount of memory used by the actual union >>>> functions in any way? >>> >>> Oh, yes, of course. For some reason I thought that covered the calls >>> to the union operator function too, but it indeed only covers >>> deserialization. I do think it is still worthwhile to not do the >>> create/delete cycle, but won't hold the patch back for that. >>> >> >> I think the union_tuples() changes are better left for a separate patch. >> >>>>>> However, I don't think the number of union_tuples calls is likely to be >>>>>> very high, especially for large tables. Because we split the table into >>>>>> 2048 chunks, and then cap the chunk size by 8192. For large tables >>>>>> (where this matters) we're likely close to 8192. >>>>> >>>>> I agree that the merging part of the index creation is the last part, >>>>> and usually has no high impact on the total performance of the reindex >>>>> operation, but in memory-constrained environments releasing and then >>>>> requesting the same chunk of memory over and over again just isn't >>>>> great. >>>> >>>> OK, I'll take a look at the scratch context you suggested. >>>> >>>> My point however was we won't actually do that very often, because on >>>> large tables the BRIN ranges are likely smaller than the parallel scan >>>> chunk size, so few overlaps. OTOH if the table is small, or if the BRIN >>>> ranges are large, there'll be few of them. >>> >>> That's true, so maybe I'm concerned about something that amounts to >>> only marginal gains. >>> >> >> However, after thinking about this a bit more, I think we actually do >> need to do something about the memory management when merging tuples. >> AFAIK the general assumption was that union_tuple() only runs for a >> single range, and then the whole context gets freed. > > Correct, but it is also is (or should be) assumed that union_tuple > will be called several times in the same context to fix repeat > concurrent updates. Presumably, that only happens rarely, but it's > something that should be kept in mind regardless. > In theory, yes. But union_tuples() is used only in summarize_range(), and that only processes a single page range. >> But the way the >> merging was implemented, it all runs in a single context. And while a >> single union_tuple() may not need a lot memory, in total it may be >> annoying. I just added a palloc(1MB) into union_tuples and ended up with >> ~160MB allocated in the PortalContext on just 2GB table. In practice the >> memory will grow more slowly, but not great :-/ >> >> The attached 0003 patch adds a memory context that's reset after >> producing a merged BRIN tuple for each page range. > > Looks good. > > This also made me think a bit more about how we're working with the > tuples. With your latest patch, we always deserialize and re-serialize > the sorted brin tuples, just in case the next tuple will also be a > BRIN tuple of the same page range. Could we save some of that > deserialization time by optimistically expecting that we're not going > to need to merge the tuple and only store a local copy of it locally? > See attached 0002; this saves some cycles in common cases. > Good idea! > The v20231128 version of the patchset (as squashed, attached v5-0001) > looks good to me. > Cool. I'll put this through a bit more stress testing, and then I'll get it pushed. Thanks for the reviews! -- Tomas Vondra EnterpriseDB: http://www.enterprisedb.com The Enterprise PostgreSQL Company ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-29 17:55 Tomas Vondra <[email protected]> parent: Tomas Vondra <[email protected]> 0 siblings, 1 reply; 25+ messages in thread From: Tomas Vondra @ 2023-11-29 17:55 UTC (permalink / raw) To: Matthias van de Meent <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On 11/29/23 15:52, Tomas Vondra wrote: >> ... >> >> This also made me think a bit more about how we're working with the >> tuples. With your latest patch, we always deserialize and re-serialize >> the sorted brin tuples, just in case the next tuple will also be a >> BRIN tuple of the same page range. Could we save some of that >> deserialization time by optimistically expecting that we're not going >> to need to merge the tuple and only store a local copy of it locally? >> See attached 0002; this saves some cycles in common cases. >> > > Good idea! > FWIW there's a bug, in this part of the optimization: ------------------ + if (memtuple == NULL) + memtuple = brin_deform_tuple(state->bs_bdesc, btup, + memtup_holder); + union_tuples(state->bs_bdesc, memtuple, btup); continue; ------------------ The deforming should use prevbtup, otherwise union_tuples() jut combines two copies of the same tuple. Which however brings me to the bigger issue with this - my stress test found this issue pretty quickly, but then I spent quite a bit of time trying to find what went wrong. I find this reworked code pretty hard to understand, and not necessarily because of how it's written. The problem is it the same loop tries to juggle multiple pieces of information with different lifespans, and so on. I find it really hard to reason about how it behaves ... I did try to measure how much it actually saves, but none of the tests I did actually found measurable improvement. So I'm tempted to just not include this part, and accept that we may deserialize some of the tuples unnecessarily. Did you actually observe measurable improvements in some cases? regards -- Tomas Vondra EnterpriseDB: http://www.enterprisedb.com The Enterprise PostgreSQL Company ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-29 20:30 Matthias van de Meent <[email protected]> parent: Tomas Vondra <[email protected]> 0 siblings, 1 reply; 25+ messages in thread From: Matthias van de Meent @ 2023-11-29 20:30 UTC (permalink / raw) To: Tomas Vondra <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On Wed, 29 Nov 2023 at 18:55, Tomas Vondra <[email protected]> wrote: > > On 11/29/23 15:52, Tomas Vondra wrote: > >> ... > >> > >> This also made me think a bit more about how we're working with the > >> tuples. With your latest patch, we always deserialize and re-serialize > >> the sorted brin tuples, just in case the next tuple will also be a > >> BRIN tuple of the same page range. Could we save some of that > >> deserialization time by optimistically expecting that we're not going > >> to need to merge the tuple and only store a local copy of it locally? > >> See attached 0002; this saves some cycles in common cases. > >> > > > > Good idea! > > > > FWIW there's a bug, in this part of the optimization: > > ------------------ > + if (memtuple == NULL) > + memtuple = brin_deform_tuple(state->bs_bdesc, btup, > + memtup_holder); > + > union_tuples(state->bs_bdesc, memtuple, btup); > continue; > ------------------ > > The deforming should use prevbtup, otherwise union_tuples() jut combines > two copies of the same tuple. Good point. There were some more issues as well, fixes are attached. > Which however brings me to the bigger issue with this - my stress test > found this issue pretty quickly, but then I spent quite a bit of time > trying to find what went wrong. I find this reworked code pretty hard to > understand, and not necessarily because of how it's written. The problem > is it the same loop tries to juggle multiple pieces of information with > different lifespans, and so on. I find it really hard to reason about > how it behaves ... Yeah, it'd be nice if we had a peek option for sortsupport, that'd improve context handling. > I did try to measure how much it actually saves, but none of the tests I > did actually found measurable improvement. So I'm tempted to just not > include this part, and accept that we may deserialize some of the tuples > unnecessarily. > > Did you actually observe measurable improvements in some cases? The improvements would mostly stem from brin indexes with multiple (potentially compressed) by-ref types, as they go through more complex and expensive code to deserialize, requiring separate palloc() and memcpy() calls each. For single-column and by-value types the improvements are expected to be negligible, because there is no meaningful difference between copying a single by-ref value and copying its container; the additional work done for each tuple is marginal for those. For an 8-column BRIN index ((sha256((id)::text::bytea)::text), (sha256((id+1)::text::bytea)::text), (sha256((id+2)::text::bytea)::text), ...) instrumented with 0003 I measured a difference of 10x less time spent in the main loop of _brin_end_parallel, from ~30ms to 3ms when dealing with 55k 1-block ranges. It's not a lot, but worth at least something, I guess? The attached patch fixes the issue that you called out . It also further updates _brin_end_parallel: the final 'write empty tuples' loop is never hit and is thus removed, because if there were any tuples in the spool we'd have filled the empty ranges at the end of the main loop, and if there were no tuples in the spool then the memtuple would still be at its original initialized value of 0 thus resulting in a constant false condition. I also updated some comments. Kind regards, Matthias van de Meent Neon (https://neon.tech) Attachments: [application/octet-stream] v6-0003-NOCOMMIT-Instrumentation-for-time-spent-in-_brin_.patch (2.7K, ../../CAEze2Wi9nWxx2wDTHaBJi36JLQ+-JcTU0BcRh+yd8AR-9VNxTw@mail.gmail.com/2-v6-0003-NOCOMMIT-Instrumentation-for-time-spent-in-_brin_.patch) download | inline diff: From 97707510215456cf8db0f720b1c9a96e6f4dc073 Mon Sep 17 00:00:00 2001 From: Matthias van de Meent <[email protected]> Date: Wed, 29 Nov 2023 20:35:22 +0100 Subject: [PATCH v6 3/3] NOCOMMIT: Instrumentation for time spent in _brin_end_parallel --- src/backend/access/brin/brin.c | 17 +++++++++++++++++ 1 file changed, 17 insertions(+) diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index e7ec7c7b53..119c23cb09 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -2482,6 +2482,9 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) oldCxt; BrinTuple *prevbtup = NULL; Size prevtuplen; + instr_time time_spent; + + INSTR_TIME_SET_ZERO(time_spent); /* Shutdown worker processes */ WaitForParallelWorkersToFinish(brinleader->pcxt); @@ -2523,6 +2526,11 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) */ while ((btup = tuplesort_getbrintuple(spool->sortstate, &tuplen, true)) != NULL) { + instr_time opr_start; + instr_time opr_end; + + INSTR_TIME_SET_CURRENT(opr_start); + /* Ranges should be multiples of pages_per_range for the index. */ Assert(btup->bt_blkno % brinshared->pagesPerRange == 0); @@ -2579,6 +2587,8 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) } union_tuples(state->bs_bdesc, memtuple, btup); + INSTR_TIME_SET_CURRENT(opr_end); + INSTR_TIME_ACCUM_DIFF(time_spent, opr_end, opr_start); continue; } else @@ -2602,8 +2612,11 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) len = prevtuplen; } + INSTR_TIME_SET_CURRENT(opr_end); + INSTR_TIME_ACCUM_DIFF(time_spent, opr_end, opr_start); brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); + INSTR_TIME_SET_CURRENT(opr_start); /* * Reset the per-output-range context. This frees all the memory @@ -2627,6 +2640,9 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) /* continue to insert empty pages before thisblock */ } + INSTR_TIME_SET_CURRENT(opr_end); + INSTR_TIME_ACCUM_DIFF(time_spent, opr_end, opr_start); + /* Fill empty ranges for all ranges missing in the tuplesort. */ prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; while (prevblkno + state->bs_pagesPerRange < btup->bt_blkno) @@ -2698,6 +2714,7 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) UnregisterSnapshot(brinleader->snapshot); DestroyParallelContext(brinleader->pcxt); ExitParallelMode(); + elog(LOG, "Spent %ld nanos on non-IO tasks", INSTR_TIME_GET_NANOSEC(time_spent)); } /* -- 2.40.1 [application/octet-stream] v6-0002-Reduce-de-forming-of-BRIN-tuples-in-parallel-BRIN.patch (7.6K, ../../CAEze2Wi9nWxx2wDTHaBJi36JLQ+-JcTU0BcRh+yd8AR-9VNxTw@mail.gmail.com/3-v6-0002-Reduce-de-forming-of-BRIN-tuples-in-parallel-BRIN.patch) download | inline diff: From 2a1de622d4a83b940fba3ad6f9f1d1af334d2552 Mon Sep 17 00:00:00 2001 From: Matthias van de Meent <[email protected]> Date: Wed, 29 Nov 2023 15:09:17 +0100 Subject: [PATCH v6 2/3] Reduce de-/forming of BRIN tuples in parallel BRIN build De-/forming of the BRIN tuple is actually quite expensive, so in this commit we introduce a mechanism where we don't do that if only one BRIN tuple is stored in the shared sort by moving the serialized tuple into the local context, and only deserialize it once we need to use the memtuple. --- src/backend/access/brin/brin.c | 115 ++++++++++++++++++++------------- 1 file changed, 70 insertions(+), 45 deletions(-) diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index 001cf04aac..e7ec7c7b53 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -2471,6 +2471,7 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) int i; BrinTuple *btup; BrinMemTuple *memtuple = NULL; + BrinMemTuple *memtup_holder = NULL; Size tuplen; BrinShared *brinshared = brinleader->brinshared; BlockNumber prevblkno = InvalidBlockNumber; @@ -2479,6 +2480,8 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) BrinSpool *spool; MemoryContext rangeCxt, oldCxt; + BrinTuple *prevbtup = NULL; + Size prevtuplen; /* Shutdown worker processes */ WaitForParallelWorkersToFinish(brinleader->pcxt); @@ -2498,7 +2501,7 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) * Initialize BrinMemTuple we'll use to union summaries from workers (in * case they happened to produce parts of the same paga range). */ - memtuple = brin_new_memtuple(state->bs_bdesc); + memtup_holder = brin_new_memtuple(state->bs_bdesc); /* * Create a memory context we'll reset to combine results for a single @@ -2526,9 +2529,10 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) /* * Do we need to union summaries for the same page range? * - * If this is the first brin tuple we read, then just deform it into - * the memtuple, and continue with the next one from tuplesort. We - * however may need to insert empty summaries into the index. + * If this is the first brin tuple we read, then cache it and continue + * with the next one from tuplesort. We however may need to insert + * empty summaries into the index for the page ranges < the first + * page. * * If it's the same block as the last we saw, we simply union the brin * tuple into it, and we're done - we don't even need to insert empty @@ -2539,20 +2543,41 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) * page range, we need to do the insert and then deform the tuple into * the memtuple. Then we'll insert empty ranges before the new brin * tuple, if needed. + * + * Because it is likely we only get one tuple for each page range, we + * only deform the tuple when we actually need to merge the data. This + * means we'll only deform the tuple if we detect duplicates, and the + * deformed tuple is stored as memtuple. `memtuple_holder` is the + * reference to the BRIN memory tuple, memtuple refers to the same + * tuple if and when in use for merging data. + * + * When writing data to disk, we take care to use the cached copy if + * memtuple is not set, otherwise we form a new tuple and write that + * out to disk. */ if (prevblkno == InvalidBlockNumber) { - /* First brin tuples, just deform into memtuple. */ - memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); + /* First brin tuple, store it in the local context. */ + prevbtup = palloc0(tuplen); + memcpy(prevbtup, btup, tuplen); + prevtuplen = tuplen; /* continue to insert empty pages before thisblock */ } - else if (memtuple->bt_blkno == btup->bt_blkno) + else if (prevbtup->bt_blkno == btup->bt_blkno) { /* * Not the first brin tuple, but same page range as the previous - * one, so we can merge it into the memtuple. + * one, so we can merge it into the memtuple. If this is the first + * merge for this block number, we still have to deform the + * original tuple before we can merge them. */ + if (memtuple == NULL) + { + memtuple = brin_deform_tuple(state->bs_bdesc, prevbtup, + memtup_holder); + } + union_tuples(state->bs_bdesc, memtuple, btup); continue; } @@ -2563,23 +2588,41 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) /* * We got brin tuple for a different page range, so form a brin - * tuple from the memtuple, insert it, and re-init the memtuple - * from the new brin tuple. + * tuple from the memtuple (if required), insert it, and store a + * copy of the new tuple for future use. */ - tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, - memtuple, &len); + if (memtuple != NULL) + { + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); + } + else + { + tmp = prevbtup; + len = prevtuplen; + } brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); /* * Reset the per-output-range context. This frees all the memory - * possibly allocated by the union functions, and also the BRIN - * tuple we just formed and inserted. + * possibly allocated by the union functions, the previous cached + * btuple, and the btup we just may have formed from the memtuple. */ MemoryContextReset(rangeCxt); - memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); + /* clear any potential pointers to the cleared context */ + memtuple = NULL; + prevbtup = NULL; + + /* + * Prepare for the next iteration by storing the new range's tuple + * in the current context, and resetting memtuple. + */ + prevbtup = palloc0(tuplen); + memcpy(prevbtup, btup, tuplen); + prevtuplen = tuplen; /* continue to insert empty pages before thisblock */ } @@ -2614,44 +2657,26 @@ _brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) tuplesort_end(spool->sortstate); - /* Fill empty ranges at the end, for all ranges missing in the tuplesort. */ - prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; - while (prevblkno + state->bs_pagesPerRange < memtuple->bt_blkno) + /* + * If we had any result ranges, then we need to finish writing the cached + * data. + */ + if (prevbtup != NULL) { - /* the missing range */ - prevblkno += state->bs_pagesPerRange; - - /* Did we already build the empty range? If not, do it now. */ - if (emptyTuple == NULL) - { - BrinMemTuple *dtuple = brin_new_memtuple(state->bs_bdesc); + BrinTuple *tmp; + Size len; - emptyTuple = brin_form_tuple(state->bs_bdesc, prevblkno, dtuple, &emptySize); - } + if (memtuple != NULL) + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); else { - /* we already have am "empty range" tuple, just set the block */ - emptyTuple->bt_blkno = prevblkno; + tmp = prevbtup; + len = prevtuplen; } - brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, - &state->bs_currentInsertBuf, - emptyTuple->bt_blkno, emptyTuple, emptySize); - } - - /* Fill the BRIN tuple for the last page range. */ - if (prevblkno != InvalidBlockNumber) - { - BrinTuple *tmp; - Size len; - - tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, - memtuple, &len); - brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); - - pfree(tmp); } /* -- 2.40.1 [application/octet-stream] v6-0001-Allow-BRIN-to-build-its-index-in-parallel.patch (51.6K, ../../CAEze2Wi9nWxx2wDTHaBJi36JLQ+-JcTU0BcRh+yd8AR-9VNxTw@mail.gmail.com/4-v6-0001-Allow-BRIN-to-build-its-index-in-parallel.patch) download | inline diff: From 48ea20bc3d991ea57475ead179c510a420d5e406 Mon Sep 17 00:00:00 2001 From: Matthias van de Meent <[email protected]> Date: Wed, 29 Nov 2023 14:35:10 +0100 Subject: [PATCH v6 1/3] Allow BRIN to build its index in parallel --- contrib/bloom/blutils.c | 1 + doc/src/sgml/indexam.sgml | 7 + src/backend/access/brin/brin.c | 894 +++++++++++++++++- src/backend/access/gin/ginutil.c | 1 + src/backend/access/gist/gist.c | 1 + src/backend/access/hash/hash.c | 1 + src/backend/access/nbtree/nbtree.c | 1 + src/backend/access/spgist/spgutils.c | 1 + src/backend/access/transam/parallel.c | 4 + src/backend/catalog/index.c | 2 +- src/backend/utils/sort/tuplesortvariants.c | 207 ++++ src/include/access/amapi.h | 2 + src/include/access/brin.h | 3 + src/include/utils/tuplesort.h | 11 + .../modules/dummy_index_am/dummy_index_am.c | 1 + src/tools/pgindent/typedefs.list | 5 + 16 files changed, 1136 insertions(+), 6 deletions(-) diff --git a/contrib/bloom/blutils.c b/contrib/bloom/blutils.c index 4830cb3fee..a781c5d98d 100644 --- a/contrib/bloom/blutils.c +++ b/contrib/bloom/blutils.c @@ -122,6 +122,7 @@ blhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amparallelvacuumoptions = diff --git a/doc/src/sgml/indexam.sgml b/doc/src/sgml/indexam.sgml index f107c43d6a..cc4135e394 100644 --- a/doc/src/sgml/indexam.sgml +++ b/doc/src/sgml/indexam.sgml @@ -123,6 +123,8 @@ typedef struct IndexAmRoutine bool ampredlocks; /* does AM support parallel scan? */ bool amcanparallel; + /* does AM support parallel build? */ + bool amcanbuildparallel; /* does AM support columns included with clause INCLUDE? */ bool amcaninclude; /* does AM use maintenance_work_mem? */ @@ -286,6 +288,11 @@ ambuild (Relation heapRelation, and compute the keys that need to be inserted into the index. The function must return a palloc'd struct containing statistics about the new index. + The <structfield>amcanbuildparallel</structfield> flag indicates whether + the access method supports parallel index builds. When set to <literal>true</literal>, + the system will attempt to allocate parallel workers for the build. + Access methods supporting only non-parallel index builds should leave + this flag set to <literal>false</literal>. </para> <para> diff --git a/src/backend/access/brin/brin.c b/src/backend/access/brin/brin.c index 4f2dfdd17b..001cf04aac 100644 --- a/src/backend/access/brin/brin.c +++ b/src/backend/access/brin/brin.c @@ -33,6 +33,7 @@ #include "postmaster/autovacuum.h" #include "storage/bufmgr.h" #include "storage/freespace.h" +#include "tcop/tcopprot.h" /* pgrminclude ignore */ #include "utils/acl.h" #include "utils/builtins.h" #include "utils/datum.h" @@ -40,7 +41,119 @@ #include "utils/index_selfuncs.h" #include "utils/memutils.h" #include "utils/rel.h" +#include "utils/tuplesort.h" +/* Magic numbers for parallel state sharing */ +#define PARALLEL_KEY_BRIN_SHARED UINT64CONST(0xB000000000000001) +#define PARALLEL_KEY_TUPLESORT UINT64CONST(0xB000000000000002) +#define PARALLEL_KEY_QUERY_TEXT UINT64CONST(0xB000000000000003) +#define PARALLEL_KEY_WAL_USAGE UINT64CONST(0xB000000000000004) +#define PARALLEL_KEY_BUFFER_USAGE UINT64CONST(0xB000000000000005) + +/* + * Status record for spooling/sorting phase. + */ +typedef struct BrinSpool +{ + Tuplesortstate *sortstate; /* state data for tuplesort.c */ + Relation heap; + Relation index; +} BrinSpool; + +/* + * Status for index builds performed in parallel. This is allocated in a + * dynamic shared memory segment. + */ +typedef struct BrinShared +{ + /* + * These fields are not modified during the build. They primarily exist + * for the benefit of worker processes that need to create state + * corresponding to that used by the leader. + */ + Oid heaprelid; + Oid indexrelid; + bool isconcurrent; + BlockNumber pagesPerRange; + int scantuplesortstates; + + /* + * workersdonecv is used to monitor the progress of workers. All parallel + * participants must indicate that they are done before leader can use + * results built by the workers (and before leader can write the data into + * the index). + */ + ConditionVariable workersdonecv; + + /* + * mutex protects all fields before heapdesc. + * + * These fields contain status information of interest to BRIN index + * builds that must work just the same when an index is built in parallel. + */ + slock_t mutex; + + /* + * Mutable state that is maintained by workers, and reported back to + * leader at end of the scans. + * + * nparticipantsdone is number of worker processes finished. + * + * reltuples is the total number of input heap tuples. + * + * indtuples is the total number of tuples that made it into the index. + */ + int nparticipantsdone; + double reltuples; + double indtuples; + + /* + * ParallelTableScanDescData data follows. Can't directly embed here, as + * implementations of the parallel table scan desc interface might need + * stronger alignment. + */ +} BrinShared; + +/* + * Return pointer to a BrinShared's parallel table scan. + * + * c.f. shm_toc_allocate as to why BUFFERALIGN is used, rather than just + * MAXALIGN. + */ +#define ParallelTableScanFromBrinShared(shared) \ + (ParallelTableScanDesc) ((char *) (shared) + BUFFERALIGN(sizeof(BrinShared))) + +/* + * Status for leader in parallel index build. + */ +typedef struct BrinLeader +{ + /* parallel context itself */ + ParallelContext *pcxt; + + /* + * nparticipanttuplesorts is the exact number of worker processes + * successfully launched, plus one leader process if it participates as a + * worker (only DISABLE_LEADER_PARTICIPATION builds avoid leader + * participating as a worker). + */ + int nparticipanttuplesorts; + + /* + * Leader process convenience pointers to shared state (leader avoids TOC + * lookups). + * + * brinshared is the shared state for entire build. sharedsort is the + * shared, tuplesort-managed state passed to each process tuplesort. + * snapshot is the snapshot used by the scan iff an MVCC snapshot is + * required. + */ + BrinShared *brinshared; + Sharedsort *sharedsort; + Snapshot snapshot; + WalUsage *walusage; + BufferUsage *bufferusage; +} BrinLeader; /* * We use a BrinBuildState during initial construction of a BRIN index. @@ -49,13 +162,23 @@ typedef struct BrinBuildState { Relation bs_irel; - int bs_numtuples; + double bs_numtuples; + double bs_reltuples; Buffer bs_currentInsertBuf; BlockNumber bs_pagesPerRange; BlockNumber bs_currRangeStart; BrinRevmap *bs_rmAccess; BrinDesc *bs_bdesc; BrinMemTuple *bs_dtuple; + + /* + * bs_leader is only present when a parallel index build is performed, and + * only in the leader process. (Actually, only the leader process has a + * BrinBuildState.) + */ + BrinLeader *bs_leader; + int bs_worker_id; + BrinSpool *bs_spool; } BrinBuildState; /* @@ -88,6 +211,7 @@ static void terminate_brin_buildstate(BrinBuildState *state); static void brinsummarize(Relation index, Relation heapRel, BlockNumber pageRange, bool include_partial, double *numSummarized, double *numExisting); static void form_and_insert_tuple(BrinBuildState *state); +static void form_and_spill_tuple(BrinBuildState *state); static void union_tuples(BrinDesc *bdesc, BrinMemTuple *a, BrinTuple *b); static void brin_vacuum_scan(Relation idxrel, BufferAccessStrategy strategy); @@ -95,6 +219,20 @@ static bool add_values_to_range(Relation idxRel, BrinDesc *bdesc, BrinMemTuple *dtup, const Datum *values, const bool *nulls); static bool check_null_keys(BrinValues *bval, ScanKey *nullkeys, int nnullkeys); +/* parallel index builds */ +static void _brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, + bool isconcurrent, int request); +static void _brin_end_parallel(BrinLeader *btleader, BrinBuildState *state); +static Size _brin_parallel_estimate_shared(Relation heap, Snapshot snapshot); +static void _brin_leader_participate_as_worker(BrinBuildState *buildstate, + Relation heap, Relation index); +static void _brin_parallel_scan_and_build(BrinBuildState *buildstate, + BrinSpool *brinspool, + BrinShared *brinshared, + Sharedsort *sharedsort, + Relation heap, Relation index, + int sortmem, bool progress); + /* * BRIN handler function: return IndexAmRoutine with access method parameters * and callbacks. @@ -119,6 +257,7 @@ brinhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = true; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = true; @@ -874,6 +1013,63 @@ brinbuildCallback(Relation index, values, isnull); } +/* + * A version of the callback, used by parallel index builds. The main difference + * is that instead of writing the BRIN tuples into the index, we write them into + * a shared tuplesort, and leave the insertion up to the leader (which may + * reorder them a bit etc.). The callback also does not generate empty ranges, + * those may be added by the leader when merging results from workers. + */ +static void +brinbuildCallbackParallel(Relation index, + ItemPointer tid, + Datum *values, + bool *isnull, + bool tupleIsAlive, + void *brstate) +{ + BrinBuildState *state = (BrinBuildState *) brstate; + BlockNumber thisblock; + + thisblock = ItemPointerGetBlockNumber(tid); + + /* + * If we're in a block that belongs to a future range, summarize what + * we've got and start afresh. Note the scan might have skipped many + * pages, if they were devoid of live tuples; we do not create emptry BRIN + * ranges here - the leader is responsible for filling them in. + */ + if (thisblock > state->bs_currRangeStart + state->bs_pagesPerRange - 1) + { + + BRIN_elog((DEBUG2, + "brinbuildCallback: completed a range: %u--%u", + state->bs_currRangeStart, + state->bs_currRangeStart + state->bs_pagesPerRange)); + + /* create the index tuple and write it into the tuplesort */ + form_and_spill_tuple(state); + + /* + * Set state to correspond to the next range (for this block). + * + * This skips ranges that are either empty (and so we don't get any + * tuples to summarize), or processes by other workers. We can't + * differentiate those cases here easily, so we leave it up to the + * leader to fill empty ranges where needed. + */ + state->bs_currRangeStart + = state->bs_pagesPerRange * (thisblock / state->bs_pagesPerRange); + + /* re-initialize state for it */ + brin_memtuple_initialize(state->bs_dtuple, state->bs_bdesc); + } + + /* Accumulate the current tuple into the running state */ + (void) add_values_to_range(index, state->bs_bdesc, state->bs_dtuple, + values, isnull); +} + /* * brinbuild() -- build a new BRIN index. */ @@ -935,18 +1131,90 @@ brinbuild(Relation heap, Relation index, IndexInfo *indexInfo) revmap = brinRevmapInitialize(index, &pagesPerRange); state = initialize_brin_buildstate(index, revmap, pagesPerRange); + state->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + state->bs_spool->heap = heap; + state->bs_spool->index = index; + + /* + * Attempt to launch parallel worker scan when required + * + * XXX plan_create_index_workers makes the number of workers dependent on + * maintenance_work_mem, requiring 32MB for each worker. That makes sense + * for btree, but not for BRIN, which can do away with much less memory. + * So maybe make that somehow less strict, optionally? + */ + if (indexInfo->ii_ParallelWorkers > 0) + _brin_begin_parallel(state, heap, index, indexInfo->ii_Concurrent, + indexInfo->ii_ParallelWorkers); + /* * Now scan the relation. No syncscan allowed here because we want the * heap blocks in physical order. */ - reltuples = table_index_build_scan(heap, index, indexInfo, false, true, - brinbuildCallback, (void *) state, NULL); - /* process the final batch */ - form_and_insert_tuple(state); + /* + * If parallel build requested and at least one worker process was + * successfully launched, set up coordination state + */ + if (state->bs_leader) + { + SortCoordinate coordinate; + + coordinate = (SortCoordinate) palloc0(sizeof(SortCoordinateData)); + coordinate->isWorker = false; + coordinate->nParticipants = + state->bs_leader->nparticipanttuplesorts; + coordinate->sharedsort = state->bs_leader->sharedsort; + + + /* + * Begin serial/leader tuplesort. + * + * In cases where parallelism is involved, the leader receives the + * same share of maintenance_work_mem as a serial sort (it is + * generally treated in the same way as a serial sort once we return). + * Parallel worker Tuplesortstates will have received only a fraction + * of maintenance_work_mem, though. + * + * We rely on the lifetime of the Leader Tuplesortstate almost not + * overlapping with any worker Tuplesortstate's lifetime. There may + * be some small overlap, but that's okay because we rely on leader + * Tuplesortstate only allocating a small, fixed amount of memory + * here. When its tuplesort_performsort() is called (by our caller), + * and significant amounts of memory are likely to be used, all + * workers must have already freed almost all memory held by their + * Tuplesortstates (they are about to go away completely, too). The + * overall effect is that maintenance_work_mem always represents an + * absolute high watermark on the amount of memory used by a CREATE + * INDEX operation, regardless of the use of parallelism or any other + * factor. + */ + state->bs_spool->sortstate = + tuplesort_begin_index_brin(heap, index, + maintenance_work_mem, coordinate, + TUPLESORT_NONE); + + /* + * In parallel mode, wait for workers to complete, and then read all + * tuples from the shared tuplesort and insert them into the index. + */ + _brin_end_parallel(state->bs_leader, state); + } + else /* no parallel index build */ + { + reltuples = table_index_build_scan(heap, index, indexInfo, false, true, + brinbuildCallback, (void *) state, NULL); + + /* process the final batch */ + form_and_insert_tuple(state); + + /* track the number of relation tuples */ + state->bs_reltuples = reltuples; + } /* release resources */ idxtuples = state->bs_numtuples; + reltuples = state->bs_reltuples; brinRevmapTerminate(state->bs_rmAccess); terminate_brin_buildstate(state); @@ -1366,12 +1634,16 @@ initialize_brin_buildstate(Relation idxRel, BrinRevmap *revmap, state->bs_irel = idxRel; state->bs_numtuples = 0; + state->bs_reltuples = 0; state->bs_currentInsertBuf = InvalidBuffer; state->bs_pagesPerRange = pagesPerRange; state->bs_currRangeStart = 0; state->bs_rmAccess = revmap; state->bs_bdesc = brin_build_desc(idxRel); state->bs_dtuple = brin_new_memtuple(state->bs_bdesc); + state->bs_leader = NULL; + state->bs_worker_id = 0; + state->bs_spool = NULL; return state; } @@ -1663,6 +1935,32 @@ form_and_insert_tuple(BrinBuildState *state) pfree(tup); } +/* + * Given a deformed tuple in the build state, convert it into the on-disk + * format and write it to a (shared) tuplesort (the leader will insert it + * into the index later). + */ +static void +form_and_spill_tuple(BrinBuildState *state) +{ + BrinTuple *tup; + Size size; + + /* don't insert empty tuples in parallel build */ + if (state->bs_dtuple->bt_empty_range) + return; + + tup = brin_form_tuple(state->bs_bdesc, state->bs_currRangeStart, + state->bs_dtuple, &size); + + /* write the BRIN tuple to the tuplesort */ + tuplesort_putbrintuple(state->bs_spool->sortstate, tup, size); + + state->bs_numtuples++; + + pfree(tup); +} + /* * Given two deformed tuples, adjust the first one so that it's consistent * with the summary values in both. @@ -1982,3 +2280,589 @@ check_null_keys(BrinValues *bval, ScanKey *nullkeys, int nnullkeys) return true; } + +static void +_brin_begin_parallel(BrinBuildState *buildstate, Relation heap, Relation index, + bool isconcurrent, int request) +{ + ParallelContext *pcxt; + int scantuplesortstates; + Snapshot snapshot; + Size estbrinshared; + Size estsort; + BrinShared *brinshared; + Sharedsort *sharedsort; + BrinLeader *brinleader = (BrinLeader *) palloc0(sizeof(BrinLeader)); + WalUsage *walusage; + BufferUsage *bufferusage; + bool leaderparticipates = true; + int querylen; + +#ifdef DISABLE_LEADER_PARTICIPATION + leaderparticipates = false; +#endif + + /* + * Enter parallel mode, and create context for parallel build of brin + * index + */ + EnterParallelMode(); + Assert(request > 0); + pcxt = CreateParallelContext("postgres", "_brin_parallel_build_main", + request); + + scantuplesortstates = leaderparticipates ? request + 1 : request; + + /* + * Prepare for scan of the base relation. In a normal index build, we use + * SnapshotAny because we must retrieve all tuples and do our own time + * qual checks (because we have to index RECENTLY_DEAD tuples). In a + * concurrent build, we take a regular MVCC snapshot and index whatever's + * live according to that. + */ + if (!isconcurrent) + snapshot = SnapshotAny; + else + snapshot = RegisterSnapshot(GetTransactionSnapshot()); + + /* + * Estimate size for our own PARALLEL_KEY_BRIN_SHARED workspace. + */ + estbrinshared = _brin_parallel_estimate_shared(heap, snapshot); + shm_toc_estimate_chunk(&pcxt->estimator, estbrinshared); + estsort = tuplesort_estimate_shared(scantuplesortstates); + shm_toc_estimate_chunk(&pcxt->estimator, estsort); + + shm_toc_estimate_keys(&pcxt->estimator, 2); + + /* + * Estimate space for WalUsage and BufferUsage -- PARALLEL_KEY_WAL_USAGE + * and PARALLEL_KEY_BUFFER_USAGE. + * + * If there are no extensions loaded that care, we could skip this. We + * have no way of knowing whether anyone's looking at pgWalUsage or + * pgBufferUsage, so do it unconditionally. + */ + shm_toc_estimate_chunk(&pcxt->estimator, + mul_size(sizeof(WalUsage), pcxt->nworkers)); + shm_toc_estimate_keys(&pcxt->estimator, 1); + shm_toc_estimate_chunk(&pcxt->estimator, + mul_size(sizeof(BufferUsage), pcxt->nworkers)); + shm_toc_estimate_keys(&pcxt->estimator, 1); + + /* Finally, estimate PARALLEL_KEY_QUERY_TEXT space */ + if (debug_query_string) + { + querylen = strlen(debug_query_string); + shm_toc_estimate_chunk(&pcxt->estimator, querylen + 1); + shm_toc_estimate_keys(&pcxt->estimator, 1); + } + else + querylen = 0; /* keep compiler quiet */ + + /* Everyone's had a chance to ask for space, so now create the DSM */ + InitializeParallelDSM(pcxt); + + /* If no DSM segment was available, back out (do serial build) */ + if (pcxt->seg == NULL) + { + if (IsMVCCSnapshot(snapshot)) + UnregisterSnapshot(snapshot); + DestroyParallelContext(pcxt); + ExitParallelMode(); + return; + } + + /* Store shared build state, for which we reserved space */ + brinshared = (BrinShared *) shm_toc_allocate(pcxt->toc, estbrinshared); + /* Initialize immutable state */ + brinshared->heaprelid = RelationGetRelid(heap); + brinshared->indexrelid = RelationGetRelid(index); + brinshared->isconcurrent = isconcurrent; + brinshared->scantuplesortstates = scantuplesortstates; + brinshared->pagesPerRange = buildstate->bs_pagesPerRange; + ConditionVariableInit(&brinshared->workersdonecv); + SpinLockInit(&brinshared->mutex); + + /* Initialize mutable state */ + brinshared->nparticipantsdone = 0; + brinshared->reltuples = 0.0; + brinshared->indtuples = 0.0; + + table_parallelscan_initialize(heap, + ParallelTableScanFromBrinShared(brinshared), + snapshot); + + /* + * Store shared tuplesort-private state, for which we reserved space. + * Then, initialize opaque state using tuplesort routine. + */ + sharedsort = (Sharedsort *) shm_toc_allocate(pcxt->toc, estsort); + tuplesort_initialize_shared(sharedsort, scantuplesortstates, + pcxt->seg); + + /* + * Store shared tuplesort-private state, for which we reserved space. + * Then, initialize opaque state using tuplesort routine. + */ + shm_toc_insert(pcxt->toc, PARALLEL_KEY_BRIN_SHARED, brinshared); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_TUPLESORT, sharedsort); + + /* Store query string for workers */ + if (debug_query_string) + { + char *sharedquery; + + sharedquery = (char *) shm_toc_allocate(pcxt->toc, querylen + 1); + memcpy(sharedquery, debug_query_string, querylen + 1); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_QUERY_TEXT, sharedquery); + } + + /* + * Allocate space for each worker's WalUsage and BufferUsage; no need to + * initialize. + */ + walusage = shm_toc_allocate(pcxt->toc, + mul_size(sizeof(WalUsage), pcxt->nworkers)); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_WAL_USAGE, walusage); + bufferusage = shm_toc_allocate(pcxt->toc, + mul_size(sizeof(BufferUsage), pcxt->nworkers)); + shm_toc_insert(pcxt->toc, PARALLEL_KEY_BUFFER_USAGE, bufferusage); + + /* Launch workers, saving status for leader/caller */ + LaunchParallelWorkers(pcxt); + brinleader->pcxt = pcxt; + brinleader->nparticipanttuplesorts = pcxt->nworkers_launched; + if (leaderparticipates) + brinleader->nparticipanttuplesorts++; + brinleader->brinshared = brinshared; + brinleader->sharedsort = sharedsort; + brinleader->snapshot = snapshot; + brinleader->walusage = walusage; + brinleader->bufferusage = bufferusage; + + /* If no workers were successfully launched, back out (do serial build) */ + if (pcxt->nworkers_launched == 0) + { + _brin_end_parallel(brinleader, NULL); + return; + } + + /* Save leader state now that it's clear build will be parallel */ + buildstate->bs_leader = brinleader; + + /* Join heap scan ourselves */ + if (leaderparticipates) + _brin_leader_participate_as_worker(buildstate, heap, index); + + /* + * Caller needs to wait for all launched workers when we return. Make + * sure that the failure-to-start case will not hang forever. + */ + WaitForParallelWorkersToAttach(pcxt); +} + +/* + * Shut down workers, destroy parallel context, and end parallel mode. + */ +static void +_brin_end_parallel(BrinLeader *brinleader, BrinBuildState *state) +{ + int i; + BrinTuple *btup; + BrinMemTuple *memtuple = NULL; + Size tuplen; + BrinShared *brinshared = brinleader->brinshared; + BlockNumber prevblkno = InvalidBlockNumber; + BrinTuple *emptyTuple = NULL; + Size emptySize; + BrinSpool *spool; + MemoryContext rangeCxt, + oldCxt; + + /* Shutdown worker processes */ + WaitForParallelWorkersToFinish(brinleader->pcxt); + + if (!state) + return; + + /* copy the data into leader state (we have to wait for the workers ) */ + state->bs_reltuples = brinshared->reltuples; + state->bs_numtuples = brinshared->indtuples; + + /* do the actual sort in the leader */ + spool = state->bs_spool; + tuplesort_performsort(spool->sortstate); + + /* + * Initialize BrinMemTuple we'll use to union summaries from workers (in + * case they happened to produce parts of the same paga range). + */ + memtuple = brin_new_memtuple(state->bs_bdesc); + + /* + * Create a memory context we'll reset to combine results for a single + * page range (received from the workers). We don't expect huge number of + * overlaps under regular circumstances, because for large tables the + * chunk size is likely larger than the BRIN page range), but it can + * happen, and the union functions may do all kinds of stuff. So we better + * reset the context once in a while. + */ + rangeCxt = AllocSetContextCreate(CurrentMemoryContext, + "brin union", + ALLOCSET_DEFAULT_SIZES); + oldCxt = MemoryContextSwitchTo(rangeCxt); + + /* + * Read the BRIN tuples from the shared tuplesort, sorted by block number. + * That probably gives us an index that is cheaper to scan, thanks to + * mostly getting data from the same index page as before. + */ + while ((btup = tuplesort_getbrintuple(spool->sortstate, &tuplen, true)) != NULL) + { + /* Ranges should be multiples of pages_per_range for the index. */ + Assert(btup->bt_blkno % brinshared->pagesPerRange == 0); + + /* + * Do we need to union summaries for the same page range? + * + * If this is the first brin tuple we read, then just deform it into + * the memtuple, and continue with the next one from tuplesort. We + * however may need to insert empty summaries into the index. + * + * If it's the same block as the last we saw, we simply union the brin + * tuple into it, and we're done - we don't even need to insert empty + * ranges, because that was done earlier when we saw the first brin + * tuple (for this range). + * + * Finally, if it's not the first brin tuple, and it's not the same + * page range, we need to do the insert and then deform the tuple into + * the memtuple. Then we'll insert empty ranges before the new brin + * tuple, if needed. + */ + if (prevblkno == InvalidBlockNumber) + { + /* First brin tuples, just deform into memtuple. */ + memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); + + /* continue to insert empty pages before thisblock */ + } + else if (memtuple->bt_blkno == btup->bt_blkno) + { + /* + * Not the first brin tuple, but same page range as the previous + * one, so we can merge it into the memtuple. + */ + union_tuples(state->bs_bdesc, memtuple, btup); + continue; + } + else + { + BrinTuple *tmp; + Size len; + + /* + * We got brin tuple for a different page range, so form a brin + * tuple from the memtuple, insert it, and re-init the memtuple + * from the new brin tuple. + */ + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); + + /* + * Reset the per-output-range context. This frees all the memory + * possibly allocated by the union functions, and also the BRIN + * tuple we just formed and inserted. + */ + MemoryContextReset(rangeCxt); + + memtuple = brin_deform_tuple(state->bs_bdesc, btup, memtuple); + + /* continue to insert empty pages before thisblock */ + } + + /* Fill empty ranges for all ranges missing in the tuplesort. */ + prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; + while (prevblkno + state->bs_pagesPerRange < btup->bt_blkno) + { + /* the missing range */ + prevblkno += state->bs_pagesPerRange; + + /* Did we already build the empty range? If not, do it now. */ + if (emptyTuple == NULL) + { + BrinMemTuple *dtuple = brin_new_memtuple(state->bs_bdesc); + + emptyTuple = brin_form_tuple(state->bs_bdesc, prevblkno, dtuple, &emptySize); + } + else + { + /* we already have am "empty range" tuple, just set the block */ + emptyTuple->bt_blkno = prevblkno; + } + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, + emptyTuple->bt_blkno, emptyTuple, emptySize); + } + + prevblkno = btup->bt_blkno; + } + + tuplesort_end(spool->sortstate); + + /* Fill empty ranges at the end, for all ranges missing in the tuplesort. */ + prevblkno = (prevblkno == InvalidBlockNumber) ? 0 : prevblkno; + while (prevblkno + state->bs_pagesPerRange < memtuple->bt_blkno) + { + /* the missing range */ + prevblkno += state->bs_pagesPerRange; + + /* Did we already build the empty range? If not, do it now. */ + if (emptyTuple == NULL) + { + BrinMemTuple *dtuple = brin_new_memtuple(state->bs_bdesc); + + emptyTuple = brin_form_tuple(state->bs_bdesc, prevblkno, dtuple, &emptySize); + } + else + { + /* we already have am "empty range" tuple, just set the block */ + emptyTuple->bt_blkno = prevblkno; + } + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, + emptyTuple->bt_blkno, emptyTuple, emptySize); + } + + /* Fill the BRIN tuple for the last page range. */ + if (prevblkno != InvalidBlockNumber) + { + BrinTuple *tmp; + Size len; + + tmp = brin_form_tuple(state->bs_bdesc, memtuple->bt_blkno, + memtuple, &len); + + brin_doinsert(state->bs_irel, state->bs_pagesPerRange, state->bs_rmAccess, + &state->bs_currentInsertBuf, tmp->bt_blkno, tmp, len); + + pfree(tmp); + } + + /* + * Switch back to the originam memory context, and destroy the one we + * created to isolate the union_tuple calls. + */ + MemoryContextSwitchTo(oldCxt); + MemoryContextDelete(rangeCxt); + + /* + * Next, accumulate WAL usage. (This must wait for the workers to finish, + * or we might get incomplete data.) + */ + for (i = 0; i < brinleader->pcxt->nworkers_launched; i++) + InstrAccumParallelQuery(&brinleader->bufferusage[i], &brinleader->walusage[i]); + + /* Free last reference to MVCC snapshot, if one was used */ + if (IsMVCCSnapshot(brinleader->snapshot)) + UnregisterSnapshot(brinleader->snapshot); + DestroyParallelContext(brinleader->pcxt); + ExitParallelMode(); +} + +/* + * Returns size of shared memory required to store state for a parallel + * brin index build based on the snapshot its parallel scan will use. + */ +static Size +_brin_parallel_estimate_shared(Relation heap, Snapshot snapshot) +{ + /* c.f. shm_toc_allocate as to why BUFFERALIGN is used */ + return add_size(BUFFERALIGN(sizeof(BrinShared)), + table_parallelscan_estimate(heap, snapshot)); +} + +/* + * Within leader, participate as a parallel worker. + */ +static void +_brin_leader_participate_as_worker(BrinBuildState *buildstate, Relation heap, Relation index) +{ + BrinLeader *brinleader = buildstate->bs_leader; + int sortmem; + + /* Allocate memory and initialize private spool */ + buildstate->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + buildstate->bs_spool->heap = buildstate->bs_spool->heap; + buildstate->bs_spool->index = buildstate->bs_spool->index; + + /* + * Might as well use reliable figure when doling out maintenance_work_mem + * (when requested number of workers were not launched, this will be + * somewhat higher than it is for other workers). + */ + sortmem = maintenance_work_mem / brinleader->nparticipanttuplesorts; + + /* Perform work common to all participants */ + _brin_parallel_scan_and_build(buildstate, buildstate->bs_spool, brinleader->brinshared, + brinleader->sharedsort, heap, index, sortmem, true); +} + +/* + * Perform a worker's portion of a parallel sort. + * + * This generates a tuplesort for passed btspool, and a second tuplesort + * state if a second btspool is need (i.e. for unique index builds). All + * other spool fields should already be set when this is called. + * + * sortmem is the amount of working memory to use within each worker, + * expressed in KBs. + * + * When this returns, workers are done, and need only release resources. + */ +static void +_brin_parallel_scan_and_build(BrinBuildState *state, BrinSpool *brinspool, + BrinShared *brinshared, Sharedsort *sharedsort, + Relation heap, Relation index, int sortmem, + bool progress) +{ + SortCoordinate coordinate; + TableScanDesc scan; + double reltuples; + IndexInfo *indexInfo; + + /* Initialize local tuplesort coordination state */ + coordinate = palloc0(sizeof(SortCoordinateData)); + coordinate->isWorker = true; + coordinate->nParticipants = -1; + coordinate->sharedsort = sharedsort; + + /* Begin "partial" tuplesort */ + brinspool->sortstate = tuplesort_begin_index_brin(brinspool->heap, + brinspool->index, + sortmem, coordinate, + TUPLESORT_NONE); + + /* Join parallel scan */ + indexInfo = BuildIndexInfo(index); + indexInfo->ii_Concurrent = brinshared->isconcurrent; + + scan = table_beginscan_parallel(heap, + ParallelTableScanFromBrinShared(brinshared)); + + reltuples = table_index_build_scan(heap, index, indexInfo, true, true, + brinbuildCallbackParallel, state, scan); + + /* insert the last item */ + form_and_spill_tuple(state); + + /* sort the BRIN ranges built by this worker */ + tuplesort_performsort(brinspool->sortstate); + + state->bs_reltuples += reltuples; + + /* + * Done. Record ambuild statistics. + */ + SpinLockAcquire(&brinshared->mutex); + brinshared->nparticipantsdone++; + brinshared->reltuples += state->bs_reltuples; + brinshared->indtuples += state->bs_numtuples; + SpinLockRelease(&brinshared->mutex); + + /* Notify leader */ + ConditionVariableSignal(&brinshared->workersdonecv); + + tuplesort_end(brinspool->sortstate); +} + +/* + * Perform work within a launched parallel process. + */ +void +_brin_parallel_build_main(dsm_segment *seg, shm_toc *toc) +{ + char *sharedquery; + BrinShared *brinshared; + Sharedsort *sharedsort; + BrinBuildState *buildstate; + Relation heapRel; + Relation indexRel; + LOCKMODE heapLockmode; + LOCKMODE indexLockmode; + WalUsage *walusage; + BufferUsage *bufferusage; + int sortmem; + + /* + * The only possible status flag that can be set to the parallel worker is + * PROC_IN_SAFE_IC. + */ + Assert((MyProc->statusFlags == 0) || + (MyProc->statusFlags == PROC_IN_SAFE_IC)); + + /* Set debug_query_string for individual workers first */ + sharedquery = shm_toc_lookup(toc, PARALLEL_KEY_QUERY_TEXT, true); + debug_query_string = sharedquery; + + /* Report the query string from leader */ + pgstat_report_activity(STATE_RUNNING, debug_query_string); + + /* Look up brin shared state */ + brinshared = shm_toc_lookup(toc, PARALLEL_KEY_BRIN_SHARED, false); + + /* Open relations using lock modes known to be obtained by index.c */ + if (!brinshared->isconcurrent) + { + heapLockmode = ShareLock; + indexLockmode = AccessExclusiveLock; + } + else + { + heapLockmode = ShareUpdateExclusiveLock; + indexLockmode = RowExclusiveLock; + } + + /* Open relations within worker */ + heapRel = table_open(brinshared->heaprelid, heapLockmode); + indexRel = index_open(brinshared->indexrelid, indexLockmode); + + buildstate = initialize_brin_buildstate(indexRel, NULL, brinshared->pagesPerRange); + + /* Initialize worker's own spool */ + buildstate->bs_spool = (BrinSpool *) palloc0(sizeof(BrinSpool)); + buildstate->bs_spool->heap = heapRel; + buildstate->bs_spool->index = indexRel; + + /* Look up shared state private to tuplesort.c */ + sharedsort = shm_toc_lookup(toc, PARALLEL_KEY_TUPLESORT, false); + tuplesort_attach_shared(sharedsort, seg); + + /* Prepare to track buffer usage during parallel execution */ + InstrStartParallelQuery(); + + /* + * Might as well use reliable figure when doling out maintenance_work_mem + * (when requested number of workers were not launched, this will be + * somewhat higher than it is for other workers). + */ + sortmem = maintenance_work_mem / brinshared->scantuplesortstates; + + _brin_parallel_scan_and_build(buildstate, buildstate->bs_spool, + brinshared, sharedsort, + heapRel, indexRel, sortmem, false); + + /* Report WAL/buffer usage during parallel execution */ + bufferusage = shm_toc_lookup(toc, PARALLEL_KEY_BUFFER_USAGE, false); + walusage = shm_toc_lookup(toc, PARALLEL_KEY_WAL_USAGE, false); + InstrEndParallelQuery(&bufferusage[ParallelWorkerNumber], + &walusage[ParallelWorkerNumber]); + + index_close(indexRel, indexLockmode); + table_close(heapRel, heapLockmode); +} diff --git a/src/backend/access/gin/ginutil.c b/src/backend/access/gin/ginutil.c index a875c5d3d7..9b1a0ac345 100644 --- a/src/backend/access/gin/ginutil.c +++ b/src/backend/access/gin/ginutil.c @@ -54,6 +54,7 @@ ginhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = true; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = true; amroutine->amsummarizing = false; diff --git a/src/backend/access/gist/gist.c b/src/backend/access/gist/gist.c index 9a1bf8f66c..e052ba8bda 100644 --- a/src/backend/access/gist/gist.c +++ b/src/backend/access/gist/gist.c @@ -76,6 +76,7 @@ gisthandler(PG_FUNCTION_ARGS) amroutine->amclusterable = true; amroutine->ampredlocks = true; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = true; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/hash/hash.c b/src/backend/access/hash/hash.c index 6443ff21bd..905519692c 100644 --- a/src/backend/access/hash/hash.c +++ b/src/backend/access/hash/hash.c @@ -73,6 +73,7 @@ hashhandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = true; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/nbtree/nbtree.c b/src/backend/access/nbtree/nbtree.c index 0930f9b37e..6c8cd93fa0 100644 --- a/src/backend/access/nbtree/nbtree.c +++ b/src/backend/access/nbtree/nbtree.c @@ -112,6 +112,7 @@ bthandler(PG_FUNCTION_ARGS) amroutine->amclusterable = true; amroutine->ampredlocks = true; amroutine->amcanparallel = true; + amroutine->amcanbuildparallel = true; amroutine->amcaninclude = true; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/spgist/spgutils.c b/src/backend/access/spgist/spgutils.c index 30c00876a5..fd4b615710 100644 --- a/src/backend/access/spgist/spgutils.c +++ b/src/backend/access/spgist/spgutils.c @@ -60,6 +60,7 @@ spghandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = true; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/backend/access/transam/parallel.c b/src/backend/access/transam/parallel.c index 194a1207be..d78314062e 100644 --- a/src/backend/access/transam/parallel.c +++ b/src/backend/access/transam/parallel.c @@ -14,6 +14,7 @@ #include "postgres.h" +#include "access/brin.h" #include "access/nbtree.h" #include "access/parallel.h" #include "access/session.h" @@ -145,6 +146,9 @@ static const struct { "_bt_parallel_build_main", _bt_parallel_build_main }, + { + "_brin_parallel_build_main", _brin_parallel_build_main + }, { "parallel_vacuum_main", parallel_vacuum_main } diff --git a/src/backend/catalog/index.c b/src/backend/catalog/index.c index 143fae01eb..40abbaf476 100644 --- a/src/backend/catalog/index.c +++ b/src/backend/catalog/index.c @@ -2982,7 +2982,7 @@ index_build(Relation heapRelation, * Note that planner considers parallel safety for us. */ if (parallel && IsNormalProcessingMode() && - indexRelation->rd_rel->relam == BTREE_AM_OID) + indexRelation->rd_indam->amcanbuildparallel) indexInfo->ii_ParallelWorkers = plan_create_index_workers(RelationGetRelid(heapRelation), RelationGetRelid(indexRelation)); diff --git a/src/backend/utils/sort/tuplesortvariants.c b/src/backend/utils/sort/tuplesortvariants.c index 2cd508e513..90fc605f1c 100644 --- a/src/backend/utils/sort/tuplesortvariants.c +++ b/src/backend/utils/sort/tuplesortvariants.c @@ -19,6 +19,7 @@ #include "postgres.h" +#include "access/brin_tuple.h" #include "access/hash.h" #include "access/htup_details.h" #include "access/nbtree.h" @@ -43,6 +44,8 @@ static void removeabbrev_cluster(Tuplesortstate *state, SortTuple *stups, int count); static void removeabbrev_index(Tuplesortstate *state, SortTuple *stups, int count); +static void removeabbrev_index_brin(Tuplesortstate *state, SortTuple *stups, + int count); static void removeabbrev_datum(Tuplesortstate *state, SortTuple *stups, int count); static int comparetup_heap(const SortTuple *a, const SortTuple *b, @@ -69,10 +72,16 @@ static int comparetup_index_hash(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); static int comparetup_index_hash_tiebreak(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); +static int comparetup_index_brin(const SortTuple *a, const SortTuple *b, + Tuplesortstate *state); static void writetup_index(Tuplesortstate *state, LogicalTape *tape, SortTuple *stup); static void readtup_index(Tuplesortstate *state, SortTuple *stup, LogicalTape *tape, unsigned int len); +static void writetup_index_brin(Tuplesortstate *state, LogicalTape *tape, + SortTuple *stup); +static void readtup_index_brin(Tuplesortstate *state, SortTuple *stup, + LogicalTape *tape, unsigned int len); static int comparetup_datum(const SortTuple *a, const SortTuple *b, Tuplesortstate *state); static int comparetup_datum_tiebreak(const SortTuple *a, const SortTuple *b, @@ -128,6 +137,16 @@ typedef struct uint32 max_buckets; } TuplesortIndexHashArg; +/* + * Data struture pointed by "TuplesortPublic.arg" for the index_brin subcase. + */ +typedef struct +{ + TuplesortIndexArg index; + + /* XXX do we need something here? */ +} TuplesortIndexBrinArg; + /* * Data struture pointed by "TuplesortPublic.arg" for the Datum case. * Set by tuplesort_begin_datum and used only by the DatumTuple routines. @@ -140,6 +159,21 @@ typedef struct int datumTypeLen; } TuplesortDatumArg; +/* + * Computing BrinTuple size with only the tuple is difficult, so we want to track + * the length referenced by the SortTuple. That's what BrinSortTuple is meant + * to do - it's essentially a BrinTuple prefixed by its length. + */ +typedef struct BrinSortTuple +{ + Size tuplen; + BrinTuple tuple; +} BrinSortTuple; + +/* Size of the BrinSortTuple, given length of the BrinTuple. */ +#define BRINSORTTUPLE_SIZE(len) (offsetof(BrinSortTuple, tuple) + (len)) + + Tuplesortstate * tuplesort_begin_heap(TupleDesc tupDesc, int nkeys, AttrNumber *attNums, @@ -527,6 +561,47 @@ tuplesort_begin_index_gist(Relation heapRel, return state; } +Tuplesortstate * +tuplesort_begin_index_brin(Relation heapRel, + Relation indexRel, + int workMem, + SortCoordinate coordinate, + int sortopt) +{ + Tuplesortstate *state = tuplesort_begin_common(workMem, coordinate, + sortopt); + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext; + TuplesortIndexBrinArg *arg; + + oldcontext = MemoryContextSwitchTo(base->maincontext); + arg = (TuplesortIndexBrinArg *) palloc(sizeof(TuplesortIndexBrinArg)); + +#ifdef TRACE_SORT + if (trace_sort) + elog(LOG, + "begin index sort: workMem = %d, randomAccess = %c", + workMem, + sortopt & TUPLESORT_RANDOMACCESS ? 't' : 'f'); +#endif + + base->nKeys = 1; /* Only one sort column, the block number */ + + base->removeabbrev = removeabbrev_index_brin; + base->comparetup = comparetup_index_brin; + base->writetup = writetup_index_brin; + base->readtup = readtup_index_brin; + base->haveDatum1 = true; + base->arg = arg; + + arg->index.heapRel = heapRel; + arg->index.indexRel = indexRel; + + MemoryContextSwitchTo(oldcontext); + + return state; +} + Tuplesortstate * tuplesort_begin_datum(Oid datumType, Oid sortOperator, Oid sortCollation, bool nullsFirstFlag, int workMem, @@ -707,6 +782,35 @@ tuplesort_putindextuplevalues(Tuplesortstate *state, Relation rel, !stup.isnull1); } +/* + * Collect one BRIN tuple while collecting input data for sort. + */ +void +tuplesort_putbrintuple(Tuplesortstate *state, BrinTuple *tuple, Size size) +{ + SortTuple stup; + BrinSortTuple *bstup; + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext = MemoryContextSwitchTo(base->tuplecontext); + + /* allocate space for the whole BRIN sort tuple */ + bstup = palloc(BRINSORTTUPLE_SIZE(size)); + + bstup->tuplen = size; + memcpy(&bstup->tuple, tuple, size); + + stup.tuple = bstup; + stup.datum1 = tuple->bt_blkno; + stup.isnull1 = false; + + tuplesort_puttuple_common(state, &stup, + base->sortKeys && + base->sortKeys->abbrev_converter && + !stup.isnull1); + + MemoryContextSwitchTo(oldcontext); +} + /* * Accept one Datum while collecting input data for sort. * @@ -850,6 +954,35 @@ tuplesort_getindextuple(Tuplesortstate *state, bool forward) return (IndexTuple) stup.tuple; } +/* + * Fetch the next BRIN tuple in either forward or back direction. + * Returns NULL if no more tuples. Returned tuple belongs to tuplesort memory + * context, and must not be freed by caller. Caller may not rely on tuple + * remaining valid after any further manipulation of tuplesort. + */ +BrinTuple * +tuplesort_getbrintuple(Tuplesortstate *state, Size *len, bool forward) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + MemoryContext oldcontext = MemoryContextSwitchTo(base->sortcontext); + SortTuple stup; + BrinSortTuple *btup; + + if (!tuplesort_gettuple_common(state, forward, &stup)) + stup.tuple = NULL; + + MemoryContextSwitchTo(oldcontext); + + if (!stup.tuple) + return NULL; + + btup = (BrinSortTuple *) stup.tuple; + + *len = btup->tuplen; + + return &btup->tuple; +} + /* * Fetch the next Datum in either forward or back direction. * Returns false if no more datums. @@ -1564,6 +1697,80 @@ readtup_index(Tuplesortstate *state, SortTuple *stup, &stup->isnull1); } +/* + * Routines specialized for BrinTuple case + */ + +static void +removeabbrev_index_brin(Tuplesortstate *state, SortTuple *stups, int count) +{ + int i; + + for (i = 0; i < count; i++) + { + BrinSortTuple *tuple; + + tuple = stups[i].tuple; + stups[i].datum1 = tuple->tuple.bt_blkno; + } +} + +static int +comparetup_index_brin(const SortTuple *a, const SortTuple *b, + Tuplesortstate *state) +{ + Assert(TuplesortstateGetPublic(state)->haveDatum1); + + if (DatumGetUInt32(a->datum1) > DatumGetUInt32(b->datum1)) + return 1; + + if (DatumGetUInt32(a->datum1) < DatumGetUInt32(b->datum1)) + return -1; + + /* silence compilers */ + return 0; +} + +static void +writetup_index_brin(Tuplesortstate *state, LogicalTape *tape, SortTuple *stup) +{ + TuplesortPublic *base = TuplesortstateGetPublic(state); + BrinSortTuple *tuple = (BrinSortTuple *) stup->tuple; + unsigned int tuplen = tuple->tuplen; + + tuplen = tuplen + sizeof(tuplen); + LogicalTapeWrite(tape, &tuplen, sizeof(tuplen)); + LogicalTapeWrite(tape, &tuple->tuple, tuple->tuplen); + if (base->sortopt & TUPLESORT_RANDOMACCESS) /* need trailing length word? */ + LogicalTapeWrite(tape, &tuplen, sizeof(tuplen)); +} + +static void +readtup_index_brin(Tuplesortstate *state, SortTuple *stup, + LogicalTape *tape, unsigned int len) +{ + BrinSortTuple *tuple; + TuplesortPublic *base = TuplesortstateGetPublic(state); + unsigned int tuplen = len - sizeof(unsigned int); + + /* + * Allocate space for the BRIN sort tuple, which is BrinTuple with an + * extra length field. + */ + tuple = (BrinSortTuple *) tuplesort_readtup_alloc(state, + BRINSORTTUPLE_SIZE(tuplen)); + + tuple->tuplen = tuplen; + + LogicalTapeReadExact(tape, &tuple->tuple, tuplen); + if (base->sortopt & TUPLESORT_RANDOMACCESS) /* need trailing length word? */ + LogicalTapeReadExact(tape, &tuplen, sizeof(tuplen)); + stup->tuple = (void *) tuple; + + /* set up first-column key value, which is block number */ + stup->datum1 = tuple->tuple.bt_blkno; +} + /* * Routines specialized for DatumTuple case */ diff --git a/src/include/access/amapi.h b/src/include/access/amapi.h index 244459587f..df85ae3aac 100644 --- a/src/include/access/amapi.h +++ b/src/include/access/amapi.h @@ -243,6 +243,8 @@ typedef struct IndexAmRoutine bool ampredlocks; /* does AM support parallel scan? */ bool amcanparallel; + /* does AM support parallel build? */ + bool amcanbuildparallel; /* does AM support columns included with clause INCLUDE? */ bool amcaninclude; /* does AM use maintenance_work_mem? */ diff --git a/src/include/access/brin.h b/src/include/access/brin.h index ed66f1b3d5..3451ecb211 100644 --- a/src/include/access/brin.h +++ b/src/include/access/brin.h @@ -11,6 +11,7 @@ #define BRIN_H #include "nodes/execnodes.h" +#include "storage/shm_toc.h" #include "utils/relcache.h" @@ -52,4 +53,6 @@ typedef struct BrinStatsData extern void brinGetStats(Relation index, BrinStatsData *stats); +extern void _brin_parallel_build_main(dsm_segment *seg, shm_toc *toc); + #endif /* BRIN_H */ diff --git a/src/include/utils/tuplesort.h b/src/include/utils/tuplesort.h index 9ed2de76cd..357eb35311 100644 --- a/src/include/utils/tuplesort.h +++ b/src/include/utils/tuplesort.h @@ -21,6 +21,7 @@ #ifndef TUPLESORT_H #define TUPLESORT_H +#include "access/brin_tuple.h" #include "access/itup.h" #include "executor/tuptable.h" #include "storage/dsm.h" @@ -282,6 +283,9 @@ typedef struct * The "index_hash" API is similar to index_btree, but the tuples are * actually sorted by their hash codes not the raw data. * + * The "index_brin" API is similar to index_btree, but the tuples are + * BrinTuple and are sorted by their block number not the raw data. + * * Parallel sort callers are required to coordinate multiple tuplesort states * in a leader process and one or more worker processes. The leader process * must launch workers, and have each perform an independent "partial" @@ -426,6 +430,10 @@ extern Tuplesortstate *tuplesort_begin_index_gist(Relation heapRel, Relation indexRel, int workMem, SortCoordinate coordinate, int sortopt); +extern Tuplesortstate *tuplesort_begin_index_brin(Relation heapRel, + Relation indexRel, + int workMem, SortCoordinate coordinate, + int sortopt); extern Tuplesortstate *tuplesort_begin_datum(Oid datumType, Oid sortOperator, Oid sortCollation, bool nullsFirstFlag, @@ -438,6 +446,7 @@ extern void tuplesort_putheaptuple(Tuplesortstate *state, HeapTuple tup); extern void tuplesort_putindextuplevalues(Tuplesortstate *state, Relation rel, ItemPointer self, const Datum *values, const bool *isnull); +extern void tuplesort_putbrintuple(Tuplesortstate *state, BrinTuple *tup, Size len); extern void tuplesort_putdatum(Tuplesortstate *state, Datum val, bool isNull); @@ -445,6 +454,8 @@ extern bool tuplesort_gettupleslot(Tuplesortstate *state, bool forward, bool copy, TupleTableSlot *slot, Datum *abbrev); extern HeapTuple tuplesort_getheaptuple(Tuplesortstate *state, bool forward); extern IndexTuple tuplesort_getindextuple(Tuplesortstate *state, bool forward); +extern BrinTuple *tuplesort_getbrintuple(Tuplesortstate *state, Size *len, + bool forward); extern bool tuplesort_getdatum(Tuplesortstate *state, bool forward, bool copy, Datum *val, bool *isNull, Datum *abbrev); diff --git a/src/test/modules/dummy_index_am/dummy_index_am.c b/src/test/modules/dummy_index_am/dummy_index_am.c index cbdae7ab7a..eaa0c483b7 100644 --- a/src/test/modules/dummy_index_am/dummy_index_am.c +++ b/src/test/modules/dummy_index_am/dummy_index_am.c @@ -294,6 +294,7 @@ dihandler(PG_FUNCTION_ARGS) amroutine->amclusterable = false; amroutine->ampredlocks = false; amroutine->amcanparallel = false; + amroutine->amcanbuildparallel = false; amroutine->amcaninclude = false; amroutine->amusemaintenanceworkmem = false; amroutine->amsummarizing = false; diff --git a/src/tools/pgindent/typedefs.list b/src/tools/pgindent/typedefs.list index 86a9886d4f..001fef5865 100644 --- a/src/tools/pgindent/typedefs.list +++ b/src/tools/pgindent/typedefs.list @@ -297,13 +297,17 @@ BpChar BrinBuildState BrinDesc BrinInsertState +BrinLeader BrinMemTuple BrinMetaPageData BrinOpaque BrinOpcInfo BrinOptions BrinRevmap +BrinShared +BrinSortTuple BrinSpecialSpace +BrinSpool BrinStatsData BrinTuple BrinValues @@ -2879,6 +2883,7 @@ TupleTableSlotOps TuplesortClusterArg TuplesortDatumArg TuplesortIndexArg +TuplesortIndexBrinArg TuplesortIndexBTreeArg TuplesortIndexHashArg TuplesortInstrumentation -- 2.40.1 ^ permalink raw reply [nested|flat] 25+ messages in thread
* Re: Parallel CREATE INDEX for BRIN indexes @ 2023-11-29 20:56 Tomas Vondra <[email protected]> parent: Matthias van de Meent <[email protected]> 0 siblings, 0 replies; 25+ messages in thread From: Tomas Vondra @ 2023-11-29 20:56 UTC (permalink / raw) To: Matthias van de Meent <[email protected]>; +Cc: PostgreSQL Hackers <[email protected]> On 11/29/23 21:30, Matthias van de Meent wrote: > On Wed, 29 Nov 2023 at 18:55, Tomas Vondra > <[email protected]> wrote: >> >> On 11/29/23 15:52, Tomas Vondra wrote: >>>> ... >>>> >>>> This also made me think a bit more about how we're working with the >>>> tuples. With your latest patch, we always deserialize and re-serialize >>>> the sorted brin tuples, just in case the next tuple will also be a >>>> BRIN tuple of the same page range. Could we save some of that >>>> deserialization time by optimistically expecting that we're not going >>>> to need to merge the tuple and only store a local copy of it locally? >>>> See attached 0002; this saves some cycles in common cases. >>>> >>> >>> Good idea! >>> >> >> FWIW there's a bug, in this part of the optimization: >> >> ------------------ >> + if (memtuple == NULL) >> + memtuple = brin_deform_tuple(state->bs_bdesc, btup, >> + memtup_holder); >> + >> union_tuples(state->bs_bdesc, memtuple, btup); >> continue; >> ------------------ >> >> The deforming should use prevbtup, otherwise union_tuples() jut combines >> two copies of the same tuple. > > Good point. There were some more issues as well, fixes are attached. > >> Which however brings me to the bigger issue with this - my stress test >> found this issue pretty quickly, but then I spent quite a bit of time >> trying to find what went wrong. I find this reworked code pretty hard to >> understand, and not necessarily because of how it's written. The problem >> is it the same loop tries to juggle multiple pieces of information with >> different lifespans, and so on. I find it really hard to reason about >> how it behaves ... > > Yeah, it'd be nice if we had a peek option for sortsupport, that'd > improve context handling. > >> I did try to measure how much it actually saves, but none of the tests I >> did actually found measurable improvement. So I'm tempted to just not >> include this part, and accept that we may deserialize some of the tuples >> unnecessarily. >> >> Did you actually observe measurable improvements in some cases? > > The improvements would mostly stem from brin indexes with multiple > (potentially compressed) by-ref types, as they go through more complex > and expensive code to deserialize, requiring separate palloc() and > memcpy() calls each. > For single-column and by-value types the improvements are expected to > be negligible, because there is no meaningful difference between > copying a single by-ref value and copying its container; the > additional work done for each tuple is marginal for those. > > For an 8-column BRIN index ((sha256((id)::text::bytea)::text), > (sha256((id+1)::text::bytea)::text), > (sha256((id+2)::text::bytea)::text), ...) instrumented with 0003 I > measured a difference of 10x less time spent in the main loop of > _brin_end_parallel, from ~30ms to 3ms when dealing with 55k 1-block > ranges. It's not a lot, but worth at least something, I guess? > It is something, but I can't really convince myself it's worth the extra code complexity. It's a somewhat extreme example, and the parallelism certainly saves much more than this. > The attached patch fixes the issue that you called out . > It also further updates _brin_end_parallel: the final 'write empty > tuples' loop is never hit and is thus removed, because if there were > any tuples in the spool we'd have filled the empty ranges at the end > of the main loop, and if there were no tuples in the spool then the > memtuple would still be at its original initialized value of 0 thus > resulting in a constant false condition. I also updated some comments. > Ah, right. I'll take a look tomorrow, but I guess I didn't realize we insert the empty ranges in the main loop, because we're already looking at the *next* summary. But I think the idea was to insert empty ranges if there's a chunk of empty ranges at the end of the table, after the last tuple the index build reads. But I'm not sure that can actually happen ... regards -- Tomas Vondra EnterpriseDB: http://www.enterprisedb.com The Enterprise PostgreSQL Company ^ permalink raw reply [nested|flat] 25+ messages in thread
end of thread, other threads:[~2023-11-29 20:56 UTC | newest] Thread overview: 25+ messages (download: mbox mbox.gz follow: Atom feed) -- links below jump to the message on this page -- 2020-03-17 18:43 [PATCH v2 12/12] Move away from argv string comparison Mike Palmiotto <[email protected]> 2023-07-04 22:08 Re: Parallel CREATE INDEX for BRIN indexes Tomas Vondra <[email protected]> 2023-07-05 08:44 ` Re: Parallel CREATE INDEX for BRIN indexes Matthias van de Meent <[email protected]> 2023-07-05 11:11 ` Re: Parallel CREATE INDEX for BRIN indexes Tomas Vondra <[email protected]> 2023-07-05 14:33 ` Re: Parallel CREATE INDEX for BRIN indexes Matthias van de Meent <[email protected]> 2023-07-06 14:13 ` Re: Parallel CREATE INDEX for BRIN indexes Tomas Vondra <[email protected]> 2023-07-11 21:11 ` Re: Parallel CREATE INDEX for BRIN indexes Matthias van de Meent <[email protected]> 2023-07-14 13:57 ` Re: Parallel CREATE INDEX for BRIN indexes Tomas Vondra <[email protected]> 2023-07-14 15:01 ` Re: Parallel CREATE INDEX for BRIN indexes Matthias van de Meent <[email protected]> 2023-11-08 11:03 ` Re: Parallel CREATE INDEX for BRIN indexes Tomas Vondra <[email protected]> 2023-11-12 09:38 ` Re: Parallel CREATE INDEX for BRIN indexes Matthias van de Meent <[email protected]> 2023-11-12 10:01 ` Re: Parallel CREATE INDEX for BRIN indexes Tomas Vondra <[email protected]> 2023-11-20 19:48 ` Re: Parallel CREATE INDEX for BRIN indexes Matthias van de Meent <[email protected]> 2023-11-22 19:16 ` Re: Parallel CREATE INDEX for BRIN indexes Tomas Vondra <[email protected]> 2023-11-23 12:33 ` Re: Parallel CREATE INDEX for BRIN indexes Matthias van de Meent <[email protected]> 2023-11-23 13:35 ` Re: Parallel CREATE INDEX for BRIN indexes Tomas Vondra <[email protected]> 2023-11-28 15:39 ` Re: Parallel CREATE INDEX for BRIN indexes Matthias van de Meent <[email protected]> 2023-11-28 17:59 ` Re: Parallel CREATE INDEX for BRIN indexes Tomas Vondra <[email protected]> 2023-11-29 14:42 ` Re: Parallel CREATE INDEX for BRIN indexes Matthias van de Meent <[email protected]> 2023-11-29 14:52 ` Re: Parallel CREATE INDEX for BRIN indexes Tomas Vondra <[email protected]> 2023-11-29 17:55 ` Re: Parallel CREATE INDEX for BRIN indexes Tomas Vondra <[email protected]> 2023-11-29 20:30 ` Re: Parallel CREATE INDEX for BRIN indexes Matthias van de Meent <[email protected]> 2023-11-29 20:56 ` Re: Parallel CREATE INDEX for BRIN indexes Tomas Vondra <[email protected]> 2023-09-19 08:40 [PATCH v1 2/3] Replace magic "one" in tsvector binary receiving=0A= Denis Erokhin <[email protected]> 2023-09-19 08:40 [PATCH v1 2/3] Replace magic "one" in tsvector binary receiving=0A= Denis Erokhin <[email protected]>
This inbox is served by agora; see mirroring instructions for how to clone and mirror all data and code used for this inbox